JPS6313410B2 - - Google Patents
Info
- Publication number
- JPS6313410B2 JPS6313410B2 JP55040550A JP4055080A JPS6313410B2 JP S6313410 B2 JPS6313410 B2 JP S6313410B2 JP 55040550 A JP55040550 A JP 55040550A JP 4055080 A JP4055080 A JP 4055080A JP S6313410 B2 JPS6313410 B2 JP S6313410B2
- Authority
- JP
- Japan
- Prior art keywords
- dehydrochlorination
- aqueous
- chlorine
- sodium chloride
- temperature
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 63
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 claims description 38
- 238000000034 method Methods 0.000 claims description 28
- 238000007033 dehydrochlorination reaction Methods 0.000 claims description 25
- 239000011780 sodium chloride Substances 0.000 claims description 19
- 239000003054 catalyst Substances 0.000 claims description 17
- 239000000243 solution Substances 0.000 claims description 14
- YACLQRRMGMJLJV-UHFFFAOYSA-N chloroprene Chemical compound ClC(=C)C=C YACLQRRMGMJLJV-UHFFFAOYSA-N 0.000 claims description 13
- 239000000460 chlorine Substances 0.000 claims description 12
- 229910052801 chlorine Inorganic materials 0.000 claims description 12
- 239000003792 electrolyte Substances 0.000 claims description 12
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 11
- 239000008346 aqueous phase Substances 0.000 claims description 9
- LIFLRQVHKGGNSG-UHFFFAOYSA-N 2,3-dichlorobuta-1,3-diene Chemical compound ClC(=C)C(Cl)=C LIFLRQVHKGGNSG-UHFFFAOYSA-N 0.000 claims description 7
- XVEASTGLHPVZNA-UHFFFAOYSA-N 3,4-dichlorobut-1-ene Chemical compound ClCC(Cl)C=C XVEASTGLHPVZNA-UHFFFAOYSA-N 0.000 claims description 7
- 238000010908 decantation Methods 0.000 claims description 7
- 239000012074 organic phase Substances 0.000 claims description 7
- 239000000203 mixture Substances 0.000 claims description 6
- 239000003513 alkali Substances 0.000 claims description 5
- -1 sulfonium compound Chemical group 0.000 claims description 5
- WZUZDBPJFHQVJC-UHFFFAOYSA-N 2,3,4-trichlorobut-1-ene Chemical compound ClCC(Cl)C(Cl)=C WZUZDBPJFHQVJC-UHFFFAOYSA-N 0.000 claims description 4
- 239000007864 aqueous solution Substances 0.000 claims description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 3
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- 238000005868 electrolysis reaction Methods 0.000 claims description 3
- 125000001453 quaternary ammonium group Chemical group 0.000 claims description 3
- IXZVKECRTHXEEW-UHFFFAOYSA-N 1,2,3,4-tetrachlorobutane Chemical compound ClCC(Cl)C(Cl)CCl IXZVKECRTHXEEW-UHFFFAOYSA-N 0.000 claims description 2
- 238000000926 separation method Methods 0.000 claims description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims 2
- 150000001804 chlorine Chemical class 0.000 claims 1
- 239000007788 liquid Substances 0.000 claims 1
- 125000005496 phosphonium group Chemical group 0.000 claims 1
- 235000011121 sodium hydroxide Nutrition 0.000 description 19
- 239000012267 brine Substances 0.000 description 16
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 16
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 7
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 6
- 235000019270 ammonium chloride Nutrition 0.000 description 5
- 239000003112 inhibitor Substances 0.000 description 5
- 238000009835 boiling Methods 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 239000012528 membrane Substances 0.000 description 4
- 238000005191 phase separation Methods 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- 229960004592 isopropanol Drugs 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- 150000004023 quaternary phosphonium compounds Chemical class 0.000 description 2
- 238000001256 steam distillation Methods 0.000 description 2
- 239000002699 waste material Substances 0.000 description 2
- WJFKNYWRSNBZNX-UHFFFAOYSA-N 10H-phenothiazine Chemical compound C1=CC=C2NC3=CC=CC=C3SC2=C1 WJFKNYWRSNBZNX-UHFFFAOYSA-N 0.000 description 1
- QTWJRLJHJPIABL-UHFFFAOYSA-N 2-methylphenol;3-methylphenol;4-methylphenol Chemical compound CC1=CC=C(O)C=C1.CC1=CC=CC(O)=C1.CC1=CC=CC=C1O QTWJRLJHJPIABL-UHFFFAOYSA-N 0.000 description 1
- XESZUVZBAMCAEJ-UHFFFAOYSA-N 4-tert-butylcatechol Chemical compound CC(C)(C)C1=CC=C(O)C(O)=C1 XESZUVZBAMCAEJ-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 150000001204 N-oxides Chemical class 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000006177 alkyl benzyl group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 125000005529 alkyleneoxy group Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- GQQMXRVECZFZFG-UHFFFAOYSA-M benzenesulfonate;benzyl-dimethyl-(3,5,5-trimethylhexyl)phosphanium Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1.CC(C)(C)CC(C)CC[P+](C)(C)CC1=CC=CC=C1 GQQMXRVECZFZFG-UHFFFAOYSA-M 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 235000019864 coconut oil Nutrition 0.000 description 1
- 239000003240 coconut oil Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 229930003836 cresol Natural products 0.000 description 1
- JCTZUGYQQNXGBC-UHFFFAOYSA-M dihexyl(methyl)sulfanium;iodide Chemical compound [I-].CCCCCC[S+](C)CCCCCC JCTZUGYQQNXGBC-UHFFFAOYSA-M 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- CSSXFMXXEQYDFF-UHFFFAOYSA-M dodecyl-ethyl-methylsulfanium;chloride Chemical compound [Cl-].CCCCCCCCCCCC[S+](C)CC CSSXFMXXEQYDFF-UHFFFAOYSA-M 0.000 description 1
- 238000004945 emulsification Methods 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- WZZMHOBVLAEJOD-UHFFFAOYSA-N methylsulfanylmethane;hydrobromide Chemical compound [Br-].C[SH+]C WZZMHOBVLAEJOD-UHFFFAOYSA-N 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 125000001477 organic nitrogen group Chemical group 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 229950000688 phenothiazine Drugs 0.000 description 1
- 150000003014 phosphoric acid esters Chemical class 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- IBWGNZVCJVLSHB-UHFFFAOYSA-M tetrabutylphosphanium;chloride Chemical compound [Cl-].CCCC[P+](CCCC)(CCCC)CCCC IBWGNZVCJVLSHB-UHFFFAOYSA-M 0.000 description 1
- ASYYSVCOLJRHAO-UHFFFAOYSA-M tricyclohexyl(2-hydroxyethyl)phosphanium;chloride Chemical compound [Cl-].C1CCCCC1[P+](C1CCCCC1)(CCO)C1CCCCC1 ASYYSVCOLJRHAO-UHFFFAOYSA-M 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C17/00—Preparation of halogenated hydrocarbons
- C07C17/25—Preparation of halogenated hydrocarbons by splitting-off hydrogen halides from halogenated hydrocarbons
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Electrolytic Production Of Non-Metals, Compounds, Apparatuses Therefor (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/026,202 US4215078A (en) | 1979-04-02 | 1979-04-02 | Process for manufacturing chloroprene and 2,3-dichlorobutadiene-1,3 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS55133322A JPS55133322A (en) | 1980-10-17 |
| JPS6313410B2 true JPS6313410B2 (,) | 1988-03-25 |
Family
ID=21830446
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP4055080A Granted JPS55133322A (en) | 1979-04-02 | 1980-03-31 | Manufacture of chloroprene or 2*33dichlorobutadienee1*3 |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4215078A (,) |
| JP (1) | JPS55133322A (,) |
| DE (1) | DE3012331A1 (,) |
| FR (1) | FR2453123A1 (,) |
| GB (1) | GB2046749B (,) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4605800A (en) * | 1983-01-17 | 1986-08-12 | E. I. Du Pont De Nemours And Company | Process for the manufacture of chloroprene |
| FR2710056B1 (fr) * | 1993-09-17 | 1995-12-01 | Enichem Elastomeres France | Procédé de déshydrochloration du 3,4-dichloro-1-butène en chloroprène. |
| JP4521921B2 (ja) * | 2000-03-08 | 2010-08-11 | 旭化成ケミカルズ株式会社 | 塩化アルカリの電解方法 |
| US8030531B2 (en) * | 2007-12-19 | 2011-10-04 | Dupont Performance Elastomers Llc | Process for production of 2,3-dichlorobutadiene-1,3 |
| US8889928B2 (en) * | 2013-03-12 | 2014-11-18 | Honeywell International Inc. | Method to improve 1,1,3-trichloropropene and/or 3,3,3-trichloropropene selectivity during the dehydrochlorination of 1,1,1,3-tetrachloropropane |
| EP3510009A1 (en) * | 2016-09-09 | 2019-07-17 | Blue Cube IP LLC | Processes for the dehydrochlorination of a chlorinated alkane |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA834780A (en) * | 1970-02-17 | W. Crary James | Dehydrohalogenation of halogenated compounds | |
| US2539307A (en) * | 1948-10-08 | 1951-01-23 | Diamond Alkali Co | Method of making vinyl chloride |
| GB848598A (en) * | 1958-07-04 | 1960-09-21 | Distillers Co Yeast Ltd | Production of chloroprene |
| NL279456A (,) * | 1961-06-08 | |||
| US3981937A (en) * | 1966-06-03 | 1976-09-21 | E. I. Du Pont De Nemours And Company | Dehydrohalogenation of 3,4-dichloro-1-butene |
| US3754044A (en) * | 1968-02-28 | 1973-08-21 | Du Pont | Dehydrohalogenation of halogenated compounds |
| US3876716A (en) * | 1968-02-28 | 1975-04-08 | Du Pont | Dehydrochlorination of chlorinated compounds |
| FR2002799A6 (fr) * | 1968-02-28 | 1969-10-31 | Du Pont | Perfectionnements apportés aux réactions de déshydrohalogénation de composés organiques |
| US3639493A (en) * | 1968-02-28 | 1972-02-01 | Du Pont | Dehydrohalogenation of halogenated compounds |
| US3639492A (en) * | 1968-02-28 | 1972-02-01 | Du Pont | Dehydrohalogenation of halogenated compounds |
| US3936508A (en) * | 1973-03-03 | 1976-02-03 | Bayer Aktiengesellschaft | Process for the preparation of chloroprene |
| US3965203A (en) * | 1974-01-30 | 1976-06-22 | Petro-Tex Chemical Corporation | Process for the production of 2-chlorobutadiene-1,3 from 3,4-dichlorobutene-1 |
| DE2460912C3 (de) * | 1974-12-21 | 1978-06-01 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von 2-Chlorbutadien-(M) |
-
1979
- 1979-04-02 US US06/026,202 patent/US4215078A/en not_active Expired - Lifetime
-
1980
- 1980-02-20 FR FR8003690A patent/FR2453123A1/fr active Granted
- 1980-03-29 DE DE19803012331 patent/DE3012331A1/de active Granted
- 1980-03-31 JP JP4055080A patent/JPS55133322A/ja active Granted
- 1980-04-01 GB GB8010902A patent/GB2046749B/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| JPS55133322A (en) | 1980-10-17 |
| US4215078A (en) | 1980-07-29 |
| GB2046749A (en) | 1980-11-19 |
| FR2453123A1 (fr) | 1980-10-31 |
| DE3012331C2 (,) | 1991-04-18 |
| GB2046749B (en) | 1983-06-15 |
| FR2453123B1 (,) | 1983-02-25 |
| DE3012331A1 (de) | 1980-10-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP2229343B1 (de) | Verfahren zur herstellung von diarylcarbonat | |
| US4496752A (en) | Production of epoxy compounds from olefinic compounds | |
| EP1894914B1 (de) | Verfahren zur Herstellung von Diarylcarbonat | |
| EP0380365B1 (en) | Method for recovering hydrobromic acid and methanol | |
| US8309761B2 (en) | Removing hydrocarbon impurities from acetic acid by ionic liquid extraction | |
| CN115181080B (zh) | 一种甲基叔丁基醚-四氢呋喃-乙醇-水共沸体系的分离工艺 | |
| JPS6313410B2 (,) | ||
| US3455797A (en) | Procedure for the preparation of olefin oxides | |
| US6214235B1 (en) | Process for removal of quaternary ammonium salt | |
| US3993693A (en) | Method for producing perchloromethyl mercaptan | |
| JPS6137267B2 (,) | ||
| US4277405A (en) | Production of epoxy compounds from olefinic compounds | |
| US5227541A (en) | Purification of 2,3-dichloro-1-propanol | |
| EP0034184B1 (en) | Method for recovering bromine contained in a discharge | |
| GB1582830A (en) | Production of chloroprene | |
| DE2541526C2 (de) | Verfahren zur Herstellung eines Alkylenoxids | |
| US4743707A (en) | Process for purifying allyl alcohol | |
| US6414204B1 (en) | Process for producing allyl chloride | |
| RU2858939C1 (ru) | Способ получения 2-аминоэтансульфоновой кислоты | |
| EP0497759A1 (en) | METHOD FOR RECOVERING CATALYTIC QUANTITIES. | |
| EP1191007B1 (en) | Process for production of allyl chloride | |
| CN216777944U (zh) | 一种从三乙胺盐酸盐溶液中连续回收三乙胺的装置系统 | |
| EP2241550B1 (de) | Verfahren zur Herstellung von Diarylcarbonat | |
| US3393137A (en) | Solvent recovery process | |
| CS247189B2 (en) | Method of 1,2-dichloroethane production |