IL44000A - 1-alkylideneaminouracils their preparation and their use as herbicides - Google Patents
1-alkylideneaminouracils their preparation and their use as herbicidesInfo
- Publication number
- IL44000A IL44000A IL44000A IL4400074A IL44000A IL 44000 A IL44000 A IL 44000A IL 44000 A IL44000 A IL 44000A IL 4400074 A IL4400074 A IL 4400074A IL 44000 A IL44000 A IL 44000A
- Authority
- IL
- Israel
- Prior art keywords
- alkyl
- compound
- carbon atoms
- process according
- variant
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 title description 8
- 239000004009 herbicide Substances 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 41
- 238000000034 method Methods 0.000 claims description 29
- 125000000217 alkyl group Chemical group 0.000 claims description 22
- 241000196324 Embryophyta Species 0.000 claims description 19
- 239000003085 diluting agent Substances 0.000 claims description 14
- 125000004432 carbon atom Chemical group C* 0.000 claims description 12
- 239000000203 mixture Substances 0.000 claims description 11
- 229910052799 carbon Inorganic materials 0.000 claims description 10
- 238000006243 chemical reaction Methods 0.000 claims description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims description 8
- 239000001257 hydrogen Substances 0.000 claims description 8
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 7
- 229910052736 halogen Inorganic materials 0.000 claims description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 7
- 150000002576 ketones Chemical class 0.000 claims description 7
- 150000002367 halogens Chemical group 0.000 claims description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 5
- 230000002363 herbicidal effect Effects 0.000 claims description 5
- 239000007788 liquid Substances 0.000 claims description 5
- 239000003054 catalyst Substances 0.000 claims description 4
- -1 cycloaTkenyl Chemical group 0.000 claims description 4
- 239000007787 solid Substances 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 3
- 239000004480 active ingredient Substances 0.000 claims description 3
- 125000003342 alkenyl group Chemical group 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 125000003884 phenylalkyl group Chemical group 0.000 claims description 3
- 239000002798 polar solvent Substances 0.000 claims description 3
- 239000003377 acid catalyst Substances 0.000 claims description 2
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 claims description 2
- 239000000460 chlorine Chemical group 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 125000000392 cycloalkenyl group Chemical group 0.000 claims description 2
- 239000012442 inert solvent Substances 0.000 claims description 2
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 claims 2
- 125000002541 furyl group Chemical group 0.000 claims 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims 2
- IILMINFWXULDNN-UHFFFAOYSA-N 1-aminopyrimidine-2,4-dione Chemical compound NN1C=CC(=O)NC1=O IILMINFWXULDNN-UHFFFAOYSA-N 0.000 claims 1
- DMYXWQPNMMVHBF-UHFFFAOYSA-N 5-amino-3,6-dimethyl-1h-pyrimidine-2,4-dione Chemical compound CC=1NC(=O)N(C)C(=O)C=1N DMYXWQPNMMVHBF-UHFFFAOYSA-N 0.000 claims 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims 1
- 239000004215 Carbon black (E152) Substances 0.000 claims 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims 1
- 229910052794 bromium Inorganic materials 0.000 claims 1
- 229930195733 hydrocarbon Natural products 0.000 claims 1
- 125000001183 hydrocarbyl group Chemical group 0.000 claims 1
- OSFBJERFMQCEQY-UHFFFAOYSA-N propylidene Chemical group [CH]CC OSFBJERFMQCEQY-UHFFFAOYSA-N 0.000 claims 1
- 239000004094 surface-active agent Substances 0.000 claims 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- 150000001299 aldehydes Chemical class 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 238000002844 melting Methods 0.000 description 7
- 230000008018 melting Effects 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- 239000002244 precipitate Substances 0.000 description 6
- ISAKRJDGNUQOIC-UHFFFAOYSA-N Uracil Chemical compound O=C1C=CNC(=O)N1 ISAKRJDGNUQOIC-UHFFFAOYSA-N 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 125000001931 aliphatic group Chemical group 0.000 description 3
- 235000013339 cereals Nutrition 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- 235000014820 Galium aparine Nutrition 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- PWAXUOGZOSVGBO-UHFFFAOYSA-N adipoyl chloride Chemical compound ClC(=O)CCCCC(Cl)=O PWAXUOGZOSVGBO-UHFFFAOYSA-N 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 235000019441 ethanol Nutrition 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- QEWYKACRFQMRMB-UHFFFAOYSA-N fluoroacetic acid Chemical compound OC(=O)CF QEWYKACRFQMRMB-UHFFFAOYSA-N 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- PLQCPDHNBLXOEO-UHFFFAOYSA-N oxazine-3,4-dione Chemical class O=C1C=CONC1=O PLQCPDHNBLXOEO-UHFFFAOYSA-N 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- 229920000151 polyglycol Polymers 0.000 description 2
- 239000010695 polyglycol Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 229940035893 uracil Drugs 0.000 description 2
- AHXADOAHIKYQRT-UHFFFAOYSA-N 2,5-dimethylheptan-4-one Chemical compound CCC(C)C(=O)CC(C)C AHXADOAHIKYQRT-UHFFFAOYSA-N 0.000 description 1
- BCHZICNRHXRCHY-UHFFFAOYSA-N 2h-oxazine Chemical compound N1OC=CC=C1 BCHZICNRHXRCHY-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- 240000002245 Acer pensylvanicum Species 0.000 description 1
- 235000006760 Acer pensylvanicum Nutrition 0.000 description 1
- 102000009027 Albumins Human genes 0.000 description 1
- 108010088751 Albumins Proteins 0.000 description 1
- 240000001592 Amaranthus caudatus Species 0.000 description 1
- 235000009328 Amaranthus caudatus Nutrition 0.000 description 1
- 244000056139 Brassica cretica Species 0.000 description 1
- 235000003351 Brassica cretica Nutrition 0.000 description 1
- 235000003343 Brassica rupestris Nutrition 0.000 description 1
- 240000003173 Drymaria cordata Species 0.000 description 1
- 244000058871 Echinochloa crus-galli Species 0.000 description 1
- 244000025670 Eleusine indica Species 0.000 description 1
- 235000014716 Eleusine indica Nutrition 0.000 description 1
- 241000234642 Festuca Species 0.000 description 1
- 244000214240 Galinsoga parviflora Species 0.000 description 1
- 235000018914 Galinsoga parviflora Nutrition 0.000 description 1
- 240000005702 Galium aparine Species 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 244000211187 Lepidium sativum Species 0.000 description 1
- 235000007849 Lepidium sativum Nutrition 0.000 description 1
- 241000209082 Lolium Species 0.000 description 1
- 101100310622 Mus musculus Soga1 gene Proteins 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 241001310793 Podium Species 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 240000003705 Senecio vulgaris Species 0.000 description 1
- 244000152045 Themeda triandra Species 0.000 description 1
- 240000001261 Urtica urens Species 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical class ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- QKSKPIVNLNLAAV-UHFFFAOYSA-N bis(2-chloroethyl) sulfide Chemical compound ClCCSCCCl QKSKPIVNLNLAAV-UHFFFAOYSA-N 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- KQWGXHWJMSMDJJ-UHFFFAOYSA-N cyclohexyl isocyanate Chemical compound O=C=NC1CCCCC1 KQWGXHWJMSMDJJ-UHFFFAOYSA-N 0.000 description 1
- 230000002950 deficient Effects 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 241001233957 eudicotyledons Species 0.000 description 1
- HYBBIBNJHNGZAN-UHFFFAOYSA-N furfural Chemical compound O=CC1=CC=CO1 HYBBIBNJHNGZAN-UHFFFAOYSA-N 0.000 description 1
- 230000035784 germination Effects 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 230000012010 growth Effects 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 235000010460 mustard Nutrition 0.000 description 1
- 230000017066 negative regulation of growth Effects 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 230000008635 plant growth Effects 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/52—Two oxygen atoms
- C07D239/54—Two oxygen atoms as doubly bound oxygen atoms or as unsubstituted hydroxy radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/52—Two oxygen atoms
- C07D239/54—Two oxygen atoms as doubly bound oxygen atoms or as unsubstituted hydroxy radicals
- C07D239/545—Two oxygen atoms as doubly bound oxygen atoms or as unsubstituted hydroxy radicals with other hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/553—Two oxygen atoms as doubly bound oxygen atoms or as unsubstituted hydroxy radicals with other hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms with halogen atoms or nitro radicals directly attached to ring carbon atoms, e.g. fluorouracil
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyridine Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Thiazole And Isothizaole Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2301971A DE2301971A1 (de) | 1973-01-16 | 1973-01-16 | 1-alkylidenaminouracile, verfahren zu ihrer herstellung und ihre verwendung als herbizide |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL44000A0 IL44000A0 (en) | 1974-05-16 |
| IL44000A true IL44000A (en) | 1977-05-31 |
Family
ID=5869110
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL44000A IL44000A (en) | 1973-01-16 | 1974-01-14 | 1-alkylideneaminouracils their preparation and their use as herbicides |
Country Status (26)
| Country | Link |
|---|---|
| US (1) | US4006008A (cs) |
| JP (2) | JPS49108245A (cs) |
| AT (1) | AT328791B (cs) |
| AU (1) | AU475434B2 (cs) |
| BE (1) | BE809818A (cs) |
| BR (1) | BR7400215D0 (cs) |
| CA (1) | CA1050980A (cs) |
| CH (1) | CH604514A5 (cs) |
| CS (1) | CS179437B2 (cs) |
| DD (1) | DD114209A5 (cs) |
| DE (1) | DE2301971A1 (cs) |
| EG (1) | EG11022A (cs) |
| ES (1) | ES422303A1 (cs) |
| FR (1) | FR2213940B1 (cs) |
| GB (1) | GB1405401A (cs) |
| HU (1) | HU168587B (cs) |
| IE (1) | IE38745B1 (cs) |
| IL (1) | IL44000A (cs) |
| IT (1) | IT1044792B (cs) |
| LU (1) | LU69154A1 (cs) |
| NL (1) | NL7400539A (cs) |
| PL (1) | PL88496B1 (cs) |
| RO (1) | RO63028A (cs) |
| SU (1) | SU542446A3 (cs) |
| TR (1) | TR17624A (cs) |
| ZA (1) | ZA74254B (cs) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4448961A (en) * | 1980-09-14 | 1984-05-15 | Zoecon Corporation | Substituted anilino pyrimidines |
| DE69204909T2 (de) * | 1991-06-07 | 1996-02-08 | Sumitomo Chemical Co | Amino-Urazilderivate, deren Herstellung und Verwendung. |
| KR20170004695A (ko) | 2015-07-03 | 2017-01-11 | 엘지전자 주식회사 | 와치 타입 단말기 |
-
1973
- 1973-01-16 RO RO7300077210A patent/RO63028A/ro unknown
- 1973-01-16 DE DE2301971A patent/DE2301971A1/de active Pending
-
1974
- 1974-01-10 AU AU64398/74A patent/AU475434B2/en not_active Expired
- 1974-01-14 PL PL1974168085A patent/PL88496B1/pl unknown
- 1974-01-14 BR BR215/74A patent/BR7400215D0/pt unknown
- 1974-01-14 SU SU1992877A patent/SU542446A3/ru active
- 1974-01-14 CH CH48174A patent/CH604514A5/xx not_active IP Right Cessation
- 1974-01-14 DD DD175988A patent/DD114209A5/xx unknown
- 1974-01-14 IL IL44000A patent/IL44000A/en unknown
- 1974-01-14 IT IT19388/74A patent/IT1044792B/it active
- 1974-01-14 LU LU69154A patent/LU69154A1/xx unknown
- 1974-01-14 US US05/433,165 patent/US4006008A/en not_active Expired - Lifetime
- 1974-01-15 GB GB186574A patent/GB1405401A/en not_active Expired
- 1974-01-15 ZA ZA740254A patent/ZA74254B/xx unknown
- 1974-01-15 EG EG14/74A patent/EG11022A/xx active
- 1974-01-15 CA CA190,205A patent/CA1050980A/en not_active Expired
- 1974-01-15 TR TR17624A patent/TR17624A/xx unknown
- 1974-01-15 ES ES422303A patent/ES422303A1/es not_active Expired
- 1974-01-15 NL NL7400539A patent/NL7400539A/xx not_active Application Discontinuation
- 1974-01-15 IE IE87/74A patent/IE38745B1/xx unknown
- 1974-01-16 BE BE139873A patent/BE809818A/xx unknown
- 1974-01-16 JP JP49007176A patent/JPS49108245A/ja active Pending
- 1974-01-16 JP JP49007175A patent/JPS49108083A/ja active Pending
- 1974-01-16 AT AT33474*#A patent/AT328791B/de not_active IP Right Cessation
- 1974-01-16 CS CS7400000271A patent/CS179437B2/cs unknown
- 1974-01-16 HU HUBA3015A patent/HU168587B/hu unknown
- 1974-01-16 FR FR7401489A patent/FR2213940B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| SU542446A3 (ru) | 1977-01-05 |
| NL7400539A (cs) | 1974-07-18 |
| TR17624A (tr) | 1975-07-23 |
| PL88496B1 (cs) | 1976-09-30 |
| CS179437B2 (en) | 1977-10-31 |
| DE2301971A1 (de) | 1974-07-25 |
| IE38745L (en) | 1974-07-16 |
| HU168587B (cs) | 1976-06-28 |
| AU6439874A (en) | 1975-07-10 |
| AT328791B (de) | 1976-04-12 |
| IL44000A0 (en) | 1974-05-16 |
| JPS49108083A (cs) | 1974-10-14 |
| ZA74254B (en) | 1974-12-24 |
| LU69154A1 (cs) | 1974-08-19 |
| ES422303A1 (es) | 1976-07-01 |
| BE809818A (fr) | 1974-07-16 |
| AU475434B2 (en) | 1976-08-19 |
| EG11022A (en) | 1977-01-31 |
| IE38745B1 (en) | 1978-05-24 |
| US4006008A (en) | 1977-02-01 |
| FR2213940A1 (cs) | 1974-08-09 |
| ATA33474A (de) | 1975-06-15 |
| RO63028A (fr) | 1978-08-15 |
| CA1050980A (en) | 1979-03-20 |
| DD114209A5 (cs) | 1975-07-20 |
| GB1405401A (en) | 1975-09-10 |
| CH604514A5 (cs) | 1978-09-15 |
| IT1044792B (it) | 1980-04-21 |
| BR7400215D0 (pt) | 1974-08-22 |
| JPS49108245A (cs) | 1974-10-15 |
| FR2213940B1 (cs) | 1977-06-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0104532B1 (en) | O-halobenzoic acid derivatives, process for their preparation, herbicidal compositions and their use | |
| US3957852A (en) | Diphenyl ether compounds | |
| US4003912A (en) | Dicarboximido-N-phenylsubstituted carbamates and derivatives | |
| EP0506907A1 (en) | Heterocyclic dione derivatives as pesticides and plant growth regulators | |
| JPH05178844A (ja) | 除草性化合物 | |
| KR890000368B1 (ko) | (티오-)우레아의 제조방법 | |
| IL31811A (en) | N-(2,2,4,4-tetrafluoro-1,3-benzodioxanyl)-ureas and their preparation | |
| US3133079A (en) | Herbicidal aryl alkyl imidazolinones | |
| IL30585A (en) | Compounds 1,2,4- Thiodiazolyl urea, their preparation and use for weed control | |
| US3978068A (en) | Azomethine compounds of 4-amino-5-H-1,2,4-triazin-5-ones and herbicidal compositions containing them | |
| IL44000A (en) | 1-alkylideneaminouracils their preparation and their use as herbicides | |
| IL26698A (en) | Amidothionophosphoric acid ester | |
| CA1063109A (en) | N-(1,2,4-triazin-5-on-4-yl)-glycine derivatives, process for their preparation and their use as herbicides | |
| US3216816A (en) | Herbicidal composition and method | |
| DE69118634T2 (de) | Benzoxazine mit herbizider Wirkung | |
| US3940391A (en) | 3,4-Dihydro-1,2,4-triazine compounds | |
| US4348411A (en) | Combating bacteria with halogenomethylsulphonylphenyl-phthalamic acids | |
| CA1288434C (en) | Herbicidal compositions | |
| US4482737A (en) | Preparation of N-substituted N-isocyanatocarbonyl-carbamates | |
| US4034104A (en) | Carbamic acid esters of gallic acid, their esters, and heavy metal salts | |
| US4350520A (en) | Plant growth regulant compositions | |
| EP0144052A2 (de) | Chinolinoxyphenylharnstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung zur Bekämpfung unerwünschten Pflanzenwuchhses | |
| HU187330B (en) | Herbicide compositions containing 3,4,5,6-tetrahydro-1,2,4,6-thiatriazine-3,5-dion-1,1-dioxide derivatives and process for producing the active agents | |
| US3148211A (en) | Arylalkyl hydantoaldehyde, dialkylacetals | |
| KR930011780B1 (ko) | 3-옥시미노 디페닐에테르 유도체의 제조방법 |