IL46181A - Substituted quinuclidin-2-yl quinoline derivatives their manufacture and pharmaceutical compositions containing the - Google Patents
Substituted quinuclidin-2-yl quinoline derivatives their manufacture and pharmaceutical compositions containing theInfo
- Publication number
- IL46181A IL46181A IL46181A IL4618174A IL46181A IL 46181 A IL46181 A IL 46181A IL 46181 A IL46181 A IL 46181A IL 4618174 A IL4618174 A IL 4618174A IL 46181 A IL46181 A IL 46181A
- Authority
- IL
- Israel
- Prior art keywords
- manufacture
- pharmaceutical compositions
- compositions containing
- quinoline derivatives
- quinuclidin
- Prior art date
Links
- USMCMHIJVVKFEO-UHFFFAOYSA-N 2-(1-azabicyclo[2.2.2]octan-2-yl)quinoline Chemical class C1=CC=CC2=NC(C3CC4CCN3CC4)=CC=C21 USMCMHIJVVKFEO-UHFFFAOYSA-N 0.000 title 1
- 238000004519 manufacturing process Methods 0.000 title 1
- 239000008194 pharmaceutical composition Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
- C07D215/22—Oxygen atoms attached in position 2 or 4
- C07D215/233—Oxygen atoms attached in position 2 or 4 only one oxygen atom which is attached in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/12—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/18—Halogen atoms or nitro radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D453/00—Heterocyclic compounds containing quinuclidine or iso-quinuclidine ring systems, e.g. quinine alkaloids
- C07D453/02—Heterocyclic compounds containing quinuclidine or iso-quinuclidine ring systems, e.g. quinine alkaloids containing not further condensed quinuclidine ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D453/00—Heterocyclic compounds containing quinuclidine or iso-quinuclidine ring systems, e.g. quinine alkaloids
- C07D453/02—Heterocyclic compounds containing quinuclidine or iso-quinuclidine ring systems, e.g. quinine alkaloids containing not further condensed quinuclidine ring systems
- C07D453/04—Heterocyclic compounds containing quinuclidine or iso-quinuclidine ring systems, e.g. quinine alkaloids containing not further condensed quinuclidine ring systems having a quinolyl-4, a substituted quinolyl-4 or a alkylenedioxy-quinolyl-4 radical linked through only one carbon atom, attached in position 2, e.g. quinine
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US42264573A | 1973-12-07 | 1973-12-07 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL46181A0 IL46181A0 (en) | 1975-03-13 |
| IL46181A true IL46181A (en) | 1978-03-10 |
Family
ID=23675777
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL46181A IL46181A (en) | 1973-12-07 | 1974-12-04 | Substituted quinuclidin-2-yl quinoline derivatives their manufacture and pharmaceutical compositions containing the |
Country Status (17)
| Country | Link |
|---|---|
| JP (1) | JPS5088076A (OSRAM) |
| AT (2) | AT339310B (OSRAM) |
| BE (1) | BE823023A (OSRAM) |
| BR (1) | BR7410249A (OSRAM) |
| CA (1) | CA1039283A (OSRAM) |
| CH (1) | CH605916A5 (OSRAM) |
| DE (1) | DE2458146A1 (OSRAM) |
| DK (1) | DK141700B (OSRAM) |
| FR (1) | FR2292476A1 (OSRAM) |
| GB (1) | GB1441519A (OSRAM) |
| IL (1) | IL46181A (OSRAM) |
| KE (1) | KE2718A (OSRAM) |
| MY (1) | MY7700239A (OSRAM) |
| NL (1) | NL7415931A (OSRAM) |
| PH (1) | PH10837A (OSRAM) |
| SE (1) | SE415100B (OSRAM) |
| ZA (1) | ZA747664B (OSRAM) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2381044A1 (fr) * | 1977-02-17 | 1978-09-15 | Hoffmann La Roche | Procede pour la preparation de mefloquine |
| HU191508B (en) * | 1982-12-02 | 1987-02-27 | Alkaloida Vegyeszeti Gyar,Hu | Process for preparing new chloromethyl-quinoline derivatives |
| WO1999012532A2 (en) * | 1997-09-08 | 1999-03-18 | F.Hoffmann-La Roche Ag | Piperidine derivatives against malaria |
| JP2002360830A (ja) * | 2001-06-04 | 2002-12-17 | Heiwa Corp | 球貯蔵入賞装置 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1217427A (en) * | 1967-12-21 | 1970-12-31 | America Home Products Corp | Cinchona alkaloid derivatives |
| CH590275A5 (OSRAM) * | 1970-03-16 | 1977-07-29 | Hoffmann La Roche | |
| IL38492A (en) * | 1971-01-07 | 1975-08-31 | Sparamedica Ag | Quinoline derivatives,their preparation and pharmaceutical compositions containing them |
-
1974
- 1974-11-30 CH CH1586274A patent/CH605916A5/xx not_active IP Right Cessation
- 1974-12-02 ZA ZA00747664A patent/ZA747664B/xx unknown
- 1974-12-02 PH PH16586A patent/PH10837A/en unknown
- 1974-12-03 SE SE7415160A patent/SE415100B/xx unknown
- 1974-12-04 IL IL46181A patent/IL46181A/xx unknown
- 1974-12-05 CA CA215,292A patent/CA1039283A/en not_active Expired
- 1974-12-05 FR FR7439824A patent/FR2292476A1/fr active Granted
- 1974-12-06 DK DK637674AA patent/DK141700B/da unknown
- 1974-12-06 NL NL7415931A patent/NL7415931A/xx not_active Application Discontinuation
- 1974-12-06 JP JP49140423A patent/JPS5088076A/ja active Pending
- 1974-12-06 BE BE151217A patent/BE823023A/xx unknown
- 1974-12-06 AT AT977974A patent/AT339310B/de not_active IP Right Cessation
- 1974-12-06 BR BR10249/74A patent/BR7410249A/pt unknown
- 1974-12-06 GB GB5284374A patent/GB1441519A/en not_active Expired
- 1974-12-09 DE DE19742458146 patent/DE2458146A1/de not_active Withdrawn
-
1977
- 1977-01-18 AT AT24577A patent/AT353792B/de not_active IP Right Cessation
- 1977-03-30 KE KE2718A patent/KE2718A/xx unknown
- 1977-12-30 MY MY239/77A patent/MY7700239A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| ZA747664B (en) | 1976-01-28 |
| DK141700C (OSRAM) | 1980-12-08 |
| ATA977974A (de) | 1977-02-15 |
| AT353792B (de) | 1979-12-10 |
| DE2458146A1 (de) | 1975-06-12 |
| AT339310B (de) | 1977-10-10 |
| GB1441519A (en) | 1976-07-07 |
| NL7415931A (nl) | 1975-06-10 |
| IL46181A0 (en) | 1975-03-13 |
| AU7559274A (en) | 1976-05-27 |
| BE823023A (fr) | 1975-06-06 |
| CH605916A5 (OSRAM) | 1978-10-13 |
| DK637674A (OSRAM) | 1975-07-28 |
| SE7415160L (OSRAM) | 1975-06-09 |
| ATA24577A (de) | 1979-05-15 |
| PH10837A (en) | 1977-09-09 |
| MY7700239A (en) | 1977-12-31 |
| FR2292476B1 (OSRAM) | 1979-05-18 |
| KE2718A (en) | 1977-07-15 |
| SE415100B (sv) | 1980-09-08 |
| BR7410249A (pt) | 1976-06-29 |
| JPS5088076A (OSRAM) | 1975-07-15 |
| CA1039283A (en) | 1978-09-26 |
| DK141700B (da) | 1980-05-27 |
| FR2292476A1 (fr) | 1976-06-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL43853A0 (en) | Pharmaceutical compositions and their manufacture | |
| IL44202A (en) | (3-amino-2-hydroxy-propoxy)-diazines and -pyridine derivatives,their manufacture and pharmaceutical compositions containing them | |
| PH10519A (en) | 4-hydroxymethyl-1-phthalazone derivatives and pharmaceutical compositions thereof | |
| IL46193A0 (en) | Novel pyridoindole derivatives,their manufacture and pharmaceutical compositions containing them | |
| GB1482552A (en) | Benzomorphanes and morphinane derivatives and pharmaceutical compositions containing the same | |
| IL45322A (en) | Phenoxymethyl-phenoxy-propionic acid derivatives the preparation thereof and compositions containing them | |
| IL45516A (en) | 3,20-dioxo-17aalpha-hydroxy-d-homopregn-4-enes their manufacture and pharmaceutical compositions containing them | |
| IL45797A (en) | Isoquinoline derivatives their production and pharmaceutical compositions containing them | |
| IL44427A0 (en) | Dibenzothiepine derivatives,their manufacture and pharmaceutical compositions containing them | |
| HK72578A (en) | Pharmaceutical compositions | |
| PH11400A (en) | Naphthyridine derivatives and pharmaceutical composition thereof | |
| ZA742956B (en) | Pharmaceutical compositions containing triazolo-isoquinoline derivatives | |
| AU7201374A (en) | Pharmaceutical compositions | |
| PH10643A (en) | Benzylpyrimidine derivatives and pharmaceutical compositions thereof | |
| IL45950A (en) | 2-glycylamido-4-pyridyl-thiazole derivatives their preparation and pharmaceutical compositions containing them | |
| IL46181A (en) | Substituted quinuclidin-2-yl quinoline derivatives their manufacture and pharmaceutical compositions containing the | |
| IL41562A0 (en) | Novel morphinan derivatives,their manufacture and pharmaceutical compositions containing them | |
| PH11219A (en) | N-substituted-dihydroxyphenethylamine derivatives and pharmaceutical composition thereof | |
| IL44329A0 (en) | New 1,4-dihydroquinoline derivatives,their production and pharmaceutical compositions containing them | |
| IL41471A (en) | Quinoline derivatives,their production and pharmaceutical compositions containing them | |
| IL46315A0 (en) | Pharmaceutical compositions comprising vincamine | |
| IL40828A0 (en) | Dibenzothiepin derivatives,their manufacture and pharmaceutical compositions containing them | |
| HK57578A (en) | Pharmaceutical compositions | |
| GB1400842A (en) | Oxaprostanoic acid derivatives and pharmaceutical compositions containing the same | |
| IL46316A0 (en) | Pharmaceutical compositions comprising vincamine |