JPS6149190B2 - - Google Patents
Info
- Publication number
- JPS6149190B2 JPS6149190B2 JP53111855A JP11185578A JPS6149190B2 JP S6149190 B2 JPS6149190 B2 JP S6149190B2 JP 53111855 A JP53111855 A JP 53111855A JP 11185578 A JP11185578 A JP 11185578A JP S6149190 B2 JPS6149190 B2 JP S6149190B2
- Authority
- JP
- Japan
- Prior art keywords
- reactants
- combined amount
- mil
- mol
- permeability
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- -1 poly(ethylene terephthalate) Polymers 0.000 claims description 37
- 239000000376 reactant Substances 0.000 claims description 37
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims description 35
- 229920000728 polyester Polymers 0.000 claims description 35
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 claims description 26
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 claims description 26
- 230000035699 permeability Effects 0.000 claims description 23
- 229920000139 polyethylene terephthalate Polymers 0.000 claims description 15
- 239000005020 polyethylene terephthalate Substances 0.000 claims description 15
- 229910002092 carbon dioxide Inorganic materials 0.000 claims description 13
- 230000009477 glass transition Effects 0.000 claims description 13
- 239000001569 carbon dioxide Substances 0.000 claims description 12
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 11
- 229910052760 oxygen Inorganic materials 0.000 claims description 11
- 239000001301 oxygen Substances 0.000 claims description 11
- SQJQLYOMPSJVQS-UHFFFAOYSA-N 4-(4-carboxyphenyl)sulfonylbenzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1S(=O)(=O)C1=CC=C(C(O)=O)C=C1 SQJQLYOMPSJVQS-UHFFFAOYSA-N 0.000 claims description 9
- 239000000047 product Substances 0.000 claims description 9
- 235000013305 food Nutrition 0.000 claims description 6
- 239000000463 material Substances 0.000 claims description 6
- 150000003457 sulfones Chemical class 0.000 claims description 6
- 239000002954 polymerization reaction product Substances 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 230000005540 biological transmission Effects 0.000 claims 3
- 238000004806 packaging method and process Methods 0.000 description 11
- 229920000642 polymer Polymers 0.000 description 8
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- 229920001634 Copolyester Polymers 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 6
- 150000001991 dicarboxylic acids Chemical class 0.000 description 6
- 239000002253 acid Substances 0.000 description 5
- 235000014171 carbonated beverage Nutrition 0.000 description 5
- 239000003054 catalyst Substances 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 150000002148 esters Chemical class 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- 239000003814 drug Substances 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 230000003197 catalytic effect Effects 0.000 description 3
- 150000002334 glycols Chemical class 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 235000015097 nutrients Nutrition 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 2
- ADCOVFLJGNWWNZ-UHFFFAOYSA-N antimony trioxide Chemical compound O=[Sb]O[Sb]=O ADCOVFLJGNWWNZ-UHFFFAOYSA-N 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 150000005690 diesters Chemical class 0.000 description 2
- VNGOYPQMJFJDLV-UHFFFAOYSA-N dimethyl benzene-1,3-dicarboxylate Chemical compound COC(=O)C1=CC=CC(C(=O)OC)=C1 VNGOYPQMJFJDLV-UHFFFAOYSA-N 0.000 description 2
- 150000002009 diols Chemical class 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 238000006068 polycondensation reaction Methods 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 229910052719 titanium Inorganic materials 0.000 description 2
- 239000010936 titanium Substances 0.000 description 2
- 238000005809 transesterification reaction Methods 0.000 description 2
- AOFRNZNXMCOXHP-UHFFFAOYSA-N 2-(2-carboxyphenyl)sulfonylbenzoic acid Chemical compound OC(=O)C1=CC=CC=C1S(=O)(=O)C1=CC=CC=C1C(O)=O AOFRNZNXMCOXHP-UHFFFAOYSA-N 0.000 description 1
- GPAPPPVRLPGFEQ-UHFFFAOYSA-N 4,4'-dichlorodiphenyl sulfone Chemical compound C1=CC(Cl)=CC=C1S(=O)(=O)C1=CC=C(Cl)C=C1 GPAPPPVRLPGFEQ-UHFFFAOYSA-N 0.000 description 1
- NEQFBGHQPUXOFH-UHFFFAOYSA-N 4-(4-carboxyphenyl)benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1C1=CC=C(C(O)=O)C=C1 NEQFBGHQPUXOFH-UHFFFAOYSA-N 0.000 description 1
- LLLVZDVNHNWSDS-UHFFFAOYSA-N 4-methylidene-3,5-dioxabicyclo[5.2.2]undeca-1(9),7,10-triene-2,6-dione Chemical compound C1(C2=CC=C(C(=O)OC(=C)O1)C=C2)=O LLLVZDVNHNWSDS-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical class OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- ZOIORXHNWRGPMV-UHFFFAOYSA-N acetic acid;zinc Chemical compound [Zn].CC(O)=O.CC(O)=O ZOIORXHNWRGPMV-UHFFFAOYSA-N 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001339 alkali metal compounds Chemical class 0.000 description 1
- 150000001341 alkaline earth metal compounds Chemical class 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 235000013405 beer Nutrition 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- YHWCPXVTRSHPNY-UHFFFAOYSA-N butan-1-olate;titanium(4+) Chemical compound [Ti+4].CCCC[O-].CCCC[O-].CCCC[O-].CCCC[O-] YHWCPXVTRSHPNY-UHFFFAOYSA-N 0.000 description 1
- VSGNNIFQASZAOI-UHFFFAOYSA-L calcium acetate Chemical compound [Ca+2].CC([O-])=O.CC([O-])=O VSGNNIFQASZAOI-UHFFFAOYSA-L 0.000 description 1
- 239000001639 calcium acetate Substances 0.000 description 1
- 229960005147 calcium acetate Drugs 0.000 description 1
- 235000011092 calcium acetate Nutrition 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 235000012174 carbonated soft drink Nutrition 0.000 description 1
- JVLRYPRBKSMEBF-UHFFFAOYSA-K diacetyloxystibanyl acetate Chemical compound [Sb+3].CC([O-])=O.CC([O-])=O.CC([O-])=O JVLRYPRBKSMEBF-UHFFFAOYSA-K 0.000 description 1
- UHWHMHPXHWHWPX-UHFFFAOYSA-J dipotassium;oxalate;oxotitanium(2+) Chemical compound [K+].[K+].[Ti+2]=O.[O-]C(=O)C([O-])=O.[O-]C(=O)C([O-])=O UHWHMHPXHWHWPX-UHFFFAOYSA-J 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- UEGPKNKPLBYCNK-UHFFFAOYSA-L magnesium acetate Chemical compound [Mg+2].CC([O-])=O.CC([O-])=O UEGPKNKPLBYCNK-UHFFFAOYSA-L 0.000 description 1
- 239000011654 magnesium acetate Substances 0.000 description 1
- 229940069446 magnesium acetate Drugs 0.000 description 1
- 235000011285 magnesium acetate Nutrition 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 229940071125 manganese acetate Drugs 0.000 description 1
- UOGMEBQRZBEZQT-UHFFFAOYSA-L manganese(2+);diacetate Chemical compound [Mn+2].CC([O-])=O.CC([O-])=O UOGMEBQRZBEZQT-UHFFFAOYSA-L 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 238000010137 moulding (plastic) Methods 0.000 description 1
- KYTZHLUVELPASH-UHFFFAOYSA-N naphthalene-1,2-dicarboxylic acid Chemical class C1=CC=CC2=C(C(O)=O)C(C(=O)O)=CC=C21 KYTZHLUVELPASH-UHFFFAOYSA-N 0.000 description 1
- 229920000620 organic polymer Polymers 0.000 description 1
- 230000037050 permeability transition Effects 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 235000015067 sauces Nutrition 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 150000003623 transition metal compounds Chemical class 0.000 description 1
- 238000002834 transmittance Methods 0.000 description 1
- 239000004246 zinc acetate Substances 0.000 description 1
- 229960000314 zinc acetate Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G63/00—Macromolecular compounds obtained by reactions forming a carboxylic ester link in the main chain of the macromolecule
- C08G63/68—Polyesters containing atoms other than carbon, hydrogen and oxygen
- C08G63/688—Polyesters containing atoms other than carbon, hydrogen and oxygen containing sulfur
- C08G63/6884—Polyesters containing atoms other than carbon, hydrogen and oxygen containing sulfur derived from polycarboxylic acids and polyhydroxy compounds
- C08G63/6886—Dicarboxylic acids and dihydroxy compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyesters Or Polycarbonates (AREA)
- Containers Having Bodies Formed In One Piece (AREA)
- Packging For Living Organisms, Food Or Medicinal Products That Are Sensitive To Environmental Conditiond (AREA)
- Wrappers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/690,482 US4115363A (en) | 1976-05-27 | 1976-05-27 | Linear copolyesters of isophthalic acid 4,4'-sulfonyldibenzoic acid, bis(4-beta-hydroxyethoxyphenyl) sulfone and ethylene glycol |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5498887A JPS5498887A (en) | 1979-08-04 |
| JPS6149190B2 true JPS6149190B2 (cg-RX-API-DMAC10.html) | 1986-10-28 |
Family
ID=24772641
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP5996877A Granted JPS52144094A (en) | 1976-05-27 | 1977-05-25 | Linear copolymerized polyester |
| JP11185578A Granted JPS5498887A (en) | 1976-05-27 | 1978-09-13 | Injection type vessel* which one component is linear copolymerized polyester |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP5996877A Granted JPS52144094A (en) | 1976-05-27 | 1977-05-25 | Linear copolymerized polyester |
Country Status (8)
| Country | Link |
|---|---|
| US (2) | US4115363A (cg-RX-API-DMAC10.html) |
| JP (2) | JPS52144094A (cg-RX-API-DMAC10.html) |
| DE (1) | DE2720845C2 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2352848A1 (cg-RX-API-DMAC10.html) |
| GB (2) | GB1585404A (cg-RX-API-DMAC10.html) |
| HK (2) | HK47681A (cg-RX-API-DMAC10.html) |
| MY (2) | MY8200135A (cg-RX-API-DMAC10.html) |
| NL (1) | NL166270C (cg-RX-API-DMAC10.html) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4330661A (en) * | 1980-02-08 | 1982-05-18 | Owens-Illinois, Inc. | Copolyesters, method of making same and packaging materials |
| US4307060A (en) * | 1980-03-25 | 1981-12-22 | Owens-Illinois, Inc. | Thermoplastic polyesters, and method of making hollow articles therefrom |
| US4401805A (en) * | 1982-03-01 | 1983-08-30 | Eastman Kodak Company | Modified poly(ethylene terephthalate) having improved gas barrier properties |
| US4388456A (en) * | 1982-03-01 | 1983-06-14 | Eastman Kodak Company | Copolyesters having improved gas barrier properties |
| US4398017A (en) * | 1982-03-09 | 1983-08-09 | Owens-Illinois, Inc. | Copolyesters |
| US4384106A (en) * | 1982-03-09 | 1983-05-17 | Owens-Illinois, Inc. | Copolyesters |
| US4403090A (en) * | 1982-09-07 | 1983-09-06 | The Goodyear Tire & Rubber Company | Polyisophthalates and copolymers thereof having high barrier properties |
| US4482586A (en) * | 1982-09-07 | 1984-11-13 | The Goodyear Tire & Rubber Company | Multi-layer polyisophthalate and polyterephthalate articles and process therefor |
| US4436893A (en) | 1982-10-25 | 1984-03-13 | Rohm And Haas Company | Copolyester of polyethylene terephthalate and sulfonyl diphenol |
| US4547563A (en) * | 1983-02-14 | 1985-10-15 | Rohm And Haas Company | Copolyester of polyethylene terephthalate and bis (4-beta hydroxy ethoxy phenyl) sulfone |
| US4578437A (en) * | 1983-08-01 | 1986-03-25 | Eastman Kodak Company | Copolyester/polyester blends having reduced carbon dioxide permeability |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2593411A (en) * | 1949-12-21 | 1952-04-22 | Eastman Kodak Co | Bis (4-beta-hydroxyalkoxyphenyl) sulfones and polyesters prepared therefrom |
| US2973339A (en) * | 1955-08-11 | 1961-02-28 | Linear terephthalate polyesters of | |
| US3536665A (en) * | 1967-05-25 | 1970-10-27 | Allied Chem | Linear polyesters of 4,4' dichlorocarbonyldiphenylsulfone and aromatic dihydroxy compounds and their method of preparation |
| DE2146055A1 (de) * | 1971-09-15 | 1973-03-22 | Hoechst Ag | Glasklare, lineare, thermoplastische copolyester und verfahren zu ihrer herstellung |
| US3787526A (en) * | 1971-10-22 | 1974-01-22 | Ici America Inc | Non-linear polyesters from a dicarboxylic acid,etherified diphenol and an alkoxylated polyhydroxy compound |
| US3972852A (en) * | 1973-08-07 | 1976-08-03 | Teijin Limited | Process for preparing aromatic polyesters from diphenols |
| JPS5744695B2 (cg-RX-API-DMAC10.html) * | 1973-09-10 | 1982-09-22 | ||
| JPS5096692A (cg-RX-API-DMAC10.html) * | 1973-12-27 | 1975-07-31 |
-
1976
- 1976-05-27 US US05/690,482 patent/US4115363A/en not_active Expired - Lifetime
-
1977
- 1977-04-27 NL NL7704596.A patent/NL166270C/xx not_active IP Right Cessation
- 1977-05-09 DE DE2720845A patent/DE2720845C2/de not_active Expired
- 1977-05-24 GB GB40631/79A patent/GB1585404A/en not_active Expired
- 1977-05-24 GB GB21826/77A patent/GB1585403A/en not_active Expired
- 1977-05-25 JP JP5996877A patent/JPS52144094A/ja active Granted
- 1977-05-26 FR FR7716197A patent/FR2352848A1/fr active Granted
- 1977-11-02 US US05/847,970 patent/US4145517A/en not_active Expired - Lifetime
-
1978
- 1978-09-13 JP JP11185578A patent/JPS5498887A/ja active Granted
-
1981
- 1981-09-24 HK HK476/81A patent/HK47681A/xx unknown
- 1981-09-24 HK HK474/81A patent/HK47781A/xx unknown
-
1982
- 1982-12-30 MY MY135/82A patent/MY8200135A/xx unknown
- 1982-12-30 MY MY131/82A patent/MY8200131A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| JPS52144094A (en) | 1977-12-01 |
| HK47681A (en) | 1981-10-02 |
| FR2352848A1 (fr) | 1977-12-23 |
| US4115363A (en) | 1978-09-19 |
| GB1585404A (en) | 1981-03-04 |
| MY8200131A (en) | 1982-12-31 |
| NL166270C (nl) | 1981-07-15 |
| JPS5544096B2 (cg-RX-API-DMAC10.html) | 1980-11-10 |
| DE2720845C2 (de) | 1985-08-01 |
| MY8200135A (en) | 1982-12-31 |
| JPS5498887A (en) | 1979-08-04 |
| US4145517A (en) | 1979-03-20 |
| DE2720845A1 (de) | 1977-12-08 |
| FR2352848B1 (cg-RX-API-DMAC10.html) | 1980-06-20 |
| NL7704596A (nl) | 1977-11-29 |
| NL166270B (nl) | 1981-02-16 |
| HK47781A (en) | 1981-10-02 |
| GB1585403A (en) | 1981-03-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0105824B1 (en) | Polyisophthalates and copolymers thereof having high barrier properties | |
| US4499262A (en) | Process for the preparation of sulfo-modified polyesters | |
| JP3395972B2 (ja) | ポリエステル容器およびその製造法 | |
| US4426512A (en) | Polyester containers having improved gas barrier properties | |
| US5612423A (en) | Process for manufacturing polyester copolymers containing terephthalate and naphthalate units | |
| US4440922A (en) | Polyester containers having improved gas barrier properties | |
| US4574148A (en) | Polyester resins capable of forming containers having improved gas barrier properties | |
| US4552948A (en) | Polyester resins capable of forming containers having improved gas barrier properties | |
| US4418188A (en) | Polyethylene isophthalate having reduced cyclic dimer content and process therefore | |
| US4560741A (en) | Polyester resins capable of forming containers having improved gas barrier properties | |
| US4424242A (en) | Containers having improved gas barrier properties | |
| WO1995021881A1 (en) | A process for preparing copolyesters | |
| JPS5964625A (ja) | 環状ダイマ−含有量の少ないポリイソフタレ−ト及びそのコポリマ−とそれらの製法 | |
| US4110315A (en) | Molded container of polyester prepared from a bis(hydroxyethoxyphenyl)sulfone | |
| JPS6149190B2 (cg-RX-API-DMAC10.html) | ||
| US5989665A (en) | Copolyesters of 1,3-propanediol having improved gas barrier properties | |
| US5895807A (en) | Process for manufacturing polyester copolymers | |
| US4436895A (en) | Polyester containers having improved gas barrier properties | |
| US4663426A (en) | Polyester resins capable of forming containers having improved gas barrier properties | |
| GB2228940A (en) | Polyesters | |
| US4098769A (en) | Linear copolyesters | |
| US4073949A (en) | Terephthalic acid/P,P-sulfonyldibenzoic acid/ethylene glycol/neopentyl glycol polyester compositions and containers made therefrom | |
| US4049631A (en) | Isophthalic acid/p,p-sulfonyldibenzoic acid/ethylene glycol/neopentyl glycol polyester compositions and containers made therefrom | |
| US4546170A (en) | Polyester resins useful for forming containers having improved gas barrier properties | |
| US5942596A (en) | Process for the production of clear copolyesters of terephthalic acid, napthalenedicarboxylic acid and ethylene glycol |