IL42218A - Process for the preparation of compounds 1-) 5-alkyl-1,3,4-thiaziazol-2-yl (-3-alkyl urea - Google Patents
Process for the preparation of compounds 1-) 5-alkyl-1,3,4-thiaziazol-2-yl (-3-alkyl ureaInfo
- Publication number
- IL42218A IL42218A IL42218A IL4221873A IL42218A IL 42218 A IL42218 A IL 42218A IL 42218 A IL42218 A IL 42218A IL 4221873 A IL4221873 A IL 4221873A IL 42218 A IL42218 A IL 42218A
- Authority
- IL
- Israel
- Prior art keywords
- alkyl
- thiadiazol
- aromatic hydrocarbon
- added
- butyl
- Prior art date
Links
- 235000013877 carbamide Nutrition 0.000 title claims description 7
- 238000004519 manufacturing process Methods 0.000 title description 3
- 150000004945 aromatic hydrocarbons Chemical class 0.000 claims description 18
- 239000010410 layer Substances 0.000 claims description 18
- 239000002904 solvent Substances 0.000 claims description 16
- 238000006243 chemical reaction Methods 0.000 claims description 15
- 238000000034 method Methods 0.000 claims description 13
- 239000002253 acid Substances 0.000 claims description 10
- 239000012948 isocyanate Substances 0.000 claims description 10
- 150000001875 compounds Chemical class 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 150000002513 isocyanates Chemical class 0.000 claims description 8
- 239000000203 mixture Substances 0.000 claims description 8
- 238000010438 heat treatment Methods 0.000 claims description 7
- 238000002360 preparation method Methods 0.000 claims description 7
- VLLMWSRANPNYQX-UHFFFAOYSA-N thiadiazole Chemical compound C1=CSN=N1.C1=CSN=N1 VLLMWSRANPNYQX-UHFFFAOYSA-N 0.000 claims description 7
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 6
- 239000011707 mineral Substances 0.000 claims description 6
- 230000002378 acidificating effect Effects 0.000 claims description 4
- 239000012044 organic layer Substances 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 238000001035 drying Methods 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 210000000056 organ Anatomy 0.000 claims 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 66
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 24
- -1 alkyl isocyanate Chemical class 0.000 description 20
- 229940032330 sulfuric acid Drugs 0.000 description 11
- 239000011541 reaction mixture Substances 0.000 description 10
- 229940057054 1,3-dimethylurea Drugs 0.000 description 9
- 239000008096 xylene Substances 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 6
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 5
- 239000000908 ammonium hydroxide Substances 0.000 description 5
- 239000012065 filter cake Substances 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 3
- 239000004202 carbamide Substances 0.000 description 3
- 239000012153 distilled water Substances 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000006210 cyclodehydration reaction Methods 0.000 description 2
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 2
- 239000004009 herbicide Substances 0.000 description 2
- IVSZLXZYQVIEFR-UHFFFAOYSA-N m-xylene Chemical group CC1=CC=CC(C)=C1 IVSZLXZYQVIEFR-UHFFFAOYSA-N 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000006798 ring closing metathesis reaction Methods 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- 238000004809 thin layer chromatography Methods 0.000 description 2
- AWHORBWDEKTQAX-UHFFFAOYSA-N 1,3-dipropylurea Chemical compound CCCNC(=O)NCCC AWHORBWDEKTQAX-UHFFFAOYSA-N 0.000 description 1
- 125000004777 2-fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 description 1
- 125000004398 2-methyl-2-butyl group Chemical group CC(C)(CC)* 0.000 description 1
- 125000004918 2-methyl-2-pentyl group Chemical group CC(C)(CCC)* 0.000 description 1
- 125000004922 2-methyl-3-pentyl group Chemical group CC(C)C(CC)* 0.000 description 1
- 125000004917 3-methyl-2-butyl group Chemical group CC(C(C)*)C 0.000 description 1
- JZUFKLXOESDKRF-UHFFFAOYSA-N Chlorothiazide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC2=C1NCNS2(=O)=O JZUFKLXOESDKRF-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 150000001266 acyl halides Chemical class 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000004996 alkyl benzenes Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000005997 bromomethyl group Chemical group 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 125000004775 chlorodifluoromethyl group Chemical group FC(F)(Cl)* 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 125000001475 halogen functional group Chemical group 0.000 description 1
- 125000006341 heptafluoro n-propyl group Chemical group FC(F)(F)C(F)(F)C(F)(F)* 0.000 description 1
- BRWIZMBXBAOCCF-UHFFFAOYSA-N hydrazinecarbothioamide Chemical compound NNC(N)=S BRWIZMBXBAOCCF-UHFFFAOYSA-N 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 231100000989 no adverse effect Toxicity 0.000 description 1
- 125000006340 pentafluoro ethyl group Chemical group FC(F)(F)C(F)(F)* 0.000 description 1
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000001577 simple distillation Methods 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 239000012485 toluene extract Substances 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D285/00—Heterocyclic compounds containing rings having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by groups C07D275/00 - C07D283/00
- C07D285/01—Five-membered rings
- C07D285/02—Thiadiazoles; Hydrogenated thiadiazoles
- C07D285/04—Thiadiazoles; Hydrogenated thiadiazoles not condensed with other rings
- C07D285/12—1,3,4-Thiadiazoles; Hydrogenated 1,3,4-thiadiazoles
- C07D285/125—1,3,4-Thiadiazoles; Hydrogenated 1,3,4-thiadiazoles with oxygen, sulfur or nitrogen atoms, directly attached to ring carbon atoms, the nitrogen atoms not forming part of a nitro radical
- C07D285/135—Nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen- Or Sulfur-Containing Heterocyclic Ring Compounds With Rings Of Six Or More Members (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US00255703A US3803164A (en) | 1972-05-22 | 1972-05-22 | Simplified one vessel preparation of 1-(5-alkyl-1,3,4-thiadiazol-2-yl)-1,3-dialkyl-ureas with azeotropic drying |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL42218A0 IL42218A0 (en) | 1973-07-30 |
| IL42218A true IL42218A (en) | 1977-01-31 |
Family
ID=22969531
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL42218A IL42218A (en) | 1972-05-22 | 1973-05-08 | Process for the preparation of compounds 1-) 5-alkyl-1,3,4-thiaziazol-2-yl (-3-alkyl urea |
Country Status (27)
| Country | Link |
|---|---|
| US (1) | US3803164A (cs) |
| JP (1) | JPS4948668A (cs) |
| AR (1) | AR194667A1 (cs) |
| AT (1) | AT325631B (cs) |
| AU (1) | AU472800B2 (cs) |
| BE (1) | BE799575A (cs) |
| BG (1) | BG21215A3 (cs) |
| BR (1) | BR7303730D0 (cs) |
| CA (1) | CA955261A (cs) |
| CH (1) | CH562235A5 (cs) |
| CS (1) | CS178427B2 (cs) |
| DD (1) | DD105232A5 (cs) |
| DE (1) | DE2325332A1 (cs) |
| ES (1) | ES414987A1 (cs) |
| FR (1) | FR2185629B1 (cs) |
| GB (1) | GB1405195A (cs) |
| HU (1) | HU166841B (cs) |
| IE (1) | IE37589B1 (cs) |
| IL (1) | IL42218A (cs) |
| IT (1) | IT986094B (cs) |
| NL (1) | NL7307093A (cs) |
| PH (1) | PH11138A (cs) |
| PL (1) | PL99724B1 (cs) |
| RO (1) | RO62899A (cs) |
| SE (1) | SE395274B (cs) |
| SU (1) | SU649319A3 (cs) |
| ZA (1) | ZA732973B (cs) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1439501A (en) * | 1972-08-14 | 1976-06-16 | Air Prod & Chem | Herbicidal compositions and method of use |
| US4097264A (en) * | 1973-05-14 | 1978-06-27 | Gulf Oil Corporation | Chloro-tert.butyl-1,3,4-thiadiazoleurea herbicides and use to combat unwanted vegetation |
| US4028090A (en) * | 1974-10-15 | 1977-06-07 | Eli Lilly And Company | Herbicidal use of 5-cyanoalkyl-1,3,4-thiadiazol-2-ylureas |
| DE2623657A1 (de) * | 1976-05-24 | 1977-12-08 | Schering Ag | 2-dimethylcarbamoylimino-1,3,4- thiadiazolin-3-id-salze, verfahren zur herstellung dieser verbindungen sowie diese enthaltende herbizide mittel |
| DE3884070T2 (de) * | 1987-06-25 | 1994-01-13 | Dowelanco | Verfahren zur Herstellung von Harnstoffen. |
| CN103288777A (zh) * | 2013-05-28 | 2013-09-11 | 浙江禾田化工有限公司 | 特丁噻草隆关键中间体2-甲基氨基-5-叔丁基-1,3,4-噻二唑的合成方法 |
| US10259778B2 (en) * | 2014-11-10 | 2019-04-16 | Aurobindo Pharma Ltd | Process for the preparation of raltegravir |
| CN108794427B (zh) * | 2018-07-13 | 2022-07-29 | 江苏快达农化股份有限公司 | 一种1,3,4-噻二唑衍生物的合成方法 |
-
1972
- 1972-05-22 US US00255703A patent/US3803164A/en not_active Expired - Lifetime
-
1973
- 1973-05-02 ZA ZA732973A patent/ZA732973B/xx unknown
- 1973-05-03 IE IE697/73A patent/IE37589B1/xx unknown
- 1973-05-04 GB GB2137173A patent/GB1405195A/en not_active Expired
- 1973-05-08 IL IL42218A patent/IL42218A/en unknown
- 1973-05-09 AU AU55477/73A patent/AU472800B2/en not_active Expired
- 1973-05-11 CA CA171,019A patent/CA955261A/en not_active Expired
- 1973-05-15 FR FR7317448A patent/FR2185629B1/fr not_active Expired
- 1973-05-16 BE BE1005049A patent/BE799575A/xx unknown
- 1973-05-16 SE SE7306899A patent/SE395274B/xx unknown
- 1973-05-17 CH CH708173A patent/CH562235A5/xx not_active IP Right Cessation
- 1973-05-18 DE DE2325332A patent/DE2325332A1/de active Pending
- 1973-05-18 AR AR248101A patent/AR194667A1/es active
- 1973-05-18 PH PH14626A patent/PH11138A/en unknown
- 1973-05-21 HU HUEI477A patent/HU166841B/hu unknown
- 1973-05-21 SU SU731925437A patent/SU649319A3/ru active
- 1973-05-21 NL NL7307093A patent/NL7307093A/xx not_active Application Discontinuation
- 1973-05-21 ES ES414987A patent/ES414987A1/es not_active Expired
- 1973-05-21 BR BR3730/73A patent/BR7303730D0/pt unknown
- 1973-05-22 CS CS3683A patent/CS178427B2/cs unknown
- 1973-05-22 BG BG023692A patent/BG21215A3/xx unknown
- 1973-05-22 IT IT50116/73A patent/IT986094B/it active
- 1973-05-22 RO RO74866A patent/RO62899A/ro unknown
- 1973-05-22 DD DD170991A patent/DD105232A5/xx unknown
- 1973-05-22 PL PL1973162757A patent/PL99724B1/pl unknown
- 1973-05-22 JP JP48057097A patent/JPS4948668A/ja active Pending
- 1973-05-22 AT AT444473A patent/AT325631B/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| AU5547773A (en) | 1974-11-14 |
| ES414987A1 (es) | 1976-02-16 |
| SE395274B (sv) | 1977-08-08 |
| HU166841B (cs) | 1975-06-28 |
| IL42218A0 (en) | 1973-07-30 |
| JPS4948668A (cs) | 1974-05-11 |
| BG21215A3 (bg) | 1976-03-20 |
| US3803164A (en) | 1974-04-09 |
| SU649319A3 (ru) | 1979-02-25 |
| BR7303730D0 (pt) | 1974-06-27 |
| AR194667A1 (es) | 1973-07-31 |
| IE37589L (en) | 1973-11-22 |
| GB1405195A (en) | 1975-09-03 |
| AU472800B2 (en) | 1976-06-03 |
| BE799575A (fr) | 1973-11-16 |
| CA955261A (en) | 1974-09-24 |
| ZA732973B (en) | 1974-10-30 |
| DE2325332A1 (de) | 1973-12-06 |
| DD105232A5 (cs) | 1974-04-12 |
| NL7307093A (cs) | 1973-11-26 |
| CH562235A5 (cs) | 1975-05-30 |
| ATA444473A (de) | 1975-01-15 |
| PL99724B1 (pl) | 1978-08-31 |
| FR2185629B1 (cs) | 1977-04-29 |
| CS178427B2 (cs) | 1977-09-15 |
| AT325631B (de) | 1975-10-27 |
| IT986094B (it) | 1975-01-10 |
| PH11138A (en) | 1977-10-27 |
| RO62899A (cs) | 1977-08-15 |
| IE37589B1 (en) | 1977-08-31 |
| FR2185629A1 (cs) | 1974-01-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP2855467B1 (en) | Processes to produce certain 2-(pyridine-3-yl)thiazoles | |
| NO136793B (no) | Analogifremgangsm}te til fremstilling av terapeutisk virksomme substituerte 1,2,4-triazolderivater. | |
| EP0104522B1 (en) | New pyrazolo(3,4-b)pyridine derivatives and process for producing them | |
| IL42218A (en) | Process for the preparation of compounds 1-) 5-alkyl-1,3,4-thiaziazol-2-yl (-3-alkyl urea | |
| CA1184556A (en) | Catalysts for silylation | |
| Elliott | 126. The stereochemistry of an oxazoline derivative of threonine. Improvement of a recent threonine synthesis | |
| CA2368815A1 (en) | Novel synthesis and crystallization of piperazine ring-containing compounds | |
| US2989538A (en) | Process for preparing pyrazoloindenone hydrazones | |
| DE68926810T2 (de) | Benzoxazepinon-Verfahren | |
| Brown et al. | 170. The mechanism of indole formation from phenacylarylamines. Part III. The conditions and mechanism of the isomerisation and indolisation of phenacylarylamines | |
| US3887572A (en) | Preparation of 2-amino-5-alkyl-1,3,4-thiadiazoles | |
| US9475799B1 (en) | Synthesis of Raltegravir | |
| JPS5821916B2 (ja) | トリアゾロベンゾチアゾ−ルルイノセイホウ | |
| US3203954A (en) | Novel 3, 5-disubstituted-1, 2, 6-(2h)-thiadiazine-1, 1-dioxides | |
| US20010051718A1 (en) | Novel synthesis and crystallization of piperazine ring-containing compounds | |
| Breuer | Nitroheterocycles. I. Nitrofuryl-substituted 3-amino-1, 2, 4-oxadiazoles and 5-amino-1, 2, 4-oxadiazoles | |
| US2827457A (en) | department of commerce | |
| Sakai et al. | 5-Methyl-and 5-phenyl-1-aminotetrazoles | |
| US2945047A (en) | Thiosemicarbazides | |
| KR860001568B1 (ko) | 선택적 설폰화 방법에 의한 페닐렌디아민 유도체의 제조 방법 | |
| CA1268458A (en) | Quinolizinone compound, processes for preparation thereof and pharmaceutical composition comprising the same | |
| US3385861A (en) | Process for the manufacture of a 3-unsubstituted 1-[5-nitro-2-thiazolyl]-2-oxotetrahydroimidazole | |
| Sato et al. | The Reaction of N-Acylmethylisoquinolinium Betain with Heterocumulens | |
| US3170930A (en) | Derivatives of dibenzo[1, 4, 5]thiadiazepine, dibenzo[1, 4, 5]oxadiazepine and dibenzo[1, 2, 5]triazepine | |
| US2801248A (en) | 4-pyridoxylamino-3-isoxazolidone compounds |