IL51359A0 - Novel indan-5-yl-n-methylcarbamic acid esters their preparation and their use as insecticides - Google Patents
Novel indan-5-yl-n-methylcarbamic acid esters their preparation and their use as insecticidesInfo
- Publication number
- IL51359A0 IL51359A0 IL51359A IL5135977A IL51359A0 IL 51359 A0 IL51359 A0 IL 51359A0 IL 51359 A IL51359 A IL 51359A IL 5135977 A IL5135977 A IL 5135977A IL 51359 A0 IL51359 A0 IL 51359A0
- Authority
- IL
- Israel
- Prior art keywords
- insecticides
- preparation
- acid esters
- methylcarbamic acid
- indan
- Prior art date
Links
- ZTZGWQJZRMGZHG-UHFFFAOYSA-N 2,3-dihydro-1h-inden-5-yl(methyl)carbamic acid Chemical class OC(=O)N(C)C1=CC=C2CCCC2=C1 ZTZGWQJZRMGZHG-UHFFFAOYSA-N 0.000 title 1
- 239000002917 insecticide Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C271/00—Derivatives of carbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C271/06—Esters of carbamic acids
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19762603835 DE2603835A1 (de) | 1976-02-02 | 1976-02-02 | Indan-5-yl-n-methylcarbaminsaeureester, verfahren zu ihrer herstellung sowie ihre verwendung als insektizide |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL51359A0 true IL51359A0 (en) | 1977-03-31 |
Family
ID=5968817
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL51359A IL51359A0 (en) | 1976-02-02 | 1977-01-31 | Novel indan-5-yl-n-methylcarbamic acid esters their preparation and their use as insecticides |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4107324A (da) |
| JP (1) | JPS5295647A (da) |
| BE (1) | BE850911A (da) |
| BR (1) | BR7700580A (da) |
| DE (1) | DE2603835A1 (da) |
| DK (1) | DK39677A (da) |
| FR (1) | FR2339591A1 (da) |
| GB (1) | GB1512936A (da) |
| IL (1) | IL51359A0 (da) |
| NL (1) | NL7700991A (da) |
| PL (1) | PL195708A1 (da) |
| PT (1) | PT66125B (da) |
| SE (1) | SE7701050L (da) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2739193A1 (de) * | 1977-08-31 | 1979-03-08 | Bayer Ag | Indan-5-yl-n-alkyl-carbaminsaeureester, verfahren zu ihrer herstellung sowie ihre verwendung als pflanzenschutzmittel |
| EP0011601B1 (de) * | 1978-11-06 | 1983-02-09 | Ciba-Geigy Ag | 1H-Inden-1-on-Derivate, Verfahren zu ihrer Herstellung sowie ihre Verwendung in mikrobiziden Mitteln und zur Bekämpfung von Mikroorganismen |
| US4510337A (en) * | 1984-01-31 | 1985-04-09 | Phillips Petroleum Company | Process for production of 1,1-dimethyl-6-hydroxyindans |
| DE10210623A1 (de) | 2002-03-11 | 2003-09-25 | Haarmann & Reimer Gmbh | Alkoxy-substituierte Indane und deren Herstellung |
| EP2641903B1 (de) | 2012-03-19 | 2014-10-22 | Symrise AG | Dihydrobenzofuran-Derivate als Riech- und/oder Aromastoffe |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3084096A (en) * | 1955-08-29 | 1963-04-02 | Union Carbide Corp | Indanyl n-methyl carbamate |
| US2870057A (en) * | 1957-11-26 | 1959-01-20 | Gulf Research Development Co | 4- or 5-indanyl n-methyl carbamate |
| DE1249261B (de) * | 1966-06-18 | 1967-09-07 | Farbenfabriken Bayer Aktiengesellschaft, Leverkusen | Verfahren zur Herstellung von Indanyl-N-methylcarbaminsäureestern |
| CH513822A (de) * | 1968-05-25 | 1971-10-15 | Bayer Ag | Verfahren zur Herstellung von Indanyl-N-methylcarbaminsäureestern |
-
1976
- 1976-02-02 DE DE19762603835 patent/DE2603835A1/de active Pending
-
1977
- 1977-01-28 PT PT66125A patent/PT66125B/pt unknown
- 1977-01-28 US US05/763,742 patent/US4107324A/en not_active Expired - Lifetime
- 1977-01-31 GB GB3838/77A patent/GB1512936A/en not_active Expired
- 1977-01-31 BR BR7700580A patent/BR7700580A/pt unknown
- 1977-01-31 BE BE174509A patent/BE850911A/xx unknown
- 1977-01-31 IL IL51359A patent/IL51359A0/xx unknown
- 1977-01-31 NL NL7700991A patent/NL7700991A/xx not_active Application Discontinuation
- 1977-01-31 DK DK39677A patent/DK39677A/da unknown
- 1977-02-01 PL PL19570877A patent/PL195708A1/xx not_active IP Right Cessation
- 1977-02-01 SE SE7701050A patent/SE7701050L/xx unknown
- 1977-02-02 JP JP981277A patent/JPS5295647A/ja active Pending
- 1977-02-02 FR FR7702886A patent/FR2339591A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| US4107324A (en) | 1978-08-15 |
| FR2339591B3 (da) | 1979-10-05 |
| FR2339591A1 (fr) | 1977-08-26 |
| SE7701050L (sv) | 1977-08-03 |
| PL195708A1 (pl) | 1978-01-02 |
| PT66125B (de) | 1978-06-30 |
| DK39677A (da) | 1977-08-03 |
| BE850911A (fr) | 1977-08-01 |
| NL7700991A (nl) | 1977-08-04 |
| GB1512936A (en) | 1978-06-01 |
| DE2603835A1 (de) | 1977-08-04 |
| PT66125A (de) | 1977-02-01 |
| BR7700580A (pt) | 1977-10-04 |
| JPS5295647A (en) | 1977-08-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL58192A0 (en) | N,n-dimethyl-carbamic acid o-pyrazolyl esters their preparation and their use as pesticides | |
| IL52959A0 (en) | Novel pyrimidinylthionophosphonic acid esters their preparation and their use as insecticides and acaricides | |
| ZA775121B (en) | Novel substituted benzoylureidodiphenyl esters and their use as insecticides | |
| IL51466A0 (en) | Novel cyclopropanecarboxylic acid esters their preparation and pesticidal compositions containing them | |
| IL50630A0 (en) | Novel benzimidoylthionothiolphosphoric acid esters their preparation and their use as insecticides and acaricides | |
| ZA775854B (en) | Novel n,n-dimethyl-o-pyrazolyl-carbamic acid esters and their use as insecticides | |
| IL53174A0 (en) | Novel n-chloroacetyl-n-phenyl-alanine esters their preparation and their use as fungicides | |
| IL58148A (en) | N,n-dimethyl-carbamic acid o-pyrimidinyl esters,their preparation and their use as pesticides | |
| IL60534A0 (en) | N,n-dimethyl-carbamic acid o-pyrimidinyl esters,their preparation and their use as pesticides | |
| IL51359A0 (en) | Novel indan-5-yl-n-methylcarbamic acid esters their preparation and their use as insecticides | |
| IL50285A0 (en) | Vinylthionophosphoric acid esters their preparation and their use as insecticides and acaricides | |
| IL56019A0 (en) | Novel n,n-dialkyl-o-pyrimidinyl-carbamic acid esters, their preparation and their use as insecticides | |
| IL55871A0 (en) | Novel phenoxyphenoxyalkanecarboxylic acid esters and their use as herbicides | |
| IL53022A0 (en) | Novel n,n-dimethyl-o-pyrazolyl-carbamic acid esters their preparation and their use as insecticides | |
| IL55060A0 (en) | Novel n,n-dialkyl-o-pyrimidinyl-carbamic acid esters,their preparation and their use as insecticides | |
| DE2960306D1 (en) | Alpha-isopropyl-phenylacetic acid esters, their preparation and use as pesticides | |
| IL52019A0 (en) | Novel 5-phenylcarbamoyl-barbituric acids and their use as insecticides | |
| NZ185901A (en) | 1-aziridine-carboxylic acid esters and their preparation | |
| IL51113A0 (en) | Novel o-alkyl-o-phenylthiophosphonic acid esters their preparation and their use as insecticides | |
| IL61286A0 (en) | -phenylalkanoic acid esters, their preparation and their use as pesticides | |
| MY7800281A (en) | Novel substituted thionophosphonic acid diaklkyl esters and their use as insecticides | |
| IL50994A0 (en) | Alpj alpha-carbamoyloximino-alkylphosphonic acid esters their preparation and their use as insecticides and acaricides | |
| IL51565A0 (en) | Novel o,s-dialkyl-o-pyrazoledithiophosphoric acid esters their preparation and their use as insecticides and acaricides | |
| IL51523A0 (en) | Novel o s-dialkyl-o-pyrazolothionothiolphosphoric acid esters their preparation and their use as insecticides and acaricides | |
| IL51846A0 (en) | Novel o-quinoxalylthionophosphonic acid esters their prepation and their use as insecticides and acaricides |