JPH0583104B2 - - Google Patents
Info
- Publication number
- JPH0583104B2 JPH0583104B2 JP62018777A JP1877787A JPH0583104B2 JP H0583104 B2 JPH0583104 B2 JP H0583104B2 JP 62018777 A JP62018777 A JP 62018777A JP 1877787 A JP1877787 A JP 1877787A JP H0583104 B2 JPH0583104 B2 JP H0583104B2
- Authority
- JP
- Japan
- Prior art keywords
- group
- pyridine
- formula
- phthalocyanine
- acid amide
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- -1 β-substituted ethylsulfonyl groups Chemical group 0.000 claims description 41
- 238000000034 method Methods 0.000 claims description 30
- 238000006243 chemical reaction Methods 0.000 claims description 26
- 150000001412 amines Chemical class 0.000 claims description 20
- IEQIEDJGQAUEQZ-UHFFFAOYSA-N phthalocyanine Chemical compound N1C(N=C2C3=CC=CC=C3C(N=C3C4=CC=CC=C4C(=N4)N3)=N2)=C(C=CC=C2)C2=C1N=C1C2=CC=CC=C2C4=N1 IEQIEDJGQAUEQZ-UHFFFAOYSA-N 0.000 claims description 14
- 239000001007 phthalocyanine dye Substances 0.000 claims description 14
- DFPAKSUCGFBDDF-UHFFFAOYSA-N Nicotinamide Chemical group NC(=O)C1=CC=CN=C1 DFPAKSUCGFBDDF-UHFFFAOYSA-N 0.000 claims description 13
- 239000000203 mixture Substances 0.000 claims description 13
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 claims description 13
- 125000004432 carbon atom Chemical group C* 0.000 claims description 12
- 150000001875 compounds Chemical class 0.000 claims description 12
- 125000000217 alkyl group Chemical group 0.000 claims description 11
- 125000003118 aryl group Chemical group 0.000 claims description 11
- 238000006482 condensation reaction Methods 0.000 claims description 9
- IBBMAWULFFBRKK-UHFFFAOYSA-N picolinamide Chemical compound NC(=O)C1=CC=CC=N1 IBBMAWULFFBRKK-UHFFFAOYSA-N 0.000 claims description 9
- XTHPWXDJESJLNJ-UHFFFAOYSA-N sulfurochloridic acid Chemical group OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 claims description 9
- 125000001931 aliphatic group Chemical group 0.000 claims description 7
- 125000002947 alkylene group Chemical group 0.000 claims description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 7
- DWJMBQYORXLGAE-UHFFFAOYSA-N pyridine-2-sulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=N1 DWJMBQYORXLGAE-UHFFFAOYSA-N 0.000 claims description 7
- 235000005152 nicotinamide Nutrition 0.000 claims description 6
- 239000011570 nicotinamide Substances 0.000 claims description 6
- 229910052783 alkali metal Inorganic materials 0.000 claims description 5
- 125000000623 heterocyclic group Chemical group 0.000 claims description 5
- 229910052751 metal Inorganic materials 0.000 claims description 4
- 239000002184 metal Substances 0.000 claims description 4
- 125000006615 aromatic heterocyclic group Chemical group 0.000 claims description 3
- 125000002837 carbocyclic group Chemical group 0.000 claims description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- 125000005330 8 membered heterocyclic group Chemical group 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- 125000005842 heteroatom Chemical group 0.000 claims description 2
- 229940124530 sulfonamide Drugs 0.000 claims description 2
- 150000003456 sulfonamides Chemical class 0.000 claims description 2
- 125000000467 secondary amino group Chemical class [H]N([*:1])[*:2] 0.000 claims 2
- 239000000975 dye Substances 0.000 description 17
- 239000002253 acid Substances 0.000 description 14
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 10
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 10
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 8
- 150000003839 salts Chemical class 0.000 description 8
- 125000001424 substituent group Chemical group 0.000 description 8
- 238000004043 dyeing Methods 0.000 description 7
- RBTKNAXYKSUFRK-UHFFFAOYSA-N heliogen blue Chemical compound [Cu].[N-]1C2=C(C=CC=C3)C3=C1N=C([N-]1)C3=CC=CC=C3C1=NC([N-]1)=C(C=CC=C3)C3=C1N=C([N-]1)C3=CC=CC=C3C1=N2 RBTKNAXYKSUFRK-UHFFFAOYSA-N 0.000 description 7
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 6
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 6
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 6
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 6
- 229910052802 copper Inorganic materials 0.000 description 6
- 239000010949 copper Substances 0.000 description 6
- 150000007513 acids Chemical class 0.000 description 5
- 239000003054 catalyst Substances 0.000 description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 5
- 150000003335 secondary amines Chemical class 0.000 description 5
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 5
- 235000017557 sodium bicarbonate Nutrition 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- 239000012736 aqueous medium Substances 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 150000001805 chlorine compounds Chemical class 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 235000001968 nicotinic acid Nutrition 0.000 description 4
- 239000011664 nicotinic acid Substances 0.000 description 4
- 229960003512 nicotinic acid Drugs 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- 229920000742 Cotton Polymers 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 150000004982 aromatic amines Chemical class 0.000 description 3
- 239000011230 binding agent Substances 0.000 description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 230000000052 comparative effect Effects 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 229910052759 nickel Inorganic materials 0.000 description 3
- 229960003966 nicotinamide Drugs 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 238000006467 substitution reaction Methods 0.000 description 3
- 239000004753 textile Substances 0.000 description 3
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methylaniline Chemical compound CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 2
- JKDBHOCXOBHEHB-UHFFFAOYSA-N NC1=CC=CC=C1.C1=CC=C2C(N)=CC=CC2=C1 Chemical compound NC1=CC=CC=C1.C1=CC=C2C(N)=CC=CC2=C1 JKDBHOCXOBHEHB-UHFFFAOYSA-N 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- DFPAKSUCGFBDDF-ZQBYOMGUSA-N [14c]-nicotinamide Chemical compound N[14C](=O)C1=CC=CN=C1 DFPAKSUCGFBDDF-ZQBYOMGUSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000001045 blue dye Substances 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 125000006125 ethylsulfonyl group Chemical class 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 125000004957 naphthylene group Chemical group 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 230000020477 pH reduction Effects 0.000 description 2
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 2
- 235000021317 phosphate Nutrition 0.000 description 2
- NKFLEFWUYAUDJV-UHFFFAOYSA-N pyridine-3-sulfonamide Chemical compound NS(=O)(=O)C1=CC=CN=C1 NKFLEFWUYAUDJV-UHFFFAOYSA-N 0.000 description 2
- 239000004627 regenerated cellulose Substances 0.000 description 2
- 239000010981 turquoise Substances 0.000 description 2
- AZUYLZMQTIKGSC-UHFFFAOYSA-N 1-[6-[4-(5-chloro-6-methyl-1H-indazol-4-yl)-5-methyl-3-(1-methylindazol-5-yl)pyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one Chemical compound ClC=1C(=C2C=NNC2=CC=1C)C=1C(=NN(C=1C)C1CC2(CN(C2)C(C=C)=O)C1)C=1C=C2C=NN(C2=CC=1)C AZUYLZMQTIKGSC-UHFFFAOYSA-N 0.000 description 1
- RUFPHBVGCFYCNW-UHFFFAOYSA-N 1-naphthylamine Chemical compound C1=CC=C2C(N)=CC=CC2=C1 RUFPHBVGCFYCNW-UHFFFAOYSA-N 0.000 description 1
- MPQHBWNDIOJYNP-UHFFFAOYSA-N 2,6-dimethylpyridine-3-carboxamide Chemical compound CC1=CC=C(C(N)=O)C(C)=N1 MPQHBWNDIOJYNP-UHFFFAOYSA-N 0.000 description 1
- DERMVGUSAPXPSM-UHFFFAOYSA-N 2-(3-amino-4-methoxyphenyl)sulfonylethanol Chemical compound COC1=CC=C(S(=O)(=O)CCO)C=C1N DERMVGUSAPXPSM-UHFFFAOYSA-N 0.000 description 1
- CETGJLKGOWVPEZ-UHFFFAOYSA-N 2-(3-amino-4-methylphenyl)sulfonylethanol Chemical compound CC1=CC=C(S(=O)(=O)CCO)C=C1N CETGJLKGOWVPEZ-UHFFFAOYSA-N 0.000 description 1
- ASASRSMRAPYLQI-UHFFFAOYSA-N 2-(3-aminophenyl)sulfonylethanol Chemical compound NC1=CC=CC(S(=O)(=O)CCO)=C1 ASASRSMRAPYLQI-UHFFFAOYSA-N 0.000 description 1
- JBLSIJHHYSSKPI-UHFFFAOYSA-N 2-(4-amino-2,5-dimethoxyphenyl)sulfonylethanol Chemical compound COC1=CC(S(=O)(=O)CCO)=C(OC)C=C1N JBLSIJHHYSSKPI-UHFFFAOYSA-N 0.000 description 1
- XIJDOIFYURSZNV-UHFFFAOYSA-N 2-(4-amino-3-bromophenyl)sulfonylethanol Chemical compound NC1=CC=C(S(=O)(=O)CCO)C=C1Br XIJDOIFYURSZNV-UHFFFAOYSA-N 0.000 description 1
- ROIXYTXNFPEHIG-UHFFFAOYSA-N 2-(4-amino-3-methoxyphenyl)sulfonylethanol Chemical compound COC1=CC(S(=O)(=O)CCO)=CC=C1N ROIXYTXNFPEHIG-UHFFFAOYSA-N 0.000 description 1
- BMDXUOISXOQCJR-UHFFFAOYSA-N 2-(4-amino-5-methoxy-2-methylphenyl)sulfonylethanol Chemical compound COC1=CC(S(=O)(=O)CCO)=C(C)C=C1N BMDXUOISXOQCJR-UHFFFAOYSA-N 0.000 description 1
- CSCNRHJJGXZFGX-UHFFFAOYSA-N 2-(4-aminophenyl)sulfonylethanol Chemical compound NC1=CC=C(S(=O)(=O)CCO)C=C1 CSCNRHJJGXZFGX-UHFFFAOYSA-N 0.000 description 1
- XMPQOEALHSZPNG-UHFFFAOYSA-N 2-[(3-amino-4-methoxyphenyl)methylsulfonyl]ethanol Chemical compound COC1=CC=C(CS(=O)(=O)CCO)C=C1N XMPQOEALHSZPNG-UHFFFAOYSA-N 0.000 description 1
- HLECWBCVFHVMSF-UHFFFAOYSA-N 2-[4-(2-aminoethyl)phenyl]sulfonylethanol Chemical compound NCCC1=CC=C(S(=O)(=O)CCO)C=C1 HLECWBCVFHVMSF-UHFFFAOYSA-N 0.000 description 1
- AYUQPQKFMNBGRA-UHFFFAOYSA-N 2-[4-(2-aminoethylamino)-3-nitrophenyl]sulfonylethanol Chemical compound NCCNC1=CC=C(S(=O)(=O)CCO)C=C1[N+]([O-])=O AYUQPQKFMNBGRA-UHFFFAOYSA-N 0.000 description 1
- YEANHCCZXNKIPM-UHFFFAOYSA-N 2-[4-(methylamino)phenyl]sulfonylethanol Chemical compound CNC1=CC=C(S(=O)(=O)CCO)C=C1 YEANHCCZXNKIPM-UHFFFAOYSA-N 0.000 description 1
- PIVYGOADFCMGQQ-UHFFFAOYSA-N 2-[6-amino-4-(2-hydroxyethylsulfonyl)naphthalen-2-yl]sulfonylethanol Chemical compound C1=C(S(=O)(=O)CCO)C=C(S(=O)(=O)CCO)C2=CC(N)=CC=C21 PIVYGOADFCMGQQ-UHFFFAOYSA-N 0.000 description 1
- DMXZGJQHYGCXMZ-UHFFFAOYSA-N 2-amino-4-(2-hydroxyethylsulfonyl)-6-nitrophenol Chemical compound NC1=CC(S(=O)(=O)CCO)=CC([N+]([O-])=O)=C1O DMXZGJQHYGCXMZ-UHFFFAOYSA-N 0.000 description 1
- JTYLVPBXKYDHAO-UHFFFAOYSA-N 2-amino-4-(2-hydroxyethylsulfonyl)benzenesulfonic acid Chemical compound NC1=CC(S(=O)(=O)CCO)=CC=C1S(O)(=O)=O JTYLVPBXKYDHAO-UHFFFAOYSA-N 0.000 description 1
- ARDMXFUQZAMOBC-UHFFFAOYSA-N 2-amino-4-(2-hydroxyethylsulfonyl)benzoic acid Chemical compound NC1=CC(S(=O)(=O)CCO)=CC=C1C(O)=O ARDMXFUQZAMOBC-UHFFFAOYSA-N 0.000 description 1
- SNUWQQFUPOZCIQ-UHFFFAOYSA-N 2-amino-4-(2-hydroxyethylsulfonyl)phenol Chemical compound NC1=CC(S(=O)(=O)CCO)=CC=C1O SNUWQQFUPOZCIQ-UHFFFAOYSA-N 0.000 description 1
- SXYFVFGTFCDYPV-UHFFFAOYSA-N 2-amino-5-(2-hydroxyethylsulfonyl)phenol Chemical compound NC1=CC=C(S(=O)(=O)CCO)C=C1O SXYFVFGTFCDYPV-UHFFFAOYSA-N 0.000 description 1
- FHCSBDDIIUIZIZ-UHFFFAOYSA-N 2-carbamoylpyridine-3,4-dicarboxylic acid Chemical compound N1=C(C(=C(C=C1)C(=O)O)C(=O)O)C(=O)N FHCSBDDIIUIZIZ-UHFFFAOYSA-N 0.000 description 1
- DIABIDLZBNRSPR-UHFFFAOYSA-N 2-carbamoylpyridine-3-carboxylic acid Chemical compound NC(=O)C1=NC=CC=C1C(O)=O DIABIDLZBNRSPR-UHFFFAOYSA-N 0.000 description 1
- RIEKUXDEDZHANI-UHFFFAOYSA-N 2-carbamoylpyridine-4-carboxylic acid Chemical compound NC(=O)C1=CC(C(O)=O)=CC=N1 RIEKUXDEDZHANI-UHFFFAOYSA-N 0.000 description 1
- DAHOYMNLSWLDGQ-UHFFFAOYSA-N 2-methylpyridine-3-sulfonamide Chemical compound CC1=NC=CC=C1S(N)(=O)=O DAHOYMNLSWLDGQ-UHFFFAOYSA-N 0.000 description 1
- ZAJAQTYSTDTMCU-UHFFFAOYSA-N 3-aminobenzenesulfonic acid Chemical compound NC1=CC=CC(S(O)(=O)=O)=C1 ZAJAQTYSTDTMCU-UHFFFAOYSA-N 0.000 description 1
- QSWFOURBRIHFTB-UHFFFAOYSA-N 3-carbamoyl-2-methylpyridine-4-carboxylic acid Chemical compound CC1=NC=CC(=C1C(=O)N)C(=O)O QSWFOURBRIHFTB-UHFFFAOYSA-N 0.000 description 1
- WWYUMUYJDXXBSR-UHFFFAOYSA-N 3-carbamoylpyridine-4-carboxylic acid Chemical compound NC(=O)C1=CN=CC=C1C(O)=O WWYUMUYJDXXBSR-UHFFFAOYSA-N 0.000 description 1
- HRWSRGPWDJADIS-UHFFFAOYSA-N 4,6-dimethylpyridine-2-carboxamide Chemical compound CC1=CC(C)=NC(C(N)=O)=C1 HRWSRGPWDJADIS-UHFFFAOYSA-N 0.000 description 1
- ZXRPDBDIBLUWFT-UHFFFAOYSA-N 4-amino-n-[3-(2-hydroxyethylsulfonyl)phenyl]benzamide Chemical compound C1=CC(N)=CC=C1C(=O)NC1=CC=CC(S(=O)(=O)CCO)=C1 ZXRPDBDIBLUWFT-UHFFFAOYSA-N 0.000 description 1
- HVBSAKJJOYLTQU-UHFFFAOYSA-N 4-aminobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1 HVBSAKJJOYLTQU-UHFFFAOYSA-N 0.000 description 1
- ALYNCZNDIQEVRV-UHFFFAOYSA-N 4-aminobenzoic acid Chemical compound NC1=CC=C(C(O)=O)C=C1 ALYNCZNDIQEVRV-UHFFFAOYSA-N 0.000 description 1
- SYUVVPUHLFHXQV-UHFFFAOYSA-N 4-ethylpyridine-3-carboxamide Chemical compound CCC1=CC=NC=C1C(N)=O SYUVVPUHLFHXQV-UHFFFAOYSA-N 0.000 description 1
- SXKLOQCGXUTBNP-UHFFFAOYSA-N 4-methylpyridine-3-carboxamide Chemical compound CC1=CC=NC=C1C(N)=O SXKLOQCGXUTBNP-UHFFFAOYSA-N 0.000 description 1
- SRIRTFSQYOUBGL-UHFFFAOYSA-N 5-carbamoylpyridine-3-carboxylic acid Chemical compound NC(=O)C1=CN=CC(C(O)=O)=C1 SRIRTFSQYOUBGL-UHFFFAOYSA-N 0.000 description 1
- MUTVEWJASOPKGU-UHFFFAOYSA-N 6-carbamoylpyridine-2-carboxylic acid Chemical compound NC(=O)C1=CC=CC(C(O)=O)=N1 MUTVEWJASOPKGU-UHFFFAOYSA-N 0.000 description 1
- KCXJVFSGFHMNKY-UHFFFAOYSA-N 6-carbamoylpyridine-3,4-dicarboxylic acid Chemical compound N1=C(C=C(C(=C1)C(=O)O)C(=O)O)C(=O)N KCXJVFSGFHMNKY-UHFFFAOYSA-N 0.000 description 1
- JFCICVDKSOXXCF-UHFFFAOYSA-N 6-carbamoylpyridine-3-carboxylic acid Chemical compound NC(=O)C1=CC=C(C(O)=O)C=N1 JFCICVDKSOXXCF-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- RISUMPVKPHEEJG-UHFFFAOYSA-N C1=CC=CC=C1[Cu](C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 Chemical compound C1=CC=CC=C1[Cu](C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 RISUMPVKPHEEJG-UHFFFAOYSA-N 0.000 description 1
- 229920003043 Cellulose fiber Polymers 0.000 description 1
- BQRPKHOZMDAQPG-UHFFFAOYSA-J Cl[Ni](Cl)(Cl)Cl Chemical compound Cl[Ni](Cl)(Cl)Cl BQRPKHOZMDAQPG-UHFFFAOYSA-J 0.000 description 1
- MQJKPEGWNLWLTK-UHFFFAOYSA-N Dapsone Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=C1 MQJKPEGWNLWLTK-UHFFFAOYSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 101100386054 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) CYS3 gene Proteins 0.000 description 1
- 159000000021 acetate salts Chemical class 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- WDEQGLDWZMIMJM-UHFFFAOYSA-N benzyl 4-hydroxy-2-(hydroxymethyl)pyrrolidine-1-carboxylate Chemical compound OCC1CC(O)CN1C(=O)OCC1=CC=CC=C1 WDEQGLDWZMIMJM-UHFFFAOYSA-N 0.000 description 1
- UCMIRNVEIXFBKS-UHFFFAOYSA-N beta-alanine Chemical compound NCCC(O)=O UCMIRNVEIXFBKS-UHFFFAOYSA-N 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical group OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Chemical group 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 1
- 229940043430 calcium compound Drugs 0.000 description 1
- 150000001674 calcium compounds Chemical class 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 235000010980 cellulose Nutrition 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- MPMSMUBQXQALQI-UHFFFAOYSA-N cobalt phthalocyanine Chemical compound [Co+2].C12=CC=CC=C2C(N=C2[N-]C(C3=CC=CC=C32)=N2)=NC1=NC([C]1C=CC=CC1=1)=NC=1N=C1[C]3C=CC=CC3=C2[N-]1 MPMSMUBQXQALQI-UHFFFAOYSA-N 0.000 description 1
- 230000002860 competitive effect Effects 0.000 description 1
- QUQFTIVBFKLPCL-UHFFFAOYSA-L copper;2-amino-3-[(2-amino-2-carboxylatoethyl)disulfanyl]propanoate Chemical compound [Cu+2].[O-]C(=O)C(N)CSSCC(N)C([O-])=O QUQFTIVBFKLPCL-UHFFFAOYSA-L 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- VFQXVTODMYMSMJ-UHFFFAOYSA-N isonicotinamide Chemical compound NC(=O)C1=CC=NC=C1 VFQXVTODMYMSMJ-UHFFFAOYSA-N 0.000 description 1
- 239000010985 leather Substances 0.000 description 1
- 239000012669 liquid formulation Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- RIWRFSMVIUAEBX-UHFFFAOYSA-N n-methyl-1-phenylmethanamine Chemical compound CNCC1=CC=CC=C1 RIWRFSMVIUAEBX-UHFFFAOYSA-N 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 230000009965 odorless effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical group 0.000 description 1
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical group OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 1
- SIOXPEMLGUPBBT-UHFFFAOYSA-N picolinic acid Chemical compound OC(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-N 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M potassium chloride Inorganic materials [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 1
- 150000003112 potassium compounds Chemical class 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- KZVLNAGYSAKYMG-UHFFFAOYSA-N pyridine-2-sulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=N1 KZVLNAGYSAKYMG-UHFFFAOYSA-N 0.000 description 1
- XFIUZEAHIJGTTB-UHFFFAOYSA-N pyridine-4-sulfonamide Chemical compound NS(=O)(=O)C1=CC=NC=C1 XFIUZEAHIJGTTB-UHFFFAOYSA-N 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000000985 reactive dye Substances 0.000 description 1
- 238000009938 salting Methods 0.000 description 1
- 238000005185 salting out Methods 0.000 description 1
- 150000003336 secondary aromatic amines Chemical class 0.000 description 1
- 101150035983 str1 gene Proteins 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 229950000244 sulfanilic acid Drugs 0.000 description 1
- 125000000565 sulfonamide group Chemical group 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- XOAAWQZATWQOTB-UHFFFAOYSA-N taurine Chemical compound NCCS(O)(=O)=O XOAAWQZATWQOTB-UHFFFAOYSA-N 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 230000002110 toxicologic effect Effects 0.000 description 1
- 231100000027 toxicology Toxicity 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 210000002268 wool Anatomy 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B47/00—Porphines; Azaporphines
- C09B47/04—Phthalocyanines abbreviation: Pc
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/44—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group not directly attached to a heterocyclic ring
- C09B62/503—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group not directly attached to a heterocyclic ring the reactive group being an esterified or non-esterified hydroxyalkyl sulfonyl or mercaptoalkyl sulfonyl group, a quaternised or non-quaternised aminoalkyl sulfonyl group, a heterylmercapto alkyl sulfonyl group, a vinyl sulfonyl or a substituted vinyl sulfonyl group, or a thiophene-dioxide group
- C09B62/517—Porphines; Azaporphines
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19863603124 DE3603124A1 (de) | 1986-02-01 | 1986-02-01 | Verfahren zur herstellung von wasserloeslichen phthalocyaninfarbstoffen |
| DE3603124.0 | 1986-02-01 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS62185756A JPS62185756A (ja) | 1987-08-14 |
| JPH0583104B2 true JPH0583104B2 (enExample) | 1993-11-24 |
Family
ID=6293171
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP62018777A Granted JPS62185756A (ja) | 1986-02-01 | 1987-01-30 | 水溶性フタロシアニン染料の製法 |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4745187A (enExample) |
| EP (1) | EP0231837B1 (enExample) |
| JP (1) | JPS62185756A (enExample) |
| KR (1) | KR950003617B1 (enExample) |
| BR (1) | BR8700425A (enExample) |
| DE (2) | DE3603124A1 (enExample) |
| IN (1) | IN169433B (enExample) |
| MX (1) | MX168635B (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3727909A1 (de) * | 1987-08-21 | 1989-03-02 | Hoechst Ag | Wasserloesliche phthalocyaninverbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe |
| DE3930738B4 (de) * | 1988-09-23 | 2004-07-29 | Clariant Finance (Bvi) Ltd. | Phthalocyanin-Reaktivfarbstoffe, ihre Herstellung und ihre Verwendung |
| DE4016712A1 (de) * | 1990-05-24 | 1991-11-28 | Bayer Ag | Farbstoffgemische |
| TW222297B (enExample) * | 1991-08-09 | 1994-04-11 | Hoechst Ag | |
| DE4238047A1 (de) * | 1992-11-11 | 1994-05-19 | Basf Ag | Verfahren zur Herstellung von Phthalocyaninreaktivfarbstoffen |
| DE4242975A1 (de) * | 1992-12-18 | 1994-06-23 | Basf Ag | Verfahren zur Herstellung von Phthalocyaninreaktivfarbstoffen |
| DE4305453A1 (de) * | 1993-02-23 | 1994-08-25 | Bayer Ag | Reaktivfarbstoffblaumischungen mit verbesserter Metamerie |
| DE4311540A1 (de) * | 1993-04-07 | 1994-10-13 | Du Pont Deutschland | Photopolymerisierbare Druckschicht für Flexo-Druckplatten |
| EP0648815B1 (de) * | 1993-10-15 | 1998-07-29 | DyStar Textilfarben GmbH & Co. Deutschland KG | Wasserlösliche, metallfreie Phthalocyaninfarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung |
| DE19624469A1 (de) * | 1996-06-19 | 1998-01-02 | Dystar Textilfarben Gmbh & Co | Reaktive Aluminiumphthalocyaninfarbstoffe, Verfahren zu ihrer Herstellung und Verwendung |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IN150949B (enExample) * | 1978-06-02 | 1983-01-29 | Hoechst Ag | |
| GB2024837B (en) * | 1979-06-04 | 1982-11-03 | Hoechst Ag | Process for the reparation of water-soluble phthalocyanine dyestuffs |
| DE3025790A1 (de) * | 1980-07-08 | 1982-02-04 | Hoechst Ag, 6000 Frankfurt | Wasserloesliche phthalocyaninverbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe |
| DE3138864A1 (de) * | 1981-09-30 | 1983-04-14 | Hoechst Ag, 6230 Frankfurt | Wasserloesliche faserreaktive phthalocyaninverbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe |
-
1986
- 1986-02-01 DE DE19863603124 patent/DE3603124A1/de not_active Withdrawn
-
1987
- 1987-01-06 IN IN17/CAL/87A patent/IN169433B/en unknown
- 1987-01-23 DE DE8787100972T patent/DE3760390D1/de not_active Expired
- 1987-01-23 EP EP87100972A patent/EP0231837B1/de not_active Expired
- 1987-01-29 US US07/008,300 patent/US4745187A/en not_active Expired - Lifetime
- 1987-01-30 MX MX005096A patent/MX168635B/es unknown
- 1987-01-30 JP JP62018777A patent/JPS62185756A/ja active Granted
- 1987-01-30 KR KR1019870000731A patent/KR950003617B1/ko not_active Expired - Fee Related
- 1987-01-30 BR BR8700425A patent/BR8700425A/pt not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| EP0231837B1 (de) | 1989-08-02 |
| DE3760390D1 (en) | 1989-09-07 |
| EP0231837A2 (de) | 1987-08-12 |
| DE3603124A1 (de) | 1987-08-06 |
| BR8700425A (pt) | 1987-12-15 |
| KR870007989A (ko) | 1987-09-23 |
| KR950003617B1 (ko) | 1995-04-17 |
| EP0231837A3 (en) | 1987-10-21 |
| MX168635B (es) | 1993-06-02 |
| JPS62185756A (ja) | 1987-08-14 |
| US4745187A (en) | 1988-05-17 |
| IN169433B (enExample) | 1991-10-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR890002349B1 (ko) | 수용성 섬유-반응성 프탈로시아닌 화합물의 제조방법 | |
| JPH0583104B2 (enExample) | ||
| US4237050A (en) | Process for the preparation of water-soluble phthalocyanine dyestuffs | |
| US4952688A (en) | Water-soluble phthalocyanine compounds | |
| US4786728A (en) | Water-soluble triphendioxazine compounds | |
| US4350632A (en) | Water-soluble phthalocyanine compounds | |
| US5858026A (en) | Dicyclic metal complex formazan derivatives, process for producing the same, composition containing the same and dyeing process employing the same | |
| US4033980A (en) | Phthalocyanine dyestuffs and process for preparing them | |
| JPS6256188B2 (enExample) | ||
| JP2831406B2 (ja) | 水溶性染料、その製法及び用途 | |
| US5856472A (en) | Reactive aluminum phthalocyanine dyestuffs, processes for their preparation and their use | |
| US5302708A (en) | Water-soluble phthalocyanine dyes | |
| JPH0558462B2 (enExample) | ||
| US5015731A (en) | Copper complex formazan compounds containing a cyanamido-S-triazinylamino radical and a fiber-reactive group of the vinylsulfone series, suitable as dyes | |
| US5138041A (en) | Water-soluble fiber-reactive monoazo and disazo dyestuffs having a s-triazinylamino group and three fiber-reactive groups of the vinylsulfone series | |
| JPH07196938A (ja) | 水溶性の金属不含フタロシアニン染料、その製法及び 使用法 | |
| US5321134A (en) | Water-soluble phthalocyanine dyes, processes for their preparation and their use | |
| US4895954A (en) | Precursors for synthesis of triphendioxazine dyestuffs | |
| JPH07207177A (ja) | 水溶性フタロシアニン染料、その製造方法およびその用途 | |
| KR100455567B1 (ko) | 수용성 섬유-반응성 염료 | |
| GB2024837A (en) | Process for the Preparation of Water-Soluble Phthalocyanine Dyestuffs | |
| JPS6212261B2 (enExample) | ||
| US5539109A (en) | Fiber-reactive triphenodioxazine dyes | |
| US5256776A (en) | Water-soluble phthalocyanine dyestuffs, processes for their preparation and their use | |
| JPH01108266A (ja) | 反応性染料 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| LAPS | Cancellation because of no payment of annual fees |