IT996889B - Cavo ad alta tensione per pistole a mano per spruzzatura elettrosta tica - Google Patents
Cavo ad alta tensione per pistole a mano per spruzzatura elettrosta ticaInfo
- Publication number
- IT996889B IT996889B IT70162/73A IT7016273A IT996889B IT 996889 B IT996889 B IT 996889B IT 70162/73 A IT70162/73 A IT 70162/73A IT 7016273 A IT7016273 A IT 7016273A IT 996889 B IT996889 B IT 996889B
- Authority
- IT
- Italy
- Prior art keywords
- electrosta
- tica
- spraying
- high voltage
- voltage cable
- Prior art date
Links
- HTFVKMHFUBCIMH-UHFFFAOYSA-N 1,3,5-triiodo-1,3,5-triazinane-2,4,6-trione Chemical compound IN1C(=O)N(I)C(=O)N(I)C1=O HTFVKMHFUBCIMH-UHFFFAOYSA-N 0.000 title 1
- 238000005507 spraying Methods 0.000 title 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01B—CABLES; CONDUCTORS; INSULATORS; SELECTION OF MATERIALS FOR THEIR CONDUCTIVE, INSULATING OR DIELECTRIC PROPERTIES
- H01B7/00—Insulated conductors or cables characterised by their form
- H01B7/0054—Cables with incorporated electric resistances
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US34724073A | 1973-04-02 | 1973-04-02 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IT996889B true IT996889B (it) | 1975-12-10 |
Family
ID=23362897
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IT70162/73A IT996889B (it) | 1973-04-02 | 1973-10-25 | Cavo ad alta tensione per pistole a mano per spruzzatura elettrosta tica |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3792409A (enFirst) |
| JP (1) | JPS50381A (enFirst) |
| AU (1) | AU472386B2 (enFirst) |
| CA (1) | CA991286A (enFirst) |
| DE (1) | DE2353809A1 (enFirst) |
| FR (1) | FR2223797B1 (enFirst) |
| GB (1) | GB1424296A (enFirst) |
| IT (1) | IT996889B (enFirst) |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5024727A (enFirst) * | 1973-06-14 | 1975-03-17 | ||
| US3885085A (en) * | 1974-06-11 | 1975-05-20 | Gen Cable Corp | High voltage solid extruded insulated power cables |
| JPS5265164U (enFirst) * | 1975-11-10 | 1977-05-13 | ||
| US4103276A (en) * | 1976-07-14 | 1978-07-25 | Nordson Corporation | Resistor core cable |
| DE2832284A1 (de) | 1978-07-22 | 1980-01-31 | Reinshagen Kabelwerk Gmbh | Flexible leitung fuer hohe gleichspannungen |
| JPS6111852Y2 (enFirst) * | 1980-01-31 | 1986-04-14 | ||
| US4487057A (en) * | 1980-09-16 | 1984-12-11 | Raychem Corporation | Continuous sense and locate device |
| US4576827A (en) * | 1984-04-23 | 1986-03-18 | Nordson Corporation | Electrostatic spray coating system |
| DE3428087A1 (de) * | 1984-07-30 | 1986-01-30 | Kraftwerk Union AG, 4330 Mülheim | Konzentrisches dreileiterkabel |
| US4584431A (en) * | 1984-10-11 | 1986-04-22 | Us Of America Secr Air Force | High voltage RF coaxial cable |
| US4739935A (en) * | 1986-03-12 | 1988-04-26 | Nordson Corporation | Flexible voltage cable for electrostatic spray gun |
| JPH02165516A (ja) * | 1988-12-16 | 1990-06-26 | Sumitomo Electric Ind Ltd | 直流用高圧電線 |
| US4924037A (en) * | 1988-12-20 | 1990-05-08 | W. L. Gore & Associates, Inc. | Electrical cable |
| US5034719A (en) * | 1989-04-04 | 1991-07-23 | Prestolite Wire Corporation | Radio frequency interference suppression ignition cable having a semiconductive polyolefin conductive core |
| US4978813A (en) * | 1989-08-29 | 1990-12-18 | W. L. Gore & Associates, Inc. | Electrical cable |
| DE3929450A1 (de) * | 1989-09-05 | 1991-03-07 | Kabel & Draht Gmbh | Elektrofilterkabel |
| US5166477A (en) * | 1991-05-28 | 1992-11-24 | General Electric Company | Cable and termination for high voltage and high frequency applications |
| DE19637472A1 (de) * | 1996-09-13 | 1998-03-26 | Schnier Elektrostatik Gmbh | Schwingungsfreies bedämpftes Hochspannungskabel |
| US5803372A (en) * | 1997-04-03 | 1998-09-08 | Asahi Sunac Corporation | Hand held rotary atomizer spray gun |
| US20020189845A1 (en) * | 2001-06-14 | 2002-12-19 | Gorrell Brian E. | High voltage cable |
| DE102014010777A1 (de) * | 2014-01-30 | 2015-07-30 | Dürr Systems GmbH | Hochspannungskabel |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB547481A (en) * | 1940-05-10 | 1942-08-28 | United Air Lines Transp Corp | Improvements in or relating to electrical resistors |
| US2703356A (en) * | 1951-02-01 | 1955-03-01 | Gen Motors Corp | High ohmic resistance conductor |
| US2790053A (en) * | 1951-12-27 | 1957-04-23 | Thomas F Peterson | Shielded ignition cable and resistors |
| US3167255A (en) * | 1961-05-08 | 1965-01-26 | Sames Mach Electrostat | Electrostatic sprayer system having a separate high resistivity conductor |
| US3105218A (en) * | 1961-06-30 | 1963-09-24 | Fischer & Co H G | Electric resistor |
| US3105219A (en) * | 1962-02-19 | 1963-09-24 | H G Fischer & Co Inc | Electric resistor |
| US3284751A (en) * | 1963-10-11 | 1966-11-08 | Eltra Corp | Resistor ignition lead |
| DE1490618C3 (de) * | 1964-07-24 | 1974-11-14 | Kabel- Und Lackdrahtfabriken Gmbh, 6800 Mannheim | Widerstandszündleitung für Brennkraftmaschinen |
| US3348186A (en) * | 1964-11-16 | 1967-10-17 | Nordson Corp | High resistance cable |
| US3518606A (en) * | 1968-06-27 | 1970-06-30 | Eltra Corp | Ignition cable with terminal construction |
| GB1335580A (en) * | 1970-03-20 | 1973-10-31 | Yazaki Corp | High frequency noise prevention cable |
| US3644866A (en) * | 1971-01-11 | 1972-02-22 | Owens Corning Fiberglass Corp | Tightly bound bundle of filaments and method of producing same |
| US3680027A (en) * | 1971-04-19 | 1972-07-25 | Avnet Inc | Ignition cable |
-
1973
- 1973-04-02 US US00347240A patent/US3792409A/en not_active Expired - Lifetime
- 1973-10-22 AU AU61657/73A patent/AU472386B2/en not_active Expired
- 1973-10-23 CA CA183,971A patent/CA991286A/en not_active Expired
- 1973-10-25 IT IT70162/73A patent/IT996889B/it active
- 1973-10-26 DE DE19732353809 patent/DE2353809A1/de not_active Ceased
- 1973-11-16 FR FR7340987A patent/FR2223797B1/fr not_active Expired
-
1974
- 1974-01-24 JP JP49010569A patent/JPS50381A/ja active Pending
- 1974-04-02 GB GB1466174A patent/GB1424296A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| JPS50381A (enFirst) | 1975-01-06 |
| GB1424296A (en) | 1976-02-11 |
| FR2223797A1 (enFirst) | 1974-10-25 |
| US3792409A (en) | 1974-02-12 |
| AU472386B2 (en) | 1976-05-20 |
| FR2223797B1 (enFirst) | 1976-10-01 |
| CA991286A (en) | 1976-06-15 |
| AU6165773A (en) | 1975-04-24 |
| DE2353809A1 (de) | 1974-10-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IT996889B (it) | Cavo ad alta tensione per pistole a mano per spruzzatura elettrosta tica | |
| IT1017120B (it) | Pistola a spruzzo | |
| IT942921B (it) | Dispositivo caricatore elettrosta tico per pistole a spruzzo | |
| JPS5252946A (en) | Electrostatic spray gun | |
| SE418577B (sv) | Sprutpistol | |
| IT1057157B (it) | Dispositivo per il rivestimento elettrostatico a spruzzo | |
| SE384329B (sv) | Sprutskap for elektrostatisk sprutmalning | |
| PL201980A1 (pl) | Elektrostatyczne urzadzenie do natryskiwania farby | |
| AU8612475A (en) | Spray booth | |
| IT1016713B (it) | Cavo elettrico ad alta tensione | |
| AU6824374A (en) | Spray booth | |
| IT1192234B (it) | Apparecchio per il rivestimento di oggetti particolarmente mediante applicazione a spruzzo | |
| IT1045725B (it) | Apparecchiatura di controllo per pistole erogatrici di adesivo | |
| IT1112704B (it) | Pistola elettrostatica a spruzzo | |
| IT1140694B (it) | Comparatore di tensione | |
| BE827632A (nl) | Plasma sproeipistool | |
| IT1015862B (it) | Pistola a spruzzo | |
| IT1020917B (it) | Cavo elettrico ad alta tensione | |
| GB1555542A (en) | Spray gun | |
| IT1030489B (it) | Dispositivo per il rivestimento elettrostatico a spruzzo | |
| IT1020178B (it) | Spruzzatore a pennello per aerosol | |
| IT1064408B (it) | Trasformatore di tensione per alte tensioni | |
| IT1125687B (it) | Rivelatore di tensione unipolare | |
| IT1072145B (it) | Generatore di alta tensione particolarmente per televisori | |
| AU7791075A (en) | Spray gun |