IL39036A - Benzofuran and benzothiophene carboxylic acid derivatives,their preparation and compositions containing them - Google Patents
Benzofuran and benzothiophene carboxylic acid derivatives,their preparation and compositions containing themInfo
- Publication number
- IL39036A IL39036A IL39036A IL3903672A IL39036A IL 39036 A IL39036 A IL 39036A IL 39036 A IL39036 A IL 39036A IL 3903672 A IL3903672 A IL 3903672A IL 39036 A IL39036 A IL 39036A
- Authority
- IL
- Israel
- Prior art keywords
- carboxylic acid
- formula
- lower alkyl
- compound
- general formula
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title claims description 46
- DYSJMQABFPKAQM-UHFFFAOYSA-N 1-benzothiophene-2-carboxylic acid Chemical class C1=CC=C2SC(C(=O)O)=CC2=C1 DYSJMQABFPKAQM-UHFFFAOYSA-N 0.000 title claims description 16
- IANQTJSKSUMEQM-UHFFFAOYSA-N 1-benzofuran Chemical compound C1=CC=C2OC=CC2=C1 IANQTJSKSUMEQM-UHFFFAOYSA-N 0.000 title claims description 14
- 238000002360 preparation method Methods 0.000 title claims description 7
- 150000001875 compounds Chemical class 0.000 claims description 76
- 125000000217 alkyl group Chemical group 0.000 claims description 44
- -1 cyano, carbamoyl Chemical group 0.000 claims description 35
- 238000000034 method Methods 0.000 claims description 34
- 239000002253 acid Substances 0.000 claims description 33
- 239000001257 hydrogen Substances 0.000 claims description 33
- 229910052739 hydrogen Inorganic materials 0.000 claims description 33
- 150000003839 salts Chemical class 0.000 claims description 32
- 150000002431 hydrogen Chemical class 0.000 claims description 21
- 239000007858 starting material Substances 0.000 claims description 15
- 229910052736 halogen Inorganic materials 0.000 claims description 12
- 150000002367 halogens Chemical class 0.000 claims description 12
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 11
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 10
- 125000003545 alkoxy group Chemical group 0.000 claims description 9
- 125000003282 alkyl amino group Chemical group 0.000 claims description 9
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 9
- 125000003277 amino group Chemical group 0.000 claims description 8
- 230000002378 acidificating effect Effects 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 7
- 239000003054 catalyst Substances 0.000 claims description 7
- 239000012954 diazonium Substances 0.000 claims description 7
- 150000001989 diazonium salts Chemical class 0.000 claims description 7
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 6
- 229910052799 carbon Inorganic materials 0.000 claims description 6
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 6
- 239000001301 oxygen Substances 0.000 claims description 6
- 229910052760 oxygen Inorganic materials 0.000 claims description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical group [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 claims description 5
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 5
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 4
- 230000003110 anti-inflammatory effect Effects 0.000 claims description 4
- 239000000460 chlorine Substances 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 125000006575 electron-withdrawing group Chemical group 0.000 claims description 4
- 229910052717 sulfur Chemical group 0.000 claims description 4
- 239000011593 sulfur Chemical group 0.000 claims description 4
- 150000007513 acids Chemical class 0.000 claims description 3
- 125000002905 alkanoylamido group Chemical group 0.000 claims description 3
- 125000004429 atom Chemical group 0.000 claims description 3
- 150000001733 carboxylic acid esters Chemical class 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 230000003356 anti-rheumatic effect Effects 0.000 claims description 2
- 150000007514 bases Chemical class 0.000 claims description 2
- 125000001589 carboacyl group Chemical group 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- 125000005907 alkyl ester group Chemical group 0.000 claims 2
- 150000001735 carboxylic acids Chemical class 0.000 claims 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- 125000001424 substituent group Chemical group 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 84
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 71
- 239000000243 solution Substances 0.000 description 71
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 70
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 63
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 59
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 54
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 36
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 33
- 239000013078 crystal Substances 0.000 description 33
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 27
- 239000000463 material Substances 0.000 description 25
- 238000006243 chemical reaction Methods 0.000 description 23
- 238000010992 reflux Methods 0.000 description 23
- 239000011541 reaction mixture Substances 0.000 description 21
- 239000007787 solid Substances 0.000 description 20
- 238000001914 filtration Methods 0.000 description 19
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 18
- 239000003921 oil Substances 0.000 description 17
- 235000019198 oils Nutrition 0.000 description 17
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 16
- 229910052938 sodium sulfate Inorganic materials 0.000 description 16
- 235000011152 sodium sulphate Nutrition 0.000 description 16
- 239000000725 suspension Substances 0.000 description 16
- OFFSPAZVIVZPHU-UHFFFAOYSA-N 1-benzofuran-2-carboxylic acid Chemical compound C1=CC=C2OC(C(=O)O)=CC2=C1 OFFSPAZVIVZPHU-UHFFFAOYSA-N 0.000 description 15
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 15
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 15
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 14
- 239000012044 organic layer Substances 0.000 description 13
- 239000002244 precipitate Substances 0.000 description 13
- 239000002904 solvent Substances 0.000 description 13
- 238000002425 crystallisation Methods 0.000 description 12
- 230000008025 crystallization Effects 0.000 description 12
- IGOWSOGBQMBHIY-UHFFFAOYSA-N ethyl 3-bromo-4-oxocyclohexane-1-carboxylate Chemical compound CCOC(=O)C1CCC(=O)C(Br)C1 IGOWSOGBQMBHIY-UHFFFAOYSA-N 0.000 description 12
- 239000005457 ice water Substances 0.000 description 12
- 239000010410 layer Substances 0.000 description 12
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 10
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 10
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 10
- 238000002844 melting Methods 0.000 description 10
- 230000008018 melting Effects 0.000 description 10
- 229920000137 polyphosphoric acid Polymers 0.000 description 10
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 10
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- 239000003610 charcoal Substances 0.000 description 9
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 9
- 229920002261 Corn starch Polymers 0.000 description 8
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 8
- 239000008120 corn starch Substances 0.000 description 8
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 8
- 239000000706 filtrate Substances 0.000 description 8
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 8
- 238000001953 recrystallisation Methods 0.000 description 8
- 229920006395 saturated elastomer Polymers 0.000 description 8
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 8
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 125000004494 ethyl ester group Chemical group 0.000 description 6
- 238000001704 evaporation Methods 0.000 description 6
- 230000008020 evaporation Effects 0.000 description 6
- 150000004702 methyl esters Chemical class 0.000 description 6
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 6
- 238000000746 purification Methods 0.000 description 6
- 239000000829 suppository Substances 0.000 description 6
- GTHSURHQQNPABH-UHFFFAOYSA-N 3-(4-nitrophenoxy)iminocyclohexane-1-carboxylic acid Chemical compound C1C(C(=O)O)CCCC1=NOC1=CC=C([N+]([O-])=O)C=C1 GTHSURHQQNPABH-UHFFFAOYSA-N 0.000 description 5
- IHCCAYCGZOLTEU-UHFFFAOYSA-N 3-furoic acid Chemical compound OC(=O)C=1C=COC=1 IHCCAYCGZOLTEU-UHFFFAOYSA-N 0.000 description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 5
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 5
- 206010030113 Oedema Diseases 0.000 description 5
- 239000002585 base Substances 0.000 description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 5
- 229910052794 bromium Inorganic materials 0.000 description 5
- 239000008101 lactose Substances 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- 229910000027 potassium carbonate Inorganic materials 0.000 description 5
- OVARTBFNCCXQKS-UHFFFAOYSA-N propan-2-one;hydrate Chemical compound O.CC(C)=O OVARTBFNCCXQKS-UHFFFAOYSA-N 0.000 description 5
- AEKVBBNGWBBYLL-UHFFFAOYSA-N 4-fluorobenzonitrile Chemical compound FC1=CC=C(C#N)C=C1 AEKVBBNGWBBYLL-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- NPOMSUOUAZCMBL-UHFFFAOYSA-N dichloromethane;ethoxyethane Chemical compound ClCCl.CCOCC NPOMSUOUAZCMBL-UHFFFAOYSA-N 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- HWJHWSBFPPPIPD-UHFFFAOYSA-N ethoxyethane;propan-2-one Chemical compound CC(C)=O.CCOCC HWJHWSBFPPPIPD-UHFFFAOYSA-N 0.000 description 4
- 229910052500 inorganic mineral Inorganic materials 0.000 description 4
- 235000019359 magnesium stearate Nutrition 0.000 description 4
- LXCFILQKKLGQFO-UHFFFAOYSA-N methylparaben Chemical compound COC(=O)C1=CC=C(O)C=C1 LXCFILQKKLGQFO-UHFFFAOYSA-N 0.000 description 4
- 235000010755 mineral Nutrition 0.000 description 4
- 239000011707 mineral Substances 0.000 description 4
- IWDCLRJOBJJRNH-UHFFFAOYSA-N p-cresol Chemical compound CC1=CC=C(O)C=C1 IWDCLRJOBJJRNH-UHFFFAOYSA-N 0.000 description 4
- 239000002798 polar solvent Substances 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- QELSKZZBTMNZEB-UHFFFAOYSA-N propylparaben Chemical compound CCCOC(=O)C1=CC=C(O)C=C1 QELSKZZBTMNZEB-UHFFFAOYSA-N 0.000 description 4
- 235000017557 sodium bicarbonate Nutrition 0.000 description 4
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 4
- 235000010288 sodium nitrite Nutrition 0.000 description 4
- WFQDTOYDVUWQMS-UHFFFAOYSA-N 1-fluoro-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(F)C=C1 WFQDTOYDVUWQMS-UHFFFAOYSA-N 0.000 description 3
- PMADTMCLYIHMPB-UHFFFAOYSA-N 3-(4-cyanophenoxy)iminocyclohexane-1-carboxylic acid Chemical compound C1C(C(=O)O)CCCC1=NOC1=CC=C(C#N)C=C1 PMADTMCLYIHMPB-UHFFFAOYSA-N 0.000 description 3
- KDYBZGPBGTXFOO-UHFFFAOYSA-N 7-nitro-2,3-dihydro-1h-cyclopenta[b][1]benzofuran-2-carboxylic acid Chemical compound O1C2=CC=C([N+]([O-])=O)C=C2C2=C1CC(C(=O)O)C2 KDYBZGPBGTXFOO-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- 150000001350 alkyl halides Chemical class 0.000 description 3
- 239000002260 anti-inflammatory agent Substances 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- 239000003638 chemical reducing agent Substances 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- PSLIMVZEAPALCD-UHFFFAOYSA-N ethanol;ethoxyethane Chemical compound CCO.CCOCC PSLIMVZEAPALCD-UHFFFAOYSA-N 0.000 description 3
- 239000012259 ether extract Substances 0.000 description 3
- CHDFNIZLAAFFPX-UHFFFAOYSA-N ethoxyethane;oxolane Chemical compound CCOCC.C1CCOC1 CHDFNIZLAAFFPX-UHFFFAOYSA-N 0.000 description 3
- MBTIJHBZLWHTMH-UHFFFAOYSA-N ethoxyethane;oxolane;pentane Chemical compound CCCCC.CCOCC.C1CCOC1 MBTIJHBZLWHTMH-UHFFFAOYSA-N 0.000 description 3
- DLLJVQNYBYOKGS-UHFFFAOYSA-N ethoxyethane;pentane Chemical compound CCCCC.CCOCC DLLJVQNYBYOKGS-UHFFFAOYSA-N 0.000 description 3
- 229910052731 fluorine Inorganic materials 0.000 description 3
- 239000011737 fluorine Substances 0.000 description 3
- 210000002683 foot Anatomy 0.000 description 3
- 150000002430 hydrocarbons Chemical group 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000000454 talc Substances 0.000 description 3
- 229910052623 talc Inorganic materials 0.000 description 3
- 239000008215 water for injection Substances 0.000 description 3
- ZDPAWHACYDRYIW-UHFFFAOYSA-N 1-(4-fluorophenyl)ethanone Chemical compound CC(=O)C1=CC=C(F)C=C1 ZDPAWHACYDRYIW-UHFFFAOYSA-N 0.000 description 2
- FCEHBMOGCRZNNI-UHFFFAOYSA-N 1-benzothiophene Chemical compound C1=CC=C2SC=CC2=C1 FCEHBMOGCRZNNI-UHFFFAOYSA-N 0.000 description 2
- XQDNFAMOIPNVES-UHFFFAOYSA-N 3,5-Dimethoxyphenol Chemical compound COC1=CC(O)=CC(OC)=C1 XQDNFAMOIPNVES-UHFFFAOYSA-N 0.000 description 2
- ASHGTJPOSUFTGB-UHFFFAOYSA-N 3-methoxyphenol Chemical compound COC1=CC=CC(O)=C1 ASHGTJPOSUFTGB-UHFFFAOYSA-N 0.000 description 2
- YWAJHFIJXMVWKF-UHFFFAOYSA-N 4-(4-cyanophenoxy)iminocyclohexane-1-carboxylic acid Chemical compound C1CC(C(=O)O)CCC1=NOC1=CC=C(C#N)C=C1 YWAJHFIJXMVWKF-UHFFFAOYSA-N 0.000 description 2
- VZXOZSQDJJNBRC-UHFFFAOYSA-N 4-chlorobenzenethiol Chemical compound SC1=CC=C(Cl)C=C1 VZXOZSQDJJNBRC-UHFFFAOYSA-N 0.000 description 2
- WXNZTHHGJRFXKQ-UHFFFAOYSA-N 4-chlorophenol Chemical compound OC1=CC=C(Cl)C=C1 WXNZTHHGJRFXKQ-UHFFFAOYSA-N 0.000 description 2
- BCFOYFSAJSMVEG-UHFFFAOYSA-N 7-amino-2,3-dihydro-1h-cyclopenta[b][1]benzofuran-1-carboxylic acid Chemical compound C12=CC(N)=CC=C2OC2=C1C(C(O)=O)CC2 BCFOYFSAJSMVEG-UHFFFAOYSA-N 0.000 description 2
- DUHWSXHMZQFESQ-UHFFFAOYSA-N 7-nitro-2,3-dihydro-1h-cyclopenta[b][1]benzofuran-1-carboxylic acid Chemical compound O1C2=CC=C([N+]([O-])=O)C=C2C2=C1CCC2C(=O)O DUHWSXHMZQFESQ-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 239000003708 ampul Substances 0.000 description 2
- 229940121363 anti-inflammatory agent Drugs 0.000 description 2
- 239000003435 antirheumatic agent Substances 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- 239000012267 brine Substances 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 2
- 239000008116 calcium stearate Substances 0.000 description 2
- 235000013539 calcium stearate Nutrition 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 150000001721 carbon Chemical group 0.000 description 2
- 238000010531 catalytic reduction reaction Methods 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000012230 colorless oil Substances 0.000 description 2
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 2
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 2
- 229940045803 cuprous chloride Drugs 0.000 description 2
- JBDSSBMEKXHSJF-UHFFFAOYSA-N cyclopentanecarboxylic acid Chemical compound OC(=O)C1CCCC1 JBDSSBMEKXHSJF-UHFFFAOYSA-N 0.000 description 2
- RBLGLDWTCZMLRW-UHFFFAOYSA-K dicalcium;phosphate;dihydrate Chemical compound O.O.[Ca+2].[Ca+2].[O-]P([O-])([O-])=O RBLGLDWTCZMLRW-UHFFFAOYSA-K 0.000 description 2
- MDKXBBPLEGPIRI-UHFFFAOYSA-N ethoxyethane;methanol Chemical compound OC.CCOCC MDKXBBPLEGPIRI-UHFFFAOYSA-N 0.000 description 2
- HVDVRKAQOMQSBM-UHFFFAOYSA-N ethyl 3-(1-chlorocyclohexa-2,4-dien-1-yl)oxy-4-oxocyclohexane-1-carboxylate Chemical compound C(C)OC(=O)C1CC(C(CC1)=O)OC1(CC=CC=C1)Cl HVDVRKAQOMQSBM-UHFFFAOYSA-N 0.000 description 2
- 235000013305 food Nutrition 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- TUHMQDODLHWPCC-UHFFFAOYSA-N formyl cyanide Chemical compound O=CC#N TUHMQDODLHWPCC-UHFFFAOYSA-N 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 239000004292 methyl p-hydroxybenzoate Substances 0.000 description 2
- 235000010270 methyl p-hydroxybenzoate Nutrition 0.000 description 2
- 229960002216 methylparaben Drugs 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 150000002923 oximes Chemical class 0.000 description 2
- 239000000546 pharmaceutical excipient Substances 0.000 description 2
- 239000000825 pharmaceutical preparation Substances 0.000 description 2
- 235000010232 propyl p-hydroxybenzoate Nutrition 0.000 description 2
- 239000004405 propyl p-hydroxybenzoate Substances 0.000 description 2
- 229960003415 propylparaben Drugs 0.000 description 2
- 238000006722 reduction reaction Methods 0.000 description 2
- 239000012047 saturated solution Substances 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000007916 tablet composition Substances 0.000 description 2
- 239000001993 wax Substances 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- QAXKBEHUGLSTJR-UHFFFAOYSA-N 2-(4-cyanophenoxy)iminocyclopentane-1-carboxylic acid Chemical compound OC(=O)C1CCCC1=NOC1=CC=C(C#N)C=C1 QAXKBEHUGLSTJR-UHFFFAOYSA-N 0.000 description 1
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 1
- ZQAUOWFKOIDFAG-UHFFFAOYSA-N 2-bromo-3-oxocyclohexane-1-carboxylic acid Chemical compound OC(=O)C1CCCC(=O)C1Br ZQAUOWFKOIDFAG-UHFFFAOYSA-N 0.000 description 1
- VKPPFDPXZWFDFA-UHFFFAOYSA-N 2-chloroethanamine Chemical compound NCCCl VKPPFDPXZWFDFA-UHFFFAOYSA-N 0.000 description 1
- ISPYQTSUDJAMAB-UHFFFAOYSA-N 2-chlorophenol Chemical compound OC1=CC=CC=C1Cl ISPYQTSUDJAMAB-UHFFFAOYSA-N 0.000 description 1
- LQLJZSJKRYTKTP-UHFFFAOYSA-N 2-dimethylaminoethyl chloride hydrochloride Chemical compound Cl.CN(C)CCCl LQLJZSJKRYTKTP-UHFFFAOYSA-N 0.000 description 1
- 125000003006 2-dimethylaminoethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-M 2-methylbenzenesulfonate Chemical compound CC1=CC=CC=C1S([O-])(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-M 0.000 description 1
- VPOMSPZBQMDLTM-UHFFFAOYSA-N 3,5-dichlorophenol Chemical compound OC1=CC(Cl)=CC(Cl)=C1 VPOMSPZBQMDLTM-UHFFFAOYSA-N 0.000 description 1
- SKBHIWCIALRSGD-UHFFFAOYSA-N 3-(2-nitrophenoxy)iminocyclohexane-1-carboxylic acid Chemical compound C1C(C(=O)O)CCCC1=NOC1=CC=CC=C1[N+]([O-])=O SKBHIWCIALRSGD-UHFFFAOYSA-N 0.000 description 1
- WBJRNCQSGOIXAA-UHFFFAOYSA-N 3-(4-acetylphenoxy)iminocyclohexane-1-carboxylic acid Chemical compound C1=CC(C(=O)C)=CC=C1ON=C1CC(C(O)=O)CCC1 WBJRNCQSGOIXAA-UHFFFAOYSA-N 0.000 description 1
- ODRCYEQIDLWSNU-UHFFFAOYSA-N 3-(4-chlorophenoxy)-4-oxocyclohexane-1-carboxylic acid Chemical compound C1C(C(=O)O)CCC(=O)C1OC1=CC=C(Cl)C=C1 ODRCYEQIDLWSNU-UHFFFAOYSA-N 0.000 description 1
- YJFODUYNZYDKSR-UHFFFAOYSA-N 3-(4-chlorophenoxy)-4-oxocyclopentane-1-carboxylic acid Chemical compound O=C1CC(C(=O)O)CC1OC1=CC=C(Cl)C=C1 YJFODUYNZYDKSR-UHFFFAOYSA-N 0.000 description 1
- GCRGUCXDOAGCOE-UHFFFAOYSA-N 3-(4-chlorophenyl)sulfanyl-4-oxocyclohexane-1-carboxylic acid Chemical compound C1C(C(=O)O)CCC(=O)C1SC1=CC=C(Cl)C=C1 GCRGUCXDOAGCOE-UHFFFAOYSA-N 0.000 description 1
- BDDWGNVGTGYIEA-UHFFFAOYSA-N 3-(4-chlorophenyl)sulfanyl-4-oxocyclopentane-1-carboxylic acid Chemical compound O=C1CC(C(=O)O)CC1SC1=CC=C(Cl)C=C1 BDDWGNVGTGYIEA-UHFFFAOYSA-N 0.000 description 1
- JLEZLWICWIIMAG-UHFFFAOYSA-N 3-(4-cyanophenoxy)iminocyclopentane-1-carboxylic acid Chemical compound C1C(C(=O)O)CCC1=NOC1=CC=C(C#N)C=C1 JLEZLWICWIIMAG-UHFFFAOYSA-N 0.000 description 1
- FCVZIQJUDAKFLT-UHFFFAOYSA-N 3-bromo-2-oxocyclopentane-1-carboxylic acid Chemical compound OC(=O)C1CCC(Br)C1=O FCVZIQJUDAKFLT-UHFFFAOYSA-N 0.000 description 1
- QAHHVIYXYRBQPU-UHFFFAOYSA-N 3-bromo-4-oxocyclohexane-1-carboxylic acid Chemical compound OC(=O)C1CCC(=O)C(Br)C1 QAHHVIYXYRBQPU-UHFFFAOYSA-N 0.000 description 1
- QGRZWNVEMXZQQY-UHFFFAOYSA-N 3-bromo-4-oxocyclopentane-1-carboxylic acid Chemical compound OC(=O)C1CC(Br)C(=O)C1 QGRZWNVEMXZQQY-UHFFFAOYSA-N 0.000 description 1
- HORNXRXVQWOLPJ-UHFFFAOYSA-N 3-chlorophenol Chemical compound OC1=CC=CC(Cl)=C1 HORNXRXVQWOLPJ-UHFFFAOYSA-N 0.000 description 1
- FTTMNLAIVOASPQ-UHFFFAOYSA-N 4-bromo-3-oxocyclohexane-1-carboxylic acid Chemical compound OC(=O)C1CCC(Br)C(=O)C1 FTTMNLAIVOASPQ-UHFFFAOYSA-N 0.000 description 1
- RHMPLDJJXGPMEX-UHFFFAOYSA-N 4-fluorophenol Chemical compound OC1=CC=C(F)C=C1 RHMPLDJJXGPMEX-UHFFFAOYSA-N 0.000 description 1
- BTJIUGUIPKRLHP-UHFFFAOYSA-N 4-nitrophenol Chemical compound OC1=CC=C([N+]([O-])=O)C=C1 BTJIUGUIPKRLHP-UHFFFAOYSA-N 0.000 description 1
- TZIJHJOUSJOWCC-UHFFFAOYSA-N 6,7,8,9-tetrahydrodibenzofuran-2,7-dicarboxylic acid Chemical compound O1C2=CC=C(C(O)=O)C=C2C2=C1CC(C(=O)O)CC2 TZIJHJOUSJOWCC-UHFFFAOYSA-N 0.000 description 1
- IRFMVRXPJIPSOL-UHFFFAOYSA-N 6-acetamido-2,3-dihydro-1h-cyclopenta[b][1]benzofuran-2-carboxylic acid Chemical compound O1C2=CC(NC(=O)C)=CC=C2C2=C1CC(C(O)=O)C2 IRFMVRXPJIPSOL-UHFFFAOYSA-N 0.000 description 1
- IFTQSLKGEUUWLJ-UHFFFAOYSA-N 6-chloro-2,3-dihydro-1h-cyclopenta[b][1]benzofuran-2-carboxylic acid Chemical compound O1C2=CC(Cl)=CC=C2C2=C1CC(C(=O)O)C2 IFTQSLKGEUUWLJ-UHFFFAOYSA-N 0.000 description 1
- KFNIMQOTKAOALJ-UHFFFAOYSA-N 6-methoxy-2,3-dihydro-1h-cyclopenta[b][1]benzofuran-2-carboxylic acid Chemical compound O1C2=CC(OC)=CC=C2C2=C1CC(C(O)=O)C2 KFNIMQOTKAOALJ-UHFFFAOYSA-N 0.000 description 1
- GUNFOHJZKJZTNG-UHFFFAOYSA-N 7-carbamoyl-2,3-dihydro-1h-cyclopenta[b][1]benzofuran-2-carboxylic acid Chemical compound C12=CC(C(=O)N)=CC=C2OC2=C1CC(C(O)=O)C2 GUNFOHJZKJZTNG-UHFFFAOYSA-N 0.000 description 1
- UNFNFNLGONSDLT-UHFFFAOYSA-N 7-chloro-2,3-dihydro-1h-cyclopenta[b][1]benzofuran-2-carboxylic acid Chemical compound O1C2=CC=C(Cl)C=C2C2=C1CC(C(=O)O)C2 UNFNFNLGONSDLT-UHFFFAOYSA-N 0.000 description 1
- GRSVDWRKJFCNGE-UHFFFAOYSA-N 7-fluoro-2,3-dihydro-1h-cyclopenta[b][1]benzofuran-2-carboxylic acid Chemical compound O1C2=CC=C(F)C=C2C2=C1CC(C(=O)O)C2 GRSVDWRKJFCNGE-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- MSGJJSUGTJADRM-UHFFFAOYSA-N 8-chloro-1,2,3,4-tetrahydrodibenzofuran-3-carboxylic acid Chemical compound O1C2=CC=C(Cl)C=C2C2=C1CC(C(=O)O)CC2 MSGJJSUGTJADRM-UHFFFAOYSA-N 0.000 description 1
- UGQOYXLANACCHE-UHFFFAOYSA-N 8-fluoro-1,2,3,4-tetrahydrodibenzothiophene-3-carboxylic acid Chemical compound S1C2=CC=C(F)C=C2C2=C1CC(C(=O)O)CC2 UGQOYXLANACCHE-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 235000019739 Dicalciumphosphate Nutrition 0.000 description 1
- 241000237858 Gastropoda Species 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- 241000186359 Mycobacterium Species 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- 206010028980 Neoplasm Diseases 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 1
- QOSMNYMQXIVWKY-UHFFFAOYSA-N Propyl levulinate Chemical compound CCCOC(=O)CCC(C)=O QOSMNYMQXIVWKY-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- GHVZOJONCUEWAV-UHFFFAOYSA-N [K].CCO Chemical compound [K].CCO GHVZOJONCUEWAV-UHFFFAOYSA-N 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- MOQOOKGPCBQMCY-UHFFFAOYSA-N acetic acid;hexane Chemical compound CC(O)=O.CCCCCC MOQOOKGPCBQMCY-UHFFFAOYSA-N 0.000 description 1
- PBCJIPOGFJYBJE-UHFFFAOYSA-N acetonitrile;hydrate Chemical compound O.CC#N PBCJIPOGFJYBJE-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 125000005011 alkyl ether group Chemical group 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 229940072107 ascorbate Drugs 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 1
- 229910001863 barium hydroxide Inorganic materials 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- 229940050390 benzoate Drugs 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 238000004166 bioassay Methods 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 201000011510 cancer Diseases 0.000 description 1
- 239000007963 capsule composition Substances 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000004203 carnauba wax Substances 0.000 description 1
- 235000013869 carnauba wax Nutrition 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000002512 chemotherapy Methods 0.000 description 1
- 229940001468 citrate Drugs 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000006193 diazotization reaction Methods 0.000 description 1
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 description 1
- 229940038472 dicalcium phosphate Drugs 0.000 description 1
- 229910000390 dicalcium phosphate Inorganic materials 0.000 description 1
- LZHFFKOMFJFAPE-UHFFFAOYSA-N diethyl 6,7,8,9-tetrahydrodibenzofuran-2,7-dicarboxylate Chemical compound O1C2=CC=C(C(=O)OCC)C=C2C2=C1CC(C(=O)OCC)CC2 LZHFFKOMFJFAPE-UHFFFAOYSA-N 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 230000002124 endocrine Effects 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- JNLHHFVLQDYFFB-UHFFFAOYSA-N ethyl 1-benzofuran-3-carboxylate Chemical compound C1=CC=C2C(C(=O)OCC)=COC2=C1 JNLHHFVLQDYFFB-UHFFFAOYSA-N 0.000 description 1
- ZKTDUGOEDKKHEM-UHFFFAOYSA-N ethyl 3-(3,5-dichlorophenoxy)-4-oxocyclohexane-1-carboxylate Chemical compound C1C(C(=O)OCC)CCC(=O)C1OC1=CC(Cl)=CC(Cl)=C1 ZKTDUGOEDKKHEM-UHFFFAOYSA-N 0.000 description 1
- UQQWRRBIGPCMAL-UHFFFAOYSA-N ethyl 3-(3-acetamidophenoxy)-4-oxocyclohexane-1-carboxylate Chemical compound C1C(C(=O)OCC)CCC(=O)C1OC1=CC=CC(NC(C)=O)=C1 UQQWRRBIGPCMAL-UHFFFAOYSA-N 0.000 description 1
- RYEHJTWSIUIGHD-UHFFFAOYSA-N ethyl 3-(3-methoxyphenoxy)-4-oxocyclohexane-1-carboxylate Chemical compound C1C(C(=O)OCC)CCC(=O)C1OC1=CC=CC(OC)=C1 RYEHJTWSIUIGHD-UHFFFAOYSA-N 0.000 description 1
- XNMVPQMZTCQMQQ-UHFFFAOYSA-N ethyl 3-(4-chlorophenoxy)-4-oxocyclohexane-1-carboxylate Chemical compound C1C(C(=O)OCC)CCC(=O)C1OC1=CC=C(Cl)C=C1 XNMVPQMZTCQMQQ-UHFFFAOYSA-N 0.000 description 1
- IBYXSUIOIJVSJV-UHFFFAOYSA-N ethyl 3-(4-fluorophenoxy)-4-oxocyclohexane-1-carboxylate Chemical compound C1C(C(=O)OCC)CCC(=O)C1OC1=CC=C(F)C=C1 IBYXSUIOIJVSJV-UHFFFAOYSA-N 0.000 description 1
- PJRUIFRNVUIWTF-UHFFFAOYSA-N ethyl 3-(4-methylphenoxy)-4-oxocyclohexane-1-carboxylate Chemical compound C1C(C(=O)OCC)CCC(=O)C1OC1=CC=C(C)C=C1 PJRUIFRNVUIWTF-UHFFFAOYSA-N 0.000 description 1
- QGLALWDWPQBQPR-UHFFFAOYSA-N ethyl 3-bromo-4-oxocyclopentane-1-carboxylate Chemical compound CCOC(=O)C1CC(Br)C(=O)C1 QGLALWDWPQBQPR-UHFFFAOYSA-N 0.000 description 1
- ZXYAWONOWHSQRU-UHFFFAOYSA-N ethyl 4-oxocyclohexanecarboxylate Chemical compound CCOC(=O)C1CCC(=O)CC1 ZXYAWONOWHSQRU-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000005496 eutectics Effects 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000005171 halobenzenes Chemical class 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 210000000548 hind-foot Anatomy 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- TVZISJTYELEYPI-UHFFFAOYSA-N hypodiphosphoric acid Chemical compound OP(O)(=O)P(O)(O)=O TVZISJTYELEYPI-UHFFFAOYSA-N 0.000 description 1
- 238000007654 immersion Methods 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- QLNWXBAGRTUKKI-UHFFFAOYSA-N metacetamol Chemical compound CC(=O)NC1=CC=CC(O)=C1 QLNWXBAGRTUKKI-UHFFFAOYSA-N 0.000 description 1
- 125000006533 methyl amino methyl group Chemical group [H]N(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- ZBUQPAJRQXISTC-UHFFFAOYSA-N n-(chloromethyl)-n-ethylethanamine Chemical compound CCN(CC)CCl ZBUQPAJRQXISTC-UHFFFAOYSA-N 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 239000012454 non-polar solvent Substances 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 235000008390 olive oil Nutrition 0.000 description 1
- 239000004006 olive oil Substances 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 230000003204 osmotic effect Effects 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- 125000004115 pentoxy group Chemical group [*]OC([H])([H])C([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- 229960002895 phenylbutazone Drugs 0.000 description 1
- VYMDGNCVAMGZFE-UHFFFAOYSA-N phenylbutazonum Chemical compound O=C1C(CCCC)C(=O)N(C=2C=CC=CC=2)N1C1=CC=CC=C1 VYMDGNCVAMGZFE-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- ACVYVLVWPXVTIT-UHFFFAOYSA-N phosphinic acid Chemical compound O[PH2]=O ACVYVLVWPXVTIT-UHFFFAOYSA-N 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- YGSDEFSMJLZEOE-UHFFFAOYSA-M salicylate Chemical compound OC1=CC=CC=C1C([O-])=O YGSDEFSMJLZEOE-UHFFFAOYSA-M 0.000 description 1
- 229960001860 salicylate Drugs 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 238000010956 selective crystallization Methods 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- GQFIWFPBDXSASA-UHFFFAOYSA-M sodium;2-chlorophenolate Chemical compound [Na+].[O-]C1=CC=CC=C1Cl GQFIWFPBDXSASA-UHFFFAOYSA-M 0.000 description 1
- JWYMWHGENDPLFG-UHFFFAOYSA-M sodium;3-chlorophenolate Chemical compound [Na+].[O-]C1=CC=CC(Cl)=C1 JWYMWHGENDPLFG-UHFFFAOYSA-M 0.000 description 1
- CFPLEOLETMZLIB-UHFFFAOYSA-M sodium;4-chlorophenolate Chemical compound [Na+].[O-]C1=CC=C(Cl)C=C1 CFPLEOLETMZLIB-UHFFFAOYSA-M 0.000 description 1
- FENGEGUDMXHOBU-UHFFFAOYSA-M sodium;4-fluorophenolate Chemical compound [Na+].[O-]C1=CC=C(F)C=C1 FENGEGUDMXHOBU-UHFFFAOYSA-M 0.000 description 1
- ZECBPBHBGNLLMU-UHFFFAOYSA-M sodium;4-methylphenolate Chemical compound [Na+].CC1=CC=C([O-])C=C1 ZECBPBHBGNLLMU-UHFFFAOYSA-M 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 238000000859 sublimation Methods 0.000 description 1
- 230000008022 sublimation Effects 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/91—Dibenzofurans; Hydrogenated dibenzofurans
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/93—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems condensed with a ring other than six-membered
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/50—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D333/76—Dibenzothiophenes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US12857071A | 1971-03-26 | 1971-03-26 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL39036A0 IL39036A0 (en) | 1972-06-28 |
| IL39036A true IL39036A (en) | 1976-05-31 |
Family
ID=22435954
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL39036A IL39036A (en) | 1971-03-26 | 1972-03-20 | Benzofuran and benzothiophene carboxylic acid derivatives,their preparation and compositions containing them |
| IL46790A IL46790A (en) | 1971-03-26 | 1975-03-11 | Phenoxy(or phenylthio)-cyclohexane(or cyclopentane)carboxylic acid derivatives and their preparation |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL46790A IL46790A (en) | 1971-03-26 | 1975-03-11 | Phenoxy(or phenylthio)-cyclohexane(or cyclopentane)carboxylic acid derivatives and their preparation |
Country Status (17)
| Country | Link |
|---|---|
| AR (3) | AR192514A1 (th) |
| AT (2) | AT313272B (th) |
| AU (1) | AU463471B2 (th) |
| BE (1) | BE781176A (th) |
| CA (1) | CA988529A (th) |
| CH (1) | CH574433A5 (th) |
| DE (1) | DE2214501A1 (th) |
| DK (1) | DK130345B (th) |
| ES (1) | ES401162A1 (th) |
| FR (1) | FR2130655B1 (th) |
| GB (2) | GB1364807A (th) |
| HU (1) | HU164250B (th) |
| IE (2) | IE36187B1 (th) |
| IL (2) | IL39036A (th) |
| NL (1) | NL7203979A (th) |
| SE (2) | SE385704B (th) |
| ZA (1) | ZA721612B (th) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CZ168896A3 (en) * | 1995-06-27 | 1997-01-15 | Egyt Gyogyszervegyeszeti Gyar | Oxaindene derivatives and process for preparing thereof |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL7008628A (th) * | 1969-06-25 | 1970-12-29 |
-
1972
- 1972-03-09 ZA ZA721612A patent/ZA721612B/xx unknown
- 1972-03-09 CH CH350472A patent/CH574433A5/xx not_active IP Right Cessation
- 1972-03-20 IL IL39036A patent/IL39036A/en unknown
- 1972-03-20 IE IE2067/74A patent/IE36187B1/xx unknown
- 1972-03-20 IE IE354/72A patent/IE36186B1/xx unknown
- 1972-03-21 AU AU40245/72A patent/AU463471B2/en not_active Expired
- 1972-03-22 CA CA137,759A patent/CA988529A/en not_active Expired
- 1972-03-23 HU HUHO1463A patent/HU164250B/hu unknown
- 1972-03-24 AT AT257972A patent/AT313272B/de not_active IP Right Cessation
- 1972-03-24 SE SE7203902A patent/SE385704B/xx unknown
- 1972-03-24 DE DE19722214501 patent/DE2214501A1/de active Pending
- 1972-03-24 NL NL7203979A patent/NL7203979A/xx not_active Application Discontinuation
- 1972-03-24 AT AT229773A patent/AT319227B/de not_active IP Right Cessation
- 1972-03-24 BE BE781176A patent/BE781176A/xx unknown
- 1972-03-24 FR FR7210383A patent/FR2130655B1/fr not_active Expired
- 1972-03-24 DK DK145472AA patent/DK130345B/da unknown
- 1972-03-24 GB GB5123373A patent/GB1364807A/en not_active Expired
- 1972-03-24 GB GB1387772A patent/GB1364806A/en not_active Expired
- 1972-03-25 ES ES401162A patent/ES401162A1/es not_active Expired
- 1972-11-23 AR AR245290A patent/AR192514A1/es active
- 1972-11-24 AR AR245289A patent/AR194407A1/es active
- 1972-11-24 AR AR245291A patent/AR192515A1/es active
-
1974
- 1974-12-27 SE SE7416328A patent/SE7416328L/xx unknown
-
1975
- 1975-03-11 IL IL46790A patent/IL46790A/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CA988529A (en) | 1976-05-04 |
| IL39036A0 (en) | 1972-06-28 |
| IE36186L (en) | 1972-09-26 |
| CH574433A5 (th) | 1976-04-15 |
| ES401162A1 (es) | 1975-02-01 |
| AT319227B (de) | 1974-12-10 |
| HU164250B (th) | 1974-01-28 |
| AR194407A1 (es) | 1973-07-13 |
| AT313272B (de) | 1974-02-11 |
| AR192514A1 (es) | 1973-02-21 |
| SE385704B (sv) | 1976-07-19 |
| GB1364806A (en) | 1974-08-29 |
| SE7416328L (th) | 1974-12-27 |
| ZA721612B (en) | 1972-11-29 |
| DK130345C (th) | 1975-07-07 |
| IE36186B1 (en) | 1976-09-01 |
| GB1364807A (en) | 1974-08-29 |
| IE36187B1 (en) | 1976-09-01 |
| BE781176A (fr) | 1972-09-25 |
| DE2214501A1 (de) | 1972-10-05 |
| AU4024572A (en) | 1972-03-21 |
| NL7203979A (th) | 1972-09-28 |
| AR192515A1 (es) | 1973-02-21 |
| FR2130655A1 (th) | 1972-11-03 |
| DK130345B (da) | 1975-02-10 |
| FR2130655B1 (th) | 1975-06-20 |
| AU463471B2 (en) | 1975-07-08 |
| IL46790A (en) | 1976-05-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3896145A (en) | Carbazoles | |
| SU1029827A3 (ru) | Способ получени меркаптозамещенных 2,3,4,5-тетрагидро-1 @ -3-бензазепинов или их солей | |
| GB2210879A (en) | 4h-1-benzopyran-4-one derivatives | |
| CA1064031A (en) | Antifertility compounds | |
| JPH06340647A (ja) | N−ヘテロアリール−n′−フェニル尿素誘導体,その製法及びその用途 | |
| NO155826B (no) | Roerbuntkabel til bruk under vann. | |
| IL42799A (en) | Carbazolic history of alcohols, sites and alkanoic acids, their preparation and pharmaceutical preparations containing signal | |
| CA1073904A (en) | Substituted 6-aryl-4h-s-triazolo-(3,4c)-thieno-(2,3e)-1,4-diazepines and processes for production thereof | |
| HU190023B (en) | Process for producing imidazoline derivatives and non toxic salts thereof | |
| IL40861A (en) | History of theapine and oxapine and their preparation | |
| EP0132130B1 (en) | Aroyl benzofuran and benzothiophene acetic and propionic acids processes for their production and pharmaceutical compositions containing them | |
| US3803180A (en) | Tricyclic compounds | |
| EP0259930B1 (en) | Derivatives of phenyl, pyrrolidin-2-yl substituted 5-ring heterocycles having antipsychotic properties | |
| US4192809A (en) | Certain 8-halodibenzofuran-3-alkanols | |
| US3931288A (en) | Alkyl esters of 4-chlorophenoxy-4-oxo-cycloalkyl-carboxylic acid | |
| US3868387A (en) | 1,2,3,4-tetrahydrocarbazole-2-carboxylic acids and their derivatives | |
| IL39036A (en) | Benzofuran and benzothiophene carboxylic acid derivatives,their preparation and compositions containing them | |
| US4219657A (en) | Dibenzothiophenes | |
| US4222944A (en) | Halo-3-dibenzofuran alkanonitriles | |
| US3903133A (en) | 3-Halo-4-oxo-cyclohexane carboxylic acid esters | |
| US3875219A (en) | Phenoxyimino carboxylic acids and esters | |
| US4334078A (en) | Dibenzothiophenes | |
| IE54878B1 (en) | 3,3-dialkyl- and 3,3-alkylene-indoline derivatives, processes for their production and pharmaceutical compositions comprising them | |
| IE44727B1 (en) | Dibenzothiophene derivatives | |
| US3306934A (en) | 5-(aminopropylidene)-and 5-hydroxy-5-(aminopropyl)-3-dialkylsulfamoyl-5h-dibenzo[a,d] cycloheptenes |