JPS6024770B2 - キシレンの接触異性化方法 - Google Patents
キシレンの接触異性化方法Info
- Publication number
- JPS6024770B2 JPS6024770B2 JP53054135A JP5413578A JPS6024770B2 JP S6024770 B2 JPS6024770 B2 JP S6024770B2 JP 53054135 A JP53054135 A JP 53054135A JP 5413578 A JP5413578 A JP 5413578A JP S6024770 B2 JPS6024770 B2 JP S6024770B2
- Authority
- JP
- Japan
- Prior art keywords
- zeolite
- platinum
- hydrogen
- xylene
- zsm
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 52
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 title claims description 40
- 239000008096 xylene Substances 0.000 title claims description 30
- 238000006317 isomerization reaction Methods 0.000 title claims description 25
- 230000003197 catalytic effect Effects 0.000 title claims description 8
- 239000010457 zeolite Substances 0.000 claims description 97
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 claims description 87
- 229910021536 Zeolite Inorganic materials 0.000 claims description 72
- 239000003054 catalyst Substances 0.000 claims description 70
- 239000000203 mixture Substances 0.000 claims description 48
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 claims description 37
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims description 37
- 229910052751 metal Inorganic materials 0.000 claims description 30
- 239000002184 metal Substances 0.000 claims description 30
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 27
- 239000001257 hydrogen Substances 0.000 claims description 27
- 229910052739 hydrogen Inorganic materials 0.000 claims description 27
- 230000008569 process Effects 0.000 claims description 23
- 238000006243 chemical reaction Methods 0.000 claims description 22
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 21
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 21
- 150000001768 cations Chemical class 0.000 claims description 21
- -1 nitrogen-containing cation Chemical group 0.000 claims description 20
- 229910052697 platinum Inorganic materials 0.000 claims description 17
- 229910000323 aluminium silicate Inorganic materials 0.000 claims description 13
- 150000002739 metals Chemical class 0.000 claims description 13
- 229930195733 hydrocarbon Natural products 0.000 claims description 12
- 150000002430 hydrocarbons Chemical class 0.000 claims description 12
- 230000000737 periodic effect Effects 0.000 claims description 12
- 239000000377 silicon dioxide Substances 0.000 claims description 12
- 239000004215 Carbon black (E152) Substances 0.000 claims description 10
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 10
- 239000011230 binding agent Substances 0.000 claims description 10
- 229910052759 nickel Inorganic materials 0.000 claims description 10
- 239000002994 raw material Substances 0.000 claims description 10
- 239000003085 diluting agent Substances 0.000 claims description 9
- 229910017052 cobalt Inorganic materials 0.000 claims description 6
- 239000010941 cobalt Substances 0.000 claims description 6
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 6
- 239000002243 precursor Substances 0.000 claims description 6
- 239000012808 vapor phase Substances 0.000 claims description 6
- 150000002431 hydrogen Chemical class 0.000 claims description 5
- 229910052742 iron Inorganic materials 0.000 claims description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 4
- 239000000126 substance Substances 0.000 claims description 3
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 claims description 2
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 2
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 claims description 2
- 229910052796 boron Inorganic materials 0.000 claims description 2
- 229910052804 chromium Inorganic materials 0.000 claims description 2
- 239000011651 chromium Substances 0.000 claims description 2
- 229910052738 indium Inorganic materials 0.000 claims description 2
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 claims description 2
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 claims description 2
- 229910052753 mercury Inorganic materials 0.000 claims description 2
- 229910052763 palladium Inorganic materials 0.000 claims description 2
- 229910052707 ruthenium Inorganic materials 0.000 claims description 2
- 229910052709 silver Inorganic materials 0.000 claims description 2
- 239000004332 silver Substances 0.000 claims description 2
- 229910052714 tellurium Inorganic materials 0.000 claims description 2
- PORWMNRCUJJQNO-UHFFFAOYSA-N tellurium atom Chemical compound [Te] PORWMNRCUJJQNO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052720 vanadium Inorganic materials 0.000 claims description 2
- 229910021472 group 8 element Inorganic materials 0.000 claims 2
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 claims 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 claims 1
- 229910052750 molybdenum Inorganic materials 0.000 claims 1
- 239000011733 molybdenum Substances 0.000 claims 1
- 229910052761 rare earth metal Inorganic materials 0.000 claims 1
- 150000002910 rare earth metals Chemical class 0.000 claims 1
- LEONUFNNVUYDNQ-UHFFFAOYSA-N vanadium atom Chemical compound [V] LEONUFNNVUYDNQ-UHFFFAOYSA-N 0.000 claims 1
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 33
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 21
- 239000000047 product Substances 0.000 description 19
- 239000013078 crystal Substances 0.000 description 18
- 239000011148 porous material Substances 0.000 description 12
- IVSZLXZYQVIEFR-UHFFFAOYSA-N m-xylene Chemical group CC1=CC=CC(C)=C1 IVSZLXZYQVIEFR-UHFFFAOYSA-N 0.000 description 10
- URLKBWYHVLBVBO-UHFFFAOYSA-N Para-Xylene Chemical group CC1=CC=C(C)C=C1 URLKBWYHVLBVBO-UHFFFAOYSA-N 0.000 description 9
- 239000002253 acid Substances 0.000 description 9
- 150000002500 ions Chemical class 0.000 description 9
- 229910052783 alkali metal Inorganic materials 0.000 description 7
- 125000003118 aryl group Chemical group 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- KVNYFPKFSJIPBJ-UHFFFAOYSA-N 1,2-diethylbenzene Chemical compound CCC1=CC=CC=C1CC KVNYFPKFSJIPBJ-UHFFFAOYSA-N 0.000 description 6
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 125000000217 alkyl group Chemical group 0.000 description 6
- 238000007323 disproportionation reaction Methods 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- 239000012188 paraffin wax Substances 0.000 description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 5
- 229910052782 aluminium Inorganic materials 0.000 description 5
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 5
- 239000000571 coke Substances 0.000 description 5
- 229940078552 o-xylene Drugs 0.000 description 5
- 125000001477 organic nitrogen group Chemical group 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 4
- 150000004820 halides Chemical class 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 3
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 3
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical group [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 3
- 238000004458 analytical method Methods 0.000 description 3
- 125000000129 anionic group Chemical group 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 238000000605 extraction Methods 0.000 description 3
- 239000012634 fragment Substances 0.000 description 3
- 239000001307 helium Substances 0.000 description 3
- 229910052734 helium Inorganic materials 0.000 description 3
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium atom Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 description 3
- 238000005342 ion exchange Methods 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 125000004430 oxygen atom Chemical group O* 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 229910052710 silicon Inorganic materials 0.000 description 3
- 239000010703 silicon Substances 0.000 description 3
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 2
- CPLXHLVBOLITMK-UHFFFAOYSA-N Magnesium oxide Chemical compound [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 2
- PQBAWAQIRZIWIV-UHFFFAOYSA-N N-methylpyridinium Chemical class C[N+]1=CC=CC=C1 PQBAWAQIRZIWIV-UHFFFAOYSA-N 0.000 description 2
- 239000004115 Sodium Silicate Substances 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- MCMNRKCIXSYSNV-UHFFFAOYSA-N Zirconium dioxide Chemical compound O=[Zr]=O MCMNRKCIXSYSNV-UHFFFAOYSA-N 0.000 description 2
- 230000004913 activation Effects 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 150000003863 ammonium salts Chemical class 0.000 description 2
- QVYARBLCAHCSFJ-UHFFFAOYSA-N butane-1,1-diamine Chemical compound CCCC(N)N QVYARBLCAHCSFJ-UHFFFAOYSA-N 0.000 description 2
- 238000001354 calcination Methods 0.000 description 2
- 239000004927 clay Substances 0.000 description 2
- 238000005336 cracking Methods 0.000 description 2
- 230000020335 dealkylation Effects 0.000 description 2
- 238000006900 dealkylation reaction Methods 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- 108010023700 galanin-(1-13)-bradykinin-(2-9)-amide Proteins 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 150000004679 hydroxides Chemical class 0.000 description 2
- 229910052809 inorganic oxide Inorganic materials 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 150000002823 nitrates Chemical class 0.000 description 2
- 230000008707 rearrangement Effects 0.000 description 2
- 230000008929 regeneration Effects 0.000 description 2
- 238000011069 regeneration method Methods 0.000 description 2
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 2
- 229910052911 sodium silicate Inorganic materials 0.000 description 2
- 239000002689 soil Substances 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical class [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 206010011224 Cough Diseases 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 235000008331 Pinus X rigitaeda Nutrition 0.000 description 1
- 235000011613 Pinus brutia Nutrition 0.000 description 1
- 241000018646 Pinus brutia Species 0.000 description 1
- 241001648319 Toronia toru Species 0.000 description 1
- 241000209140 Triticum Species 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- 238000002441 X-ray diffraction Methods 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 230000003679 aging effect Effects 0.000 description 1
- 229910001413 alkali metal ion Inorganic materials 0.000 description 1
- 150000004996 alkyl benzenes Chemical class 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- JYIBXUUINYLWLR-UHFFFAOYSA-N aluminum;calcium;potassium;silicon;sodium;trihydrate Chemical compound O.O.O.[Na].[Al].[Si].[K].[Ca] JYIBXUUINYLWLR-UHFFFAOYSA-N 0.000 description 1
- ANBBXQWFNXMHLD-UHFFFAOYSA-N aluminum;sodium;oxygen(2-) Chemical compound [O-2].[O-2].[Na+].[Al+3] ANBBXQWFNXMHLD-UHFFFAOYSA-N 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- SYWDWCWQXBUCOP-UHFFFAOYSA-N benzene;ethene Chemical compound C=C.C1=CC=CC=C1 SYWDWCWQXBUCOP-UHFFFAOYSA-N 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 229910001603 clinoptilolite Inorganic materials 0.000 description 1
- 238000002485 combustion reaction Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000010304 firing Methods 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000007863 gel particle Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000002638 heterogeneous catalyst Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 230000000968 intestinal effect Effects 0.000 description 1
- 150000004694 iodide salts Chemical class 0.000 description 1
- 238000010409 ironing Methods 0.000 description 1
- 230000002427 irreversible effect Effects 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 229910021645 metal ion Inorganic materials 0.000 description 1
- 239000008267 milk Substances 0.000 description 1
- 210000004080 milk Anatomy 0.000 description 1
- 235000013336 milk Nutrition 0.000 description 1
- 150000002892 organic cations Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 230000002085 persistent effect Effects 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 230000036619 pore blockages Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000000634 powder X-ray diffraction Methods 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 150000003141 primary amines Chemical group 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 239000005060 rubber Substances 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 238000002791 soaking Methods 0.000 description 1
- 229910001388 sodium aluminate Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 238000010025 steaming Methods 0.000 description 1
- 229910052678 stilbite Inorganic materials 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- PUGUQINMNYINPK-UHFFFAOYSA-N tert-butyl 4-(2-chloroacetyl)piperazine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCN(C(=O)CCl)CC1 PUGUQINMNYINPK-UHFFFAOYSA-N 0.000 description 1
- OSBSFAARYOCBHB-UHFFFAOYSA-N tetrapropylammonium Chemical class CCC[N+](CCC)(CCC)CCC OSBSFAARYOCBHB-UHFFFAOYSA-N 0.000 description 1
- LPSKDVINWQNWFE-UHFFFAOYSA-M tetrapropylazanium;hydroxide Chemical compound [OH-].CCC[N+](CCC)(CCC)CCC LPSKDVINWQNWFE-UHFFFAOYSA-M 0.000 description 1
- ZCUFMDLYAMJYST-UHFFFAOYSA-N thorium dioxide Chemical compound O=[Th]=O ZCUFMDLYAMJYST-UHFFFAOYSA-N 0.000 description 1
- 238000010555 transalkylation reaction Methods 0.000 description 1
- LEMQFBIYMVUIIG-UHFFFAOYSA-N trifluoroborane;hydrofluoride Chemical compound F.FB(F)F LEMQFBIYMVUIIG-UHFFFAOYSA-N 0.000 description 1
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C5/00—Preparation of hydrocarbons from hydrocarbons containing the same number of carbon atoms
- C07C5/22—Preparation of hydrocarbons from hydrocarbons containing the same number of carbon atoms by isomerisation
- C07C5/27—Rearrangement of carbon atoms in the hydrocarbon skeleton
- C07C5/2729—Changing the branching point of an open chain or the point of substitution on a ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C5/00—Preparation of hydrocarbons from hydrocarbons containing the same number of carbon atoms
- C07C5/22—Preparation of hydrocarbons from hydrocarbons containing the same number of carbon atoms by isomerisation
- C07C5/27—Rearrangement of carbon atoms in the hydrocarbon skeleton
- C07C5/2729—Changing the branching point of an open chain or the point of substitution on a ring
- C07C5/2732—Catalytic processes
- C07C5/2737—Catalytic processes with crystalline alumino-silicates, e.g. molecular sieves
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/52—Improvements relating to the production of bulk chemicals using catalysts, e.g. selective catalysts
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Crystallography & Structural Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Catalysts (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US79504677A | 1977-05-09 | 1977-05-09 | |
| US795046 | 1977-05-09 | ||
| US872971 | 1978-02-28 | ||
| US05/872,971 US4152363A (en) | 1977-05-09 | 1978-02-28 | Vapor phase isomerization of methyl-substituted aromatic hydrocarbons improved by using highly diluted zeolite catalyst |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5416432A JPS5416432A (en) | 1979-02-07 |
| JPS6024770B2 true JPS6024770B2 (ja) | 1985-06-14 |
Family
ID=27121580
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP53054135A Expired JPS6024770B2 (ja) | 1977-05-09 | 1978-05-09 | キシレンの接触異性化方法 |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4152363A (OSRAM) |
| JP (1) | JPS6024770B2 (OSRAM) |
| BE (1) | BE865880A (OSRAM) |
| CA (1) | CA1098919A (OSRAM) |
| DD (1) | DD136830A5 (OSRAM) |
| DE (1) | DE2819304A1 (OSRAM) |
| ES (1) | ES469548A1 (OSRAM) |
| FR (1) | FR2390410A1 (OSRAM) |
| GB (1) | GB1582823A (OSRAM) |
| IT (1) | IT1109543B (OSRAM) |
| NL (1) | NL7804960A (OSRAM) |
| RO (1) | RO81334A (OSRAM) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4218573A (en) * | 1978-06-12 | 1980-08-19 | Mobil Oil Corporation | Xylene isomerization |
| JPS55129232A (en) * | 1979-03-29 | 1980-10-06 | Teijin Yuka Kk | Isomerization of xylenes |
| US4312790A (en) * | 1980-04-14 | 1982-01-26 | Mobil Oil Corporation | Aromatics processing catalysts |
| JPS5732735A (en) * | 1980-08-04 | 1982-02-22 | Teijin Yuka Kk | Regenerating method for catalyst |
| EP0065364B1 (en) * | 1981-05-20 | 1984-12-27 | Imperial Chemical Industries Plc | Process for the isomerization of alkylbenzenes |
| JPS5877828A (ja) * | 1981-11-02 | 1983-05-11 | Toray Ind Inc | エチルベンゼンを含むキシレン類の変換方法 |
| CA1227809A (en) * | 1983-10-17 | 1987-10-06 | Nancy A. Kutz | Modification of hydrocarbon conversion processes over crystalline aluminosilicate zeolite-based catalysts by incorporation of a molybdenum compound |
| US4873387A (en) * | 1987-10-13 | 1989-10-10 | Uop | Process for the isomerization of aromatics |
| US5043512A (en) * | 1988-10-06 | 1991-08-27 | Mobil Oil Corp. | Alkylaromatic isomerization process |
| US4899012A (en) * | 1988-10-17 | 1990-02-06 | Uop | Catalyst for the isomerization of aromatics |
| US5030787A (en) * | 1990-01-24 | 1991-07-09 | Mobil Oil Corp. | Catalytic disproportionation/transalkylation utilizing a C9+ aromatics feed |
| US6051744A (en) * | 1998-12-17 | 2000-04-18 | Chevron Chemical Company Llc | Low pressure hydrodealkylation of ethylbenzene and xylene isomerization |
| ITMI20030346A1 (it) * | 2003-02-27 | 2004-08-28 | Enitecnologie Spa | Procedimento per la produzione di mesitilene. |
| US6872866B1 (en) * | 2003-12-15 | 2005-03-29 | Uop Llc | Liquid phase process for C8 alkylaromatic isomerization |
| WO2010000652A1 (en) * | 2008-07-04 | 2010-01-07 | Shell Internationale Research Maatschappij B.V. | Catalyst and isomerisation process |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3702886A (en) * | 1969-10-10 | 1972-11-14 | Mobil Oil Corp | Crystalline zeolite zsm-5 and method of preparing the same |
| US3832449A (en) * | 1971-03-18 | 1974-08-27 | Mobil Oil Corp | Crystalline zeolite zsm{14 12 |
| US3856873A (en) * | 1973-09-13 | 1974-12-24 | Mobil Oil Corp | Xylene isomerization |
| JPS5341658B2 (OSRAM) * | 1973-09-13 | 1978-11-06 | ||
| US3856872A (en) * | 1973-09-13 | 1974-12-24 | Mobil Oil Corp | Xylene isomerization |
| US3887630A (en) * | 1974-02-04 | 1975-06-03 | Union Oil Co | Isomerization of alkyl aromatic hydrocarbons |
| NL7610766A (nl) * | 1975-10-03 | 1977-04-05 | Ici Ltd | Werkwijze ter bereiding van zeolieten. |
| US4100214A (en) * | 1976-05-07 | 1978-07-11 | Mobil Oil Corporation | Isomerization of monocyclic alkyl aromatic hydrocarbons |
| US4101596A (en) * | 1977-01-10 | 1978-07-18 | Mobil Oil Company | Low pressure xylene isomerization |
-
1978
- 1978-02-28 US US05/872,971 patent/US4152363A/en not_active Expired - Lifetime
- 1978-03-22 CA CA299,547A patent/CA1098919A/en not_active Expired
- 1978-04-11 BE BE186715A patent/BE865880A/xx not_active IP Right Cessation
- 1978-04-19 FR FR7811483A patent/FR2390410A1/fr active Granted
- 1978-05-02 DE DE19782819304 patent/DE2819304A1/de active Granted
- 1978-05-03 GB GB17485/78A patent/GB1582823A/en not_active Expired
- 1978-05-03 RO RO7893953A patent/RO81334A/ro unknown
- 1978-05-05 DD DD78205220A patent/DD136830A5/xx unknown
- 1978-05-08 ES ES469548A patent/ES469548A1/es not_active Expired
- 1978-05-08 IT IT23130/78A patent/IT1109543B/it active
- 1978-05-09 NL NL7804960A patent/NL7804960A/xx not_active Application Discontinuation
- 1978-05-09 JP JP53054135A patent/JPS6024770B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE2819304C2 (OSRAM) | 1989-06-22 |
| GB1582823A (en) | 1981-01-14 |
| CA1098919A (en) | 1981-04-07 |
| IT1109543B (it) | 1985-12-16 |
| BE865880A (fr) | 1978-10-11 |
| NL7804960A (nl) | 1978-11-13 |
| US4152363A (en) | 1979-05-01 |
| ES469548A1 (es) | 1980-01-01 |
| IT7823130A0 (it) | 1978-05-08 |
| FR2390410A1 (fr) | 1978-12-08 |
| JPS5416432A (en) | 1979-02-07 |
| RO81334A (ro) | 1983-08-03 |
| DD136830A5 (de) | 1979-08-01 |
| FR2390410B1 (OSRAM) | 1982-03-05 |
| DE2819304A1 (de) | 1978-11-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0234684B1 (en) | Xylene isomerization process | |
| US4312790A (en) | Aromatics processing catalysts | |
| US4094921A (en) | Selective ethylation of mono alkyl benzenes | |
| US4324940A (en) | Shape selective acid catalyzed reactions of olefins over crystalline zeolites | |
| USRE31919E (en) | Aromatics processing catalysts | |
| US4477583A (en) | Silica-modified catalyst and use for selective production of para-dialkyl substituted benzenes | |
| US4113788A (en) | Selective production of para-xylene | |
| US4465886A (en) | Silica-modified catalyst and use for selective production of para-dialkyl substituted benzenes | |
| RU2491268C2 (ru) | Способ трансалкилирования | |
| RU2514423C1 (ru) | Способ изомеризации ксилола и этилбензола с использовнием uzm-35 | |
| JPH11501286A (ja) | ゼオライト結合ゼオライト触媒を用いる炭化水素転化プロセス | |
| JPH0567613B1 (OSRAM) | ||
| EP3484619B1 (en) | Catalyst composition comprising con-type zeolite and zsm-5-type zeolite, preparation and process using such composition | |
| JPS6024770B2 (ja) | キシレンの接触異性化方法 | |
| CN101208282A (zh) | 选择性芳烃异构化方法 | |
| US4385195A (en) | Aromatics processing | |
| JPS6132294B2 (OSRAM) | ||
| CS207496B1 (en) | method of isomerization of the xylene | |
| US5254770A (en) | Isomerization of aromatic compounds over ZSM-22 zeolite | |
| CN108349836B (zh) | 用于二甲苯异构化方法中乙基苯转化的改进催化剂 | |
| US5082984A (en) | Dual function catalyst and isomerization therewith | |
| JPS60222428A (ja) | 炭化水素の接触転化法 | |
| JPS6361301B2 (OSRAM) | ||
| EP0021600B1 (en) | Selective alkylation of xylenes with ethylene | |
| WO1999032421A1 (en) | Meta-xylene production process |