IL49234A - Cyclopropane-1,1-dicarboxylic acid derivatives and their preparation - Google Patents
Cyclopropane-1,1-dicarboxylic acid derivatives and their preparationInfo
- Publication number
- IL49234A IL49234A IL49234A IL4923473A IL49234A IL 49234 A IL49234 A IL 49234A IL 49234 A IL49234 A IL 49234A IL 4923473 A IL4923473 A IL 4923473A IL 49234 A IL49234 A IL 49234A
- Authority
- IL
- Israel
- Prior art keywords
- formula
- compound
- hydrogen
- treating
- octeny
- Prior art date
Links
- FDKLLWKMYAMLIF-UHFFFAOYSA-N cyclopropane-1,1-dicarboxylic acid Chemical class OC(=O)C1(C(O)=O)CC1 FDKLLWKMYAMLIF-UHFFFAOYSA-N 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims 21
- 229910052739 hydrogen Inorganic materials 0.000 claims 13
- 239000001257 hydrogen Substances 0.000 claims 13
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 8
- 125000004187 tetrahydropyran-2-yl group Chemical group [H]C1([H])OC([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 claims 5
- 229910052783 alkali metal Inorganic materials 0.000 claims 4
- 150000001340 alkali metals Chemical class 0.000 claims 4
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims 4
- 150000002431 hydrogen Chemical group 0.000 claims 4
- BUDQDWGNQVEFAC-UHFFFAOYSA-N Dihydropyran Chemical compound C1COC=CC1 BUDQDWGNQVEFAC-UHFFFAOYSA-N 0.000 claims 3
- 239000002253 acid Substances 0.000 claims 3
- 125000001589 carboacyl group Chemical group 0.000 claims 3
- 238000004519 manufacturing process Methods 0.000 claims 3
- SRMCCEAXOINPMD-UHFFFAOYSA-N 1,5-dichloropenta-1,4-dien-3-one Chemical compound ClC=CC(=O)C=CCl SRMCCEAXOINPMD-UHFFFAOYSA-N 0.000 claims 2
- 125000000217 alkyl group Chemical group 0.000 claims 2
- 150000007942 carboxylates Chemical class 0.000 claims 2
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 claims 2
- 150000002576 ketones Chemical class 0.000 claims 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 2
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 claims 1
- 101150065749 Churc1 gene Proteins 0.000 claims 1
- 239000007818 Grignard reagent Substances 0.000 claims 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- 102100038239 Protein Churchill Human genes 0.000 claims 1
- 241001408653 Siona Species 0.000 claims 1
- -1 acetylene Grignard reagent Chemical class 0.000 claims 1
- 150000004703 alkoxides Chemical class 0.000 claims 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 claims 1
- 239000003153 chemical reaction reagent Substances 0.000 claims 1
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 claims 1
- ARNWQMJQALNBBV-UHFFFAOYSA-N lithium carbide Chemical compound [Li+].[Li+].[C-]#[C-] ARNWQMJQALNBBV-UHFFFAOYSA-N 0.000 claims 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims 1
- 150000004794 vinyl magnesium halides Chemical class 0.000 claims 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/93—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems condensed with a ring other than six-membered
- C07D307/935—Not further condensed cyclopenta [b] furans or hydrogenated cyclopenta [b] furans
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C405/00—Compounds containing a five-membered ring having two side-chains in ortho position to each other, and having oxygen atoms directly attached to the ring in ortho position to one of the side-chains, one side-chain containing, not directly attached to the ring, a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, and the other side-chain having oxygen atoms attached in gamma-position to the ring, e.g. prostaglandins ; Analogues or derivatives thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D309/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings
- C07D309/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D309/08—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D309/10—Oxygen atoms
- C07D309/12—Oxygen atoms only hydrogen atoms and one oxygen atom directly attached to ring carbon atoms, e.g. tetrahydropyranyl ethers
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pyrane Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Furan Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US00238650A US3849474A (en) | 1972-03-27 | 1972-03-27 | 11-deoxyprostaglandin derivatives and process therefor |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL49234A true IL49234A (en) | 1976-10-31 |
Family
ID=22898762
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL49234A IL49234A (en) | 1972-03-27 | 1973-02-12 | Cyclopropane-1,1-dicarboxylic acid derivatives and their preparation |
| IL41515A IL41515A (en) | 1972-03-27 | 1973-02-12 | 11-deoxyprostaglandin derivatives and their preparation |
| IL49234A IL49234A0 (en) | 1972-03-27 | 1976-03-17 | Novel cyclopropane-1,1-dicarboxylic acid derivatives and their preparation |
Family Applications After (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL41515A IL41515A (en) | 1972-03-27 | 1973-02-12 | 11-deoxyprostaglandin derivatives and their preparation |
| IL49234A IL49234A0 (en) | 1972-03-27 | 1976-03-17 | Novel cyclopropane-1,1-dicarboxylic acid derivatives and their preparation |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3849474A (cs) |
| JP (1) | JPS495945A (cs) |
| AU (2) | AU476003B2 (cs) |
| CA (1) | CA997341A (cs) |
| CH (1) | CH609969A5 (cs) |
| DE (1) | DE2313868A1 (cs) |
| FR (2) | FR2187332B1 (cs) |
| GB (3) | GB1422319A (cs) |
| HU (1) | HU167202B (cs) |
| IL (3) | IL49234A (cs) |
| NL (1) | NL7304258A (cs) |
| SE (1) | SE391520B (cs) |
| SU (1) | SU655308A3 (cs) |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4045577A (en) * | 1971-06-17 | 1977-08-30 | Alza Corporation | Valuable medicinial prostaglandin compounds prepared from material isolated from the sea |
| JPS5146114B2 (cs) * | 1972-09-01 | 1976-12-07 | ||
| US3987081A (en) * | 1973-04-16 | 1976-10-19 | American Home Products Corporation | Alkyl derivatives of prostanoic acids and preparation thereof |
| JPS5623984B2 (cs) * | 1973-04-19 | 1981-06-03 | ||
| DE2331081A1 (de) * | 1973-06-19 | 1975-01-23 | Hoechst Ag | Neue cyclopentanderivate und verfahren zu ihrer herstellung |
| US4052446A (en) * | 1973-08-06 | 1977-10-04 | Hoffmann-La Roche Inc. | 11,16-substituted prostaglandins |
| US3953435A (en) * | 1974-01-10 | 1976-04-27 | Ono Pharmaceutical Company | Aldehyde derivatives of prostaglandins |
| US3931282A (en) * | 1974-02-21 | 1976-01-06 | Syntex (U.S.A.) Inc. | 11α-Hydroxymethyl prostaglandins |
| US4034003A (en) * | 1974-04-11 | 1977-07-05 | Ono Pharmaceutical Co., Ltd. | 15-Cycloalkyl-prostaglandins |
| US3959263A (en) * | 1974-06-19 | 1976-05-25 | American Home Products Corporation | Prostaglandin intermediate |
| JPS5153758U (cs) * | 1974-10-22 | 1976-04-24 | ||
| US3996263A (en) * | 1975-05-05 | 1976-12-07 | Sankyo Company Limited | 9-Oxo-11α-methyl-15Ε-hyroxyprost-13(trans)-enoic acid derivatives and process for the preparaion thereof |
| US4086269A (en) * | 1975-07-07 | 1978-04-25 | American Home Products Corporation | 11-Deoxy-15-substituted prostaglandins |
| US4257982A (en) * | 1979-04-02 | 1981-03-24 | The Upjohn Company | 2-Decarboxy-2-aminomethyl-19,20-didehydro-13,14-dihydro-PG2 compounds |
| US4257979A (en) * | 1979-04-02 | 1981-03-24 | The Upjohn Company | 2-Decarboxy-2-aminomethyl-19-hydroxy-19-methyl-PG compounds |
| US4257983A (en) * | 1979-04-02 | 1981-03-24 | The Upjohn Company | 2-Decarboxy-2-aminomethyl-19,20-didehydro-PG1 compounds |
| US4257980A (en) * | 1979-04-02 | 1981-03-24 | The Upjohn Company | 2-Decarboxy-2-aminomethyl-19,20-didehydro-13,14-dihydro-PG1 compounds |
| US4257981A (en) * | 1979-04-02 | 1981-03-24 | The Upjohn Company | 2-Decarboxy-2-aminomethyl-19,20-didehydro-PG2 compounds |
| US4251463A (en) * | 1979-05-01 | 1981-02-17 | The Upjohn Company | 2-Decarboxy-2-aminomethyl-9-deoxy-9-methylene-5,6-didehydro-PGF1 compounds |
| US4255354A (en) * | 1979-07-05 | 1981-03-10 | The Upjohn Company | 2-Decarboxy-2-aminomethyl-19-hydroxy-19-methyl-6-oxo-PGF1 compounds |
| US4256667A (en) * | 1979-07-05 | 1981-03-17 | The Upjohn Company | 2-Decarboxy-2-aminomethyl-19-hydroxy-19-methyl-6a-carba-PGI2 compounds |
| US4254058A (en) * | 1979-07-05 | 1981-03-03 | The Upjohn Company | 2-Decarboxy-2-aminomethyl-19-hydroxy-6a-carba-PGI2 compounds |
| US4251464A (en) * | 1979-07-05 | 1981-02-17 | The Upjohn Company | 2-Decarboxy-2-aminomethyl-19-hydroxy-6-oxo-PGE1 compounds |
| US4296241A (en) * | 1979-07-21 | 1981-10-20 | Bayer Aktiengesellschaft | Preparation of 3-(2,2-dichlorovinyl)-2,2-dimethyl-cyclopropane-1-carboxylic acid derivatives |
| JPH0192401A (ja) * | 1987-09-29 | 1989-04-11 | Tatsuji Nakajima | パンツの製造法 |
| WO2008092655A1 (en) * | 2007-01-30 | 2008-08-07 | Dsm Ip Assets B.V. | Process for preparing dienones |
-
1972
- 1972-03-27 US US00238650A patent/US3849474A/en not_active Expired - Lifetime
-
1973
- 1973-02-12 IL IL49234A patent/IL49234A/en unknown
- 1973-02-12 IL IL41515A patent/IL41515A/en unknown
- 1973-02-16 AU AU52255/73A patent/AU476003B2/en not_active Expired
- 1973-03-20 DE DE2313868A patent/DE2313868A1/de active Pending
- 1973-03-23 GB GB1748375A patent/GB1422319A/en not_active Expired
- 1973-03-23 GB GB1748175A patent/GB1422318A/en not_active Expired
- 1973-03-23 GB GB1412873A patent/GB1422518A/en not_active Expired
- 1973-03-26 SE SE7304219A patent/SE391520B/xx unknown
- 1973-03-26 SU SU731900137A patent/SU655308A3/ru active
- 1973-03-26 HU HUAE376A patent/HU167202B/hu unknown
- 1973-03-26 FR FR7310802A patent/FR2187332B1/fr not_active Expired
- 1973-03-27 CA CA167,338A patent/CA997341A/en not_active Expired
- 1973-03-27 JP JP48035005A patent/JPS495945A/ja active Pending
- 1973-03-27 CH CH441873A patent/CH609969A5/xx not_active IP Right Cessation
- 1973-03-27 NL NL7304258A patent/NL7304258A/xx not_active Application Discontinuation
-
1975
- 1975-03-17 FR FR7508290A patent/FR2270234B1/fr not_active Expired
-
1976
- 1976-03-17 IL IL49234A patent/IL49234A0/xx unknown
- 1976-07-14 AU AU15895/76A patent/AU494525B2/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE2313868A1 (de) | 1973-10-04 |
| CH609969A5 (cs) | 1979-03-30 |
| US3849474A (en) | 1974-11-19 |
| IL49234A0 (en) | 1976-05-31 |
| SU655308A3 (ru) | 1979-03-30 |
| AU1589576A (en) | 1976-09-30 |
| AU494525B2 (en) | 1976-09-30 |
| GB1422318A (en) | 1976-01-28 |
| FR2187332A1 (cs) | 1974-01-18 |
| CA997341A (en) | 1976-09-21 |
| GB1422518A (en) | 1976-01-28 |
| SE391520B (sv) | 1977-02-21 |
| IL41515A0 (en) | 1973-05-31 |
| GB1422319A (en) | 1976-01-28 |
| FR2270234B1 (cs) | 1978-02-03 |
| AU5225573A (en) | 1974-08-22 |
| AU476003B2 (en) | 1976-09-09 |
| IL41515A (en) | 1976-10-31 |
| JPS495945A (cs) | 1974-01-19 |
| HU167202B (cs) | 1975-09-27 |
| FR2270234A1 (cs) | 1975-12-05 |
| FR2187332B1 (cs) | 1976-12-24 |
| NL7304258A (cs) | 1973-10-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL49234A (en) | Cyclopropane-1,1-dicarboxylic acid derivatives and their preparation | |
| Hoff et al. | Some conversions of allenyl ethers | |
| Büchi et al. | Synthetic studies on damascenones | |
| DE68918241T2 (de) | Phosphonatreagenz-Zusammensetzungen und Verfahren zu ihrer Herstellung. | |
| Cainelli et al. | Some aspects of the stereospecific synthesis of terpenoids by means of isoprene units | |
| US4000131A (en) | Process for preparing epoxide-cyclohexyl compound and resultant compound | |
| NO127862B (cs) | ||
| Pauson et al. | Cycloheptatriene and tropylium metal complexes. Part IV. Preparation of 7-exo-substituted tricarbonylcycloheptatrienechromiums | |
| US4028385A (en) | Process for preparing stereospecific farnesylacetic acid and ester thereof | |
| House et al. | The Chemistry of Carbanions. II. The Reaction of Organomagnesium Compounds with α, β-Unsaturated Ketones1a | |
| Gerkin et al. | Reaction of epoxides with tri-n-butylcarbethoxymethylidenephosphorane. Formation of unsaturated esters | |
| US2472135A (en) | Manufacture of condensation products | |
| GB1399330A (en) | Process for the production of cycloalkenyl compounds | |
| US4236027A (en) | Novel 11-alkoxy-9-keto (or hydroxy)-prostenoic acid derivatives and method for preparing same | |
| Thenappan et al. | Preparation of α-fluoro-α, β-unsaturated esters via two carbon homologation of esters | |
| JPS642106B2 (cs) | ||
| Naruse et al. | The reaction of lithium trialkylalkynylborates: A novel method of synthesizing α, β-unsaturated ketones | |
| Jorgenson et al. | Stereochemical studies in substituted cyclopentanecarboxylates | |
| US3783135A (en) | Synthesis of codling moth attractant | |
| Masuda et al. | Reaction of trialkylborane with 1-alkyne and lead (IV) acetate. A new regiospecific and stereospecific one-pot synthesis of enol acetates | |
| US3920643A (en) | Intermediates for producing prostaglandins | |
| US3641057A (en) | 4 5-dichloro- 13-dioxacyclopentenone | |
| GB1027970A (en) | Novel acetylene carbinols and a process for the manufacture thereof | |
| US4111992A (en) | Preparation of food coloring agents | |
| US4153805A (en) | Preparation of food coloring agents |