JPS5936906B2 - アクリロニトリルの二量化法 - Google Patents
アクリロニトリルの二量化法Info
- Publication number
- JPS5936906B2 JPS5936906B2 JP51131590A JP13159076A JPS5936906B2 JP S5936906 B2 JPS5936906 B2 JP S5936906B2 JP 51131590 A JP51131590 A JP 51131590A JP 13159076 A JP13159076 A JP 13159076A JP S5936906 B2 JPS5936906 B2 JP S5936906B2
- Authority
- JP
- Japan
- Prior art keywords
- acrylonitrile
- solvent
- group
- phosphorus
- compound
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 title claims description 52
- 238000000034 method Methods 0.000 title claims description 32
- 238000006471 dimerization reaction Methods 0.000 title description 6
- 239000000539 dimer Substances 0.000 claims description 30
- 239000002904 solvent Substances 0.000 claims description 26
- -1 phosphorus (III) compound Chemical class 0.000 claims description 22
- 229910052698 phosphorus Inorganic materials 0.000 claims description 16
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 16
- 239000006184 cosolvent Substances 0.000 claims description 15
- 239000011574 phosphorus Substances 0.000 claims description 14
- 150000001875 compounds Chemical class 0.000 claims description 13
- 125000003545 alkoxy group Chemical group 0.000 claims description 11
- 239000011541 reaction mixture Substances 0.000 claims description 9
- 125000000000 cycloalkoxy group Chemical group 0.000 claims description 7
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical class P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 claims description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- 125000003118 aryl group Chemical group 0.000 claims description 4
- RVDJLKVICMLVJQ-UHFFFAOYSA-N diethoxy(phenyl)phosphane Chemical compound CCOP(OCC)C1=CC=CC=C1 RVDJLKVICMLVJQ-UHFFFAOYSA-N 0.000 claims description 4
- 230000000447 dimerizing effect Effects 0.000 claims description 4
- 229930195733 hydrocarbon Natural products 0.000 claims description 4
- 239000004215 Carbon black (E152) Substances 0.000 claims description 3
- 239000003960 organic solvent Substances 0.000 claims description 3
- 125000004437 phosphorous atom Chemical group 0.000 claims description 3
- 239000000126 substance Substances 0.000 claims description 3
- 235000010290 biphenyl Nutrition 0.000 claims description 2
- 239000004305 biphenyl Substances 0.000 claims description 2
- OBMCRSLOEKFORE-UHFFFAOYSA-N bis(2,2-dimethylpropoxy)-phenylphosphane Chemical compound CC(C)(C)COP(OCC(C)(C)C)C1=CC=CC=C1 OBMCRSLOEKFORE-UHFFFAOYSA-N 0.000 claims description 2
- QCASTONPZLJEOJ-UHFFFAOYSA-N diphenyl(propan-2-yloxy)phosphane Chemical compound C=1C=CC=CC=1P(OC(C)C)C1=CC=CC=C1 QCASTONPZLJEOJ-UHFFFAOYSA-N 0.000 claims description 2
- JCRCPEDXAHDCAJ-UHFFFAOYSA-N ethoxy(diphenyl)phosphane Chemical compound C=1C=CC=CC=1P(OCC)C1=CC=CC=C1 JCRCPEDXAHDCAJ-UHFFFAOYSA-N 0.000 claims description 2
- WCPDBZHGOICZCF-UHFFFAOYSA-N phenyl-bis(3,5,5-trimethylhexoxy)phosphane Chemical compound CC(C)(C)CC(C)CCOP(OCCC(C)CC(C)(C)C)C1=CC=CC=C1 WCPDBZHGOICZCF-UHFFFAOYSA-N 0.000 claims description 2
- LDNCAOOMUMJYTN-UHFFFAOYSA-N phenyl-di(propan-2-yloxy)phosphane Chemical compound CC(C)OP(OC(C)C)C1=CC=CC=C1 LDNCAOOMUMJYTN-UHFFFAOYSA-N 0.000 claims description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 claims description 2
- 239000011877 solvent mixture Substances 0.000 claims description 2
- 125000001183 hydrocarbyl group Chemical group 0.000 claims 5
- VMUAFIWZWXGPGP-UHFFFAOYSA-N butoxy(diphenyl)phosphane Chemical group C=1C=CC=CC=1P(OCCCC)C1=CC=CC=C1 VMUAFIWZWXGPGP-UHFFFAOYSA-N 0.000 claims 1
- FXUAPBSLIPYXRF-UHFFFAOYSA-N cyclohexyloxy(diphenyl)phosphane Chemical group C1CCCCC1OP(C=1C=CC=CC=1)C1=CC=CC=C1 FXUAPBSLIPYXRF-UHFFFAOYSA-N 0.000 claims 1
- PAEBMRSIXNOSJC-UHFFFAOYSA-N di(octan-3-yloxy)-phenylphosphane Chemical compound CCCCCC(CC)OP(OC(CC)CCCCC)C1=CC=CC=C1 PAEBMRSIXNOSJC-UHFFFAOYSA-N 0.000 claims 1
- ZHKVJZORMSRATR-UHFFFAOYSA-N diphenyl(phenylmethoxy)phosphane Chemical group C=1C=CC=CC=1COP(C=1C=CC=CC=1)C1=CC=CC=C1 ZHKVJZORMSRATR-UHFFFAOYSA-N 0.000 claims 1
- OAADXJFIBNEPLY-UHFFFAOYSA-N methoxy(diphenyl)phosphane Chemical compound C=1C=CC=CC=1P(OC)C1=CC=CC=C1 OAADXJFIBNEPLY-UHFFFAOYSA-N 0.000 claims 1
- QHLNHNLXXBRSIW-UHFFFAOYSA-N octan-2-yloxy(diphenyl)phosphane Chemical compound C=1C=CC=CC=1P(OC(C)CCCCCC)C1=CC=CC=C1 QHLNHNLXXBRSIW-UHFFFAOYSA-N 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 description 36
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 33
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 32
- 239000003054 catalyst Substances 0.000 description 31
- 239000000047 product Substances 0.000 description 18
- 150000002430 hydrocarbons Chemical group 0.000 description 14
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 12
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 11
- 229920000642 polymer Polymers 0.000 description 11
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 10
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- 239000000203 mixture Substances 0.000 description 7
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 6
- 238000004458 analytical method Methods 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- 239000011550 stock solution Substances 0.000 description 6
- CSDQQAQKBAQLLE-UHFFFAOYSA-N 4-(4-chlorophenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine Chemical compound C1=CC(Cl)=CC=C1C1C(C=CS2)=C2CCN1 CSDQQAQKBAQLLE-UHFFFAOYSA-N 0.000 description 5
- BTANRVKWQNVYAZ-UHFFFAOYSA-N butan-2-ol Chemical compound CCC(C)O BTANRVKWQNVYAZ-UHFFFAOYSA-N 0.000 description 5
- 239000007862 dimeric product Substances 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 238000004811 liquid chromatography Methods 0.000 description 4
- 239000002808 molecular sieve Substances 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 4
- 239000003381 stabilizer Substances 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 230000003197 catalytic effect Effects 0.000 description 3
- 150000003018 phosphorus compounds Chemical class 0.000 description 3
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 3
- 238000006116 polymerization reaction Methods 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- NGCJVMZXRCLPRQ-UHFFFAOYSA-N 2-methylidenepentanedinitrile Chemical compound N#CC(=C)CCC#N NGCJVMZXRCLPRQ-UHFFFAOYSA-N 0.000 description 2
- JKBPBRLDGFKIIA-UHFFFAOYSA-N 2-propylidenepropanedinitrile Chemical class CCC=C(C#N)C#N JKBPBRLDGFKIIA-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- LMZLQYYLELWCCW-UHFFFAOYSA-N dimethoxy(phenyl)phosphane Chemical compound COP(OC)C1=CC=CC=C1 LMZLQYYLELWCCW-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- NWVVVBRKAWDGAB-UHFFFAOYSA-N p-methoxyphenol Chemical compound COC1=CC=C(O)C=C1 NWVVVBRKAWDGAB-UHFFFAOYSA-N 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- 239000003039 volatile agent Substances 0.000 description 2
- ZQOHAQBXINVHHC-HNQUOIGGSA-N (e)-hex-2-enedinitrile Chemical compound N#CCC\C=C\C#N ZQOHAQBXINVHHC-HNQUOIGGSA-N 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241001494479 Pecora Species 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 229920000265 Polyparaphenylene Polymers 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 150000008360 acrylonitriles Chemical class 0.000 description 1
- 238000007259 addition reaction Methods 0.000 description 1
- BTGRAWJCKBQKAO-UHFFFAOYSA-N adiponitrile Chemical compound N#CCCCCC#N BTGRAWJCKBQKAO-UHFFFAOYSA-N 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 125000005530 alkylenedioxy group Chemical group 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- CWXCZFMPFNRSGF-UHFFFAOYSA-N bis(2-ethylhexoxy)-phenylphosphane Chemical compound CCCCC(CC)COP(OCC(CC)CCCC)C1=CC=CC=C1 CWXCZFMPFNRSGF-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- AXSDOTRVGWLWBB-UHFFFAOYSA-N diethoxy-(4-methylphenyl)phosphane Chemical compound CCOP(OCC)C1=CC=C(C)C=C1 AXSDOTRVGWLWBB-UHFFFAOYSA-N 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- GMICQNPZUMNLKM-UHFFFAOYSA-N dimethoxy-(4-methylphenyl)phosphane Chemical compound COP(OC)C1=CC=C(C)C=C1 GMICQNPZUMNLKM-UHFFFAOYSA-N 0.000 description 1
- POLCUAVZOMRGSN-UHFFFAOYSA-N dipropyl ether Chemical compound CCCOCCC POLCUAVZOMRGSN-UHFFFAOYSA-N 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 150000008423 fluorobenzenes Chemical class 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 238000001030 gas--liquid chromatography Methods 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 239000002638 heterogeneous catalyst Substances 0.000 description 1
- ZQOHAQBXINVHHC-UHFFFAOYSA-N hex-2-enedinitrile Chemical class N#CCCC=CC#N ZQOHAQBXINVHHC-UHFFFAOYSA-N 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 150000002440 hydroxy compounds Chemical class 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- NNPPMTNAJDCUHE-UHFFFAOYSA-N isobutane Chemical compound CC(C)C NNPPMTNAJDCUHE-UHFFFAOYSA-N 0.000 description 1
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 239000012263 liquid product Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- GPKUICFDWYEPTK-UHFFFAOYSA-N methoxycyclohexatriene Chemical group COC1=CC=C=C[CH]1 GPKUICFDWYEPTK-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000012046 mixed solvent Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000002903 organophosphorus compounds Chemical class 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 1
- 150000008301 phosphite esters Chemical class 0.000 description 1
- XRBCRPZXSCBRTK-UHFFFAOYSA-N phosphonous acid Chemical class OPO XRBCRPZXSCBRTK-UHFFFAOYSA-N 0.000 description 1
- 150000003017 phosphorus Chemical class 0.000 description 1
- 229920001281 polyalkylene Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000003333 secondary alcohols Chemical class 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 238000000638 solvent extraction Methods 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 125000003107 substituted aryl group Chemical group 0.000 description 1
- 150000003509 tertiary alcohols Chemical class 0.000 description 1
- FQDIANVAWVHZIR-OWOJBTEDSA-N trans-1,4-Dichlorobutene Chemical compound ClC\C=C\CCl FQDIANVAWVHZIR-OWOJBTEDSA-N 0.000 description 1
- IFXORIIYQORRMJ-UHFFFAOYSA-N tribenzylphosphane Chemical compound C=1C=CC=CC=1CP(CC=1C=CC=CC=1)CC1=CC=CC=C1 IFXORIIYQORRMJ-UHFFFAOYSA-N 0.000 description 1
- VOITXYVAKOUIBA-UHFFFAOYSA-N triethylaluminium Chemical compound CC[Al](CC)CC VOITXYVAKOUIBA-UHFFFAOYSA-N 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J31/00—Catalysts comprising hydrides, coordination complexes or organic compounds
- B01J31/02—Catalysts comprising hydrides, coordination complexes or organic compounds containing organic compounds or metal hydrides
- B01J31/0234—Nitrogen-, phosphorus-, arsenic- or antimony-containing compounds
- B01J31/0255—Phosphorus containing compounds
- B01J31/0257—Phosphorus acids or phosphorus acid esters
- B01J31/0261—Phosphorus acids or phosphorus acid esters comprising phosphonous acid (-ester) groups (RP(OR')2) or the isomeric phosphinic acid (-ester) groups (R2(R'O)P=O), i.e. R= C, R'= C, H
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J31/00—Catalysts comprising hydrides, coordination complexes or organic compounds
- B01J31/02—Catalysts comprising hydrides, coordination complexes or organic compounds containing organic compounds or metal hydrides
- B01J31/0234—Nitrogen-, phosphorus-, arsenic- or antimony-containing compounds
- B01J31/0255—Phosphorus containing compounds
- B01J31/0257—Phosphorus acids or phosphorus acid esters
- B01J31/0262—Phosphorus acids or phosphorus acid esters comprising phosphinous acid (-ester) groups (R2P(OR')) or the isomeric phosphine oxide groups (R3P=O), i.e. R= C, R'= C, H
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB4532475A GB1546807A (en) | 1975-10-31 | 1975-10-31 | Dimerisation of acrylonitrile |
| GB5288875 | 1975-12-24 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5257122A JPS5257122A (en) | 1977-05-11 |
| JPS5936906B2 true JPS5936906B2 (ja) | 1984-09-06 |
Family
ID=26265562
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP51131590A Expired JPS5936906B2 (ja) | 1975-10-31 | 1976-11-01 | アクリロニトリルの二量化法 |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4126632A (en, 2012) |
| JP (1) | JPS5936906B2 (en, 2012) |
| AU (1) | AU499165B2 (en, 2012) |
| DE (1) | DE2649904A1 (en, 2012) |
| FR (1) | FR2329648A1 (en, 2012) |
| IT (2) | IT1075872B (en, 2012) |
| NL (1) | NL7612042A (en, 2012) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1547431A (en) * | 1976-05-10 | 1979-06-20 | Ici Ltd | Dimerisation of acrylonitrile |
| GB1514642A (en) * | 1976-05-24 | 1978-06-21 | Ici Ltd | Dimerisation of acrylonitrile |
| US4138428A (en) * | 1976-10-21 | 1979-02-06 | Imperial Chemical Industries Limited | Dimerization process |
| GB1547432A (en) * | 1976-11-24 | 1979-06-20 | Ici Ltd | Process for the dimerisation of acrylonitrile |
| US4263224A (en) * | 1978-07-26 | 1981-04-21 | Imperial Chemical Industries Limited | Acrylonitrile dimerization process |
| DE2965244D1 (en) * | 1978-07-26 | 1983-05-26 | Ici Plc | Phosphinites and phosphonites, their preparation and use as acrylonitrile dimerisation catalysts |
| DE2964157D1 (en) * | 1978-10-26 | 1983-01-05 | Ici Plc | A process for the dimerisation of acrylonitrile |
| US4661615A (en) * | 1982-11-03 | 1987-04-28 | Allied Corporation | Selective conversion of acrylonitrile into 1,4-dicyano-1-butene catalyzed by plymer-bound alkyl diarylphosphinites |
| US4574060A (en) * | 1982-11-03 | 1986-03-04 | Allied Corporation | Selective conversion of acrylonitrile into 1,4-dicyano-1-butene catalyzed by polymer-bound alkyl diarylphosphinites |
| US4639539A (en) * | 1984-12-24 | 1987-01-27 | Monsanto Company | Dimerization process improvements |
| US4841087A (en) * | 1987-04-17 | 1989-06-20 | Monsanto Company | Acrylonitrile dimerization process |
| DE68900645D1 (de) * | 1988-11-11 | 1992-02-13 | Shell Int Research | Katalytische zusammenstellungen. |
| US4952541A (en) * | 1989-09-01 | 1990-08-28 | Monsanto Company | Acrylonitrile dimerization process and method of treating residual catalyst |
| KR102712847B1 (ko) | 2019-10-11 | 2024-09-30 | 주식회사 엘지화학 | 신규 구조의 유기인계 촉매 및 이를 이용한 선형 디니트릴의 제조방법 |
| KR102738501B1 (ko) * | 2019-11-11 | 2024-12-04 | 주식회사 엘지화학 | 아크릴로니트릴 이량체 제조 방법 |
| KR102625391B1 (ko) * | 2019-12-12 | 2024-01-15 | 주식회사 엘지화학 | 아크릴로니트릴 이량체 제조 방법 |
| JP7230239B2 (ja) * | 2020-01-13 | 2023-02-28 | エルジー・ケム・リミテッド | アクリロニトリル二量体の製造方法 |
| KR102803733B1 (ko) | 2020-10-28 | 2025-05-02 | 주식회사 엘지화학 | 아크릴로니트릴 이량체의 제조 방법 |
| CN112480169A (zh) * | 2020-12-07 | 2021-03-12 | 南雄志一精细化工有限公司 | 一种液体含磷化合物及其应用和制备方法 |
Family Cites Families (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1051821A (en) * | 1963-03-07 | 1966-12-21 | Badisch Anlin And Soda Fabrik Ag | Dimersing acrylonitrile |
| FR1366081A (fr) | 1963-05-24 | 1964-07-10 | Rhone Poulenc Sa | Dicyano-2, 4 butène-1 |
| FR1385883A (fr) | 1964-03-05 | 1965-01-15 | Basf Ag | Procédé pour la dimérisation d'acrylonitrile |
| US3574702A (en) * | 1965-03-02 | 1971-04-13 | Nat Distillers Chem Corp | Process for dimerizing acrylonitrile compounds |
| GB1128320A (en) | 1966-02-16 | 1968-09-25 | Ici Ltd | Catalytic dimerisation of unsaturated nitriles |
| GB1194841A (en) * | 1966-04-13 | 1970-06-10 | Ici Ltd | Process for the Dimerisation of Unsaturated Compounds |
| GB1194842A (en) * | 1966-04-13 | 1970-06-10 | Ici Ltd | Process for the Dimerisation of Unsaturated Compounds |
| FR1519376A (fr) | 1966-04-19 | 1968-03-29 | Du Pont | Procédé de dimérisation de l'acrylonitrile |
| GB1154275A (en) | 1966-04-19 | 1969-06-04 | Du Pont | Process for the Dimerization of Acrylonitrile |
| US3538141A (en) * | 1967-01-23 | 1970-11-03 | Halcon International Inc | Dimerization of acrylonitrile |
| GB1206272A (en) * | 1967-03-17 | 1970-09-23 | Sovex Ltd | Improvements relating to means for reading binary codes |
| NL166928C (nl) | 1967-11-01 | 1981-10-15 | Du Pont | Werkwijze voor het bereiden van organische cyaanverbin- dingen door katalytische additie van waterstofcyanide. |
| GB1351694A (en) | 1970-10-02 | 1974-05-01 | Du Pont | Catalytic isomerization of 2-methyl-3-butenenitrile to linear pentenenitriles |
| GB1510707A (en) * | 1975-05-09 | 1978-05-17 | Ici Ltd | Catalytic compositions |
-
1976
- 1976-10-27 AU AU19035/76A patent/AU499165B2/en not_active Expired
- 1976-10-28 US US05/736,498 patent/US4126632A/en not_active Expired - Lifetime
- 1976-10-29 NL NL7612042A patent/NL7612042A/xx not_active Application Discontinuation
- 1976-10-29 DE DE19762649904 patent/DE2649904A1/de active Granted
- 1976-10-29 FR FR7632929A patent/FR2329648A1/fr active Granted
- 1976-10-29 IT IT28902/76A patent/IT1075872B/it active
- 1976-11-01 JP JP51131590A patent/JPS5936906B2/ja not_active Expired
-
1977
- 1977-10-20 IT IT7728828A patent/IT1206383B/it active
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5257122A (en) | 1977-05-11 |
| IT1075872B (it) | 1985-04-22 |
| AU499165B2 (en) | 1979-04-05 |
| FR2329648B1 (en, 2012) | 1981-02-13 |
| DE2649904A1 (de) | 1977-05-12 |
| DE2649904C2 (en, 2012) | 1988-01-07 |
| IT1206383B (it) | 1989-04-21 |
| US4126632A (en) | 1978-11-21 |
| FR2329648A1 (fr) | 1977-05-27 |
| NL7612042A (nl) | 1977-05-03 |
| AU1903576A (en) | 1978-05-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS5936906B2 (ja) | アクリロニトリルの二量化法 | |
| KR20150111295A (ko) | 에틸렌을 1-헥센으로 올리고머화하기 위한 신규 촉매 조성물 및 방법 | |
| US5252766A (en) | Method for producing polysilanes | |
| US10131608B2 (en) | Hydroformylation process | |
| JP2012525357A5 (en, 2012) | ||
| US5100854A (en) | Phosphonium salts and processes for production of and uses for the same | |
| RU2463293C2 (ru) | Способ получения соединений, содержащих нитрильные функциональные группы | |
| KR20160078961A (ko) | 알킬알루미늄과 알릴 알코올의 반응에 의한 알루미녹산의 제조 방법 | |
| US4102915A (en) | Dimerization process | |
| US4138428A (en) | Dimerization process | |
| US4059542A (en) | Organo-phosphorous catalyst composition and process for making the same | |
| CA1199338A (en) | Polymer-bound alkyl diarylphosphinite catalyst compositions and processes for making same and using same for selective conversion of acrylonitrile into 1,4-dicyano-1-butene | |
| EP0008164B1 (en) | Phosphinites and phosphonites, their preparation and use as acrylonitrile dimerisation catalysts | |
| US4089890A (en) | Process for the dimerization of acrylonitrile | |
| US3462406A (en) | Process for the polymerization of butadiene to polybutadiene having substantially 1,4 cis structure | |
| US4581178A (en) | Addition of aldehydes to organic compounds having a carbon-hydrogen bond activated by a nitro or nitrile group | |
| US3574702A (en) | Process for dimerizing acrylonitrile compounds | |
| US3567760A (en) | Process for dimerization of unsaturated nitriles tuilizing a nitrogen-containing catalyst | |
| US4263224A (en) | Acrylonitrile dimerization process | |
| Budzelaar et al. | Insertion and β-hydrogen transfer at aluminium | |
| RU2130024C1 (ru) | Способ совместного получения 1-(алкокси)-2,3,4,5- тетраалкил(арил)алюмациклопентадиенов и 1-(алкокси)-2,3- диалкил(арил)алюмациклопропенов | |
| EP0187132B1 (en) | Dimerization process improvements | |
| JPH02104569A (ja) | 二量化方法 | |
| RU2777364C2 (ru) | Способ гидроформилирования | |
| EP0542366B1 (en) | Process for the telomerization of conjugated alkadienes |