JPS6154034B2 - - Google Patents
Info
- Publication number
- JPS6154034B2 JPS6154034B2 JP53086218A JP8621878A JPS6154034B2 JP S6154034 B2 JPS6154034 B2 JP S6154034B2 JP 53086218 A JP53086218 A JP 53086218A JP 8621878 A JP8621878 A JP 8621878A JP S6154034 B2 JPS6154034 B2 JP S6154034B2
- Authority
- JP
- Japan
- Prior art keywords
- tin
- chloride
- iodide
- snx
- dichloride
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000003054 catalyst Substances 0.000 claims description 21
- 238000000034 method Methods 0.000 claims description 20
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims description 16
- 125000001183 hydrocarbyl group Chemical group 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 239000000460 chlorine Chemical group 0.000 claims description 6
- 150000001450 anions Chemical class 0.000 claims description 5
- 239000000126 substance Substances 0.000 claims description 5
- RWSOTUBLDIXVET-UHFFFAOYSA-O sulfonium Chemical compound [SH3+] RWSOTUBLDIXVET-UHFFFAOYSA-O 0.000 claims description 5
- OWUGVJBQKGQQKJ-UHFFFAOYSA-M trimethylsulfanium;chloride Chemical group [Cl-].C[S+](C)C OWUGVJBQKGQQKJ-UHFFFAOYSA-M 0.000 claims description 4
- 150000001298 alcohols Chemical group 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 150000002148 esters Chemical group 0.000 claims description 3
- 150000002170 ethers Chemical group 0.000 claims description 3
- 150000004820 halides Chemical group 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 125000001424 substituent group Chemical group 0.000 claims description 3
- 239000004215 Carbon black (E152) Substances 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 229930195733 hydrocarbon Natural products 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000001246 bromo group Chemical group Br* 0.000 claims 1
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical group II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 claims 1
- INDZTCRIYSRWOH-UHFFFAOYSA-N undec-10-enyl carbamimidothioate;hydroiodide Chemical compound I.NC(=N)SCCCCCCCCCC=C INDZTCRIYSRWOH-UHFFFAOYSA-N 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 description 19
- -1 aryl tin halides Chemical class 0.000 description 18
- PKKGKUDPKRTKLJ-UHFFFAOYSA-L dichloro(dimethyl)stannane Chemical compound C[Sn](C)(Cl)Cl PKKGKUDPKRTKLJ-UHFFFAOYSA-L 0.000 description 9
- 229910021627 Tin(IV) chloride Inorganic materials 0.000 description 8
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 8
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 7
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical class NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 7
- YFRLQYJXUZRYDN-UHFFFAOYSA-K trichloro(methyl)stannane Chemical compound C[Sn](Cl)(Cl)Cl YFRLQYJXUZRYDN-UHFFFAOYSA-K 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 6
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 6
- 239000007858 starting material Substances 0.000 description 6
- QLAJNZSPVITUCQ-UHFFFAOYSA-N 1,3,2-dioxathietane 2,2-dioxide Chemical compound O=S1(=O)OCO1 QLAJNZSPVITUCQ-UHFFFAOYSA-N 0.000 description 5
- 125000000217 alkyl group Chemical group 0.000 description 5
- VFJYIHQDILEQNR-UHFFFAOYSA-M trimethylsulfanium;iodide Chemical compound [I-].C[S+](C)C VFJYIHQDILEQNR-UHFFFAOYSA-M 0.000 description 5
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- LUZSPGQEISANPO-UHFFFAOYSA-N butyltin Chemical compound CCCC[Sn] LUZSPGQEISANPO-UHFFFAOYSA-N 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- QPBYLOWPSRZOFX-UHFFFAOYSA-J tin(iv) iodide Chemical compound I[Sn](I)(I)I QPBYLOWPSRZOFX-UHFFFAOYSA-J 0.000 description 4
- NRZWQKGABZFFKE-UHFFFAOYSA-N trimethylsulfonium Chemical compound C[S+](C)C NRZWQKGABZFFKE-UHFFFAOYSA-N 0.000 description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- DACYFBRJTSMKHY-UHFFFAOYSA-N butyl carbamimidothioate;hydroiodide Chemical compound [I-].CCCCSC(N)=[NH2+] DACYFBRJTSMKHY-UHFFFAOYSA-N 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- NEHMKBQYUWJMIP-NJFSPNSNSA-N chloro(114C)methane Chemical compound [14CH3]Cl NEHMKBQYUWJMIP-NJFSPNSNSA-N 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 150000002367 halogens Chemical group 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 229940050176 methyl chloride Drugs 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 230000035484 reaction time Effects 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- INTLMJZQCBRQAT-UHFFFAOYSA-K trichloro(octyl)stannane Chemical compound CCCCCCCC[Sn](Cl)(Cl)Cl INTLMJZQCBRQAT-UHFFFAOYSA-K 0.000 description 3
- VTHGHWCUKLJZBL-UHFFFAOYSA-N (4-methylphenyl)tin Chemical compound CC1=CC=C([Sn])C=C1 VTHGHWCUKLJZBL-UHFFFAOYSA-N 0.000 description 2
- VFWCMGCRMGJXDK-UHFFFAOYSA-N 1-chlorobutane Chemical compound CCCCCl VFWCMGCRMGJXDK-UHFFFAOYSA-N 0.000 description 2
- CNDHHGUSRIZDSL-UHFFFAOYSA-N 1-chlorooctane Chemical compound CCCCCCCCCl CNDHHGUSRIZDSL-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 2
- KWYHDKDOAIKMQN-UHFFFAOYSA-N N,N,N',N'-tetramethylethylenediamine Chemical compound CN(C)CCN(C)C KWYHDKDOAIKMQN-UHFFFAOYSA-N 0.000 description 2
- 229910002651 NO3 Inorganic materials 0.000 description 2
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- 229910021623 Tin(IV) bromide Inorganic materials 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- HQOMUNLDICRZCS-UHFFFAOYSA-N [amino(ethylsulfanyl)methylidene]azanium;iodide Chemical compound I.CCSC(N)=N HQOMUNLDICRZCS-UHFFFAOYSA-N 0.000 description 2
- 125000002877 alkyl aryl group Chemical group 0.000 description 2
- 125000003710 aryl alkyl group Chemical group 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 125000000753 cycloalkyl group Chemical group 0.000 description 2
- MKANCOHERYHKAT-UHFFFAOYSA-L dibenzyltin(2+);dichloride Chemical compound C=1C=CC=CC=1C[Sn](Cl)(Cl)CC1=CC=CC=C1 MKANCOHERYHKAT-UHFFFAOYSA-L 0.000 description 2
- SBOSGIJGEHWBKV-UHFFFAOYSA-L dioctyltin(2+);dichloride Chemical compound CCCCCCCC[Sn](Cl)(Cl)CCCCCCCC SBOSGIJGEHWBKV-UHFFFAOYSA-L 0.000 description 2
- VDEKURXOWJYWCG-UHFFFAOYSA-N dodecyltin Chemical compound CCCCCCCCCCCC[Sn] VDEKURXOWJYWCG-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- LFXAECSQJSRSTP-UHFFFAOYSA-N hydron;methyl carbamimidothioate;iodide Chemical compound I.CSC(N)=N LFXAECSQJSRSTP-UHFFFAOYSA-N 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 229920000915 polyvinyl chloride Polymers 0.000 description 2
- 239000004800 polyvinyl chloride Substances 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- 150000003585 thioureas Chemical class 0.000 description 2
- LTSUHJWLSNQKIP-UHFFFAOYSA-J tin(iv) bromide Chemical compound Br[Sn](Br)(Br)Br LTSUHJWLSNQKIP-UHFFFAOYSA-J 0.000 description 2
- JNZRDLWZFWFSBK-UHFFFAOYSA-N tribenzyltin Chemical compound C=1C=CC=CC=1C[Sn](CC=1C=CC=CC=1)CC1=CC=CC=C1 JNZRDLWZFWFSBK-UHFFFAOYSA-N 0.000 description 2
- JKBGHKARDJEAKH-UHFFFAOYSA-M (2-ethylphenyl)-dimethylsulfanium;chloride Chemical compound [Cl-].CCC1=CC=CC=C1[S+](C)C JKBGHKARDJEAKH-UHFFFAOYSA-M 0.000 description 1
- ZWPQDDCPESTSTK-UHFFFAOYSA-K 2-ethylhexyl(triiodo)stannane Chemical compound CCCCC(CC)C[Sn](I)(I)I ZWPQDDCPESTSTK-UHFFFAOYSA-K 0.000 description 1
- BQDZMSRPNHLCMX-UHFFFAOYSA-N 2-phenylethyl carbamimidothioate Chemical compound NC(=N)SCCC1=CC=CC=C1 BQDZMSRPNHLCMX-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- RCBGXMRFJSLSOK-UHFFFAOYSA-N CC(C)CCCCC[Sn](CCCCCC(C)C)(CCCCCC(C)C)CCCCCC(C)C Chemical compound CC(C)CCCCC[Sn](CCCCCC(C)C)(CCCCCC(C)C)CCCCCC(C)C RCBGXMRFJSLSOK-UHFFFAOYSA-N 0.000 description 1
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- GCTFWCDSFPMHHS-UHFFFAOYSA-M Tributyltin chloride Chemical compound CCCC[Sn](Cl)(CCCC)CCCC GCTFWCDSFPMHHS-UHFFFAOYSA-M 0.000 description 1
- NTQSSQBBWWORKE-UHFFFAOYSA-N [Cl-].C(C)N(C(SCCCC)=[NH2+])CC Chemical compound [Cl-].C(C)N(C(SCCCC)=[NH2+])CC NTQSSQBBWWORKE-UHFFFAOYSA-N 0.000 description 1
- SXORBXZOZAOSSH-UHFFFAOYSA-N [I-].C1(=CC=CC=C1)N(C(SCC)=[NH+]CCCCCC)C1=CC=CC=C1 Chemical compound [I-].C1(=CC=CC=C1)N(C(SCC)=[NH+]CCCCCC)C1=CC=CC=C1 SXORBXZOZAOSSH-UHFFFAOYSA-N 0.000 description 1
- MIVZDXLICFDIHO-UHFFFAOYSA-N [O-]S([O-])(=O)=O.CCCCCCCCSC(N)=[NH2+].CCCCCCCCSC(N)=[NH2+] Chemical compound [O-]S([O-])(=O)=O.CCCCCCCCSC(N)=[NH2+].CCCCCCCCSC(N)=[NH2+] MIVZDXLICFDIHO-UHFFFAOYSA-N 0.000 description 1
- QPPHDUICBVDSNS-UHFFFAOYSA-N [amino(cyclohexylsulfanyl)methylidene]azanium;acetate Chemical compound CC([O-])=O.NC(=[NH2+])SC1CCCCC1 QPPHDUICBVDSNS-UHFFFAOYSA-N 0.000 description 1
- JWNGATKGDWXEDT-UHFFFAOYSA-N [amino(methylsulfanyl)methylidene]azanium;bromide Chemical compound Br.CSC(N)=N JWNGATKGDWXEDT-UHFFFAOYSA-N 0.000 description 1
- KRYWEAYKLGCRRH-UHFFFAOYSA-N [amino(methylsulfanyl)methylidene]azanium;chloride Chemical compound Cl.CSC(N)=N KRYWEAYKLGCRRH-UHFFFAOYSA-N 0.000 description 1
- OXGKJZICXGAEMF-UHFFFAOYSA-N [amino(propylsulfanyl)methylidene]-ethylazanium;acetate Chemical compound CC([O-])=O.CCCSC(N)=[NH+]CC OXGKJZICXGAEMF-UHFFFAOYSA-N 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- VUEDNLCYHKSELL-UHFFFAOYSA-N arsonium Chemical class [AsH4+] VUEDNLCYHKSELL-UHFFFAOYSA-N 0.000 description 1
- GTRLQRHWPXEBLF-UHFFFAOYSA-N benzyl carbamimidothioate Chemical compound NC(=N)SCC1=CC=CC=C1 GTRLQRHWPXEBLF-UHFFFAOYSA-N 0.000 description 1
- QFRKVUYYNLYLDL-UHFFFAOYSA-K benzyl(dimethyl)sulfanium phosphate Chemical compound P(=O)([O-])([O-])[O-].C[S+](CC1=CC=CC=C1)C.C[S+](CC1=CC=CC=C1)C.C[S+](CC1=CC=CC=C1)C QFRKVUYYNLYLDL-UHFFFAOYSA-K 0.000 description 1
- IEHGOXUVPIVESF-UHFFFAOYSA-M benzyl(dimethyl)sulfanium;acetate Chemical compound CC([O-])=O.C[S+](C)CC1=CC=CC=C1 IEHGOXUVPIVESF-UHFFFAOYSA-M 0.000 description 1
- SHWIIIVDPZCDHE-UHFFFAOYSA-K benzyl(triiodo)stannane Chemical compound I[Sn](I)(I)CC1=CC=CC=C1 SHWIIIVDPZCDHE-UHFFFAOYSA-K 0.000 description 1
- MUIUMBKGZPBYCW-UHFFFAOYSA-K benzyltin(3+);tribromide Chemical compound Br[Sn](Br)(Br)CC1=CC=CC=C1 MUIUMBKGZPBYCW-UHFFFAOYSA-K 0.000 description 1
- ZPLRQSPYSZDKCM-UHFFFAOYSA-K benzyltin(3+);trichloride Chemical compound Cl[Sn](Cl)(Cl)CC1=CC=CC=C1 ZPLRQSPYSZDKCM-UHFFFAOYSA-K 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- FAMUPMBATZGWOV-UHFFFAOYSA-M bromo(triphenyl)stannane Chemical compound C=1C=CC=CC=1[Sn](C=1C=CC=CC=1)(Br)C1=CC=CC=C1 FAMUPMBATZGWOV-UHFFFAOYSA-M 0.000 description 1
- HRMIYSNVJKPYGX-UHFFFAOYSA-K butan-2-yl(trichloro)stannane Chemical compound CCC(C)[Sn](Cl)(Cl)Cl HRMIYSNVJKPYGX-UHFFFAOYSA-K 0.000 description 1
- LGSUUQDHMZCOHW-UHFFFAOYSA-K butan-2-yl(triiodo)stannane Chemical compound CCC(C)[Sn](I)(I)I LGSUUQDHMZCOHW-UHFFFAOYSA-K 0.000 description 1
- KLRVFKXKRZEASO-UHFFFAOYSA-M butyl(dimethyl)sulfanium;chloride Chemical compound [Cl-].CCCC[S+](C)C KLRVFKXKRZEASO-UHFFFAOYSA-M 0.000 description 1
- FAOSYNUKPVJLNZ-UHFFFAOYSA-N butylstannane Chemical compound CCCC[SnH3] FAOSYNUKPVJLNZ-UHFFFAOYSA-N 0.000 description 1
- YMLFYGFCXGNERH-UHFFFAOYSA-K butyltin trichloride Chemical compound CCCC[Sn](Cl)(Cl)Cl YMLFYGFCXGNERH-UHFFFAOYSA-K 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- PIMYDFDXAUVLON-UHFFFAOYSA-M chloro(triethyl)stannane Chemical compound CC[Sn](Cl)(CC)CC PIMYDFDXAUVLON-UHFFFAOYSA-M 0.000 description 1
- KWTSZCJMWHGPOS-UHFFFAOYSA-M chloro(trimethyl)stannane Chemical compound C[Sn](C)(C)Cl KWTSZCJMWHGPOS-UHFFFAOYSA-M 0.000 description 1
- MCNGJXAXOJDJKO-UHFFFAOYSA-M chloro(trioctyl)stannane Chemical compound CCCCCCCC[Sn](Cl)(CCCCCCCC)CCCCCCCC MCNGJXAXOJDJKO-UHFFFAOYSA-M 0.000 description 1
- ARHVVSVWFGIAST-UHFFFAOYSA-M cyclohexyl-ethyl-methylsulfanium;iodide Chemical compound [I-].CC[S+](C)C1CCCCC1 ARHVVSVWFGIAST-UHFFFAOYSA-M 0.000 description 1
- BESRBWLUVPELTD-UHFFFAOYSA-K cyclohexyltin(3+);trichloride Chemical compound Cl[Sn](Cl)(Cl)C1CCCCC1 BESRBWLUVPELTD-UHFFFAOYSA-K 0.000 description 1
- OUQICVAWQYLFTL-UHFFFAOYSA-L di(butan-2-yl)tin(2+);dichloride Chemical compound CCC(C)[Sn](Cl)(Cl)C(C)CC OUQICVAWQYLFTL-UHFFFAOYSA-L 0.000 description 1
- PLOWAKQTEHQOFB-UHFFFAOYSA-L di(propan-2-yl)tin(2+);dichloride Chemical compound CC(C)[Sn](Cl)(Cl)C(C)C PLOWAKQTEHQOFB-UHFFFAOYSA-L 0.000 description 1
- VKHDSOXSTURPAJ-UHFFFAOYSA-L dibenzyl(dibromo)stannane Chemical compound C=1C=CC=CC=1C[Sn](Br)(Br)CC1=CC=CC=C1 VKHDSOXSTURPAJ-UHFFFAOYSA-L 0.000 description 1
- ZGXKKMOMGSNTMD-UHFFFAOYSA-L dibenzyl(diiodo)stannane Chemical compound C=1C=CC=CC=1C[Sn](I)(I)CC1=CC=CC=C1 ZGXKKMOMGSNTMD-UHFFFAOYSA-L 0.000 description 1
- QSGGLKRQVLBHKX-UHFFFAOYSA-L dibromo(diethyl)stannane Chemical compound CC[Sn](Br)(Br)CC QSGGLKRQVLBHKX-UHFFFAOYSA-L 0.000 description 1
- GNMVEKSYLLXJKX-UHFFFAOYSA-L dibromo(dioctyl)stannane Chemical compound CCCCCCCC[Sn](Br)(Br)CCCCCCCC GNMVEKSYLLXJKX-UHFFFAOYSA-L 0.000 description 1
- QAHAIHQMIYXJNS-UHFFFAOYSA-L dibromo-di(butan-2-yl)stannane Chemical compound CCC(C)[Sn](Br)(Br)C(C)CC QAHAIHQMIYXJNS-UHFFFAOYSA-L 0.000 description 1
- RJGHQTVXGKYATR-UHFFFAOYSA-L dibutyl(dichloro)stannane Chemical compound CCCC[Sn](Cl)(Cl)CCCC RJGHQTVXGKYATR-UHFFFAOYSA-L 0.000 description 1
- HLATYLIVBMECMN-UHFFFAOYSA-L dibutyltin(2+);diiodide Chemical compound CCCC[Sn](I)(I)CCCC HLATYLIVBMECMN-UHFFFAOYSA-L 0.000 description 1
- YFAXVVMIXZAKSR-UHFFFAOYSA-L dichloro(diethyl)stannane Chemical compound CC[Sn](Cl)(Cl)CC YFAXVVMIXZAKSR-UHFFFAOYSA-L 0.000 description 1
- DGUPLUPXYGDCQP-UHFFFAOYSA-L dichloro(dipentyl)stannane Chemical compound CCCCC[Sn](Cl)(Cl)CCCCC DGUPLUPXYGDCQP-UHFFFAOYSA-L 0.000 description 1
- ISXUHJXWYNONDI-UHFFFAOYSA-L dichloro(diphenyl)stannane Chemical compound C=1C=CC=CC=1[Sn](Cl)(Cl)C1=CC=CC=C1 ISXUHJXWYNONDI-UHFFFAOYSA-L 0.000 description 1
- GXWLHTAAGCHDAV-UHFFFAOYSA-L dichloro-bis(2-methylpropyl)stannane Chemical compound CC(C)C[Sn](Cl)(Cl)CC(C)C GXWLHTAAGCHDAV-UHFFFAOYSA-L 0.000 description 1
- RHFTTZVNBAHQBF-UHFFFAOYSA-L dicyclohexyltin(2+);dibromide Chemical compound C1CCCCC1[Sn](Br)(Br)C1CCCCC1 RHFTTZVNBAHQBF-UHFFFAOYSA-L 0.000 description 1
- NXLNBJXGFFFGIT-UHFFFAOYSA-L dicyclohexyltin(2+);dichloride Chemical compound C1CCCCC1[Sn](Cl)(Cl)C1CCCCC1 NXLNBJXGFFFGIT-UHFFFAOYSA-L 0.000 description 1
- MATIRGPIRARBGK-UHFFFAOYSA-L diethyl(diiodo)stannane Chemical compound CC[Sn](I)(I)CC MATIRGPIRARBGK-UHFFFAOYSA-L 0.000 description 1
- AXQSJCWCXATTNE-UHFFFAOYSA-L dihexyltin(2+);dichloride Chemical compound CCCCCC[Sn](Cl)(Cl)CCCCCC AXQSJCWCXATTNE-UHFFFAOYSA-L 0.000 description 1
- UQCWKRIUDXVWRV-UHFFFAOYSA-L diiodo(dioctyl)stannane Chemical compound CCCCCCCC[Sn](I)(I)CCCCCCCC UQCWKRIUDXVWRV-UHFFFAOYSA-L 0.000 description 1
- VPBOTFQLPJZQSU-UHFFFAOYSA-L diiodo(dipropyl)stannane Chemical compound CCC[Sn](I)(I)CCC VPBOTFQLPJZQSU-UHFFFAOYSA-L 0.000 description 1
- RSZFAWXWWKYVPM-UHFFFAOYSA-M dimethyl(2-phenylpropyl)sulfanium;iodide Chemical compound [I-].C[S+](C)CC(C)C1=CC=CC=C1 RSZFAWXWWKYVPM-UHFFFAOYSA-M 0.000 description 1
- FVZVKXSIRVDIJM-UHFFFAOYSA-N dimethyl(propan-2-yl)sulfanium Chemical compound CC(C)[S+](C)C FVZVKXSIRVDIJM-UHFFFAOYSA-N 0.000 description 1
- BJXPBADVMVABEW-UHFFFAOYSA-M dimethyl-(2-methylphenyl)sulfanium;acetate Chemical compound CC([O-])=O.C[S+](C)C1=CC=CC=C1C BJXPBADVMVABEW-UHFFFAOYSA-M 0.000 description 1
- DOHQOGRRQASQAR-UHFFFAOYSA-L dimethyltin(2+);dibromide Chemical compound C[Sn](C)(Br)Br DOHQOGRRQASQAR-UHFFFAOYSA-L 0.000 description 1
- VVYDVQWJZWRVPE-UHFFFAOYSA-L dimethyltin(2+);diiodide Chemical compound C[Sn](C)(I)I VVYDVQWJZWRVPE-UHFFFAOYSA-L 0.000 description 1
- ALOQGPVOAWHHLG-UHFFFAOYSA-L diphenyltin(2+);dibromide Chemical compound C=1C=CC=CC=1[Sn](Br)(Br)C1=CC=CC=C1 ALOQGPVOAWHHLG-UHFFFAOYSA-L 0.000 description 1
- FPXDFNHYWPHJOJ-UHFFFAOYSA-L diphenyltin(2+);diiodide Chemical compound C=1C=CC=CC=1[Sn](I)(I)C1=CC=CC=C1 FPXDFNHYWPHJOJ-UHFFFAOYSA-L 0.000 description 1
- SJRCSTOHOSUTOF-UHFFFAOYSA-L dipropyltin(2+);dibromide Chemical compound CCC[Sn](Br)(Br)CCC SJRCSTOHOSUTOF-UHFFFAOYSA-L 0.000 description 1
- CTRHCENQKGMZLE-UHFFFAOYSA-L dipropyltin(2+);dichloride Chemical compound CCC[Sn](Cl)(Cl)CCC CTRHCENQKGMZLE-UHFFFAOYSA-L 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- JBSAUTFGQMWDTM-UHFFFAOYSA-K dodecyl(triiodo)stannane Chemical compound CCCCCCCCCCCC[Sn](I)(I)I JBSAUTFGQMWDTM-UHFFFAOYSA-K 0.000 description 1
- XQQOCKKQAMSPIA-UHFFFAOYSA-N ethyl 5-(4-bromophenyl)-1,2-oxazole-3-carboxylate Chemical compound O1N=C(C(=O)OCC)C=C1C1=CC=C(Br)C=C1 XQQOCKKQAMSPIA-UHFFFAOYSA-N 0.000 description 1
- OIEVKEGSQNONOC-UHFFFAOYSA-N ethyl(dimethyl)sulfanium;nitrate Chemical compound [O-][N+]([O-])=O.CC[S+](C)C OIEVKEGSQNONOC-UHFFFAOYSA-N 0.000 description 1
- CYRHQOOURDSWBR-UHFFFAOYSA-K ethyl(triiodo)stannane Chemical compound CC[Sn](I)(I)I CYRHQOOURDSWBR-UHFFFAOYSA-K 0.000 description 1
- ORUSAPVNJMGVOH-UHFFFAOYSA-M ethyl-methyl-propylsulfanium;4-methylbenzenesulfonate Chemical compound CCC[S+](C)CC.CC1=CC=C(S([O-])(=O)=O)C=C1 ORUSAPVNJMGVOH-UHFFFAOYSA-M 0.000 description 1
- NJVOZLGKTAPUTQ-UHFFFAOYSA-M fentin chloride Chemical compound C=1C=CC=CC=1[Sn](C=1C=CC=CC=1)(Cl)C1=CC=CC=C1 NJVOZLGKTAPUTQ-UHFFFAOYSA-M 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 150000004694 iodide salts Chemical class 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- KJSACGHPPNXZFT-UHFFFAOYSA-M iodo(triphenyl)stannane Chemical compound C=1C=CC=CC=1[Sn](C=1C=CC=CC=1)(I)C1=CC=CC=C1 KJSACGHPPNXZFT-UHFFFAOYSA-M 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- YICRPERKKBDRSP-UHFFFAOYSA-N methyl 3-amino-4-methylthiophene-2-carboxylate Chemical compound COC(=O)C=1SC=C(C)C=1N YICRPERKKBDRSP-UHFFFAOYSA-N 0.000 description 1
- KZKQGUVWZYKJBN-UHFFFAOYSA-N methyl 5-methylsulfonylpyridine-3-carboxylate Chemical compound COC(=O)C1=CN=CC(S(C)(=O)=O)=C1 KZKQGUVWZYKJBN-UHFFFAOYSA-N 0.000 description 1
- SDDKIZNHOCEXTF-UHFFFAOYSA-N methyl carbamimidothioate Chemical compound CSC(N)=N SDDKIZNHOCEXTF-UHFFFAOYSA-N 0.000 description 1
- MSMWWVPVYSKCIM-UHFFFAOYSA-N n-(2-methoxyphenyl)-2,5-dimethylaniline Chemical compound COC1=CC=CC=C1NC1=CC(C)=CC=C1C MSMWWVPVYSKCIM-UHFFFAOYSA-N 0.000 description 1
- ZMHZSHHZIKJFIR-UHFFFAOYSA-N octyltin Chemical compound CCCCCCCC[Sn] ZMHZSHHZIKJFIR-UHFFFAOYSA-N 0.000 description 1
- ZHPWRIMJTIXQIA-UHFFFAOYSA-N pentyltin Chemical compound CCCCC[Sn] ZHPWRIMJTIXQIA-UHFFFAOYSA-N 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- VMLNPPLWYBCFAV-UHFFFAOYSA-K phenyltin(3+);tribromide Chemical compound Br[Sn](Br)(Br)C1=CC=CC=C1 VMLNPPLWYBCFAV-UHFFFAOYSA-K 0.000 description 1
- UBOGEXSQACVGEC-UHFFFAOYSA-K phenyltin(3+);trichloride Chemical compound Cl[Sn](Cl)(Cl)C1=CC=CC=C1 UBOGEXSQACVGEC-UHFFFAOYSA-K 0.000 description 1
- KPCRDICFNYEBMJ-UHFFFAOYSA-K phenyltin(3+);triiodide Chemical compound I[Sn](I)(I)C1=CC=CC=C1 KPCRDICFNYEBMJ-UHFFFAOYSA-K 0.000 description 1
- XYFCBTPGUUZFHI-UHFFFAOYSA-O phosphonium Chemical compound [PH4+] XYFCBTPGUUZFHI-UHFFFAOYSA-O 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000011403 purification operation Methods 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- VFIZBHJTOHUOEK-UHFFFAOYSA-N s-ethylisothiourea Chemical compound CCSC(N)=N VFIZBHJTOHUOEK-UHFFFAOYSA-N 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- HQYFXUNMHLTGCN-UHFFFAOYSA-N tert-butyl carbamimidothioate Chemical compound CC(C)(C)SC(N)=N HQYFXUNMHLTGCN-UHFFFAOYSA-N 0.000 description 1
- JNULVZVIEMKOKF-UHFFFAOYSA-N tert-butyl(dimethyl)sulfanium Chemical compound C[S+](C)C(C)(C)C JNULVZVIEMKOKF-UHFFFAOYSA-N 0.000 description 1
- NJASUIDIZMMYED-UHFFFAOYSA-N tetra(propan-2-yl)stannane Chemical compound CC(C)[Sn](C(C)C)(C(C)C)C(C)C NJASUIDIZMMYED-UHFFFAOYSA-N 0.000 description 1
- WBVCLUDHJDTUAU-UHFFFAOYSA-N tetrabenzylstannane Chemical compound C=1C=CC=CC=1C[Sn](CC=1C=CC=CC=1)(CC=1C=CC=CC=1)CC1=CC=CC=C1 WBVCLUDHJDTUAU-UHFFFAOYSA-N 0.000 description 1
- FDNSKZMGQQDYQB-UHFFFAOYSA-N tetradodecylstannane Chemical compound CCCCCCCCCCCC[Sn](CCCCCCCCCCCC)(CCCCCCCCCCCC)CCCCCCCCCCCC FDNSKZMGQQDYQB-UHFFFAOYSA-N 0.000 description 1
- RWWNQEOPUOCKGR-UHFFFAOYSA-N tetraethyltin Chemical compound CC[Sn](CC)(CC)CC RWWNQEOPUOCKGR-UHFFFAOYSA-N 0.000 description 1
- VTDWCIMAUGGTFZ-UHFFFAOYSA-N tetrakis(2-ethylhexyl)stannane Chemical compound CCCCC(CC)C[Sn](CC(CC)CCCC)(CC(CC)CCCC)CC(CC)CCCC VTDWCIMAUGGTFZ-UHFFFAOYSA-N 0.000 description 1
- VXKWYPOMXBVZSJ-UHFFFAOYSA-N tetramethyltin Chemical compound C[Sn](C)(C)C VXKWYPOMXBVZSJ-UHFFFAOYSA-N 0.000 description 1
- JTGNPNLBCGBCMP-UHFFFAOYSA-N tetraoctylstannane Chemical compound CCCCCCCC[Sn](CCCCCCCC)(CCCCCCCC)CCCCCCCC JTGNPNLBCGBCMP-UHFFFAOYSA-N 0.000 description 1
- JEHHMOWXLBXVHN-UHFFFAOYSA-N tetrapentylstannane Chemical compound CCCCC[Sn](CCCCC)(CCCCC)CCCCC JEHHMOWXLBXVHN-UHFFFAOYSA-N 0.000 description 1
- CRHIAMBJMSSNNM-UHFFFAOYSA-N tetraphenylstannane Chemical compound C1=CC=CC=C1[Sn](C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 CRHIAMBJMSSNNM-UHFFFAOYSA-N 0.000 description 1
- OIQCWAIEHVRCCG-UHFFFAOYSA-N tetrapropylstannane Chemical compound CCC[Sn](CCC)(CCC)CCC OIQCWAIEHVRCCG-UHFFFAOYSA-N 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 150000003606 tin compounds Chemical class 0.000 description 1
- AXZWODMDQAVCJE-UHFFFAOYSA-L tin(II) chloride (anhydrous) Chemical compound [Cl-].[Cl-].[Sn+2] AXZWODMDQAVCJE-UHFFFAOYSA-L 0.000 description 1
- VDAFCYOZMJOLTQ-UHFFFAOYSA-M tri(butan-2-yl)-chlorostannane Chemical compound C(C)(CC)[Sn](C(C)CC)(C(C)CC)Cl VDAFCYOZMJOLTQ-UHFFFAOYSA-M 0.000 description 1
- UUAKGVYBNOJERU-UHFFFAOYSA-M tribenzylsulfanium;iodide Chemical compound [I-].C=1C=CC=CC=1C[S+](CC=1C=CC=CC=1)CC1=CC=CC=C1 UUAKGVYBNOJERU-UHFFFAOYSA-M 0.000 description 1
- VEKOBSVHVWMWRA-UHFFFAOYSA-K tribromo(2-ethylhexyl)stannane Chemical compound CCCCC(CC)C[Sn](Br)(Br)Br VEKOBSVHVWMWRA-UHFFFAOYSA-K 0.000 description 1
- DJLHUBJAECUMLX-UHFFFAOYSA-K tribromo(6-methylheptyl)stannane Chemical compound CC(C)CCCCC[Sn](Br)(Br)Br DJLHUBJAECUMLX-UHFFFAOYSA-K 0.000 description 1
- BYQWEYFCJKJRHO-UHFFFAOYSA-K tribromo(butyl)stannane Chemical compound CCCC[Sn](Br)(Br)Br BYQWEYFCJKJRHO-UHFFFAOYSA-K 0.000 description 1
- NZXDHJANKOMEDR-UHFFFAOYSA-K tribromo(dodecyl)stannane Chemical compound CCCCCCCCCCCC[Sn](Br)(Br)Br NZXDHJANKOMEDR-UHFFFAOYSA-K 0.000 description 1
- GOWIXKGLTIIPQR-UHFFFAOYSA-K tribromo(ethyl)stannane Chemical compound CC[Sn](Br)(Br)Br GOWIXKGLTIIPQR-UHFFFAOYSA-K 0.000 description 1
- SSGLIJVXYPSIEZ-UHFFFAOYSA-K tribromo(methyl)stannane Chemical compound C[Sn](Br)(Br)Br SSGLIJVXYPSIEZ-UHFFFAOYSA-K 0.000 description 1
- BMRKNRNFWARTTN-UHFFFAOYSA-K tribromo(octyl)stannane Chemical compound CCCCCCCC[Sn](Br)(Br)Br BMRKNRNFWARTTN-UHFFFAOYSA-K 0.000 description 1
- BYXWWBJMFOBEHX-UHFFFAOYSA-K tribromo(propyl)stannane Chemical compound CCC[Sn](Br)(Br)Br BYXWWBJMFOBEHX-UHFFFAOYSA-K 0.000 description 1
- FVRKTAOFDKFAMI-UHFFFAOYSA-M tributylstannanylium;bromide Chemical compound [Br-].CCCC[Sn+](CCCC)CCCC FVRKTAOFDKFAMI-UHFFFAOYSA-M 0.000 description 1
- LWBLDXRXGCRDDS-UHFFFAOYSA-M tributylsulfanium;bromide Chemical compound [Br-].CCCC[S+](CCCC)CCCC LWBLDXRXGCRDDS-UHFFFAOYSA-M 0.000 description 1
- OWWHESVNCQAYQR-UHFFFAOYSA-K trichloro(2-ethylhexyl)stannane Chemical compound CCCCC(CC)C[Sn](Cl)(Cl)Cl OWWHESVNCQAYQR-UHFFFAOYSA-K 0.000 description 1
- PDFNMVKYZSDSLJ-UHFFFAOYSA-K trichloro(2-methylpropyl)stannane Chemical compound CC(C)C[Sn](Cl)(Cl)Cl PDFNMVKYZSDSLJ-UHFFFAOYSA-K 0.000 description 1
- LRKFZOQBINVWHG-UHFFFAOYSA-K trichloro(6-methylheptyl)stannane Chemical compound CC(C)CCCCC[Sn](Cl)(Cl)Cl LRKFZOQBINVWHG-UHFFFAOYSA-K 0.000 description 1
- QONBXEOLXRAITN-UHFFFAOYSA-K trichloro(dodecyl)stannane Chemical compound CCCCCCCCCCCC[Sn](Cl)(Cl)Cl QONBXEOLXRAITN-UHFFFAOYSA-K 0.000 description 1
- MEBRQLCKPRKBOH-UHFFFAOYSA-K trichloro(ethyl)stannane Chemical compound CC[Sn](Cl)(Cl)Cl MEBRQLCKPRKBOH-UHFFFAOYSA-K 0.000 description 1
- RIRXGFHMQATDCF-UHFFFAOYSA-K trichloro(hexyl)stannane Chemical compound CCCCCC[Sn](Cl)(Cl)Cl RIRXGFHMQATDCF-UHFFFAOYSA-K 0.000 description 1
- IMNIKXMHMHIKDX-UHFFFAOYSA-K trichloro(propan-2-yl)stannane Chemical compound CC(C)[Sn](Cl)(Cl)Cl IMNIKXMHMHIKDX-UHFFFAOYSA-K 0.000 description 1
- NFJGHYXSHMSYFA-UHFFFAOYSA-K trichloro(propyl)stannane Chemical compound CCC[Sn](Cl)(Cl)Cl NFJGHYXSHMSYFA-UHFFFAOYSA-K 0.000 description 1
- LLMLKXBRBOGFFA-UHFFFAOYSA-K trichloro-(4-methylphenyl)stannane Chemical compound CC1=CC=C([Sn](Cl)(Cl)Cl)C=C1 LLMLKXBRBOGFFA-UHFFFAOYSA-K 0.000 description 1
- QMUWWEYTBMDCKJ-UHFFFAOYSA-M tridodecylstannanylium;chloride Chemical compound CCCCCCCCCCCC[Sn](Cl)(CCCCCCCCCCCC)CCCCCCCCCCCC QMUWWEYTBMDCKJ-UHFFFAOYSA-M 0.000 description 1
- MWKCRAHNOBACDT-UHFFFAOYSA-M tridodecylstannanylium;iodide Chemical compound CCCCCCCCCCCC[Sn](I)(CCCCCCCCCCCC)CCCCCCCCCCCC MWKCRAHNOBACDT-UHFFFAOYSA-M 0.000 description 1
- KQPIFPBKXYBDGV-UHFFFAOYSA-M triethylstannanylium;bromide Chemical compound CC[Sn](Br)(CC)CC KQPIFPBKXYBDGV-UHFFFAOYSA-M 0.000 description 1
- PRFPAWZEYOPUKM-UHFFFAOYSA-M triethylstannanylium;iodide Chemical compound CC[Sn](I)(CC)CC PRFPAWZEYOPUKM-UHFFFAOYSA-M 0.000 description 1
- LKDQWVKWYGOVJW-UHFFFAOYSA-M triethylsulfanium;iodide Chemical compound [I-].CC[S+](CC)CC LKDQWVKWYGOVJW-UHFFFAOYSA-M 0.000 description 1
- YAKWASWAUWOPAQ-UHFFFAOYSA-K triiodo(6-methylheptyl)stannane Chemical compound CC(C)CCCCC[Sn](I)(I)I YAKWASWAUWOPAQ-UHFFFAOYSA-K 0.000 description 1
- SBNYZUTZEUZATG-UHFFFAOYSA-K triiodo(methyl)stannane Chemical compound C[Sn](I)(I)I SBNYZUTZEUZATG-UHFFFAOYSA-K 0.000 description 1
- RXWKFHGICDWKDN-UHFFFAOYSA-K triiodo(octyl)stannane Chemical compound CCCCCCCC[Sn](I)(I)I RXWKFHGICDWKDN-UHFFFAOYSA-K 0.000 description 1
- HHIQCKSDOMLQMO-UHFFFAOYSA-K triiodo(propyl)stannane Chemical compound CCC[Sn](I)(I)I HHIQCKSDOMLQMO-UHFFFAOYSA-K 0.000 description 1
- MZGUIAFRJWSYJJ-UHFFFAOYSA-M trimethylstannanylium;bromide Chemical compound C[Sn](C)(C)Br MZGUIAFRJWSYJJ-UHFFFAOYSA-M 0.000 description 1
- XGRPNCOKLIMKBN-UHFFFAOYSA-M trimethylstannanylium;iodide Chemical compound C[Sn](C)(C)I XGRPNCOKLIMKBN-UHFFFAOYSA-M 0.000 description 1
- AHNJHSBNAZLPDN-UHFFFAOYSA-M trimethylsulfanium;acetate Chemical compound C[S+](C)C.CC([O-])=O AHNJHSBNAZLPDN-UHFFFAOYSA-M 0.000 description 1
- GOTIICCWNAPLMN-UHFFFAOYSA-M trimethylsulfanium;bromide Chemical compound [Br-].C[S+](C)C GOTIICCWNAPLMN-UHFFFAOYSA-M 0.000 description 1
- IMOJRKMVLGEQHL-UHFFFAOYSA-N trimethylsulfanium;nitrate Chemical compound C[S+](C)C.[O-][N+]([O-])=O IMOJRKMVLGEQHL-UHFFFAOYSA-N 0.000 description 1
- MJZACYWTDBYPTO-UHFFFAOYSA-L trimethylsulfanium;sulfate Chemical compound C[S+](C)C.C[S+](C)C.[O-]S([O-])(=O)=O MJZACYWTDBYPTO-UHFFFAOYSA-L 0.000 description 1
- BYVAUQCHMDRWFV-UHFFFAOYSA-M trioctylstannanylium;bromide Chemical compound CCCCCCCC[Sn](Br)(CCCCCCCC)CCCCCCCC BYVAUQCHMDRWFV-UHFFFAOYSA-M 0.000 description 1
- SMAVBLSQIQGWLU-UHFFFAOYSA-M trioctylstannanylium;iodide Chemical compound CCCCCCCC[Sn](I)(CCCCCCCC)CCCCCCCC SMAVBLSQIQGWLU-UHFFFAOYSA-M 0.000 description 1
- ZFEAYIKULRXTAR-UHFFFAOYSA-M triphenylsulfanium;chloride Chemical compound [Cl-].C1=CC=CC=C1[S+](C=1C=CC=CC=1)C1=CC=CC=C1 ZFEAYIKULRXTAR-UHFFFAOYSA-M 0.000 description 1
- GQBRIYIRPORZOM-UHFFFAOYSA-M tripropylstannanylium;bromide Chemical compound CCC[Sn](Br)(CCC)CCC GQBRIYIRPORZOM-UHFFFAOYSA-M 0.000 description 1
- MHTXEMSDIHFLFI-UHFFFAOYSA-M tripropylstannanylium;iodide Chemical compound CCC[Sn](I)(CCC)CCC MHTXEMSDIHFLFI-UHFFFAOYSA-M 0.000 description 1
- YQQBSHJWYVTQTA-UHFFFAOYSA-M tris(2-methylpropyl)stannanylium;bromide Chemical compound CC(C)C[Sn](Br)(CC(C)C)CC(C)C YQQBSHJWYVTQTA-UHFFFAOYSA-M 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F7/00—Compounds containing elements of Groups 4 or 14 of the Periodic Table
- C07F7/22—Tin compounds
- C07F7/2208—Compounds having tin linked only to carbon, hydrogen and/or halogen
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Catalysts (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/828,579 US4148814A (en) | 1977-08-29 | 1977-08-29 | Process for preparing monohydrocarbyltin trihalides |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5439022A JPS5439022A (en) | 1979-03-24 |
| JPS6154034B2 true JPS6154034B2 (OSRAM) | 1986-11-20 |
Family
ID=25252210
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP8621878A Granted JPS5439022A (en) | 1977-08-29 | 1978-07-17 | Process for preparing trihalogenized monohydrocarbyltin |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4148814A (OSRAM) |
| JP (1) | JPS5439022A (OSRAM) |
| AR (1) | AR230837A1 (OSRAM) |
| BE (1) | BE865667A (OSRAM) |
| BR (1) | BR7803401A (OSRAM) |
| CA (1) | CA1088087A (OSRAM) |
| DE (1) | DE2831106A1 (OSRAM) |
| ES (1) | ES468936A1 (OSRAM) |
| FR (1) | FR2401929A1 (OSRAM) |
| GB (1) | GB1598866A (OSRAM) |
| IT (1) | IT1104670B (OSRAM) |
| MX (1) | MX147862A (OSRAM) |
| NL (1) | NL7804207A (OSRAM) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP1225177A1 (en) * | 2001-01-19 | 2002-07-24 | Atofina Vlissingen B.V. | Process for the production of monoalkyltin trihalides |
| US20050101716A1 (en) * | 2003-11-12 | 2005-05-12 | Ilze Bacaloglu | Liquid microemulsion stabilizer composition for halogen-containing polymers |
| EP2588485B1 (en) * | 2010-07-01 | 2015-11-18 | PMC Organometallix, Inc. | Process for preparing monoalkyltin trihalides and dialkyltin dihalides |
| KR101622750B1 (ko) | 2011-03-30 | 2016-05-19 | 빅토르 그리고르예비치 콜레스닉 | SiO2와 FeTiO3 입자와 자기파 사이의 전자기적 상호작용을 발생시킴으로써 실리콘과 티타늄을 환원시키는 방법 |
| EP4074717A1 (en) * | 2021-04-13 | 2022-10-19 | BNT Chemicals GmbH | Method for cleaving alkyl tin halides |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL302013A (OSRAM) * | 1962-12-18 | 1900-01-01 | ||
| US3311648A (en) * | 1963-10-21 | 1967-03-28 | Stauffer Chemical Co | Organotin sulfonium compounds |
| US3400141A (en) * | 1964-04-06 | 1968-09-03 | Albright & Wilson Mfg Ltd | Method of preparing aliphatic tin halides |
| GB1115646A (en) * | 1964-09-18 | 1968-05-29 | Albright & Wilson Mfg Ltd | Improvements in the production of organotin compounds |
| US3426046A (en) * | 1965-10-22 | 1969-02-04 | Dow Chemical Co | Synthesis of epoxides from allylic sulfonium salts |
| US3442912A (en) * | 1965-09-23 | 1969-05-06 | Dow Chemical Co | Synthesis of aromatic epoxides from trialkylsulfonium salts |
| US3454610A (en) * | 1966-05-26 | 1969-07-08 | Dow Chemical Co | Synthesis of organometallic halides by redistribution |
| NL7006926A (OSRAM) * | 1969-05-20 | 1970-11-24 | ||
| CH581143A5 (OSRAM) * | 1973-08-16 | 1976-10-29 | Ciba Geigy Ag | |
| US3862198A (en) * | 1974-01-10 | 1975-01-21 | Cincinnati Milacron Chem | Catalyzed redistribution of alkyltin halides |
-
1977
- 1977-08-29 US US05/828,579 patent/US4148814A/en not_active Expired - Lifetime
-
1978
- 1978-03-15 CA CA298,937A patent/CA1088087A/en not_active Expired
- 1978-03-27 MX MX172866A patent/MX147862A/es unknown
- 1978-03-31 GB GB12696/78A patent/GB1598866A/en not_active Expired
- 1978-04-04 BE BE186546A patent/BE865667A/xx not_active IP Right Cessation
- 1978-04-19 ES ES468936A patent/ES468936A1/es not_active Expired
- 1978-04-20 NL NL7804207A patent/NL7804207A/xx not_active Application Discontinuation
- 1978-04-26 AR AR271911A patent/AR230837A1/es active
- 1978-04-26 FR FR7812304A patent/FR2401929A1/fr active Granted
- 1978-05-25 IT IT49555/78A patent/IT1104670B/it active
- 1978-05-29 BR BR7803401A patent/BR7803401A/pt unknown
- 1978-07-14 DE DE19782831106 patent/DE2831106A1/de active Granted
- 1978-07-17 JP JP8621878A patent/JPS5439022A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| CA1088087A (en) | 1980-10-21 |
| IT1104670B (it) | 1985-10-28 |
| FR2401929A1 (fr) | 1979-03-30 |
| JPS5439022A (en) | 1979-03-24 |
| IT7849555A0 (it) | 1978-05-25 |
| AR230837A1 (es) | 1984-07-31 |
| US4148814A (en) | 1979-04-10 |
| FR2401929B1 (OSRAM) | 1984-06-29 |
| NL7804207A (nl) | 1979-03-02 |
| ES468936A1 (es) | 1978-12-16 |
| DE2831106C2 (OSRAM) | 1987-08-27 |
| BR7803401A (pt) | 1979-05-08 |
| GB1598866A (en) | 1981-09-23 |
| MX147862A (es) | 1983-01-25 |
| BE865667A (fr) | 1978-07-31 |
| DE2831106A1 (de) | 1979-03-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3415857A (en) | Production of organotin halides | |
| US3862198A (en) | Catalyzed redistribution of alkyltin halides | |
| JPH0129194B2 (OSRAM) | ||
| US3519665A (en) | Direct synthesis of dialkyltin dichloride | |
| US3745183A (en) | Process for producing alkyl tin halides | |
| US3459779A (en) | Process for the production of alkyltin trihalides | |
| US4148814A (en) | Process for preparing monohydrocarbyltin trihalides | |
| JP4473510B2 (ja) | トリハロゲン化モノアルキルスズの製造方法 | |
| US3454610A (en) | Synthesis of organometallic halides by redistribution | |
| US3475472A (en) | Method for preparing triorganotin halides and bis(triorganotin) oxides | |
| US4282165A (en) | Preparation of trimethyltin chloride from dimethyltin dichloride | |
| JP5107243B2 (ja) | 三ハロゲン化モノアルキルスズおよび二ハロゲン化ジアルキルスズの調製方法 | |
| US3475473A (en) | Process for preparing triorganotin halides and bis(triorganotin) oxides | |
| US3387011A (en) | Production of organotin halides | |
| US3519667A (en) | Process for preparing mono-methyl or ethyltin trichloride | |
| US3824264A (en) | Preparation of monohydrocarbyl tin trihalides | |
| US3387012A (en) | Production of dialiphatic tind dihalides | |
| US3446826A (en) | Preparation of alkyltin chlorides,bromides,and iodides | |
| US3607891A (en) | Process for preparing tricyclohexyltin halides | |
| US3449451A (en) | Catalytic production of grignard reagents | |
| US3471539A (en) | Method for preparing triorganotin halides and bis(triorganotin) oxides | |
| US4052427A (en) | Process for the preparation of dialkyltin dihalides | |
| US3901824A (en) | New catalyst in the direct synthesis of dimethyltin dichloride | |
| US3400141A (en) | Method of preparing aliphatic tin halides | |
| US3355468A (en) | Process for preparing tricyclohexyltin chloride |