JPS5692279A - Thiazolidine derivative - Google Patents
Thiazolidine derivativeInfo
- Publication number
- JPS5692279A JPS5692279A JP17013779A JP17013779A JPS5692279A JP S5692279 A JPS5692279 A JP S5692279A JP 17013779 A JP17013779 A JP 17013779A JP 17013779 A JP17013779 A JP 17013779A JP S5692279 A JPS5692279 A JP S5692279A
- Authority
- JP
- Japan
- Prior art keywords
- compound
- formula
- lower alkyl
- aralkyl
- benzoyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 150000003548 thiazolidines Chemical class 0.000 title 1
- 150000001875 compounds Chemical class 0.000 abstract 4
- 125000000217 alkyl group Chemical group 0.000 abstract 3
- 125000003545 alkoxy group Chemical group 0.000 abstract 2
- 125000003710 aryl alkyl group Chemical group 0.000 abstract 2
- UUUHXMGGBIUAPW-UHFFFAOYSA-N 1-[1-[2-[[5-amino-2-[[1-[5-(diaminomethylideneamino)-2-[[1-[3-(1h-indol-3-yl)-2-[(5-oxopyrrolidine-2-carbonyl)amino]propanoyl]pyrrolidine-2-carbonyl]amino]pentanoyl]pyrrolidine-2-carbonyl]amino]-5-oxopentanoyl]amino]-3-methylpentanoyl]pyrrolidine-2-carbon Chemical compound C1CCC(C(=O)N2C(CCC2)C(O)=O)N1C(=O)C(C(C)CC)NC(=O)C(CCC(N)=O)NC(=O)C1CCCN1C(=O)C(CCCN=C(N)N)NC(=O)C1CCCN1C(=O)C(CC=1C2=CC=CC=C2NC=1)NC(=O)C1CCC(=O)N1 UUUHXMGGBIUAPW-UHFFFAOYSA-N 0.000 abstract 1
- 102000016912 Aldehyde Reductase Human genes 0.000 abstract 1
- 108010053754 Aldehyde reductase Proteins 0.000 abstract 1
- 208000002249 Diabetes Complications Diseases 0.000 abstract 1
- 206010012655 Diabetic complications Diseases 0.000 abstract 1
- 102000004270 Peptidyl-Dipeptidase A Human genes 0.000 abstract 1
- 108090000882 Peptidyl-Dipeptidase A Proteins 0.000 abstract 1
- 239000002253 acid Substances 0.000 abstract 1
- 125000002947 alkylene group Chemical group 0.000 abstract 1
- 239000002220 antihypertensive agent Substances 0.000 abstract 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 abstract 1
- 125000001589 carboacyl group Chemical group 0.000 abstract 1
- 239000003795 chemical substances by application Substances 0.000 abstract 1
- 125000000623 heterocyclic group Chemical group 0.000 abstract 1
- 239000003112 inhibitor Substances 0.000 abstract 1
- 239000000463 material Substances 0.000 abstract 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 abstract 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract 1
- 150000003839 salts Chemical class 0.000 abstract 1
- 229950001139 timonacic Drugs 0.000 abstract 1
Landscapes
- Thiazole And Isothizaole Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP17013779A JPS5692279A (en) | 1979-12-25 | 1979-12-25 | Thiazolidine derivative |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP17013779A JPS5692279A (en) | 1979-12-25 | 1979-12-25 | Thiazolidine derivative |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5692279A true JPS5692279A (en) | 1981-07-25 |
| JPH0140031B2 JPH0140031B2 (enExample) | 1989-08-24 |
Family
ID=15899340
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP17013779A Granted JPS5692279A (en) | 1979-12-25 | 1979-12-25 | Thiazolidine derivative |
Country Status (1)
| Country | Link |
|---|---|
| JP (1) | JPS5692279A (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1982002200A1 (en) * | 1980-12-29 | 1982-07-08 | Iwao Jun Ichi | Heterocyclic 5-membered ring compounds |
| EP0331014A3 (de) * | 1988-03-02 | 1991-10-23 | THERA - Patent Verwaltungs-GmbH | Verwendung von ACE-Inhibitoren für die Diabetesprophylaxe |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5683483A (en) * | 1979-12-13 | 1981-07-08 | Santen Pharmaceut Co Ltd | Thiazolidine compound |
-
1979
- 1979-12-25 JP JP17013779A patent/JPS5692279A/ja active Granted
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5683483A (en) * | 1979-12-13 | 1981-07-08 | Santen Pharmaceut Co Ltd | Thiazolidine compound |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1982002200A1 (en) * | 1980-12-29 | 1982-07-08 | Iwao Jun Ichi | Heterocyclic 5-membered ring compounds |
| US4464371A (en) * | 1980-12-29 | 1984-08-07 | Santen Pharmaceutical Co., Ltd. | Five-membered heterocyclic compounds |
| EP0067885B1 (en) * | 1980-12-29 | 1985-09-04 | Santen Pharmaceutical Co., Ltd. | Heterocyclic 5-membered ring compounds |
| EP0331014A3 (de) * | 1988-03-02 | 1991-10-23 | THERA - Patent Verwaltungs-GmbH | Verwendung von ACE-Inhibitoren für die Diabetesprophylaxe |
Also Published As
| Publication number | Publication date |
|---|---|
| JPH0140031B2 (enExample) | 1989-08-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS559058A (en) | 1-(3-mercapto-2-methylpropanoyl)prolyl amino acid derivative | |
| JPS5683483A (en) | Thiazolidine compound | |
| JPS56103168A (en) | Thiazole derivative, its preparation, and antihistaminic agent containing the same | |
| JPS5681578A (en) | Novel thioalkyl amide derivative | |
| JPS5692279A (en) | Thiazolidine derivative | |
| JPS574977A (en) | 2-guanidinothiazole derivative | |
| JPS5618969A (en) | Novel 1-(4-aminobenzyl)-2,3-dioxopiperazine derivative, its acid addition salt, and their preparation | |
| JPS57131771A (en) | Novel pyrimidine derivative | |
| JPS5227791A (en) | Synthesis of cephalosporins | |
| JPS5756425A (en) | Hypotensor | |
| JPS5754177A (ja) | Chikanchiazoorujudotai | |
| JPS5511547A (en) | Thiazolidine derivative | |
| JPS5592363A (en) | New 2-azetidinone derivative | |
| JPS54128583A (en) | Thiosemicarbazone derivative | |
| JPS5692260A (en) | Cyclohexanecarboxylic ester and its preparation | |
| JPS5758654A (en) | Germanium compound of prolylaminoacid derivative and its preparation | |
| JPS54106495A (en) | Cephem derivative | |
| JPS5731673A (en) | Piperazine derivative | |
| JPS57120576A (en) | Novel imidazole ester | |
| JPS57112381A (en) | Five-membered heterocyclic compound | |
| JPS57154183A (en) | Omega-piperazinylalkanoylalkylene dioxybenzenes and their acid addition salts | |
| JPS54128599A (en) | Pyrrolobenzazepin derivative | |
| JPS57169480A (en) | Production of indole derivative | |
| JPS5759856A (en) | Benzene derivative | |
| JPS5651450A (en) | Halogen-substituted proline derivative and its preparation |