IL66357A - Purification of phenoxybenzoic acid derivatives - Google Patents
Purification of phenoxybenzoic acid derivativesInfo
- Publication number
- IL66357A IL66357A IL66357A IL6635782A IL66357A IL 66357 A IL66357 A IL 66357A IL 66357 A IL66357 A IL 66357A IL 6635782 A IL6635782 A IL 6635782A IL 66357 A IL66357 A IL 66357A
- Authority
- IL
- Israel
- Prior art keywords
- purification
- acid derivatives
- phenoxybenzoic acid
- phenoxybenzoic
- derivatives
- Prior art date
Links
- PKRSYEPBQPFNRB-UHFFFAOYSA-N 2-phenoxybenzoic acid Chemical class OC(=O)C1=CC=CC=C1OC1=CC=CC=C1 PKRSYEPBQPFNRB-UHFFFAOYSA-N 0.000 title 1
- 238000000746 purification Methods 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/49—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups
- C07C205/57—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C205/59—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton the carbon skeleton being further substituted by singly-bound oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/07—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by halogen atoms
- C07C205/11—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by halogen atoms having nitro groups bound to carbon atoms of six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C201/00—Preparation of esters of nitric or nitrous acid or of compounds containing nitro or nitroso groups bound to a carbon skeleton
- C07C201/06—Preparation of nitro compounds
- C07C201/16—Separation; Purification; Stabilisation; Use of additives
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/286,996 US4405805A (en) | 1981-07-27 | 1981-07-27 | Process for recovering and purifying herbicidal phenoxybenzoic acid derivatives |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL66357A0 IL66357A0 (en) | 1982-11-30 |
| IL66357A true IL66357A (en) | 1986-04-29 |
Family
ID=23101031
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL66357A IL66357A (en) | 1981-07-27 | 1982-07-20 | Purification of phenoxybenzoic acid derivatives |
Country Status (22)
| Country | Link |
|---|---|
| US (1) | US4405805A (ro) |
| JP (1) | JPS5838235A (ro) |
| KR (1) | KR890001806B1 (ro) |
| BE (1) | BE893942A (ro) |
| BR (1) | BR8204352A (ro) |
| CA (1) | CA1203811A (ro) |
| CH (1) | CH652710A5 (ro) |
| DD (1) | DD202423A5 (ro) |
| DE (1) | DE3227846A1 (ro) |
| DK (1) | DK333582A (ro) |
| ES (2) | ES514354A0 (ro) |
| FR (1) | FR2510102B1 (ro) |
| GB (1) | GB2103214B (ro) |
| HU (1) | HU190694B (ro) |
| IE (1) | IE54596B1 (ro) |
| IL (1) | IL66357A (ro) |
| IT (1) | IT1156314B (ro) |
| LU (1) | LU84297A1 (ro) |
| NL (1) | NL8202995A (ro) |
| PL (1) | PL144334B1 (ro) |
| PT (1) | PT75324B (ro) |
| RO (1) | RO85386B (ro) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3129826A1 (de) * | 1981-07-29 | 1983-04-28 | Grillo-Werke Ag, 4100 Duisburg | Zinksalz der hydrolisierten tricarbonsaeure aus diels-alder-addukten von maleinsaeureanhydrid an undecylensaeure, verfahren zur herstellung derselben und ihre verwendung |
| US5446197A (en) * | 1994-10-04 | 1995-08-29 | Basf Corporation | Method of purifying acifluorfen |
| GB9518704D0 (en) * | 1995-09-13 | 1995-11-15 | Zeneca Ltd | Chemical process |
| GB9518705D0 (en) * | 1995-09-13 | 1995-11-15 | Zeneca Ltd | Chemical process |
| US6028219A (en) * | 1995-09-13 | 2000-02-22 | Zeneca Limited | Process for the nitration of diphenylethers |
| US5910604A (en) * | 1995-09-13 | 1999-06-08 | Zeneca Limited | Purification process |
| GB9930369D0 (en) * | 1999-12-22 | 2000-02-09 | Zeneca Ltd | Chemical process |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3798276A (en) * | 1972-03-14 | 1974-03-19 | H Bayer | Herbicidal 4-trifluoromethyl-4'-nitrodiphenyl ethers |
| US4046798A (en) * | 1973-02-12 | 1977-09-06 | Rohm And Haas Company | Herbicidal 4-trifluoromethyl-4'nitrodiphenyl ethers |
| US3928416A (en) * | 1972-03-14 | 1975-12-23 | Rohm & Haas | Herbicidal 4-trifluoromethyl-4{40 nitrodiphenyl ethers |
| CA1079303A (en) * | 1973-02-12 | 1980-06-10 | Horst O. Bayer | Herbicidal 4-trifluoromethyl-4'-nitrodiphenyl ethers |
| US3979437A (en) * | 1973-09-19 | 1976-09-07 | Mobil Oil Corporation | Substituted phenoxybenzoic acids and derivatives thereof |
| US4031131A (en) * | 1975-09-29 | 1977-06-21 | Rohm And Haas Company | Process for preparing phenoxybenzoic acids |
| EP0022610B1 (en) * | 1979-06-22 | 1986-09-03 | Rhone-Poulenc Agrochimie | Process for preparing 2-nitro-5-(substituted-phenoxy) benzoic acids and salts thereof |
| EP0023100B1 (en) * | 1979-07-18 | 1982-11-10 | Imperial Chemical Industries Plc | Herbicidal compositions comprising a diphenyl ether compound in admixture with another herbicide |
-
1981
- 1981-07-27 US US06/286,996 patent/US4405805A/en not_active Expired - Fee Related
-
1982
- 1982-07-02 FR FR8211791A patent/FR2510102B1/fr not_active Expired
- 1982-07-20 IL IL66357A patent/IL66357A/xx unknown
- 1982-07-23 IT IT22547/82A patent/IT1156314B/it active
- 1982-07-23 PL PL1982237635A patent/PL144334B1/pl unknown
- 1982-07-26 JP JP57130218A patent/JPS5838235A/ja active Pending
- 1982-07-26 GB GB08221571A patent/GB2103214B/en not_active Expired
- 1982-07-26 PT PT75324A patent/PT75324B/pt unknown
- 1982-07-26 BE BE0/208678A patent/BE893942A/fr not_active IP Right Cessation
- 1982-07-26 LU LU84297A patent/LU84297A1/fr unknown
- 1982-07-26 DE DE19823227846 patent/DE3227846A1/de not_active Withdrawn
- 1982-07-26 HU HU822398A patent/HU190694B/hu not_active IP Right Cessation
- 1982-07-26 IE IE1784/82A patent/IE54596B1/en unknown
- 1982-07-26 ES ES514354A patent/ES514354A0/es active Granted
- 1982-07-26 NL NL8202995A patent/NL8202995A/nl not_active Application Discontinuation
- 1982-07-26 CA CA000408050A patent/CA1203811A/en not_active Expired
- 1982-07-26 CH CH4540/82A patent/CH652710A5/fr not_active IP Right Cessation
- 1982-07-26 DK DK333582A patent/DK333582A/da not_active Application Discontinuation
- 1982-07-26 BR BR8204352A patent/BR8204352A/pt unknown
- 1982-07-27 DD DD82241978A patent/DD202423A5/de unknown
- 1982-07-27 RO RO108285A patent/RO85386B/ro unknown
- 1982-07-27 KR KR8203347A patent/KR890001806B1/ko not_active Expired
-
1983
- 1983-06-16 ES ES523320A patent/ES8500210A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DK333582A (da) | 1983-01-28 |
| CA1203811A (en) | 1986-04-29 |
| IL66357A0 (en) | 1982-11-30 |
| NL8202995A (nl) | 1983-02-16 |
| GB2103214B (en) | 1986-07-02 |
| IE54596B1 (en) | 1989-12-06 |
| PL144334B1 (en) | 1988-05-31 |
| KR840000478A (ko) | 1984-02-22 |
| ES8400386A1 (es) | 1983-10-16 |
| PT75324B (fr) | 1985-11-29 |
| LU84297A1 (fr) | 1984-03-22 |
| PL237635A1 (en) | 1984-08-13 |
| ES523320A0 (es) | 1984-10-01 |
| BR8204352A (pt) | 1983-07-19 |
| FR2510102A1 (fr) | 1983-01-28 |
| RO85386A (ro) | 1984-11-25 |
| KR890001806B1 (ko) | 1989-05-23 |
| HU190694B (en) | 1986-10-28 |
| RO85386B (ro) | 1984-11-30 |
| IE821784L (en) | 1983-01-27 |
| GB2103214A (en) | 1983-02-16 |
| IT8222547A1 (it) | 1984-01-23 |
| CH652710A5 (fr) | 1985-11-29 |
| BE893942A (fr) | 1983-01-26 |
| FR2510102B1 (fr) | 1985-10-11 |
| DD202423A5 (de) | 1983-09-14 |
| IT8222547A0 (it) | 1982-07-23 |
| IT1156314B (it) | 1987-02-04 |
| JPS5838235A (ja) | 1983-03-05 |
| ES514354A0 (es) | 1983-10-16 |
| PT75324A (fr) | 1982-08-01 |
| US4405805A (en) | 1983-09-20 |
| DE3227846A1 (de) | 1983-02-10 |
| ES8500210A1 (es) | 1984-10-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS57159739A (en) | Manufacture of terephthalic acid | |
| JPS57165352A (en) | Manufacture of l-carnitine | |
| DE3274971D1 (en) | Purification of water | |
| GB2096349B (en) | Improved measurement of deformation | |
| JPS5714570A (en) | Preparation of n-benzyloxycarbonylaspartic acid | |
| JPS57212139A (en) | Manufacture of 6-hydroxy-2-naphthoic acid | |
| IL66357A0 (en) | Purification of phenoxybenzoic acid derivatives | |
| GB2141708B (en) | Preparation of squaric acid | |
| JPS57149264A (en) | Manufacture of 1-alkyl-2-chloro-5-nitro-4- benzole-sulfonic acid | |
| DE3265335D1 (en) | Derivatives of dihydroxybenzoic acid | |
| ZA83442B (en) | Purification of phosphoric acid | |
| JPS57212158A (en) | Manufacture of s-arylthioglycolic acids | |
| AU8642782A (en) | Phenoxybenzoic acid derivatives | |
| GB8421390D0 (en) | Purification of water | |
| GB8520597D0 (en) | Separation & purification of salts | |
| JPS5747497A (en) | Purification of sugar solution | |
| GB8327834D0 (en) | 2-phenoxypropionic acid derivatives of pentites | |
| GB2091263B (en) | 7-((carboxy-methoximino)-lh-pyrazol-3-yl-acetyl))-amino-3-desacetoxy-3-(l-methyl-lh-tetrazol-5-yl-thio)cepha 10-sporanic acid | |
| GB8427232D0 (en) | Adsorbents for purification of water &c | |
| DE3263721D1 (en) | Purification of caffeine | |
| PL237639A1 (en) | Process for manufacturing derivatives of phenoxybenzoic acid | |
| GB2137621B (en) | Preparation of 1-naphthol-4-sulphonic acid | |
| GB2110665B (en) | Preparation of aminocyclopentanealkenoic acids | |
| JPS57176923A (en) | Manufacture of 5-oxohexanoic acid | |
| JPS57179151A (en) | Manufacture of p-sulfanyl acid |