IL39157A - Ketoxime carbamates,their preparation and their use as pesticides - Google Patents
Ketoxime carbamates,their preparation and their use as pesticidesInfo
- Publication number
- IL39157A IL39157A IL39157A IL3915772A IL39157A IL 39157 A IL39157 A IL 39157A IL 39157 A IL39157 A IL 39157A IL 3915772 A IL3915772 A IL 3915772A IL 39157 A IL39157 A IL 39157A
- Authority
- IL
- Israel
- Prior art keywords
- pests
- methylcarbamyloximino
- formula
- dimethyl
- compound
- Prior art date
Links
- 150000004657 carbamic acid derivatives Chemical class 0.000 title 1
- 239000000575 pesticide Substances 0.000 title 1
- 238000000034 method Methods 0.000 claims 18
- 241000607479 Yersinia pestis Species 0.000 claims 17
- 150000001875 compounds Chemical class 0.000 claims 10
- 125000000217 alkyl group Chemical group 0.000 claims 6
- 241000238876 Acari Species 0.000 claims 4
- 241000238631 Hexapoda Species 0.000 claims 4
- 229910052736 halogen Inorganic materials 0.000 claims 4
- 150000002367 halogens Chemical class 0.000 claims 4
- 230000000361 pesticidal effect Effects 0.000 claims 4
- 229910052739 hydrogen Inorganic materials 0.000 claims 3
- 239000001257 hydrogen Substances 0.000 claims 3
- -1 -OSC^H Chemical group 0.000 claims 2
- 125000003342 alkenyl group Chemical group 0.000 claims 2
- 125000003545 alkoxy group Chemical group 0.000 claims 2
- 150000002431 hydrogen Chemical class 0.000 claims 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 2
- 230000001105 regulatory effect Effects 0.000 claims 2
- 125000005346 substituted cycloalkyl group Chemical group 0.000 claims 2
- CFKSOJCUYPOBQJ-UHFFFAOYSA-N 2-(N-hydroxy-C-methylsulfonylcarbonimidoyl)-N,3,3-trimethylbutanamide Chemical compound CNC(=O)C(C(C)(C)C)C(=NO)S(C)(=O)=O CFKSOJCUYPOBQJ-UHFFFAOYSA-N 0.000 claims 1
- FOUOBTROYCZWFU-UHFFFAOYSA-N 2-methylsulfanylethyl n-hydroxy-3,3-dimethyl-2-(methylcarbamoyl)butanimidothioate Chemical compound CNC(=O)C(C(C)(C)C)C(=NO)SCCSC FOUOBTROYCZWFU-UHFFFAOYSA-N 0.000 claims 1
- KPQSGUJMEMUMJX-UHFFFAOYSA-N CSC(=NO)C(C(N)=O)C(C)(C)C Chemical compound CSC(=NO)C(C(N)=O)C(C)(C)C KPQSGUJMEMUMJX-UHFFFAOYSA-N 0.000 claims 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- 241000244206 Nematoda Species 0.000 claims 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 claims 1
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 claims 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims 1
- 125000000304 alkynyl group Chemical group 0.000 claims 1
- 150000001412 amines Chemical class 0.000 claims 1
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 claims 1
- 125000004432 carbon atom Chemical group C* 0.000 claims 1
- 125000004663 dialkyl amino group Chemical group 0.000 claims 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 1
- 239000012948 isocyanate Substances 0.000 claims 1
- 150000002513 isocyanates Chemical class 0.000 claims 1
- JUHVNJMMHVLRPL-UHFFFAOYSA-N methyl n-hydroxy-3,3-dimethyl-2-(methylcarbamoyl)pentanimidothioate Chemical compound CCC(C)(C)C(C(=O)NC)C(SC)=NO JUHVNJMMHVLRPL-UHFFFAOYSA-N 0.000 claims 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 claims 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims 1
- 125000002112 pyrrolidino group Chemical group [*]N1C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims 1
- 125000001424 substituent group Chemical group 0.000 claims 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/12—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms
- C07D295/125—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms with the ring nitrogen atoms and the substituent nitrogen atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/13—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms with the ring nitrogen atoms and the substituent nitrogen atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings to an acyclic saturated chain
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C321/00—Thiols, sulfides, hydropolysulfides or polysulfides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/14—Radicals substituted by singly bound hetero atoms other than halogen
- C07D333/18—Radicals substituted by singly bound hetero atoms other than halogen by sulfur atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US13258471A | 1971-04-08 | 1971-04-08 | |
| US229207A US3875232A (en) | 1971-04-08 | 1972-02-24 | AC Ketoxime carbamates |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL39157A0 IL39157A0 (en) | 1972-06-28 |
| IL39157A true IL39157A (en) | 1976-08-31 |
Family
ID=26830521
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL39157A IL39157A (en) | 1971-04-08 | 1972-04-07 | Ketoxime carbamates,their preparation and their use as pesticides |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US3875232A (ro) |
| JP (1) | JPS5533410B1 (ro) |
| AR (1) | AR192758A1 (ro) |
| BE (1) | BE830594Q (ro) |
| CA (1) | CA984399A (ro) |
| CH (3) | CH585194A5 (ro) |
| DE (1) | DE2216838C2 (ro) |
| EG (1) | EG10912A (ro) |
| ES (1) | ES401551A1 (ro) |
| FR (1) | FR2136055A5 (ro) |
| GB (1) | GB1392111A (ro) |
| HU (1) | HU165184B (ro) |
| IE (1) | IE36264B1 (ro) |
| IL (1) | IL39157A (ro) |
| IT (1) | IT954413B (ro) |
| NL (1) | NL175989C (ro) |
| PL (1) | PL89001B1 (ro) |
| RO (3) | RO72827A (ro) |
| SU (3) | SU466681A3 (ro) |
| YU (3) | YU39065B (ro) |
Families Citing this family (29)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4215075A (en) * | 1971-04-08 | 1980-07-29 | Diamond Shamrock Corporation | Ketoxime carbamates |
| US3932471A (en) * | 1972-02-24 | 1976-01-13 | Diamond Shamrock Corporation | Azide |
| DE2408522A1 (de) * | 1974-02-22 | 1975-09-04 | Boehringer Mannheim Gmbh | Aminderivate der azidophenole und verfahren zu ihrer herstellung |
| US3932508A (en) | 1974-04-26 | 1976-01-13 | Minnesota Mining And Manufacturing Company | Polyfluoromethylthio-substituted compounds |
| US4029688A (en) * | 1974-06-27 | 1977-06-14 | Union Carbide Corporation | Carbamic pesticidal compositions |
| US3988357A (en) * | 1975-01-20 | 1976-10-26 | Stauffer Chemical Company | Certain oxime carbonates |
| US4018894A (en) * | 1975-01-20 | 1977-04-19 | Stauffer Chemical Company | Oxime carbonetes as fungicidal or bactericidal agents |
| US4009179A (en) * | 1975-10-15 | 1977-02-22 | E. I. Du Pont De Nemours And Company | Di- and tri-substituted oxazolidin-2-one oximes |
| DE2621102A1 (de) | 1976-05-10 | 1977-11-24 | Schering Ag | Propan-1,2-diondioxime, schaedlingsbekaempfungsmittel enthaltend diese verbindungen sowie verfahren zu ihrer herstellung |
| US4072750A (en) * | 1976-06-01 | 1978-02-07 | Union Carbide Corporation | 1,3,5-Trithiane and 1,3,5-oxadithiane carbamoyloxime compounds and insecticidal and miticidal compositions and methods employing them |
| US4073930A (en) * | 1976-06-01 | 1978-02-14 | Union Carbide Corporation | Carbamoyloximes and oximes and insecticidal and miticidal compositions and methods employing them |
| US4454134A (en) * | 1976-06-14 | 1984-06-12 | Union Carbide Corporation | Amide carbamates and amide oxime compounds |
| DE2631522A1 (de) * | 1976-07-14 | 1978-01-19 | Bayer Ag | Oximcarbamate fluorierter ketone, verfahren zu ihrer herstellung und ihre verwendung als insektizide, akarizide und nematizide |
| US4045491A (en) * | 1976-10-07 | 1977-08-30 | International Flavors & Fragrances Inc. | α-Oxy(oxo) sulfides and ethers |
| DE2828133A1 (de) * | 1978-06-27 | 1980-01-10 | Bayer Ag | N-sulfenylierte carbamoyloximino-1- methylthio-butane, verfahren zu ihrer herstellung und ihre verwendung als insektizide |
| CA1126278A (en) * | 1978-11-09 | 1982-06-22 | Paul Winternitz | Carbamoyloximes |
| US4234514A (en) * | 1978-12-04 | 1980-11-18 | Diamond Shamrock Corporation | Method of preparing ketoxime carbamates |
| US4264528A (en) * | 1978-12-04 | 1981-04-28 | Diamond Shamrock Corporation | Method of preparing ketoxime carbamates |
| DE2933600A1 (de) * | 1979-08-18 | 1981-04-09 | Bayer Ag, 5090 Leverkusen | Substituierte 2-carbamoyloximinobutane, verfahren zu ihrer herstellung und ihre verwendung als schaedlingsbekaempfungsmittel |
| DE3125920A1 (de) | 1981-07-01 | 1983-01-20 | Basf Ag, 6700 Ludwigshafen | "verfahren zur herstellung von sulfiden" |
| US4387053A (en) * | 1981-11-23 | 1983-06-07 | Diamond Shamrock Corporation | Stabilization of oxime carbamates with gallic acid, lower alkyl ester derivatives thereof |
| DE3204788A1 (de) * | 1982-02-11 | 1983-08-18 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von 5-substituierten 1-chlor-3,3-dimethylpentan-2-onen |
| US4640927A (en) * | 1984-03-30 | 1987-02-03 | Uniroyal Chemical Company, Inc. | Substituted oxime carbamates |
| US4785108A (en) * | 1984-06-04 | 1988-11-15 | Uniroyal Chemical Company, Inc. | Substituted oxime carbamates |
| US5200427A (en) * | 1984-07-27 | 1993-04-06 | The Board Of Trustees Of The Univ. Of Illinois | Porphyric insecticides |
| GB2173499A (en) * | 1985-02-04 | 1986-10-15 | Ici Plc | Fungicidal dithiolopyrrolones |
| US7842727B2 (en) * | 2001-03-27 | 2010-11-30 | Errant Gene Therapeutics, Llc | Histone deacetylase inhibitors |
| WO2003099789A1 (en) * | 2002-05-22 | 2003-12-04 | Errant Gene Therapeutics, Llc. | Histone deacetylase inhibitors based on alphachalcogenmethylcarbonyl compounds |
| WO2003099272A1 (en) * | 2002-05-22 | 2003-12-04 | Errant Gene Therapeutics, Llc | Histone deacetylase inhibitors based on alpha-ketoepoxide compounds |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA846786A (en) * | 1970-07-14 | R. Baker Don. | Use of certain oxime esters in controlling fungi upon cellulosic materials | |
| NL106827C (ro) * | 1957-01-21 | |||
| BE637723A (ro) * | 1962-09-25 | |||
| US3400153A (en) * | 1964-09-23 | 1968-09-03 | Union Carbide Corp | Nitroalkyl carbamoyloximes |
| US3454642A (en) * | 1966-12-22 | 1969-07-08 | Upjohn Co | Alkyl 2-methylpropenyl ketoxime carbamates |
| GB1214077A (en) * | 1967-11-02 | 1970-12-02 | Usv Pharma Corp | Oximes and their carbamoyl esters and the methods of preparation thereof |
| NL6912150A (ro) * | 1968-08-19 | 1970-02-23 | ||
| US3681386A (en) * | 1969-11-06 | 1972-08-01 | Minnesota Mining & Mfg | Substituted alkanal oximes |
| CH536286A (de) * | 1970-03-23 | 1973-04-30 | Agripat Sa | Verfahren zur Herstellung von neuen Carbamoyl-oximen |
| US3647861A (en) * | 1970-08-25 | 1972-03-07 | Du Pont | Substituted o-carbamylhydroxamates |
-
1972
- 1972-02-24 US US229207A patent/US3875232A/en not_active Expired - Lifetime
- 1972-03-17 CA CA137,337A patent/CA984399A/en not_active Expired
- 1972-03-27 FR FR7210622A patent/FR2136055A5/fr not_active Expired
- 1972-04-05 AR AR241311A patent/AR192758A1/es active
- 1972-04-06 EG EG138/72A patent/EG10912A/xx active
- 1972-04-07 RO RO7282519A patent/RO72827A/ro unknown
- 1972-04-07 YU YU00944/72A patent/YU39065B/xx unknown
- 1972-04-07 CH CH436875A patent/CH585194A5/xx not_active IP Right Cessation
- 1972-04-07 JP JP3563572A patent/JPS5533410B1/ja active Pending
- 1972-04-07 SU SU1887327A patent/SU466681A3/ru active
- 1972-04-07 RO RO70445A patent/RO61151A/ro unknown
- 1972-04-07 PL PL1972154659A patent/PL89001B1/pl unknown
- 1972-04-07 IL IL39157A patent/IL39157A/en unknown
- 1972-04-07 IE IE453/72A patent/IE36264B1/xx unknown
- 1972-04-07 CH CH514972A patent/CH611275A5/xx not_active IP Right Cessation
- 1972-04-07 GB GB1618772A patent/GB1392111A/en not_active Expired
- 1972-04-07 NL NLAANVRAGE7204698,A patent/NL175989C/xx not_active IP Right Cessation
- 1972-04-07 RO RO7282518A patent/RO72853A/ro unknown
- 1972-04-07 IT IT49465/72A patent/IT954413B/it active
- 1972-04-07 DE DE2216838A patent/DE2216838C2/de not_active Expired
- 1972-04-07 CH CH436975A patent/CH591433A5/xx not_active IP Right Cessation
- 1972-04-07 SU SU1769624A patent/SU454735A3/ru active
- 1972-04-07 ES ES401551A patent/ES401551A1/es not_active Expired
- 1972-04-07 HU HUDI222A patent/HU165184B/hu unknown
- 1972-04-07 SU SU1886513A patent/SU466653A3/ru active
-
1975
- 1975-06-24 BE BE157643A patent/BE830594Q/xx not_active IP Right Cessation
-
1979
- 1979-02-12 YU YU316/79A patent/YU42298B/xx unknown
- 1979-02-12 YU YU00315/79A patent/YU39102B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| GB1392111A (en) | 1975-04-30 |
| NL175989C (nl) | 1985-02-01 |
| SU466653A3 (ru) | 1975-04-05 |
| JPS5533410B1 (ro) | 1980-08-30 |
| RO61151A (ro) | 1976-10-15 |
| NL7204698A (ro) | 1972-10-10 |
| PL89001B1 (en) | 1976-10-30 |
| SU454735A3 (ru) | 1974-12-25 |
| RO72827A (ro) | 1982-10-11 |
| CH611275A5 (ro) | 1979-05-31 |
| YU31679A (en) | 1982-05-31 |
| DE2216838A1 (de) | 1972-11-02 |
| IT954413B (it) | 1973-08-30 |
| CA984399A (en) | 1976-02-24 |
| CH591433A5 (ro) | 1977-09-15 |
| CH585194A5 (ro) | 1977-02-28 |
| SU466681A3 (ru) | 1975-04-05 |
| ES401551A1 (es) | 1975-10-01 |
| IE36264L (en) | 1972-10-08 |
| IE36264B1 (en) | 1976-09-29 |
| YU39102B (en) | 1984-04-30 |
| AR192758A1 (es) | 1973-03-14 |
| US3875232A (en) | 1975-04-01 |
| YU31579A (en) | 1982-06-30 |
| IL39157A0 (en) | 1972-06-28 |
| YU42298B (en) | 1988-08-31 |
| BE830594Q (fr) | 1975-10-16 |
| RO72853A (ro) | 1982-02-26 |
| NL175989B (nl) | 1984-09-03 |
| YU39065B (en) | 1984-04-30 |
| DE2216838C2 (de) | 1985-05-09 |
| FR2136055A5 (ro) | 1972-12-22 |
| EG10912A (en) | 1976-12-31 |
| YU94472A (en) | 1982-05-31 |
| HU165184B (ro) | 1974-07-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL39157A (en) | Ketoxime carbamates,their preparation and their use as pesticides | |
| GB1486969A (en) | Bis-(0-1-alkylthio-ethylimino)-n-methyl-carbamic acid)-n,n'-sulphides | |
| GB1455043A (en) | Urethanes of hydroxy-1-iodoalkynes and their use in fungicidal compositions | |
| ES8401017A1 (es) | Un procedimiento para la produccion de un n-fenicarbamato. | |
| TR24201A (tr) | Akrilat mantar oeldueruecueler | |
| GB894004A (en) | Carbamic acid derivatives | |
| ES8107167A1 (es) | Un procedimiento para preparar hidrazonas de benzofenona. | |
| ES354470A1 (es) | Procedimiento para preparacion de un agente fungicida. | |
| GB1454471A (en) | Aminocarbonyl-thiobarbituric acid derivatives process for their preparation and their use as insecticides and plant protection agents | |
| FR2376849A1 (fr) | Nouvelles phenylcarbamoyl-2-pyrazolines substituees, leur procede de preparation et leur application comme insecticides | |
| GB1223623A (en) | New benzimidazole compounds and pesticidal preparations containing them | |
| FR2363552A1 (fr) | Nouvelles n-aryl-n'-(cyclo)-alkyl-thiourees, leur procede de preparation et leur application a la lutte contre des parasites animaux et vegetaux | |
| GB1207788A (en) | Phenyl ketoxime carbamates and their use as herbicides | |
| GB1351473A (en) | Carbamoyloximes for use in control of viruses and fungi | |
| FR2362828A1 (fr) | Nouve | |
| GB1483617A (en) | Pesticidal thiophosphoric acid esteramides | |
| GB1296262A (ro) | ||
| GB1055721A (en) | Carbamates and herbicidal compositions containing them | |
| FR2374308A1 (fr) | Imidazolines et leur emploi comme agents pesticides | |
| US3428669A (en) | Aryl carbamates | |
| GB1519596A (en) | Dressing of seeds | |
| ES474486A1 (es) | Metodo de preparar una composicion envasada repelente de ar-tropodos. | |
| ES8504694A1 (es) | Un procedimiento para la produccion de un n-fenilcarbamato | |
| GB1238809A (ro) | ||
| KR880006201A (ko) | 살충제 3-치환 4-플루오로페닐-1-(플루오로알콕시페닐카르바모일)-피라졸린 |