JPS5791953A - 4-fluoro-4'-hydroxybiphenyl benzoic acid ester derivative - Google Patents
4-fluoro-4'-hydroxybiphenyl benzoic acid ester derivativeInfo
- Publication number
- JPS5791953A JPS5791953A JP16763780A JP16763780A JPS5791953A JP S5791953 A JPS5791953 A JP S5791953A JP 16763780 A JP16763780 A JP 16763780A JP 16763780 A JP16763780 A JP 16763780A JP S5791953 A JPS5791953 A JP S5791953A
- Authority
- JP
- Japan
- Prior art keywords
- fluoro
- hydroxybiphenyl
- benzoic acid
- formula
- acid ester
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- -1 4-fluoro-4'-hydroxybiphenyl benzoic acid ester Chemical class 0.000 title abstract 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 abstract 3
- 239000004973 liquid crystal related substance Substances 0.000 abstract 3
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 abstract 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 abstract 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 abstract 1
- QSJNKJGPJVOGPK-UHFFFAOYSA-N 4-(4-fluorophenyl)phenol Chemical group C1=CC(O)=CC=C1C1=CC=C(F)C=C1 QSJNKJGPJVOGPK-UHFFFAOYSA-N 0.000 abstract 1
- ZQVKTHRQIXSMGY-UHFFFAOYSA-M 4-ethylbenzoate Chemical compound CCC1=CC=C(C([O-])=O)C=C1 ZQVKTHRQIXSMGY-UHFFFAOYSA-M 0.000 abstract 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N Benzoic acid Natural products OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 abstract 1
- 239000005711 Benzoic acid Substances 0.000 abstract 1
- 125000000217 alkyl group Chemical group 0.000 abstract 1
- 235000010233 benzoic acid Nutrition 0.000 abstract 1
- 150000001875 compounds Chemical class 0.000 abstract 1
- 239000000470 constituent Substances 0.000 abstract 1
- 239000000463 material Substances 0.000 abstract 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 abstract 1
Landscapes
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Liquid Crystal Substances (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP16763780A JPS5791953A (en) | 1980-11-28 | 1980-11-28 | 4-fluoro-4'-hydroxybiphenyl benzoic acid ester derivative |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP16763780A JPS5791953A (en) | 1980-11-28 | 1980-11-28 | 4-fluoro-4'-hydroxybiphenyl benzoic acid ester derivative |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5791953A true JPS5791953A (en) | 1982-06-08 |
| JPS634817B2 JPS634817B2 (enExample) | 1988-02-01 |
Family
ID=15853461
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP16763780A Granted JPS5791953A (en) | 1980-11-28 | 1980-11-28 | 4-fluoro-4'-hydroxybiphenyl benzoic acid ester derivative |
Country Status (1)
| Country | Link |
|---|---|
| JP (1) | JPS5791953A (enExample) |
Cited By (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4473487A (en) * | 1981-12-24 | 1984-09-25 | Merck Patent Gesellschaft Mit Beschrankter Haftung | 4-Fluorobiphenyl derivatives, their preparation, and dielectrics and electro-optical display element containing them |
| US4502974A (en) * | 1982-03-31 | 1985-03-05 | Chisso Corporation | High temperature liquid-crystalline ester compounds |
| US4526704A (en) * | 1982-07-28 | 1985-07-02 | Hoffmann-La Roche Inc. | Multiring liquid crystal esters |
| US4558151A (en) * | 1982-10-30 | 1985-12-10 | Dainippon Ink And Chemicals, Inc. | Nematic liquid crystalline compounds |
| US4584120A (en) * | 1982-02-15 | 1986-04-22 | Hitachi, Ltd. | Liquid crystal compound and liquid crystal composition |
| US4680137A (en) * | 1985-06-10 | 1987-07-14 | Chisso Corporation | Liquid crystal ester compound |
| US4683078A (en) * | 1985-03-12 | 1987-07-28 | Chisso Corporation | Dihalogeno-aromatic compound |
-
1980
- 1980-11-28 JP JP16763780A patent/JPS5791953A/ja active Granted
Cited By (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4473487A (en) * | 1981-12-24 | 1984-09-25 | Merck Patent Gesellschaft Mit Beschrankter Haftung | 4-Fluorobiphenyl derivatives, their preparation, and dielectrics and electro-optical display element containing them |
| US4584120A (en) * | 1982-02-15 | 1986-04-22 | Hitachi, Ltd. | Liquid crystal compound and liquid crystal composition |
| US4502974A (en) * | 1982-03-31 | 1985-03-05 | Chisso Corporation | High temperature liquid-crystalline ester compounds |
| US4701547A (en) * | 1982-03-31 | 1987-10-20 | Chisso Corporation | High temperature liquid-crystalline ester compounds |
| US4526704A (en) * | 1982-07-28 | 1985-07-02 | Hoffmann-La Roche Inc. | Multiring liquid crystal esters |
| US4558151A (en) * | 1982-10-30 | 1985-12-10 | Dainippon Ink And Chemicals, Inc. | Nematic liquid crystalline compounds |
| US4683078A (en) * | 1985-03-12 | 1987-07-28 | Chisso Corporation | Dihalogeno-aromatic compound |
| US4816179A (en) * | 1985-03-12 | 1989-03-28 | Chisso Corporation | Dihalogeno-aromatic compound |
| US4680137A (en) * | 1985-06-10 | 1987-07-14 | Chisso Corporation | Liquid crystal ester compound |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS634817B2 (enExample) | 1988-02-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS5721359A (en) | 4'''-cyano-4"-biphenylyl 4-(trans-4'-alkylcyclohexyl)benzoate | |
| JPS5746952A (en) | 4'-(beta-alkyloxyethoxy)-4-cyanobiphenyl | |
| JPS5791953A (en) | 4-fluoro-4'-hydroxybiphenyl benzoic acid ester derivative | |
| JPS57154158A (en) | Liquid crystal substance having large positive dielectric anisotropy | |
| JPS5764645A (en) | 4-fluoro-4'-hydroxybiphenyl cyclohexanecarboxylate derivative | |
| JPS579742A (en) | 4'-(trans-4"-alkylcyclohexyl)4-biphenylcarboxylic acid ester | |
| JPS56164170A (en) | Liquid crystal compound | |
| JPS5540660A (en) | Fluorine-containing phenylbenzoate compound, its preparation and use | |
| JPS5594366A (en) | 4-p-alkyl benzoyloxy-pyridine oxide | |
| JPS56164169A (en) | Liquid crystal compound | |
| JPS56110777A (en) | Ester derivative of 4-fluorobenzoic acid | |
| JPS56164171A (en) | Liquid crystal compound | |
| JPS5683449A (en) | Cyclohexanecarboxylic acid cyclohexyl ester derivative | |
| JPS5781440A (en) | 4-fluorophenol cinnamic acid ester derivative | |
| JPS57118538A (en) | 4-halogenobenzoic acid 4-(4'-alkylphenyl)phenol ester derivative | |
| JPS57159742A (en) | Liquid crystal ester | |
| JPS5785343A (en) | Trans-4-alkylcyclohexanecarboxylic 3'-fluoro-4'- alkoxyphenyl ester | |
| JPS57179134A (en) | Carboxylic ester of tetrafluorophenol | |
| JPS5738760A (en) | 4-(trans-4'-alkylcyclohexyl)benzyl 4"-cyanophenyl ether | |
| JPS57130956A (en) | 4-fluoro-4'-hydroxybiphenyl derivative | |
| JPS57188545A (en) | Trans-4-alkylcyclohexane carboxylic acid methyl- substituted-4-chlorophenyl ester | |
| JPS55100352A (en) | Ester compound and its preparation | |
| JPS57176931A (en) | Carboxylic acid pentafluorophenol ester | |
| JPS5764689A (en) | Substituted biphenylyldioxane | |
| JPS57128668A (en) | 4-alkoxyphenylpropiolic acid 4'-cyanophenyl ester |