JPS5658538A - Removing agent of basic gas - Google Patents
Removing agent of basic gasInfo
- Publication number
- JPS5658538A JPS5658538A JP13541079A JP13541079A JPS5658538A JP S5658538 A JPS5658538 A JP S5658538A JP 13541079 A JP13541079 A JP 13541079A JP 13541079 A JP13541079 A JP 13541079A JP S5658538 A JPS5658538 A JP S5658538A
- Authority
- JP
- Japan
- Prior art keywords
- acid
- removing agent
- gas
- basic
- basic gases
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 239000007789 gas Substances 0.000 abstract 7
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 abstract 3
- 239000003795 chemical substances by application Substances 0.000 abstract 3
- 239000004927 clay Substances 0.000 abstract 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 abstract 2
- 239000002253 acid Substances 0.000 abstract 2
- 239000008188 pellet Substances 0.000 abstract 2
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 abstract 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 abstract 1
- 150000007513 acids Chemical class 0.000 abstract 1
- 150000001412 amines Chemical class 0.000 abstract 1
- 239000011230 binding agent Substances 0.000 abstract 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 abstract 1
- 239000004327 boric acid Substances 0.000 abstract 1
- 150000007522 mineralic acids Chemical class 0.000 abstract 1
- 238000000465 moulding Methods 0.000 abstract 1
- 125000004433 nitrogen atom Chemical group N* 0.000 abstract 1
- 150000007524 organic acids Chemical class 0.000 abstract 1
- 235000006408 oxalic acid Nutrition 0.000 abstract 1
- 239000000843 powder Substances 0.000 abstract 1
- 235000002906 tartaric acid Nutrition 0.000 abstract 1
- 239000011975 tartaric acid Substances 0.000 abstract 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 abstract 1
Landscapes
- Treating Waste Gases (AREA)
- Solid-Sorbent Or Filter-Aiding Compositions (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP13541079A JPS5658538A (en) | 1979-10-19 | 1979-10-19 | Removing agent of basic gas |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP13541079A JPS5658538A (en) | 1979-10-19 | 1979-10-19 | Removing agent of basic gas |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5658538A true JPS5658538A (en) | 1981-05-21 |
| JPS6252618B2 JPS6252618B2 (enExample) | 1987-11-06 |
Family
ID=15151069
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP13541079A Granted JPS5658538A (en) | 1979-10-19 | 1979-10-19 | Removing agent of basic gas |
Country Status (1)
| Country | Link |
|---|---|
| JP (1) | JPS5658538A (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3937578A1 (de) * | 1989-11-11 | 1991-05-16 | Haensler J Gmbh | Dentaleinheit |
| JP2006110480A (ja) * | 2004-10-15 | 2006-04-27 | Japan Energy Corp | 炭化水素からの防食剤の除去方法 |
| KR20180071918A (ko) | 2017-05-23 | 2018-06-28 | 주식회사 씨엠파트너 | 전기 구동식 이륜 차량 |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS52136895A (en) * | 1976-05-12 | 1977-11-15 | Taiyo Kaken Co | Collecting agents for basic nasty smell ingredients |
| JPS5460286A (en) * | 1977-10-21 | 1979-05-15 | Toshiba Corp | Adsorbent for basic gas |
-
1979
- 1979-10-19 JP JP13541079A patent/JPS5658538A/ja active Granted
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS52136895A (en) * | 1976-05-12 | 1977-11-15 | Taiyo Kaken Co | Collecting agents for basic nasty smell ingredients |
| JPS5460286A (en) * | 1977-10-21 | 1979-05-15 | Toshiba Corp | Adsorbent for basic gas |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3937578A1 (de) * | 1989-11-11 | 1991-05-16 | Haensler J Gmbh | Dentaleinheit |
| JP2006110480A (ja) * | 2004-10-15 | 2006-04-27 | Japan Energy Corp | 炭化水素からの防食剤の除去方法 |
| KR20180071918A (ko) | 2017-05-23 | 2018-06-28 | 주식회사 씨엠파트너 | 전기 구동식 이륜 차량 |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS6252618B2 (enExample) | 1987-11-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS5551422A (en) | Deodorization | |
| JPS5658538A (en) | Removing agent of basic gas | |
| GB1535215A (en) | Kanamycin derivatives | |
| FI914411A0 (fi) | Tillsatskula foer tillsaettning i jord foer tillfredsstaellning av kvaevebehovet hos vaexter och foerfarande foer framstaellning av densamma. | |
| JPS53111087A (en) | Storing of trioxane | |
| JPS5742520A (en) | Preparation of formed active carbon | |
| JPS5695342A (en) | Production of honeycomb molding for catalyst | |
| JPS51115592A (en) | Process of manufacturing aminoplast molding compounds | |
| JPS5212984A (en) | Purification of urokinase | |
| NO810563L (no) | Drivmiddel for kompenserende gassutviklere og fremgangsmaate ved dets fremstilling | |
| JPS5330697A (en) | Curing of compositions | |
| JPS51118708A (en) | Process for stabilization of nitro compounds | |
| JPS5361627A (en) | Regeneration of coating compound waste | |
| SU467048A1 (ru) | Способ хранени гигроскопических минеральных удобрений | |
| SU483356A1 (ru) | Способ получени строительного раствора | |
| JPS5538836A (en) | Epoxy resin curing agent | |
| SU593872A1 (ru) | Состав покрыти дл сварочных электродов | |
| SU145227A1 (ru) | Способ уменьшени слеживаемости аммиачной селитры | |
| JPS57122934A (en) | Preparation of alpha-alumina type catalyst carrier | |
| JPS52156769A (en) | Treatment of dust | |
| JPS51122860A (en) | Quick drying method and drier of livestock excrements | |
| ATA37376A (de) | Verfahren zur autoklavlosen herstellung thermisch gehaerteter, silikathydratgebundener formkoerper | |
| JPS5246025A (en) | Spray drying process for alkylsulfate-containing compounds | |
| JPS55145668A (en) | Preparation of alpha-dimethylamino-epsilon-caprolactam | |
| JPS5248586A (en) | Method for preparating air containing ozone |