IL50792A - 1,4-diphenyl-3-pyrazolin-5-ones their preparation and herbicidal compositions containing them - Google Patents
1,4-diphenyl-3-pyrazolin-5-ones their preparation and herbicidal compositions containing themInfo
- Publication number
- IL50792A IL50792A IL50792A IL5079276A IL50792A IL 50792 A IL50792 A IL 50792A IL 50792 A IL50792 A IL 50792A IL 5079276 A IL5079276 A IL 5079276A IL 50792 A IL50792 A IL 50792A
- Authority
- IL
- Israel
- Prior art keywords
- pyrazolin
- diphenyl
- ones
- preparation
- compositions containing
- Prior art date
Links
- XNWYPYFQYFUUTE-UHFFFAOYSA-N 2,4-diphenyl-1h-pyrazol-3-one Chemical class O=C1C(C=2C=CC=CC=2)=CNN1C1=CC=CC=C1 XNWYPYFQYFUUTE-UHFFFAOYSA-N 0.000 title 1
- 230000002363 herbicidal effect Effects 0.000 title 1
- 239000000203 mixture Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/14—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D231/18—One oxygen or sulfur atom
- C07D231/20—One oxygen atom attached in position 3 or 5
- C07D231/22—One oxygen atom attached in position 3 or 5 with aryl radicals attached to ring nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US63974475A | 1975-12-11 | 1975-12-11 | |
| US05/724,502 US4075003A (en) | 1975-12-11 | 1976-09-20 | Novel herbicidal method utilizing 1,4-diphenyl-3-pyrazolin-5-ones |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL50792A0 IL50792A0 (en) | 1976-12-31 |
| IL50792A true IL50792A (en) | 1979-05-31 |
Family
ID=27093389
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL50792A IL50792A (en) | 1975-12-11 | 1976-10-28 | 1,4-diphenyl-3-pyrazolin-5-ones their preparation and herbicidal compositions containing them |
Country Status (28)
| Country | Link |
|---|---|
| JP (1) | JPS6033112B2 (de) |
| AR (1) | AR218861A1 (de) |
| AT (1) | AT354434B (de) |
| AU (1) | AU507882B2 (de) |
| BG (1) | BG27547A3 (de) |
| CA (1) | CA1067907A (de) |
| CH (1) | CH622784A5 (de) |
| CS (1) | CS186746B2 (de) |
| DD (1) | DD129326A5 (de) |
| DE (1) | DE2651008A1 (de) |
| DK (1) | DK550876A (de) |
| ES (1) | ES454061A1 (de) |
| FR (1) | FR2334674A1 (de) |
| GB (1) | GB1570623A (de) |
| GR (1) | GR63123B (de) |
| IE (1) | IE43807B1 (de) |
| IL (1) | IL50792A (de) |
| IT (1) | IT1123686B (de) |
| MX (1) | MX3832E (de) |
| NL (1) | NL7613810A (de) |
| NZ (1) | NZ182530A (de) |
| PH (1) | PH13076A (de) |
| PL (1) | PL106071B1 (de) |
| PT (1) | PT65890B (de) |
| RO (1) | RO72400B (de) |
| SE (1) | SE430413B (de) |
| SU (1) | SU643083A3 (de) |
| ZA (1) | ZA766561B (de) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DK529378A (da) * | 1978-01-09 | 1979-07-10 | Shell Int Research | Anilidderivater |
| NZ213630A (en) * | 1984-10-19 | 1990-02-26 | Ici Plc | Acrylic acid derivatives and fungicidal compositions |
| DE3527157A1 (de) | 1985-07-30 | 1987-02-12 | Bayer Ag | 1-heteroaryl-4-aryl-pyrazol-derivate |
| DE102008020113A1 (de) | 2008-04-23 | 2009-10-29 | Bayer Schering Pharma Aktiengesellschaft | Substituierte Dihydropyrazolone und ihre Verwendung |
| DE102005019712A1 (de) | 2005-04-28 | 2006-11-09 | Bayer Healthcare Ag | Dipyridyl-dihydropyrazolone und ihre Verwendung |
| DE102006050513A1 (de) | 2006-10-26 | 2008-04-30 | Bayer Healthcare Ag | Substitiuierte Dihydropyrazolone und ihre Verwendung |
| DE102006050515A1 (de) | 2006-10-26 | 2008-04-30 | Bayer Healthcare Ag | Substituierte Dipyridiyl-dihydropyrazolone und ihre Verwendung |
| DE102006050516A1 (de) | 2006-10-26 | 2008-04-30 | Bayer Healthcare Ag | Substituierte Dihydropyrazolone und ihre Verwendung |
| DE102007044032A1 (de) | 2007-09-14 | 2009-03-19 | Bayer Healthcare Ag | Substituierte heterocyclische Verbindungen und ihre Verwendung |
| DE102007048447A1 (de) | 2007-10-10 | 2009-04-16 | Bayer Healthcare Ag | Substituierte Dihydropyrazolthione und ihre Verwendung |
| DE102010044131A1 (de) | 2010-11-18 | 2012-05-24 | Bayer Schering Pharma Aktiengesellschaft | Substituiertes Natrium-1H-pyrazol-5-olat |
-
1976
- 1976-10-25 GR GR52014A patent/GR63123B/el unknown
- 1976-10-28 IL IL50792A patent/IL50792A/xx unknown
- 1976-10-29 CA CA264,490A patent/CA1067907A/en not_active Expired
- 1976-11-01 IE IE2429/76A patent/IE43807B1/en unknown
- 1976-11-02 ZA ZA00766561A patent/ZA766561B/xx unknown
- 1976-11-04 NZ NZ182530A patent/NZ182530A/xx unknown
- 1976-11-05 PH PH19097A patent/PH13076A/en unknown
- 1976-11-08 DE DE19762651008 patent/DE2651008A1/de not_active Withdrawn
- 1976-11-25 PT PT65890A patent/PT65890B/pt unknown
- 1976-11-25 SE SE7613239A patent/SE430413B/xx unknown
- 1976-11-26 AR AR265630A patent/AR218861A1/es active
- 1976-12-02 ES ES454061A patent/ES454061A1/es not_active Expired
- 1976-12-02 CH CH1520676A patent/CH622784A5/de not_active IP Right Cessation
- 1976-12-04 RO RO88642A patent/RO72400B/ro unknown
- 1976-12-06 MX MX765189U patent/MX3832E/es unknown
- 1976-12-06 FR FR7636699A patent/FR2334674A1/fr active Granted
- 1976-12-06 GB GB50713/76A patent/GB1570623A/en not_active Expired
- 1976-12-07 CS CS7600007973A patent/CS186746B2/cs unknown
- 1976-12-08 DK DK550876A patent/DK550876A/da not_active Application Discontinuation
- 1976-12-08 DD DD7600196193A patent/DD129326A5/de unknown
- 1976-12-09 AU AU20436/76A patent/AU507882B2/en not_active Expired
- 1976-12-09 AT AT911876A patent/AT354434B/de not_active IP Right Cessation
- 1976-12-09 BG BG034872A patent/BG27547A3/xx unknown
- 1976-12-10 IT IT30299/76A patent/IT1123686B/it active
- 1976-12-10 PL PL1976194292A patent/PL106071B1/pl unknown
- 1976-12-10 SU SU762427094A patent/SU643083A3/ru active
- 1976-12-11 JP JP51149321A patent/JPS6033112B2/ja not_active Expired
- 1976-12-13 NL NL7613810A patent/NL7613810A/xx not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| GB1570623A (en) | 1980-07-02 |
| SE7613239L (sv) | 1977-06-12 |
| JPS5273868A (en) | 1977-06-21 |
| IE43807B1 (en) | 1981-06-03 |
| CS186746B2 (en) | 1978-12-29 |
| CH622784A5 (en) | 1981-04-30 |
| AR218861A1 (es) | 1980-07-15 |
| JPS6033112B2 (ja) | 1985-08-01 |
| PT65890B (en) | 1978-05-18 |
| SU643083A3 (ru) | 1979-01-15 |
| NL7613810A (nl) | 1977-06-14 |
| FR2334674B1 (de) | 1980-11-07 |
| PL106071B1 (pl) | 1979-11-30 |
| NZ182530A (en) | 1978-06-20 |
| MX3832E (es) | 1981-08-04 |
| GR63123B (en) | 1979-09-11 |
| FR2334674A1 (fr) | 1977-07-08 |
| DK550876A (da) | 1977-06-12 |
| PH13076A (en) | 1979-11-23 |
| ATA911876A (de) | 1979-06-15 |
| DE2651008A1 (de) | 1977-06-23 |
| IT1123686B (it) | 1986-04-30 |
| SE430413B (sv) | 1983-11-14 |
| CA1067907A (en) | 1979-12-11 |
| DD129326A5 (de) | 1978-01-11 |
| AU2043676A (en) | 1978-06-15 |
| AT354434B (de) | 1979-01-10 |
| ES454061A1 (es) | 1978-03-01 |
| PT65890A (en) | 1976-12-01 |
| RO72400A (ro) | 1983-04-29 |
| IL50792A0 (en) | 1976-12-31 |
| RO72400B (ro) | 1983-04-30 |
| BG27547A3 (en) | 1979-11-12 |
| ZA766561B (en) | 1978-06-28 |
| IE43807L (en) | 1977-06-11 |
| AU507882B2 (en) | 1980-02-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL51463A (en) | Insecticidal compositions containing n-benzyl-n-methyl-2-propynylamine derivatives,several novel n-benzyl-n-methyl-2-propynylamine derivatives and their preparation | |
| IL50011A (en) | N-substituted3-trifuloromethyl-phenyl-n-benzoyl ureas,their preparation and insecticidal compositions containing the | |
| IL48905A0 (en) | New oxadiazolinone derivatives,their preparation and pesticidal compositions containing them | |
| IL52002A (en) | Herbicidal compositions comprising m-phenoxybenzamides,certain such novel compounds and their preparation | |
| IL50928A0 (en) | New phenoxy-phenoxy-alkanecarboxylic acid derivatives,their preparation and herbicidal compositions containing them | |
| IL55114A0 (en) | Novel 5-alkylthio-pyrimidine derivatives,their preparation and herbicidal compositions containing them | |
| IL49972A (en) | 2,4-diamino-pyrimidine derivatives their manufacture and herbicidal compositions containing them | |
| IL49424A0 (en) | 1,1,1-triaryl-alkylamines,their preparation and pharmaceutical compositions containing them | |
| IL51309A0 (en) | New 1,2-benzisothiazolin-3-ones,their preparation and pharmaceutical compositions containing them | |
| IL50792A (en) | 1,4-diphenyl-3-pyrazolin-5-ones their preparation and herbicidal compositions containing them | |
| MY8000099A (en) | Isobutyramides, their preparation and therapeutic compositions containing them | |
| IL52015A0 (en) | Triazolotriazines their preparation and herbicidal compositions comprising them | |
| IL50170A0 (en) | Herbicidal compositions containing certain pyridazone-(6)derivatives,their production and their use | |
| IL46721A0 (en) | Thiatriazine derivatives,their preparation and herbicidal compositions containing them | |
| IL54358A (en) | 1-substituted-3-amino-6,7-dialkoxy-1h-1,2,4-benzothiadiazine-1-oxides,their preparation and pharmaceutical compositions containing them | |
| IL49132A (en) | 16,1l-disubstituted androst-4-en-3-ones,their preparation and pharmaceutical compositions containing them | |
| IL49231A0 (en) | Novel 2,3-dihaloalkanoyl-ureas,their preparation and their use as fungicides | |
| IL50464A0 (en) | New 1,2,4-oxadiazin-5-one derivatives their preparation and herbicidal compositions containing them | |
| IL49435A0 (en) | New 4-amino-5-thione-1,2,4-triazines,their preparation and their use as herbicides | |
| IL48847A (en) | N-(2,2-dicyanovinyl)-n-benzyl-anilines, their preparation and insecticidal and acaricidal compositions containing them | |
| IL52165A (en) | 2-cyano-2-oximinoacetamide derivatives, their preparation and fungicidal compositions containing them | |
| IL50702A (en) | Substituted 2,1,3-benzothiadiazines,their preparation and herbicidal compositions containing them | |
| IL50105A0 (en) | 1-phenyl-1,3,5,7-tetraaza-4-sulphahept-1-en-6-one derivatives,their preparation and pesticidal compositions containing them | |
| IL50554A (en) | 2,9-dioxatricyclodecanes,their preparation and pharmaceutical compositions containing them | |
| IL50676A (en) | 3-halo-2-phenyl-4,5,6,7-tetrahydro-indazoles, -2,4,5,6,7,8-tetra-hydrocyclopentapyrazoles, their production and herbicidal compositions containing them |