JPS5770878A - Isoxazole compound - Google Patents
Isoxazole compoundInfo
- Publication number
- JPS5770878A JPS5770878A JP14670680A JP14670680A JPS5770878A JP S5770878 A JPS5770878 A JP S5770878A JP 14670680 A JP14670680 A JP 14670680A JP 14670680 A JP14670680 A JP 14670680A JP S5770878 A JPS5770878 A JP S5770878A
- Authority
- JP
- Japan
- Prior art keywords
- phenyl
- compound
- halogen
- formula
- lower alkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- -1 Isoxazole compound Chemical class 0.000 title abstract 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 abstract 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 abstract 3
- 125000000217 alkyl group Chemical group 0.000 abstract 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract 3
- 229910052736 halogen Inorganic materials 0.000 abstract 2
- NEAQRZUHTPSBBM-UHFFFAOYSA-N 2-hydroxy-3,3-dimethyl-7-nitro-4h-isoquinolin-1-one Chemical compound C1=C([N+]([O-])=O)C=C2C(=O)N(O)C(C)(C)CC2=C1 NEAQRZUHTPSBBM-UHFFFAOYSA-N 0.000 abstract 1
- JCXJVPUVTGWSNB-UHFFFAOYSA-N Nitrogen dioxide Chemical group O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 abstract 1
- 239000002253 acid Substances 0.000 abstract 1
- 125000003545 alkoxy group Chemical group 0.000 abstract 1
- 150000001875 compounds Chemical class 0.000 abstract 1
- 230000002070 germicidal effect Effects 0.000 abstract 1
- 150000004820 halides Chemical class 0.000 abstract 1
- 125000005843 halogen group Chemical group 0.000 abstract 1
- 150000002367 halogens Chemical group 0.000 abstract 1
- 230000002363 herbicidal effect Effects 0.000 abstract 1
- 239000004009 herbicide Substances 0.000 abstract 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract 1
- 239000000463 material Substances 0.000 abstract 1
- 239000002904 solvent Substances 0.000 abstract 1
Landscapes
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP14670680A JPS5770878A (en) | 1980-10-20 | 1980-10-20 | Isoxazole compound |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP14670680A JPS5770878A (en) | 1980-10-20 | 1980-10-20 | Isoxazole compound |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5770878A true JPS5770878A (en) | 1982-05-01 |
| JPS6364429B2 JPS6364429B2 (enExample) | 1988-12-12 |
Family
ID=15413695
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP14670680A Granted JPS5770878A (en) | 1980-10-20 | 1980-10-20 | Isoxazole compound |
Country Status (1)
| Country | Link |
|---|---|
| JP (1) | JPS5770878A (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5650533A (en) * | 1989-09-11 | 1997-07-22 | Rhone-Poulenc Agriculture Ltd. | Intermediates to herbicidal 4-substituted isoxazoles |
| US5656573A (en) * | 1989-09-11 | 1997-08-12 | Rhone-Poulenc Agriculture Ltd. | Herbicidal 4-substituted isoxazoles |
| US5747424A (en) * | 1989-09-11 | 1998-05-05 | Rhone-Poulenc Agriculture Ltd. | Herbicidal 4-substituted isoxazol |
-
1980
- 1980-10-20 JP JP14670680A patent/JPS5770878A/ja active Granted
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5650533A (en) * | 1989-09-11 | 1997-07-22 | Rhone-Poulenc Agriculture Ltd. | Intermediates to herbicidal 4-substituted isoxazoles |
| US5656573A (en) * | 1989-09-11 | 1997-08-12 | Rhone-Poulenc Agriculture Ltd. | Herbicidal 4-substituted isoxazoles |
| US5747424A (en) * | 1989-09-11 | 1998-05-05 | Rhone-Poulenc Agriculture Ltd. | Herbicidal 4-substituted isoxazol |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS6364429B2 (enExample) | 1988-12-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0077938A3 (en) | N-(3-substituted aminophenyl) tetrahydrophthalimides and herbicidal composition | |
| JPS5629548A (en) | Omega-aminoalkoxystilbenes and their acid addition salts | |
| JPS5772903A (en) | Pyrazole herbicide | |
| JPS5770878A (en) | Isoxazole compound | |
| JPS5583751A (en) | Pypazole derivative, its preparation, and herbicide containing the same | |
| JPS56140983A (en) | Substituted acetanilide compound, its preparation and herbicide containing the same as active constituent | |
| JPS5764683A (en) | 2-(substituted phenyl)-5-alkylthiazolidin-4-one and remedy for pepticulcer containing said compound as active component | |
| EP0114456A3 (en) | Acylated isoxazolyl ureas, their preparation, herbicidal formulations containing the same, and a herbicidal method | |
| JPS54160344A (en) | Novel phosphoric acid anilide derivative | |
| JPS57106663A (en) | 1,4-disubstituted piperazine derivative and its preparation | |
| JPS57197256A (en) | Novel cyclohexanecarboxamide derivative and its preparation | |
| JPS5551050A (en) | Polymerizable aminosulfonic acid compound | |
| JPS5780379A (en) | (omega-piperazinylalkoxy)alkylenedioxybenzene and its acid addition salt | |
| JPS5799597A (en) | Sulfinamide derivative | |
| JPS57185246A (en) | 4-halo-2-pentenoic acid amide derivative, its preparation and herbicide containing the same | |
| JPS57154183A (en) | Omega-piperazinylalkanoylalkylene dioxybenzenes and their acid addition salts | |
| JPS54115347A (en) | Substituted-phenylurea deriavtive, its preparation and herbicide containing the same | |
| JPS55167203A (en) | Herbicide | |
| JPS55160769A (en) | Hydrazinophthalazine derivative | |
| JPS559002A (en) | 5-substituted picolinic acid derivative, its preparation and hypotensive agent containing the same | |
| JPS54112861A (en) | 1,2-substituted-4,5-dicyanoimidazole and its preparation | |
| JPS5520738A (en) | Novel cyclohexanecarboxamide derivative | |
| JPS5589254A (en) | Substituted isovaleric acid derivative | |
| JPS57200397A (en) | Novel aldohexopyranose-, aldopentopyranose-, or and medicament composition comprising it aldopentofuranose- nitrosourea compound, its preparation | |
| JPS54115346A (en) | Substituted-phenylurea derivative, its preparation and herbicide containing the same |