IL38913A - Aminopyridines and herbicidal,insecticidal and fungicidal compositions comprising them - Google Patents
Aminopyridines and herbicidal,insecticidal and fungicidal compositions comprising themInfo
- Publication number
- IL38913A IL38913A IL38913A IL3891372A IL38913A IL 38913 A IL38913 A IL 38913A IL 38913 A IL38913 A IL 38913A IL 3891372 A IL3891372 A IL 3891372A IL 38913 A IL38913 A IL 38913A
- Authority
- IL
- Israel
- Prior art keywords
- compound
- composition
- fluorine
- formula
- radical
- Prior art date
Links
- 150000003927 aminopyridines Chemical class 0.000 title claims abstract 3
- 230000002363 herbicidal effect Effects 0.000 title claims abstract 3
- 239000000203 mixture Substances 0.000 title claims 13
- 230000000855 fungicidal effect Effects 0.000 title claims 2
- 230000000749 insecticidal effect Effects 0.000 title claims 2
- 150000001875 compounds Chemical class 0.000 claims abstract 17
- -1 Aminopyridine compounds Chemical class 0.000 claims abstract 14
- 229910052801 chlorine Inorganic materials 0.000 claims abstract 12
- 229910052731 fluorine Inorganic materials 0.000 claims abstract 12
- 229910052794 bromium Inorganic materials 0.000 claims abstract 10
- 150000003254 radicals Chemical class 0.000 claims abstract 4
- 150000005840 aryl radicals Chemical class 0.000 claims abstract 3
- 150000004982 aromatic amines Chemical class 0.000 claims abstract 2
- 125000003118 aryl group Chemical group 0.000 claims abstract 2
- 125000001424 substituent group Chemical group 0.000 claims abstract 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims 11
- 239000011737 fluorine Substances 0.000 claims 8
- 125000003545 alkoxy group Chemical group 0.000 claims 7
- 239000000460 chlorine Substances 0.000 claims 7
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims 6
- 125000004093 cyano group Chemical group *C#N 0.000 claims 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 6
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims 5
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims 5
- 125000001624 naphthyl group Chemical group 0.000 claims 5
- 239000004480 active ingredient Substances 0.000 claims 4
- 125000000217 alkyl group Chemical group 0.000 claims 4
- 125000001309 chloro group Chemical group Cl* 0.000 claims 4
- 239000003085 diluting agent Substances 0.000 claims 4
- 125000001153 fluoro group Chemical group F* 0.000 claims 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 4
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical group CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims 3
- 125000005118 N-alkylcarbamoyl group Chemical group 0.000 claims 3
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims 3
- 239000001257 hydrogen Substances 0.000 claims 3
- 229910052739 hydrogen Inorganic materials 0.000 claims 3
- MVRNAPZMQQYTIN-UHFFFAOYSA-N 2,3,4,5-tetrafluoropyridine Chemical compound FC1=CN=C(F)C(F)=C1F MVRNAPZMQQYTIN-UHFFFAOYSA-N 0.000 claims 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims 2
- 125000001769 aryl amino group Chemical group 0.000 claims 2
- 230000002401 inhibitory effect Effects 0.000 claims 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims 2
- 150000003839 salts Chemical class 0.000 claims 2
- 239000007787 solid Substances 0.000 claims 2
- KNYWCEVWYUYFFT-UHFFFAOYSA-N 3,5-dichloro-2,6-difluoro-N-(5-fluoro-2,4-dinitrophenyl)pyridin-4-amine Chemical compound C1=C(F)C([N+](=O)[O-])=CC([N+]([O-])=O)=C1NC1=C(Cl)C(F)=NC(F)=C1Cl KNYWCEVWYUYFFT-UHFFFAOYSA-N 0.000 claims 1
- NJLMYRISUGEEKR-UHFFFAOYSA-N 3,5-dichloro-2,6-difluoro-n-[4-nitro-2-(trifluoromethyl)phenyl]pyridin-4-amine Chemical compound FC(F)(F)C1=CC([N+](=O)[O-])=CC=C1NC1=C(Cl)C(F)=NC(F)=C1Cl NJLMYRISUGEEKR-UHFFFAOYSA-N 0.000 claims 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical group [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 claims 1
- 241000607479 Yersinia pestis Species 0.000 claims 1
- 125000004414 alkyl thio group Chemical group 0.000 claims 1
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims 1
- 239000003795 chemical substances by application Substances 0.000 claims 1
- VNEBWJSWMVTSHK-UHFFFAOYSA-L disodium;3-hydroxynaphthalene-2,7-disulfonate Chemical compound [Na+].[Na+].C1=C(S([O-])(=O)=O)C=C2C=C(S([O-])(=O)=O)C(O)=CC2=C1 VNEBWJSWMVTSHK-UHFFFAOYSA-L 0.000 claims 1
- 239000004495 emulsifiable concentrate Substances 0.000 claims 1
- 239000003701 inert diluent Substances 0.000 claims 1
- 239000012442 inert solvent Substances 0.000 claims 1
- 229910052740 iodine Inorganic materials 0.000 claims 1
- 239000007788 liquid Substances 0.000 claims 1
- 229910000104 sodium hydride Inorganic materials 0.000 claims 1
- 239000012312 sodium hydride Substances 0.000 claims 1
- 239000002904 solvent Substances 0.000 claims 1
- 239000004094 surface-active agent Substances 0.000 claims 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims 1
- 125000001183 hydrocarbyl group Chemical group 0.000 abstract 2
- 125000002252 acyl group Chemical group 0.000 abstract 1
- 150000001502 aryl halides Chemical class 0.000 abstract 1
- 230000000361 pesticidal effect Effects 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/74—Amino or imino radicals substituted by hydrocarbon or substituted hydrocarbon radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/75—Amino or imino radicals, acylated by carboxylic or carbonic acids, or by sulfur or nitrogen analogues thereof, e.g. carbamates
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB729171A GB1386091A (en) | 1971-03-19 | 1971-03-19 | Amino pyridine compounds and compositions |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL38913A0 IL38913A0 (en) | 1972-06-28 |
| IL38913A true IL38913A (en) | 1976-02-29 |
Family
ID=9830296
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL38913A IL38913A (en) | 1971-03-19 | 1972-03-07 | Aminopyridines and herbicidal,insecticidal and fungicidal compositions comprising them |
Country Status (22)
| Country | Link |
|---|---|
| US (1) | US3926611A (OSRAM) |
| JP (1) | JPS53130675A (OSRAM) |
| AU (1) | AU457113B2 (OSRAM) |
| BE (1) | BE780548A (OSRAM) |
| BR (1) | BR7201574D0 (OSRAM) |
| CA (1) | CA1006163A (OSRAM) |
| CH (1) | CH559180A5 (OSRAM) |
| DD (1) | DD95489A5 (OSRAM) |
| DE (1) | DE2213057A1 (OSRAM) |
| EG (1) | EG10640A (OSRAM) |
| ES (1) | ES400912A1 (OSRAM) |
| FR (1) | FR2130420B1 (OSRAM) |
| GB (1) | GB1386091A (OSRAM) |
| HU (2) | HU163721B (OSRAM) |
| IE (1) | IE36124B1 (OSRAM) |
| IL (1) | IL38913A (OSRAM) |
| IT (1) | IT968388B (OSRAM) |
| NL (1) | NL7203573A (OSRAM) |
| OA (1) | OA03983A (OSRAM) |
| SE (1) | SE388755B (OSRAM) |
| SU (1) | SU508188A3 (OSRAM) |
| ZA (1) | ZA721369B (OSRAM) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4180670A (en) * | 1977-02-02 | 1979-12-25 | John Wyeth & Brother Limited | Amino pyridine derivatives |
| US4140778A (en) * | 1977-07-18 | 1979-02-20 | Eli Lilly And Company | N-pyridyl-N-phenylamines as rodenticides |
| DE2900504A1 (de) * | 1979-01-08 | 1980-07-24 | Hoechst Ag | Neue substituierte 4-aminopyridine, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel |
| US4201568A (en) * | 1979-03-29 | 1980-05-06 | Velsicol Chemical Corporation | 2-(1-Ethylpropylamino)-3-cyano-4-methoxymethyl-5-nitro-6-methylpyridine |
| LT2077B (lt) * | 1979-12-25 | 1993-06-15 | Ishihara Sangyo Kaisha | Fungicidine medziaga sudregstanciu milteliu pavidale |
| JPS6052146B2 (ja) * | 1979-12-25 | 1985-11-18 | 石原産業株式会社 | N−ピリジルアニリン系化合物、それらの製造方法及びそれらを含有する有害生物防除剤 |
| GB8311003D0 (en) * | 1983-04-22 | 1983-05-25 | Shell Int Research | Aniline compounds |
| JPS6013762A (ja) * | 1983-07-01 | 1985-01-24 | Toyo Soda Mfg Co Ltd | 2−ハロ−6−メチルアミノピリジンの製造法 |
| DE4029771A1 (de) * | 1990-09-20 | 1992-03-26 | Basf Ag | N-heteroaryl-2-nitroaniline |
| US5461161A (en) * | 1994-07-11 | 1995-10-24 | Dowelanco | N-pyridinyl[1,2,4]triazolo[1,5-c]pyrimidine-2-sulfonamide herbicides |
| BRPI0620527A2 (pt) * | 2005-11-23 | 2011-11-16 | Makhteshim Chem Works Ltd | polimorfo cristalino da forma i, polimorfo cristalino da forma ii, mistura de polimorfos da forma i e forma ii, processo para preparar um polimorfo cristalino da forma i, processo para preparar um polimorfo cristalino da forma ii, processo para preparar uma mistura de um polimorfo cristalino da forma i e da forma ii, composição para combater insetos, ácaros, fungos e bactérias, método para combater insetos, ácaros, fungos e bactérias, método para proteger colheitas de seres vivos nocivos, processo para preparar um composto de piridinamina, processo para purificar um composto, processo para preparar e purificar 3-cloro-n-(-3-cloro-5-trifluorometil-2-piridil)-a,a,a-t rifluoro-2, 6-dinitro-p-toluidina (fluazinam) e processo para preparar fluazinam |
| US9422235B2 (en) | 2006-12-19 | 2016-08-23 | Pharmos Corporation | Sulfonamide derivatives with therapeutic indications |
| US8937072B2 (en) | 2011-06-17 | 2015-01-20 | Sinochem Corporation | Substituted cyanoaniline compounds, preparation and use thereof |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1100824A (en) * | 1964-05-11 | 1968-01-24 | Robert Neville Haszeldine | Polyfluoropyridines |
| GB1059990A (en) * | 1964-12-18 | 1967-02-22 | Ici Ltd | Substituted pyridines |
| GB1242056A (en) * | 1967-07-24 | 1971-08-11 | Ici Ltd | Derivatives of 4-hydroxy-tetrafluoropyridine and the use thereof as plant growth inhibitors |
| US3547935A (en) * | 1967-08-07 | 1970-12-15 | American Cyanamid Co | Certain nitro-4-pyridinols,n-oxides thereof and derivatives thereof |
| US3495969A (en) * | 1967-09-25 | 1970-02-17 | Mobil Oil Corp | Substituted nitropyridines as herbicides |
| GB1219633A (en) * | 1968-01-29 | 1971-01-20 | Monsanto Chemicals | Pyridine derivatives |
| US3838159A (en) * | 1969-03-17 | 1974-09-24 | Dow Chemical Co | Substituted aminohalopyridines |
| US3576616A (en) * | 1969-05-15 | 1971-04-27 | Monsanto Co | Herbicidal compositions and methods |
| US3686230A (en) * | 1970-02-24 | 1972-08-22 | Exxon Research Engineering Co | Herbicidal n-tetrahydrofurfuryl substituted 2,6-dinitroanilines |
-
1971
- 1971-03-19 GB GB729171A patent/GB1386091A/en not_active Expired
-
1972
- 1972-02-29 US US230514A patent/US3926611A/en not_active Expired - Lifetime
- 1972-02-29 IE IE243/72A patent/IE36124B1/xx unknown
- 1972-03-01 ZA ZA721369A patent/ZA721369B/xx unknown
- 1972-03-07 AU AU39703/72A patent/AU457113B2/en not_active Expired
- 1972-03-07 IL IL38913A patent/IL38913A/en unknown
- 1972-03-08 CA CA136,590A patent/CA1006163A/en not_active Expired
- 1972-03-10 BE BE780548A patent/BE780548A/xx unknown
- 1972-03-16 EG EG106/72*UA patent/EG10640A/xx active
- 1972-03-17 FR FR7209512A patent/FR2130420B1/fr not_active Expired
- 1972-03-17 SU SU1762301A patent/SU508188A3/ru active
- 1972-03-17 HU HUIE493A patent/HU163721B/hu unknown
- 1972-03-17 DE DE19722213057 patent/DE2213057A1/de active Pending
- 1972-03-17 SE SE7203503A patent/SE388755B/xx unknown
- 1972-03-17 NL NL7203573A patent/NL7203573A/xx not_active Application Discontinuation
- 1972-03-17 HU HUIE494A patent/HU164621B/hu unknown
- 1972-03-17 OA OA54522A patent/OA03983A/xx unknown
- 1972-03-17 BR BR1574/72A patent/BR7201574D0/pt unknown
- 1972-03-18 IT IT22096/72A patent/IT968388B/it active
- 1972-03-18 ES ES400912A patent/ES400912A1/es not_active Expired
- 1972-03-20 DD DD161659A patent/DD95489A5/xx unknown
- 1972-03-20 CH CH409672A patent/CH559180A5/xx not_active IP Right Cessation
-
1978
- 1978-04-20 JP JP4598378A patent/JPS53130675A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| CH559180A5 (OSRAM) | 1975-02-28 |
| ES400912A1 (es) | 1975-01-16 |
| JPS53130675A (en) | 1978-11-14 |
| HU163721B (OSRAM) | 1973-10-27 |
| AU3970372A (en) | 1973-09-13 |
| DE2213057A1 (de) | 1972-09-28 |
| IE36124L (en) | 1972-09-19 |
| EG10640A (en) | 1976-01-31 |
| OA03983A (fr) | 1979-10-15 |
| AU457113B2 (en) | 1974-12-16 |
| FR2130420A1 (OSRAM) | 1972-11-03 |
| BR7201574D0 (pt) | 1974-01-08 |
| IT968388B (it) | 1974-03-20 |
| CA1006163A (en) | 1977-03-01 |
| SE388755B (sv) | 1976-10-18 |
| FR2130420B1 (OSRAM) | 1976-08-06 |
| BE780548A (fr) | 1972-09-11 |
| US3926611A (en) | 1975-12-16 |
| JPS5638150B2 (OSRAM) | 1981-09-04 |
| IL38913A0 (en) | 1972-06-28 |
| HU164621B (OSRAM) | 1974-03-28 |
| IE36124B1 (en) | 1976-08-18 |
| GB1386091A (en) | 1975-03-05 |
| ZA721369B (en) | 1972-12-27 |
| NL7203573A (OSRAM) | 1972-09-21 |
| DD95489A5 (OSRAM) | 1973-02-05 |
| SU508188A3 (ru) | 1976-03-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL38913A (en) | Aminopyridines and herbicidal,insecticidal and fungicidal compositions comprising them | |
| DK165443B (da) | 4-(3,5-difluorphenoxy)phenol | |
| US3293257A (en) | Pyridyl urea compounds | |
| EP0096569A3 (en) | Triazole antifungal agents | |
| US4149872A (en) | N-pyridinyl urea and cyclopropanecarboxamide herbicides | |
| GB1411213A (en) | 1,3-dithiolo-4,5-6- quinoxalines process for their preparation and their use as insecticides acaricides and fungicides | |
| US3812209A (en) | 1-hydrocarbyldithio-3-aryl ureas | |
| GB1398201A (en) | N-sulphenylated carbamidoximes a process for their preparation and their fungicidal and bactericidal use | |
| US4017638A (en) | Iso-(thio)-urea derivatives | |
| IL43513A (en) | 1-alkoxycarbonyl-2-(bis-(alkoxycarbonyl)-amino)-benzimidazoles,their preparation and fungicidal and bactericidal compositions containing them | |
| DE2643403A1 (de) | Mikrobizide mittel | |
| US3749747A (en) | Substituted cinnanyl thiocyanates and their isomers | |
| US3744988A (en) | Tobacco sucker control | |
| IL37369A (en) | Dipyridylamine derivatives and pesticidal compositions containing them | |
| CA1289469C (en) | Oxypyridinium salts and agents for combating microbes | |
| US4379147A (en) | Substituted 2-(anilinomethyl)-2-imidazoline derivatives, compositions containing these derivatives, and the use thereof for combating pests | |
| SU1264830A3 (ru) | Фунгицидное средство | |
| US3743643A (en) | Substituted triazines | |
| US4098900A (en) | N,N'-Diphenyl-guanidine derivatives | |
| US3830822A (en) | Bis-pyridyl amines | |
| DK171866B1 (da) | 1-dimethylcarbamoyl-3-substituerede-5-substituerede-1H-1,2,4-triazoler, insekticide præparater indeholdende forbindelserne, fremgangsmåde til bekæmpelse af insekter, samt anvendelse af forbindelserne og præparaterne | |
| US3817742A (en) | Substituted triazines | |
| US3766202A (en) | 1,3-disubstituted-5-(substituted thio) imino-2,4-imidazolidine-dionesand the 4-thio analogs | |
| US3864342A (en) | Herbicidal n-substituted-dithioamino and n-substituted- oxythioamino triazines | |
| US3824281A (en) | 1-carboxamidothio-3-aryl ureas |