IL95022A - ייצוב של תמיסות מימיות מרוכזות של מימן דו-חמצני - Google Patents
ייצוב של תמיסות מימיות מרוכזות של מימן דו-חמצניInfo
- Publication number
- IL95022A IL95022A IL9502290A IL9502290A IL95022A IL 95022 A IL95022 A IL 95022A IL 9502290 A IL9502290 A IL 9502290A IL 9502290 A IL9502290 A IL 9502290A IL 95022 A IL95022 A IL 95022A
- Authority
- IL
- Israel
- Prior art keywords
- stabiliser
- process according
- hydrogen peroxide
- acid
- employed
- Prior art date
Links
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 title claims description 65
- 230000006641 stabilisation Effects 0.000 title claims description 12
- 239000007864 aqueous solution Substances 0.000 title claims description 5
- 239000003381 stabilizer Substances 0.000 claims description 99
- 238000000034 method Methods 0.000 claims description 25
- 150000001875 compounds Chemical class 0.000 claims description 16
- 230000008569 process Effects 0.000 claims description 16
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid group Chemical group C(CC(O)(C(=O)O)CC(=O)O)(=O)O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 claims description 15
- ABLZXFCXXLZCGV-UHFFFAOYSA-N phosphonic acid group Chemical group P(O)(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 claims description 13
- -1 hydroxycarboxy Chemical group 0.000 claims description 12
- 238000000354 decomposition reaction Methods 0.000 claims description 11
- 239000000203 mixture Substances 0.000 claims description 10
- 150000003839 salts Chemical class 0.000 claims description 10
- 230000003019 stabilising effect Effects 0.000 claims description 10
- FJKROLUGYXJWQN-UHFFFAOYSA-N 4-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 claims description 9
- 239000002253 acid Substances 0.000 claims description 9
- 230000002378 acidificating effect Effects 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 229910019142 PO4 Inorganic materials 0.000 claims description 4
- 239000003929 acidic solution Substances 0.000 claims description 4
- 125000003277 amino group Chemical group 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 4
- 235000021317 phosphate Nutrition 0.000 claims description 4
- 229940071182 stannate Drugs 0.000 claims description 4
- 125000005402 stannate group Chemical group 0.000 claims description 4
- 229940090248 4-hydroxybenzoic acid Drugs 0.000 claims description 3
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 claims description 3
- 229910002651 NO3 Inorganic materials 0.000 claims description 2
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 claims description 2
- 125000001931 aliphatic group Chemical group 0.000 claims description 2
- 125000000524 functional group Chemical group 0.000 claims description 2
- 150000007524 organic acids Chemical class 0.000 claims description 2
- 235000005985 organic acids Nutrition 0.000 claims description 2
- 150000003013 phosphoric acid derivatives Chemical class 0.000 claims description 2
- 229910018828 PO3H2 Inorganic materials 0.000 claims 1
- 125000003118 aryl group Chemical group 0.000 claims 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical group OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 claims 1
- 239000000243 solution Substances 0.000 description 42
- 238000003860 storage Methods 0.000 description 13
- 229910052751 metal Inorganic materials 0.000 description 9
- 239000002184 metal Substances 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- DBVJJBKOTRCVKF-UHFFFAOYSA-N Etidronic acid Chemical compound OP(=O)(O)C(O)(C)P(O)(O)=O DBVJJBKOTRCVKF-UHFFFAOYSA-N 0.000 description 8
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 8
- 239000007789 gas Substances 0.000 description 7
- 238000012360 testing method Methods 0.000 description 7
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 6
- 238000010790 dilution Methods 0.000 description 6
- 239000012895 dilution Substances 0.000 description 6
- 239000001301 oxygen Substances 0.000 description 6
- 229910052760 oxygen Inorganic materials 0.000 description 6
- 239000000463 material Substances 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 4
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 4
- 238000004061 bleaching Methods 0.000 description 4
- DUYCTCQXNHFCSJ-UHFFFAOYSA-N dtpmp Chemical compound OP(=O)(O)CN(CP(O)(O)=O)CCN(CP(O)(=O)O)CCN(CP(O)(O)=O)CP(O)(O)=O DUYCTCQXNHFCSJ-UHFFFAOYSA-N 0.000 description 4
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 4
- FQENQNTWSFEDLI-UHFFFAOYSA-J sodium diphosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])([O-])=O FQENQNTWSFEDLI-UHFFFAOYSA-J 0.000 description 4
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 4
- 229940048086 sodium pyrophosphate Drugs 0.000 description 4
- 235000019818 tetrasodium diphosphate Nutrition 0.000 description 4
- 239000001577 tetrasodium phosphonato phosphate Substances 0.000 description 4
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- 239000012670 alkaline solution Substances 0.000 description 3
- 230000008859 change Effects 0.000 description 3
- 229910052802 copper Inorganic materials 0.000 description 3
- 239000010949 copper Substances 0.000 description 3
- TVQLLNFANZSCGY-UHFFFAOYSA-N disodium;dioxido(oxo)tin Chemical compound [Na+].[Na+].[O-][Sn]([O-])=O TVQLLNFANZSCGY-UHFFFAOYSA-N 0.000 description 3
- 229910052742 iron Inorganic materials 0.000 description 3
- 150000002739 metals Chemical class 0.000 description 3
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 description 3
- 229940079864 sodium stannate Drugs 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 239000001117 sulphuric acid Substances 0.000 description 3
- 235000011149 sulphuric acid Nutrition 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- RGHNJXZEOKUKBD-SQOUGZDYSA-N D-gluconic acid Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)=O RGHNJXZEOKUKBD-SQOUGZDYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- 239000004698 Polyethylene Substances 0.000 description 2
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical compound NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- CREMABGTGYGIQB-UHFFFAOYSA-N carbon carbon Chemical compound C.C CREMABGTGYGIQB-UHFFFAOYSA-N 0.000 description 2
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 2
- 239000008367 deionised water Substances 0.000 description 2
- 238000007865 diluting Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- 238000010348 incorporation Methods 0.000 description 2
- 230000003993 interaction Effects 0.000 description 2
- 230000007774 longterm Effects 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 125000002081 peroxide group Chemical group 0.000 description 2
- 150000002978 peroxides Chemical class 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- 150000003009 phosphonic acids Chemical class 0.000 description 2
- 229920000573 polyethylene Polymers 0.000 description 2
- 230000002035 prolonged effect Effects 0.000 description 2
- 150000004760 silicates Chemical class 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000004317 sodium nitrate Substances 0.000 description 2
- 235000010344 sodium nitrate Nutrition 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 229910052723 transition metal Inorganic materials 0.000 description 2
- 150000003624 transition metals Chemical class 0.000 description 2
- VPTUPAVOBUEXMZ-UHFFFAOYSA-N (1-hydroxy-2-phosphonoethyl)phosphonic acid Chemical compound OP(=O)(O)C(O)CP(O)(O)=O VPTUPAVOBUEXMZ-UHFFFAOYSA-N 0.000 description 1
- DYLIWHYUXAJDOJ-OWOJBTEDSA-N (e)-4-(6-aminopurin-9-yl)but-2-en-1-ol Chemical compound NC1=NC=NC2=C1N=CN2C\C=C\CO DYLIWHYUXAJDOJ-OWOJBTEDSA-N 0.000 description 1
- BPSYZMLXRKCSJY-UHFFFAOYSA-N 1,3,2-dioxaphosphepan-2-ium 2-oxide Chemical compound O=[P+]1OCCCCO1 BPSYZMLXRKCSJY-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- RGHNJXZEOKUKBD-UHFFFAOYSA-N D-gluconic acid Natural products OCC(O)C(O)C(O)C(O)C(O)=O RGHNJXZEOKUKBD-UHFFFAOYSA-N 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- 229940120146 EDTMP Drugs 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 239000012028 Fenton's reagent Substances 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- QPCDCPDFJACHGM-UHFFFAOYSA-N N,N-bis{2-[bis(carboxymethyl)amino]ethyl}glycine Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(=O)O)CCN(CC(O)=O)CC(O)=O QPCDCPDFJACHGM-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- YDONNITUKPKTIG-UHFFFAOYSA-N [Nitrilotris(methylene)]trisphosphonic acid Chemical compound OP(O)(=O)CN(CP(O)(O)=O)CP(O)(O)=O YDONNITUKPKTIG-UHFFFAOYSA-N 0.000 description 1
- ZVQOOHYFBIDMTQ-UHFFFAOYSA-N [methyl(oxido){1-[6-(trifluoromethyl)pyridin-3-yl]ethyl}-lambda(6)-sulfanylidene]cyanamide Chemical compound N#CN=S(C)(=O)C(C)C1=CC=C(C(F)(F)F)N=C1 ZVQOOHYFBIDMTQ-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000004411 aluminium Substances 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 230000003190 augmentative effect Effects 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000001717 carbocyclic compounds Chemical class 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 239000000356 contaminant Substances 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 230000001186 cumulative effect Effects 0.000 description 1
- SSJXIUAHEKJCMH-UHFFFAOYSA-N cyclohexane-1,2-diamine Chemical compound NC1CCCCC1N SSJXIUAHEKJCMH-UHFFFAOYSA-N 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 229940090960 diethylenetriamine pentamethylene phosphonic acid Drugs 0.000 description 1
- XPPKVPWEQAFLFU-UHFFFAOYSA-J diphosphate(4-) Chemical compound [O-]P([O-])(=O)OP([O-])([O-])=O XPPKVPWEQAFLFU-UHFFFAOYSA-J 0.000 description 1
- 235000011180 diphosphates Nutrition 0.000 description 1
- 238000011549 displacement method Methods 0.000 description 1
- NFDRPXJGHKJRLJ-UHFFFAOYSA-N edtmp Chemical compound OP(O)(=O)CN(CP(O)(O)=O)CCN(CP(O)(O)=O)CP(O)(O)=O NFDRPXJGHKJRLJ-UHFFFAOYSA-N 0.000 description 1
- 238000006735 epoxidation reaction Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000002657 fibrous material Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000000174 gluconic acid Substances 0.000 description 1
- 235000012208 gluconic acid Nutrition 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- MGZTXXNFBIUONY-UHFFFAOYSA-N hydrogen peroxide;iron(2+);sulfuric acid Chemical compound [Fe+2].OO.OS(O)(=O)=O MGZTXXNFBIUONY-UHFFFAOYSA-N 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000000391 magnesium silicate Substances 0.000 description 1
- 235000012243 magnesium silicates Nutrition 0.000 description 1
- YACKEPLHDIMKIO-UHFFFAOYSA-N methylphosphonic acid Chemical group CP(O)(O)=O YACKEPLHDIMKIO-UHFFFAOYSA-N 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 150000002892 organic cations Chemical class 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 238000010979 pH adjustment Methods 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- PTMHPRAIXMAOOB-UHFFFAOYSA-N phosphoramidic acid Chemical class NP(O)(O)=O PTMHPRAIXMAOOB-UHFFFAOYSA-N 0.000 description 1
- 238000005554 pickling Methods 0.000 description 1
- 238000005498 polishing Methods 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 239000012286 potassium permanganate Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 229940048084 pyrophosphate Drugs 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 230000001954 sterilising effect Effects 0.000 description 1
- 238000004659 sterilization and disinfection Methods 0.000 description 1
- 239000010902 straw Substances 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 238000012956 testing procedure Methods 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 150000003623 transition metal compounds Chemical class 0.000 description 1
- 230000017105 transposition Effects 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B15/00—Peroxides; Peroxyhydrates; Peroxyacids or salts thereof; Superoxides; Ozonides
- C01B15/01—Hydrogen peroxide
- C01B15/037—Stabilisation by additives
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B15/00—Peroxides; Peroxyhydrates; Peroxyacids or salts thereof; Superoxides; Ozonides
- C01B15/01—Hydrogen peroxide
- C01B15/013—Separation; Purification; Concentration
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B15/00—Peroxides; Peroxyhydrates; Peroxyacids or salts thereof; Superoxides; Ozonides
- C01B15/01—Hydrogen peroxide
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Detergent Compositions (AREA)
- Cosmetics (AREA)
- Anti-Oxidant Or Stabilizer Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB898925376A GB8925376D0 (en) | 1989-11-09 | 1989-11-09 | Stabilisation of concentrated hydrogen peroxide solutions |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL95022A0 IL95022A0 (en) | 1991-06-10 |
| IL95022A true IL95022A (he) | 1994-11-28 |
Family
ID=10666033
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL9502290A IL95022A (he) | 1989-11-09 | 1990-07-10 | ייצוב של תמיסות מימיות מרוכזות של מימן דו-חמצני |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US5130053A (he) |
| EP (1) | EP0426949B1 (he) |
| JP (1) | JPH03153505A (he) |
| KR (1) | KR910009560A (he) |
| AR (1) | AR245676A1 (he) |
| AT (1) | ATE98939T1 (he) |
| AU (1) | AU635289B2 (he) |
| BR (1) | BR9003424A (he) |
| CA (1) | CA2021264C (he) |
| DD (1) | DD296663A5 (he) |
| DE (1) | DE69005416T2 (he) |
| DK (1) | DK0426949T3 (he) |
| ES (1) | ES2062210T3 (he) |
| GB (1) | GB8925376D0 (he) |
| IL (1) | IL95022A (he) |
| MY (1) | MY105968A (he) |
| NZ (1) | NZ234523A (he) |
| PT (1) | PT94728B (he) |
Families Citing this family (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB9122048D0 (en) * | 1991-10-17 | 1991-11-27 | Interox Chemicals Ltd | Compositions and uses thereof |
| WO1993013012A1 (en) * | 1991-12-21 | 1993-07-08 | Solvay Interox Limited | Alkaline hydrogen peroxide formulation |
| GB9300366D0 (en) * | 1993-01-09 | 1993-03-03 | Solvay Interox Ltd | Compositions and uses thereof |
| FR2707896B1 (fr) * | 1993-07-22 | 1995-09-01 | Chemoxal Sa | Procédé de traitement d'un article et nouvelle solution aqueuse de peroxyde d'hydrogène. |
| EP0769046B1 (en) * | 1994-07-01 | 1998-09-02 | Warwick International Group Limited | Bleaching compositions |
| US5736497A (en) * | 1995-05-05 | 1998-04-07 | Degussa Corporation | Phosphorus free stabilized alkaline peroxygen solutions |
| US5759439A (en) * | 1996-06-14 | 1998-06-02 | The Procter & Gamble Company | Peroxygen bleaching compositions comprising peroxygen bleach and a fabric protection agent suitable for use as a pretreater for fabrics |
| US5905065A (en) * | 1995-06-27 | 1999-05-18 | The Procter & Gamble Company | Carpet cleaning compositions and method for cleaning carpets |
| US5851514A (en) * | 1995-09-26 | 1998-12-22 | Colgate Palmolive Company | Stable aqueous abrasive peroxide tooth whitening dentifrice |
| US7270499B2 (en) * | 1998-04-20 | 2007-09-18 | Greenberg Richard S | Soil and/or groundwater remediation process |
| EP1213262A1 (de) * | 2000-12-02 | 2002-06-12 | Degussa AG | Verfahren zur Herstellung von höchstkonzentriertem Wasserstoffperoxid und hiermit erhältliches mindestens 99,9 gew.-%iges Wasserstoffperoxid |
| US20020098111A1 (en) * | 2000-12-04 | 2002-07-25 | Nguyen Nick N. | Vaporizer |
| DE10146594A1 (de) * | 2001-09-21 | 2003-04-10 | Solvay Interox Gmbh | Stabilisiertes Wasserstoffperoxid |
| US7722847B2 (en) | 2002-09-30 | 2010-05-25 | Evonik Degussa Gmbh | Aqueous hydrogen peroxide solutions and method of making same |
| EP1403219A1 (en) † | 2002-09-30 | 2004-03-31 | Degussa AG | Novel aqueous hydrogen peroxide solutions |
| US7459005B2 (en) * | 2002-11-22 | 2008-12-02 | Akzo Nobel N.V. | Chemical composition and method |
| US7431775B2 (en) | 2004-04-08 | 2008-10-07 | Arkema Inc. | Liquid detergent formulation with hydrogen peroxide |
| US7169237B2 (en) * | 2004-04-08 | 2007-01-30 | Arkema Inc. | Stabilization of alkaline hydrogen peroxide |
| US7045493B2 (en) | 2004-07-09 | 2006-05-16 | Arkema Inc. | Stabilized thickened hydrogen peroxide containing compositions |
| DE102005038414A1 (de) * | 2005-08-12 | 2007-02-15 | Basf Aktiengesellschaft | Stabilisierte Ätzlösungen zum Ätzen von Cu- und Cu/Ni-Schicht |
| CN100430532C (zh) * | 2005-11-25 | 2008-11-05 | 中国科学院化学研究所 | 用于亚麻过氧化氢脱胶漂白的稳定剂及其制备方法和用途 |
| DE102006061830A1 (de) * | 2006-12-21 | 2008-06-26 | Henkel Kgaa | Stabilisierung von Zusammensetzungen, enthaltend Wasserstoffperoxid |
| CA2731047A1 (en) * | 2008-07-24 | 2010-01-28 | Fmc Corporation | Dilute aqueous peracid solutions and stabilization method |
| CN113942980B (zh) * | 2021-11-11 | 2023-11-03 | 河南慧泽生物工程有限公司 | 一种过氧化氢稳定剂 |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3387939A (en) * | 1966-07-06 | 1968-06-11 | Du Pont | Stannate stabilizer compositions containing an alkylidene diphosphonic acid, their preparation and hydrogen peroxide solutions stabilized therewith |
| US3701825A (en) * | 1970-10-23 | 1972-10-31 | Fmc Corp | Stabilization of hydrogen peroxide with ethylenediamine tetra (methylenephosphonic acid) |
| US3740187A (en) * | 1971-06-03 | 1973-06-19 | Monsanto Co | Processes for bleaching textiles |
| US3903244A (en) * | 1973-02-02 | 1975-09-02 | Fmc Corp | Stabilized hydrogen peroxide |
| US4059678A (en) * | 1973-02-02 | 1977-11-22 | Fmc Corporation | Stabilization of iron-containing acidic hydrogen peroxide solutions |
| US4155738A (en) * | 1978-03-30 | 1979-05-22 | Allergan Pharmaceuticals, Inc. | Method of stabilizing a peroxide-containing composition |
| US4304762A (en) * | 1978-09-27 | 1981-12-08 | Lever Brothers Company | Stabilization of hydrogen peroxide |
| US4320102A (en) * | 1980-10-10 | 1982-03-16 | Air Products And Chemicals, Inc. | Method of stabilizing hydrogen peroxide solutions |
| US4614646A (en) * | 1984-12-24 | 1986-09-30 | The Dow Chemical Company | Stabilization of peroxide systems in the presence of alkaline earth metal ions |
| US4725281A (en) * | 1985-07-19 | 1988-02-16 | Ciba-Geigy Corporation | Aqueous alkaline, silicate-containing composition and the use thereof for bleaching cellulosic fiber materials in the presence of per compounds |
| GB8522046D0 (en) * | 1985-09-05 | 1985-10-09 | Interox Chemicals Ltd | Stabilisation |
| FR2643093B1 (fr) * | 1989-02-15 | 1991-08-16 | Protex Manuf Prod Chimiq | Procedes ameliores de blanchiment oxydant de fibres cellulosiques |
-
1989
- 1989-11-09 GB GB898925376A patent/GB8925376D0/en active Pending
-
1990
- 1990-07-10 IL IL9502290A patent/IL95022A/he not_active IP Right Cessation
- 1990-07-10 DE DE69005416T patent/DE69005416T2/de not_active Expired - Fee Related
- 1990-07-10 AT AT90113118T patent/ATE98939T1/de not_active IP Right Cessation
- 1990-07-10 ES ES90113118T patent/ES2062210T3/es not_active Expired - Lifetime
- 1990-07-10 EP EP90113118A patent/EP0426949B1/en not_active Expired - Lifetime
- 1990-07-10 DK DK90113118.5T patent/DK0426949T3/da active
- 1990-07-12 MY MYPI90001166A patent/MY105968A/en unknown
- 1990-07-16 CA CA002021264A patent/CA2021264C/en not_active Expired - Fee Related
- 1990-07-16 NZ NZ234523A patent/NZ234523A/xx unknown
- 1990-07-16 KR KR1019900010802A patent/KR910009560A/ko not_active Ceased
- 1990-07-16 AU AU59063/90A patent/AU635289B2/en not_active Ceased
- 1990-07-16 BR BR909003424A patent/BR9003424A/pt not_active IP Right Cessation
- 1990-07-17 PT PT94728A patent/PT94728B/pt not_active IP Right Cessation
- 1990-07-17 DD DD90342846A patent/DD296663A5/de not_active IP Right Cessation
- 1990-07-17 JP JP2189277A patent/JPH03153505A/ja active Pending
- 1990-07-17 US US07/553,089 patent/US5130053A/en not_active Expired - Fee Related
- 1990-11-09 AR AR90318354A patent/AR245676A1/es active
Also Published As
| Publication number | Publication date |
|---|---|
| PT94728A (pt) | 1991-07-05 |
| MY105968A (en) | 1995-02-28 |
| CA2021264C (en) | 2000-08-15 |
| DE69005416T2 (de) | 1994-05-26 |
| DE69005416D1 (de) | 1994-02-03 |
| KR910009560A (ko) | 1991-06-28 |
| ATE98939T1 (de) | 1994-01-15 |
| PT94728B (pt) | 1997-03-31 |
| NZ234523A (en) | 1993-09-27 |
| DK0426949T3 (da) | 1994-04-25 |
| AR245676A1 (es) | 1994-02-28 |
| ES2062210T3 (es) | 1994-12-16 |
| JPH03153505A (ja) | 1991-07-01 |
| BR9003424A (pt) | 1991-08-27 |
| IL95022A0 (en) | 1991-06-10 |
| CA2021264A1 (en) | 1991-05-10 |
| GB8925376D0 (en) | 1989-12-28 |
| DD296663A5 (de) | 1991-12-12 |
| EP0426949A1 (en) | 1991-05-15 |
| EP0426949B1 (en) | 1993-12-22 |
| AU5906390A (en) | 1991-05-16 |
| US5130053A (en) | 1992-07-14 |
| AU635289B2 (en) | 1993-03-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0426949B1 (en) | Stabilisation of concentrated hydrogen peroxide solutions | |
| US3701825A (en) | Stabilization of hydrogen peroxide with ethylenediamine tetra (methylenephosphonic acid) | |
| EP0009839B1 (en) | Alkaline aqueous hydrogen peroxide solutions stabilised against decomposition | |
| KR100245405B1 (ko) | 조성물과 이의 용도 | |
| CA2731047A1 (en) | Dilute aqueous peracid solutions and stabilization method | |
| KR100567235B1 (ko) | 안정화된하이포아브롬산염의제조방법및미생물오염을조절하기위한수처리에서의그의사용방법 | |
| US3387939A (en) | Stannate stabilizer compositions containing an alkylidene diphosphonic acid, their preparation and hydrogen peroxide solutions stabilized therewith | |
| US3383174A (en) | Stabilization of hydrogen peroxide | |
| KR20010034832A (ko) | 안정한 산화브롬 조성물 및 그 제조방법과 이를 사용한생오염 억제 | |
| EP2225175B1 (en) | Stabilized hydrogen peroxide solutions | |
| US5736497A (en) | Phosphorus free stabilized alkaline peroxygen solutions | |
| CA2572189A1 (en) | Stable oxidizing bromine composition, method of manufacture and use thereof for biofouling control | |
| EP0617697B1 (en) | Alkaline hydrogen peroxide formulation | |
| US5254526A (en) | Method to prevent algae growth in pools and spas | |
| US5759440A (en) | Stabilized aqueuous solution of hydrogen peroxide and process for stabilizing an aqueous solution of hydrogen peroxide | |
| JPH01162865A (ja) | 繊維材料の前処理法 | |
| US4187293A (en) | Stabilization of solutions containing active chlorine | |
| JPH03237007A (ja) | 過酸化水素組成物 | |
| EP0551298B1 (en) | Peroxidic compositions | |
| RU2069638C1 (ru) | Стабилизированный водный раствор пероксида водорода и способ его стабилизации | |
| KR100501820B1 (ko) | 안정화된 과산화수소수용액 | |
| EP0449797A1 (en) | Method for the preparation and/or maintenance of alkaline bleaching baths and hydrogen peroxide solutions for use therein | |
| Lockport | Dada et al.(43) Pub. Date: Jan. 28, 2010 | |
| JPH1171104A (ja) | 安定化された過酸化水素水溶液 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| KB | Patent renewed | ||
| MM9K | Patent not in force due to non-payment of renewal fees |