JPH0152389B2 - - Google Patents
Info
- Publication number
- JPH0152389B2 JPH0152389B2 JP21497186A JP21497186A JPH0152389B2 JP H0152389 B2 JPH0152389 B2 JP H0152389B2 JP 21497186 A JP21497186 A JP 21497186A JP 21497186 A JP21497186 A JP 21497186A JP H0152389 B2 JPH0152389 B2 JP H0152389B2
- Authority
- JP
- Japan
- Prior art keywords
- formula
- aminocarbonyl
- compounds
- nitrophenyl
- reaction
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000001875 compounds Chemical class 0.000 claims description 40
- 229910052739 hydrogen Inorganic materials 0.000 claims description 19
- 125000000217 alkyl group Chemical group 0.000 claims description 14
- 229910052799 carbon Inorganic materials 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 241000196324 Embryophyta Species 0.000 description 29
- 239000000047 product Substances 0.000 description 29
- -1 Substituted -pyrimidinylsulfonyl Chemical group 0.000 description 27
- 238000006243 chemical reaction Methods 0.000 description 27
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 27
- 239000000243 solution Substances 0.000 description 26
- 238000002360 preparation method Methods 0.000 description 25
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 24
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 22
- 239000002904 solvent Substances 0.000 description 21
- 239000007787 solid Substances 0.000 description 20
- 239000001257 hydrogen Substances 0.000 description 18
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 18
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 16
- 239000000203 mixture Substances 0.000 description 16
- 239000000460 chlorine Substances 0.000 description 15
- 239000008187 granular material Substances 0.000 description 15
- 238000002844 melting Methods 0.000 description 15
- 230000008018 melting Effects 0.000 description 15
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 14
- 150000002431 hydrogen Chemical class 0.000 description 14
- 125000003118 aryl group Chemical group 0.000 description 13
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 12
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- 229910052801 chlorine Inorganic materials 0.000 description 12
- 239000002245 particle Substances 0.000 description 12
- VFWCMGCRMGJXDK-UHFFFAOYSA-N 1-chlorobutane Chemical compound CCCCCl VFWCMGCRMGJXDK-UHFFFAOYSA-N 0.000 description 11
- 240000007594 Oryza sativa Species 0.000 description 11
- 235000007164 Oryza sativa Nutrition 0.000 description 11
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 11
- 241000209140 Triticum Species 0.000 description 11
- 235000021307 Triticum Nutrition 0.000 description 11
- 239000004009 herbicide Substances 0.000 description 11
- 239000004615 ingredient Substances 0.000 description 11
- 235000009566 rice Nutrition 0.000 description 11
- 239000000725 suspension Substances 0.000 description 11
- 238000011282 treatment Methods 0.000 description 11
- 238000000034 method Methods 0.000 description 10
- 150000003839 salts Chemical class 0.000 description 10
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 9
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 9
- 229910052794 bromium Inorganic materials 0.000 description 9
- 239000007788 liquid Substances 0.000 description 9
- 239000000463 material Substances 0.000 description 9
- 238000001914 filtration Methods 0.000 description 8
- 239000012948 isocyanate Substances 0.000 description 8
- QPJVMBTYPHYUOC-UHFFFAOYSA-N methyl benzoate Chemical compound COC(=O)C1=CC=CC=C1 QPJVMBTYPHYUOC-UHFFFAOYSA-N 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- 239000000126 substance Substances 0.000 description 8
- 229940124530 sulfonamide Drugs 0.000 description 8
- 150000003456 sulfonamides Chemical class 0.000 description 8
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 8
- 229960000892 attapulgite Drugs 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- 229910052625 palygorskite Inorganic materials 0.000 description 7
- 239000002244 precipitate Substances 0.000 description 7
- 239000004563 wettable powder Substances 0.000 description 7
- QVCUKHQDEZNNOC-UHFFFAOYSA-N 1,2-diazabicyclo[2.2.2]octane Chemical compound C1CC2CCN1NC2 QVCUKHQDEZNNOC-UHFFFAOYSA-N 0.000 description 6
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- 244000068988 Glycine max Species 0.000 description 6
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 6
- 244000062793 Sorghum vulgare Species 0.000 description 6
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 6
- 240000008042 Zea mays Species 0.000 description 6
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 6
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 6
- 235000005822 corn Nutrition 0.000 description 6
- 230000002363 herbicidal effect Effects 0.000 description 6
- 150000002513 isocyanates Chemical class 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- SQGYOTSLMSWVJD-UHFFFAOYSA-N silver(1+) nitrate Chemical compound [Ag+].[O-]N(=O)=O SQGYOTSLMSWVJD-UHFFFAOYSA-N 0.000 description 6
- 239000002689 soil Substances 0.000 description 6
- 239000008096 xylene Substances 0.000 description 6
- 235000010469 Glycine max Nutrition 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 5
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 5
- 239000004480 active ingredient Substances 0.000 description 5
- 239000003085 diluting agent Substances 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- HNHVTXYLRVGMHD-UHFFFAOYSA-N n-butyl isocyanate Chemical compound CCCCN=C=O HNHVTXYLRVGMHD-UHFFFAOYSA-N 0.000 description 5
- 239000003921 oil Substances 0.000 description 5
- 235000019198 oils Nutrition 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- HTAXOAKNMIFKSU-UHFFFAOYSA-N 1-(4,6-dimethoxypyrimidin-2-yl)-3-[(2-nitrophenyl)methylsulfonyl]urea Chemical compound COC1=CC(OC)=NC(NC(=O)NS(=O)(=O)CC=2C(=CC=CC=2)[N+]([O-])=O)=N1 HTAXOAKNMIFKSU-UHFFFAOYSA-N 0.000 description 4
- 240000006995 Abutilon theophrasti Species 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- 235000007320 Avena fatua Nutrition 0.000 description 4
- 241000209764 Avena fatua Species 0.000 description 4
- 229920000742 Cotton Polymers 0.000 description 4
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- 239000011737 fluorine Substances 0.000 description 4
- 229910052731 fluorine Inorganic materials 0.000 description 4
- 239000000543 intermediate Substances 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 239000004576 sand Substances 0.000 description 4
- 241000894007 species Species 0.000 description 4
- 238000005507 spraying Methods 0.000 description 4
- BUXTXUBQAKIQKS-UHFFFAOYSA-N sulfuryl diisocyanate Chemical compound O=C=NS(=O)(=O)N=C=O BUXTXUBQAKIQKS-UHFFFAOYSA-N 0.000 description 4
- 238000003786 synthesis reaction Methods 0.000 description 4
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- 244000201986 Cassia tora Species 0.000 description 3
- 235000014552 Cassia tora Nutrition 0.000 description 3
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 3
- 235000017896 Digitaria Nutrition 0.000 description 3
- 241001303487 Digitaria <clam> Species 0.000 description 3
- 235000001602 Digitaria X umfolozi Nutrition 0.000 description 3
- 240000003176 Digitaria ciliaris Species 0.000 description 3
- 235000017898 Digitaria ciliaris Nutrition 0.000 description 3
- 235000005476 Digitaria cruciata Nutrition 0.000 description 3
- 235000006830 Digitaria didactyla Nutrition 0.000 description 3
- 235000005804 Digitaria eriantha ssp. eriantha Nutrition 0.000 description 3
- 235000010823 Digitaria sanguinalis Nutrition 0.000 description 3
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 3
- 244000058871 Echinochloa crus-galli Species 0.000 description 3
- 235000014716 Eleusine indica Nutrition 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 235000011999 Panicum crusgalli Nutrition 0.000 description 3
- ISAKRJDGNUQOIC-UHFFFAOYSA-N Uracil Chemical class O=C1C=CNC(=O)N1 ISAKRJDGNUQOIC-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 239000000010 aprotic solvent Substances 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 230000003197 catalytic effect Effects 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- 238000011156 evaluation Methods 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 230000012010 growth Effects 0.000 description 3
- 125000000623 heterocyclic group Chemical group 0.000 description 3
- 229910052500 inorganic mineral Inorganic materials 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- HNQIVZYLYMDVSB-UHFFFAOYSA-N methanesulfonimidic acid Chemical compound CS(N)(=O)=O HNQIVZYLYMDVSB-UHFFFAOYSA-N 0.000 description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 3
- 239000011707 mineral Substances 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 239000004033 plastic Substances 0.000 description 3
- 229920003023 plastic Polymers 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- ADZWSOLPGZMUMY-UHFFFAOYSA-M silver bromide Chemical compound [Ag]Br ADZWSOLPGZMUMY-UHFFFAOYSA-M 0.000 description 3
- 229910001961 silver nitrate Inorganic materials 0.000 description 3
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 3
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 3
- 239000002562 thickening agent Substances 0.000 description 3
- ICRCGYUJMWBKJQ-UHFFFAOYSA-N (2-methylsulfonylphenyl)methanesulfonamide Chemical compound CS(=O)(=O)C1=CC=CC=C1CS(N)(=O)=O ICRCGYUJMWBKJQ-UHFFFAOYSA-N 0.000 description 2
- ISTVKPVROGPHTI-UHFFFAOYSA-N (2-methylsulfonylphenyl)methanesulfonyl chloride Chemical compound CS(=O)(=O)C1=CC=CC=C1CS(Cl)(=O)=O ISTVKPVROGPHTI-UHFFFAOYSA-N 0.000 description 2
- HHHPBOLNRBDDIN-UHFFFAOYSA-N (2-methylsulfonylphenyl)methyl carbamimidothioate;hydrobromide Chemical compound Br.CS(=O)(=O)C1=CC=CC=C1CSC(N)=N HHHPBOLNRBDDIN-UHFFFAOYSA-N 0.000 description 2
- SNCFSWRNEADGAI-UHFFFAOYSA-N (2-nitrophenyl)methanesulfonamide Chemical compound NS(=O)(=O)CC1=CC=CC=C1[N+]([O-])=O SNCFSWRNEADGAI-UHFFFAOYSA-N 0.000 description 2
- FUEFNUGYRWQHTH-UHFFFAOYSA-N (2-nitrophenyl)methanesulfonyl chloride Chemical compound [O-][N+](=O)C1=CC=CC=C1CS(Cl)(=O)=O FUEFNUGYRWQHTH-UHFFFAOYSA-N 0.000 description 2
- UOMAUCLXHRHFRD-UHFFFAOYSA-N (2-nitrophenyl)methyl carbamimidothioate;hydrochloride Chemical compound Cl.NC(=N)SCC1=CC=CC=C1[N+]([O-])=O UOMAUCLXHRHFRD-UHFFFAOYSA-N 0.000 description 2
- LKUSKRMVUBLXDH-UHFFFAOYSA-N 1-(2-methylsulfonylphenyl)-n-(oxomethylidene)methanesulfonamide Chemical compound CS(=O)(=O)C1=CC=CC=C1CS(=O)(=O)N=C=O LKUSKRMVUBLXDH-UHFFFAOYSA-N 0.000 description 2
- SDQPJVPIWHFCES-UHFFFAOYSA-N 1-(2-nitrophenyl)-n-(oxomethylidene)ethanesulfonamide Chemical compound O=C=NS(=O)(=O)C(C)C1=CC=CC=C1[N+]([O-])=O SDQPJVPIWHFCES-UHFFFAOYSA-N 0.000 description 2
- JRSRXSLMRDOUBE-UHFFFAOYSA-N 1-(2-nitrophenyl)-n-(oxomethylidene)methanesulfonamide Chemical compound [O-][N+](=O)C1=CC=CC=C1CS(=O)(=O)N=C=O JRSRXSLMRDOUBE-UHFFFAOYSA-N 0.000 description 2
- ILVLQAASRSQQDM-UHFFFAOYSA-N 1-(2-nitrophenyl)ethanesulfonamide Chemical compound NS(=O)(=O)C(C)C1=CC=CC=C1[N+]([O-])=O ILVLQAASRSQQDM-UHFFFAOYSA-N 0.000 description 2
- OGRHYKRDIGQZIR-UHFFFAOYSA-N 1-(2-nitrophenyl)ethanesulfonyl chloride Chemical compound ClS(=O)(=O)C(C)C1=CC=CC=C1[N+]([O-])=O OGRHYKRDIGQZIR-UHFFFAOYSA-N 0.000 description 2
- OOXBILMPVRVXOC-UHFFFAOYSA-N 1-(2-nitrophenyl)ethyl carbamimidothioate;hydrobromide Chemical compound Br.NC(=N)SC(C)C1=CC=CC=C1[N+]([O-])=O OOXBILMPVRVXOC-UHFFFAOYSA-N 0.000 description 2
- QWRBSNOOIBLILY-UHFFFAOYSA-N 1-(4,6-dimethoxypyrimidin-2-yl)-3-[1-(2-nitrophenyl)ethylsulfonyl]urea Chemical compound COC1=CC(OC)=NC(NC(=O)NS(=O)(=O)C(C)C=2C(=CC=CC=2)[N+]([O-])=O)=N1 QWRBSNOOIBLILY-UHFFFAOYSA-N 0.000 description 2
- NYOVEYKGZYLOPT-UHFFFAOYSA-N 1-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)-3-[(2-nitrophenyl)methylsulfonyl]urea Chemical compound COC1=NC(C)=NC(NC(=O)NS(=O)(=O)CC=2C(=CC=CC=2)[N+]([O-])=O)=N1 NYOVEYKGZYLOPT-UHFFFAOYSA-N 0.000 description 2
- XSEZQSLGRZXPKV-UHFFFAOYSA-N 1-(4-methoxy-6-methylpyrimidin-2-yl)-3-[(2-nitrophenyl)methylsulfonyl]urea Chemical compound COC1=CC(C)=NC(NC(=O)NS(=O)(=O)CC=2C(=CC=CC=2)[N+]([O-])=O)=N1 XSEZQSLGRZXPKV-UHFFFAOYSA-N 0.000 description 2
- BGNSUIXBZRGZOV-UHFFFAOYSA-N 1-butyl-3-[(2-methylsulfonylphenyl)methylsulfonyl]urea Chemical compound CCCCNC(=O)NS(=O)(=O)CC1=CC=CC=C1S(C)(=O)=O BGNSUIXBZRGZOV-UHFFFAOYSA-N 0.000 description 2
- LVFRCHIUUKWBLR-UHFFFAOYSA-N 4,6-dimethoxypyrimidin-2-amine Chemical compound COC1=CC(OC)=NC(N)=N1 LVFRCHIUUKWBLR-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- 244000075850 Avena orientalis Species 0.000 description 2
- 235000007563 Barbarea vulgaris Nutrition 0.000 description 2
- 235000004977 Brassica sinapistrum Nutrition 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- 241000209202 Bromus secalinus Species 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 235000016854 Cyperus rotundus Nutrition 0.000 description 2
- 244000075634 Cyperus rotundus Species 0.000 description 2
- 241000219146 Gossypium Species 0.000 description 2
- 240000005979 Hordeum vulgare Species 0.000 description 2
- 235000007340 Hordeum vulgare Nutrition 0.000 description 2
- 241000207783 Ipomoea Species 0.000 description 2
- 235000021506 Ipomoea Nutrition 0.000 description 2
- 241000110847 Kochia Species 0.000 description 2
- 235000003403 Limnocharis flava Nutrition 0.000 description 2
- 244000100545 Lolium multiflorum Species 0.000 description 2
- 241001268782 Paspalum dilatatum Species 0.000 description 2
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 2
- 241001355178 Setaria faberi Species 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 244000061457 Solanum nigrum Species 0.000 description 2
- 235000002594 Solanum nigrum Nutrition 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 241000219793 Trifolium Species 0.000 description 2
- 241001506766 Xanthium Species 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 238000005054 agglomeration Methods 0.000 description 2
- 230000002776 aggregation Effects 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 2
- SOUGLODYPBMACB-UHFFFAOYSA-N butane;hydrate Chemical compound O.CCCC SOUGLODYPBMACB-UHFFFAOYSA-N 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 235000008504 concentrate Nutrition 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- XLJMAIOERFSOGZ-UHFFFAOYSA-M cyanate Chemical compound [O-]C#N XLJMAIOERFSOGZ-UHFFFAOYSA-M 0.000 description 2
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 2
- YDEXUEFDPVHGHE-GGMCWBHBSA-L disodium;(2r)-3-(2-hydroxy-3-methoxyphenyl)-2-[2-methoxy-4-(3-sulfonatopropyl)phenoxy]propane-1-sulfonate Chemical compound [Na+].[Na+].COC1=CC=CC(C[C@H](CS([O-])(=O)=O)OC=2C(=CC(CCCS([O-])(=O)=O)=CC=2)OC)=C1O YDEXUEFDPVHGHE-GGMCWBHBSA-L 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 238000005243 fluidization Methods 0.000 description 2
- 235000013305 food Nutrition 0.000 description 2
- 230000035784 germination Effects 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 230000002218 hypoglycaemic effect Effects 0.000 description 2
- 238000002329 infrared spectrum Methods 0.000 description 2
- 229920000609 methyl cellulose Polymers 0.000 description 2
- 239000001923 methylcellulose Substances 0.000 description 2
- 235000010981 methylcellulose Nutrition 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- XSXHWVKGUXMUQE-UHFFFAOYSA-N osmium dioxide Inorganic materials O=[Os]=O XSXHWVKGUXMUQE-UHFFFAOYSA-N 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- 229910052903 pyrophyllite Inorganic materials 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 239000001488 sodium phosphate Substances 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 238000003860 storage Methods 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- 229910002029 synthetic silica gel Inorganic materials 0.000 description 2
- 229960000278 theophylline Drugs 0.000 description 2
- ZFXYFBGIUFBOJW-UHFFFAOYSA-N theophylline Chemical compound O=C1N(C)C(=O)N(C)C2=C1NC=N2 ZFXYFBGIUFBOJW-UHFFFAOYSA-N 0.000 description 2
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- WYRSGXAIHNMKOL-UHFFFAOYSA-N $l^{1}-sulfanylethane Chemical compound CC[S] WYRSGXAIHNMKOL-UHFFFAOYSA-N 0.000 description 1
- QSLPNSWXUQHVLP-UHFFFAOYSA-N $l^{1}-sulfanylmethane Chemical compound [S]C QSLPNSWXUQHVLP-UHFFFAOYSA-N 0.000 description 1
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical compound C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 1
- FHKIGGSCRYVAMY-UHFFFAOYSA-N 1-(1-bromoethyl)-2-nitrobenzene Chemical compound CC(Br)C1=CC=CC=C1[N+]([O-])=O FHKIGGSCRYVAMY-UHFFFAOYSA-N 0.000 description 1
- UVKIRNJVBHYNDH-UHFFFAOYSA-N 1-(4,6-dimethoxy-1,3,5-triazin-2-yl)-3-[(2-nitrophenyl)methylsulfonyl]urea Chemical compound COC1=NC(OC)=NC(NC(=O)NS(=O)(=O)CC=2C(=CC=CC=2)[N+]([O-])=O)=N1 UVKIRNJVBHYNDH-UHFFFAOYSA-N 0.000 description 1
- FZJRFAFARJTHPL-UHFFFAOYSA-N 1-(4,6-dimethoxypyrimidin-2-yl)-3-[(2-methylsulfonylphenyl)methylsulfonyl]urea Chemical compound COC1=CC(OC)=NC(NC(=O)NS(=O)(=O)CC=2C(=CC=CC=2)S(C)(=O)=O)=N1 FZJRFAFARJTHPL-UHFFFAOYSA-N 0.000 description 1
- ZBLBWTFICJOODX-UHFFFAOYSA-N 1-(bromomethyl)-2-methylsulfonylbenzene Chemical compound CS(=O)(=O)C1=CC=CC=C1CBr ZBLBWTFICJOODX-UHFFFAOYSA-N 0.000 description 1
- BXCBUWKTXLWPSB-UHFFFAOYSA-N 1-(chloromethyl)-2-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1CCl BXCBUWKTXLWPSB-UHFFFAOYSA-N 0.000 description 1
- CYEJMVLDXAUOPN-UHFFFAOYSA-N 2-dodecylphenol Chemical compound CCCCCCCCCCCCC1=CC=CC=C1O CYEJMVLDXAUOPN-UHFFFAOYSA-N 0.000 description 1
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 1
- 240000004731 Acer pseudoplatanus Species 0.000 description 1
- 235000002754 Acer pseudoplatanus Nutrition 0.000 description 1
- 235000007756 Akebia quinata Nutrition 0.000 description 1
- 240000008027 Akebia quinata Species 0.000 description 1
- 241001621841 Alopecurus myosuroides Species 0.000 description 1
- 235000013479 Amaranthus retroflexus Nutrition 0.000 description 1
- 244000237956 Amaranthus retroflexus Species 0.000 description 1
- 241000490495 Barbarea Species 0.000 description 1
- 240000008399 Barbarea vulgaris Species 0.000 description 1
- KHBQMWCZKVMBLN-UHFFFAOYSA-N Benzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=C1 KHBQMWCZKVMBLN-UHFFFAOYSA-N 0.000 description 1
- 241000219310 Beta vulgaris subsp. vulgaris Species 0.000 description 1
- 244000078782 Brassica arvensis Species 0.000 description 1
- 235000008427 Brassica arvensis Nutrition 0.000 description 1
- 244000024671 Brassica kaber Species 0.000 description 1
- 235000014750 Brassica kaber Nutrition 0.000 description 1
- 241000209200 Bromus Species 0.000 description 1
- 241001193547 Bromus diandrus var. rigidus Species 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 244000025254 Cannabis sativa Species 0.000 description 1
- 241000220244 Capsella <angiosperm> Species 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 235000006719 Cassia obtusifolia Nutrition 0.000 description 1
- 244000277285 Cassia obtusifolia Species 0.000 description 1
- 244000192528 Chrysanthemum parthenium Species 0.000 description 1
- 241000208296 Datura Species 0.000 description 1
- 240000008853 Datura stramonium Species 0.000 description 1
- 240000000532 Descurainia pinnata Species 0.000 description 1
- 235000014257 Descurainia pinnata Nutrition 0.000 description 1
- 235000017680 Descurainia sophia Nutrition 0.000 description 1
- 235000012827 Digitaria sp Nutrition 0.000 description 1
- 241000508725 Elymus repens Species 0.000 description 1
- 241001289540 Fallopia convolvulus Species 0.000 description 1
- 206010053759 Growth retardation Diseases 0.000 description 1
- 241000209219 Hordeum Species 0.000 description 1
- 240000001549 Ipomoea eriocarpa Species 0.000 description 1
- 235000005146 Ipomoea eriocarpa Nutrition 0.000 description 1
- 240000007218 Ipomoea hederacea Species 0.000 description 1
- 229930194542 Keto Natural products 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 229920001732 Lignosulfonate Polymers 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 235000017945 Matricaria Nutrition 0.000 description 1
- 235000007232 Matricaria chamomilla Nutrition 0.000 description 1
- FMINYZXVCTYSNY-UHFFFAOYSA-N Methyldymron Chemical compound C=1C=CC=CC=1N(C)C(=O)NC(C)(C)C1=CC=CC=C1 FMINYZXVCTYSNY-UHFFFAOYSA-N 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- 235000019502 Orange oil Nutrition 0.000 description 1
- 241000233855 Orchidaceae Species 0.000 description 1
- 244000046052 Phaseolus vulgaris Species 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 235000001982 Physalis edulis Nutrition 0.000 description 1
- 240000004001 Physalis peruviana Species 0.000 description 1
- 208000012641 Pigmentation disease Diseases 0.000 description 1
- 235000006485 Platanus occidentalis Nutrition 0.000 description 1
- 244000292693 Poa annua Species 0.000 description 1
- 241000209049 Poa pratensis Species 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 241000205407 Polygonum Species 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 241000920652 Quercus lusitanica Species 0.000 description 1
- 229910006074 SO2NH2 Inorganic materials 0.000 description 1
- 244000124765 Salsola kali Species 0.000 description 1
- 235000007658 Salsola kali Nutrition 0.000 description 1
- 241000533293 Sesbania emerus Species 0.000 description 1
- 240000003461 Setaria viridis Species 0.000 description 1
- 235000002248 Setaria viridis Nutrition 0.000 description 1
- 240000006410 Sida spinosa Species 0.000 description 1
- 241000220263 Sisymbrium Species 0.000 description 1
- 235000005647 Sisymbrium altissimum Nutrition 0.000 description 1
- 244000174087 Sisymbrium altissimum Species 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- 240000002439 Sorghum halepense Species 0.000 description 1
- 235000021536 Sugar beet Nutrition 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 244000098338 Triticum aestivum Species 0.000 description 1
- 241001506773 Xanthium sp. Species 0.000 description 1
- RKZXQQPEDGMHBJ-LIGJGSPWSA-N [(2s,3r,4r,5r)-2,3,4,5,6-pentakis[[(z)-octadec-9-enoyl]oxy]hexyl] (z)-octadec-9-enoate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OC[C@@H](OC(=O)CCCCCCC\C=C/CCCCCCCC)[C@@H](OC(=O)CCCCCCC\C=C/CCCCCCCC)[C@H](OC(=O)CCCCCCC\C=C/CCCCCCCC)[C@@H](OC(=O)CCCCCCC\C=C/CCCCCCCC)COC(=O)CCCCCCC\C=C/CCCCCCCC RKZXQQPEDGMHBJ-LIGJGSPWSA-N 0.000 description 1
- NREZYYOKSDXACH-UHFFFAOYSA-N [2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoylmethyl]phenyl] methanesulfonate Chemical compound COC1=CC(OC)=NC(NC(=O)NS(=O)(=O)CC=2C(=CC=CC=2)OS(C)(=O)=O)=N1 NREZYYOKSDXACH-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000274 adsorptive effect Effects 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 239000003905 agrochemical Substances 0.000 description 1
- 238000007605 air drying Methods 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000005005 aminopyrimidines Chemical class 0.000 description 1
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 239000003472 antidiabetic agent Substances 0.000 description 1
- 229940125708 antidiabetic agent Drugs 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 238000000889 atomisation Methods 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- PPWBRCCBKOWDNB-UHFFFAOYSA-N bensulfuron Chemical compound COC1=CC(OC)=NC(NC(=O)NS(=O)(=O)CC=2C(=CC=CC=2)C(O)=O)=N1 PPWBRCCBKOWDNB-UHFFFAOYSA-N 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- 150000005524 benzylchlorides Chemical class 0.000 description 1
- 125000002619 bicyclic group Chemical group 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- HKPHPIREJKHECO-UHFFFAOYSA-N butachlor Chemical compound CCCCOCN(C(=O)CCl)C1=C(CC)C=CC=C1CC HKPHPIREJKHECO-UHFFFAOYSA-N 0.000 description 1
- CNWSQCLBDWYLAN-UHFFFAOYSA-N butylurea Chemical compound CCCCNC(N)=O CNWSQCLBDWYLAN-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- RYAGRZNBULDMBW-UHFFFAOYSA-L calcium;3-(2-hydroxy-3-methoxyphenyl)-2-[2-methoxy-4-(3-sulfonatopropyl)phenoxy]propane-1-sulfonate Chemical compound [Ca+2].COC1=CC=CC(CC(CS([O-])(=O)=O)OC=2C(=CC(CCCS([O-])(=O)=O)=CC=2)OC)=C1O RYAGRZNBULDMBW-UHFFFAOYSA-L 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 229960004424 carbon dioxide Drugs 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 238000003889 chemical engineering Methods 0.000 description 1
- 239000007810 chemical reaction solvent Substances 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 150000001923 cyclic compounds Chemical class 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000007812 deficiency Effects 0.000 description 1
- 230000035613 defoliation Effects 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 1
- KWABLUYIOFEZOY-UHFFFAOYSA-N dioctyl butanedioate Chemical compound CCCCCCCCOC(=O)CCC(=O)OCCCCCCCC KWABLUYIOFEZOY-UHFFFAOYSA-N 0.000 description 1
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 1
- 229910000397 disodium phosphate Inorganic materials 0.000 description 1
- 235000019800 disodium phosphate Nutrition 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 230000008029 eradication Effects 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000004880 explosion Methods 0.000 description 1
- 210000003608 fece Anatomy 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 239000001963 growth medium Substances 0.000 description 1
- 231100000001 growth retardation Toxicity 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 239000012456 homogeneous solution Substances 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- GRHBQAYDJPGGLF-UHFFFAOYSA-N isothiocyanic acid Chemical compound N=C=S GRHBQAYDJPGGLF-UHFFFAOYSA-N 0.000 description 1
- 229910052622 kaolinite Inorganic materials 0.000 description 1
- CYPPCCJJKNISFK-UHFFFAOYSA-J kaolinite Chemical compound [OH-].[OH-].[OH-].[OH-].[Al+3].[Al+3].[O-][Si](=O)O[Si]([O-])=O CYPPCCJJKNISFK-UHFFFAOYSA-J 0.000 description 1
- 239000010871 livestock manure Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- DBOUFTHAEAVMJC-UHFFFAOYSA-N methyl 2-(sulfamoylmethyl)benzoate Chemical compound COC(=O)C1=CC=CC=C1CS(N)(=O)=O DBOUFTHAEAVMJC-UHFFFAOYSA-N 0.000 description 1
- ULYFCBYLOKDMSS-UHFFFAOYSA-N methyl 2-[(4,6-dimethylpyrimidin-2-yl)carbamoylsulfamoylmethyl]benzoate Chemical compound COC(=O)C1=CC=CC=C1CS(=O)(=O)NC(=O)NC1=NC(C)=CC(C)=N1 ULYFCBYLOKDMSS-UHFFFAOYSA-N 0.000 description 1
- 230000000813 microbial effect Effects 0.000 description 1
- 235000019713 millet Nutrition 0.000 description 1
- 238000003801 milling Methods 0.000 description 1
- 239000003595 mist Substances 0.000 description 1
- 229910000403 monosodium phosphate Inorganic materials 0.000 description 1
- 235000019799 monosodium phosphate Nutrition 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 231100001184 nonphytotoxic Toxicity 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- 239000010502 orange oil Substances 0.000 description 1
- 239000005416 organic matter Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- 235000020030 perry Nutrition 0.000 description 1
- 230000002688 persistence Effects 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 238000005191 phase separation Methods 0.000 description 1
- ABOYDMHGKWRPFD-UHFFFAOYSA-N phenylmethanesulfonamide Chemical compound NS(=O)(=O)CC1=CC=CC=C1 ABOYDMHGKWRPFD-UHFFFAOYSA-N 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000002373 plant growth inhibitor Substances 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 235000014483 powder concentrate Nutrition 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 239000003586 protic polar solvent Substances 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 description 1
- 238000010791 quenching Methods 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000007670 refining Methods 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- AJPJDKMHJJGVTQ-UHFFFAOYSA-M sodium dihydrogen phosphate Chemical compound [Na+].OP(O)([O-])=O AJPJDKMHJJGVTQ-UHFFFAOYSA-M 0.000 description 1
- 239000008247 solid mixture Substances 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 238000003892 spreading Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 238000005987 sulfurization reaction Methods 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 125000001302 tertiary amino group Chemical group 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 229940035893 uracil Drugs 0.000 description 1
- 238000001238 wet grinding Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- 238000004383 yellowing Methods 0.000 description 1
Landscapes
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (3)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US20363880A | 1980-11-03 | 1980-11-03 | |
US203638 | 1980-11-03 | ||
US306212 | 1981-09-29 |
Publications (2)
Publication Number | Publication Date |
---|---|
JPS62103059A JPS62103059A (ja) | 1987-05-13 |
JPH0152389B2 true JPH0152389B2 (pl) | 1989-11-08 |
Family
ID=22754736
Family Applications (3)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
JP56174697A Granted JPS57112379A (en) | 1980-11-03 | 1981-11-02 | Herbicidal sulfonamides |
JP21497086A Granted JPS62116567A (ja) | 1980-11-03 | 1986-09-11 | ベンジルスルホニル尿素類及びその利用 |
JP21497186A Granted JPS62103059A (ja) | 1980-11-03 | 1986-09-11 | ベンゼンメタンスルホニルイソシアネ−ト類 |
Family Applications Before (2)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
JP56174697A Granted JPS57112379A (en) | 1980-11-03 | 1981-11-02 | Herbicidal sulfonamides |
JP21497086A Granted JPS62116567A (ja) | 1980-11-03 | 1986-09-11 | ベンジルスルホニル尿素類及びその利用 |
Country Status (1)
Country | Link |
---|---|
JP (3) | JPS57112379A (pl) |
Families Citing this family (10)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
JPH02131412A (ja) * | 1982-11-04 | 1990-05-21 | E I Du Pont De Nemours & Co | 水稲用複合除草剤 |
JPS5982306A (ja) * | 1982-11-04 | 1984-05-12 | イ−・アイ・デユポン・デ・ニモアス・アンド・カンパニ− | 水田雑草除草方法 |
DD238318A5 (de) * | 1984-08-30 | 1986-08-20 | Bayer Ag,De | Herbizide mittel |
JPS6187670A (ja) * | 1984-10-05 | 1986-05-06 | S D S Baiotetsuku:Kk | スルホニルアセトアミド誘導体及び除草剤 |
JPH0655650B2 (ja) * | 1984-11-06 | 1994-07-27 | 三共株式会社 | 除草剤組成物 |
JPS63179806A (ja) * | 1987-01-21 | 1988-07-23 | Kumiai Chem Ind Co Ltd | 除草剤組成物 |
JP2546200B2 (ja) * | 1991-02-20 | 1996-10-23 | 東ソー株式会社 | 田植前湛水下水田除草用水性懸濁製剤および散布方法 |
JPH04308605A (ja) * | 1991-04-08 | 1992-10-30 | Sumitomo Metal Ind Ltd | 銅導体ペースト |
JP3270819B2 (ja) * | 1997-02-13 | 2002-04-02 | 北興化学工業株式会社 | 湛水下水田の直接散布用水性懸濁製剤 |
JP3270825B2 (ja) * | 1997-02-14 | 2002-04-02 | 北興化学工業株式会社 | 湛水下水田の直接散布用水性懸濁製剤 |
-
1981
- 1981-11-02 JP JP56174697A patent/JPS57112379A/ja active Granted
-
1986
- 1986-09-11 JP JP21497086A patent/JPS62116567A/ja active Granted
- 1986-09-11 JP JP21497186A patent/JPS62103059A/ja active Granted
Also Published As
Publication number | Publication date |
---|---|
JPS626705B2 (pl) | 1987-02-13 |
JPS6251954B2 (pl) | 1987-11-02 |
JPS62116567A (ja) | 1987-05-28 |
JPS57112379A (en) | 1982-07-13 |
JPS62103059A (ja) | 1987-05-13 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
US4420325A (en) | Herbicidal sulfonamides | |
EP0009419B1 (en) | Agricultural sulfonamides, and preparation and use thereof | |
US4214890A (en) | Herbicidal pyrimidine and triazine sulfonamides | |
EP0094260B1 (en) | Herbicidal heterocyclic alkylaminocarbonylsulfonamides | |
EP0117014B1 (en) | Herbicidal n-hydroxy-n'-sulfonylguanidines and sulfonamide inner salts | |
CS199741B2 (en) | Herbicide | |
CA1107283A (en) | Agricultural carbamimidothioates | |
EP0070698B1 (en) | Herbicidal indole sulfonamides | |
US4301286A (en) | Herbicidal O-alkyl sulfonylisoureas | |
EP0051466B1 (en) | Herbicidal sulfonamides | |
EP0073627B1 (en) | Herbicidal sulfonamides | |
KR850000633B1 (ko) | 설폰아미드의 제조방법 | |
JPH0152389B2 (pl) | ||
US4528024A (en) | Herbicidal alkyl sulfones | |
US4668281A (en) | Thiophenesulfonamides | |
EP0113956A1 (en) | Herbicidal phenoxy esters of N-((heterocyclic)aminocarbonyl) sulfamic acid | |
US4632693A (en) | Herbicidal sulfonamides | |
US4543120A (en) | Alkyl sulfonyl sulfonamides | |
US4293330A (en) | Herbicidal N-(pyridinylaminocarbonyl)benzenesulfonamides | |
US4689070A (en) | Herbicidal N-hydroxy-N'-sulfonylguanidines | |
US4750930A (en) | Herbicidal N-hydroxy-N'-sulfonylguanidines | |
US4555261A (en) | Herbicidal sulfonamides | |
US4604131A (en) | Herbicidal sulfonamides | |
JPS6325588B2 (pl) | ||
US4741757A (en) | Thiophenesulfonamides |