IL38841A - Recovery of hydrogen fluoride - Google Patents
Recovery of hydrogen fluorideInfo
- Publication number
- IL38841A IL38841A IL38841A IL3884172A IL38841A IL 38841 A IL38841 A IL 38841A IL 38841 A IL38841 A IL 38841A IL 3884172 A IL3884172 A IL 3884172A IL 38841 A IL38841 A IL 38841A
- Authority
- IL
- Israel
- Prior art keywords
- process according
- alkali
- hydrogen fluoride
- fluoride
- mixture
- Prior art date
Links
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 title claims description 44
- 229910000040 hydrogen fluoride Inorganic materials 0.000 title claims description 44
- 238000011084 recovery Methods 0.000 title claims description 9
- 238000000034 method Methods 0.000 claims description 36
- 239000007788 liquid Substances 0.000 claims description 21
- 229910001515 alkali metal fluoride Inorganic materials 0.000 claims description 20
- 239000000203 mixture Substances 0.000 claims description 20
- 239000008246 gaseous mixture Substances 0.000 claims description 11
- PUZPDOWCWNUUKD-UHFFFAOYSA-M sodium fluoride Chemical group [F-].[Na+] PUZPDOWCWNUUKD-UHFFFAOYSA-M 0.000 claims description 10
- DOIRQSBPFJWKBE-UHFFFAOYSA-N dibutyl phthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC DOIRQSBPFJWKBE-UHFFFAOYSA-N 0.000 claims description 6
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 claims description 6
- 239000010436 fluorite Substances 0.000 claims description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 6
- 125000006267 biphenyl group Chemical group 0.000 claims description 5
- 238000009835 boiling Methods 0.000 claims description 5
- 238000010438 heat treatment Methods 0.000 claims description 5
- 239000011775 sodium fluoride Substances 0.000 claims description 5
- 235000013024 sodium fluoride Nutrition 0.000 claims description 5
- 150000001491 aromatic compounds Chemical class 0.000 claims description 3
- 235000010290 biphenyl Nutrition 0.000 claims description 3
- 239000004305 biphenyl Substances 0.000 claims description 3
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 claims description 3
- 229920001451 polypropylene glycol Polymers 0.000 claims description 3
- WRIDQFICGBMAFQ-UHFFFAOYSA-N (E)-8-Octadecenoic acid Natural products CCCCCCCCCC=CCCCCCCC(O)=O WRIDQFICGBMAFQ-UHFFFAOYSA-N 0.000 claims description 2
- LQJBNNIYVWPHFW-UHFFFAOYSA-N 20:1omega9c fatty acid Natural products CCCCCCCCCCC=CCCCCCCCC(O)=O LQJBNNIYVWPHFW-UHFFFAOYSA-N 0.000 claims description 2
- QSBYPNXLFMSGKH-UHFFFAOYSA-N 9-Heptadecensaeure Natural products CCCCCCCC=CCCCCCCCC(O)=O QSBYPNXLFMSGKH-UHFFFAOYSA-N 0.000 claims description 2
- 239000005642 Oleic acid Substances 0.000 claims description 2
- ZQPPMHVWECSIRJ-UHFFFAOYSA-N Oleic acid Natural products CCCCCCCCC=CCCCCCCCC(O)=O ZQPPMHVWECSIRJ-UHFFFAOYSA-N 0.000 claims description 2
- QXJSBBXBKPUZAA-UHFFFAOYSA-N isooleic acid Natural products CCCCCCCC=CCCCCCCCCC(O)=O QXJSBBXBKPUZAA-UHFFFAOYSA-N 0.000 claims description 2
- 239000002480 mineral oil Substances 0.000 claims description 2
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims 1
- 235000010446 mineral oil Nutrition 0.000 claims 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- 239000007789 gas Substances 0.000 description 6
- 239000002002 slurry Substances 0.000 description 6
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- 238000010521 absorption reaction Methods 0.000 description 3
- WUKWITHWXAAZEY-UHFFFAOYSA-L calcium difluoride Chemical compound [F-].[F-].[Ca+2] WUKWITHWXAAZEY-UHFFFAOYSA-L 0.000 description 3
- 229910001634 calcium fluoride Inorganic materials 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 2
- 239000000374 eutectic mixture Substances 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 235000010269 sulphur dioxide Nutrition 0.000 description 2
- 239000004291 sulphur dioxide Substances 0.000 description 2
- 150000003568 thioethers Chemical class 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- -1 calcium fluorosilicate Chemical compound 0.000 description 1
- 239000000378 calcium silicate Substances 0.000 description 1
- 229910052918 calcium silicate Inorganic materials 0.000 description 1
- OYACROKNLOSFPA-UHFFFAOYSA-N calcium;dioxido(oxo)silane Chemical compound [Ca+2].[O-][Si]([O-])=O OYACROKNLOSFPA-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 239000000356 contaminant Substances 0.000 description 1
- 230000008602 contraction Effects 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000003682 fluorination reaction Methods 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000010907 mechanical stirring Methods 0.000 description 1
- 229910001512 metal fluoride Inorganic materials 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical class OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 1
- 229920000151 polyglycol Polymers 0.000 description 1
- 239000010695 polyglycol Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- ABTOQLMXBSRXSM-UHFFFAOYSA-N silicon tetrafluoride Chemical compound F[Si](F)(F)F ABTOQLMXBSRXSM-UHFFFAOYSA-N 0.000 description 1
- 238000001577 simple distillation Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B7/00—Halogens; Halogen acids
- C01B7/19—Fluorine; Hydrogen fluoride
- C01B7/191—Hydrogen fluoride
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Gas Separation By Absorption (AREA)
- Sorption Type Refrigeration Machines (AREA)
- Solid-Sorbent Or Filter-Aiding Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Hydrogen, Water And Hydrids (AREA)
- Treating Waste Gases (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB626971 | 1971-03-08 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL38841A0 IL38841A0 (en) | 1972-04-27 |
| IL38841A true IL38841A (en) | 1974-12-31 |
Family
ID=9811456
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL38841A IL38841A (en) | 1971-03-08 | 1972-02-25 | Recovery of hydrogen fluoride |
Country Status (20)
| Country | Link |
|---|---|
| JP (1) | JPS5229276B1 (enExample) |
| AT (1) | AT325010B (enExample) |
| AU (1) | AU463078B2 (enExample) |
| BE (1) | BE780060A (enExample) |
| BR (1) | BR7201280D0 (enExample) |
| CA (1) | CA957132A (enExample) |
| CS (1) | CS170181B2 (enExample) |
| DD (1) | DD94807A5 (enExample) |
| DE (1) | DE2209841B2 (enExample) |
| ES (1) | ES400511A1 (enExample) |
| FR (1) | FR2128712B1 (enExample) |
| GB (1) | GB1332968A (enExample) |
| IL (1) | IL38841A (enExample) |
| IT (1) | IT959556B (enExample) |
| NL (1) | NL151043B (enExample) |
| NO (1) | NO133363C (enExample) |
| SE (1) | SE379994B (enExample) |
| SU (1) | SU459884A3 (enExample) |
| TR (1) | TR19068A (enExample) |
| ZA (1) | ZA721323B (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4491570A (en) * | 1984-05-03 | 1985-01-01 | Pennwalt Corporation | Removal of arsenic from hydrogen fluoride |
| US4832935A (en) * | 1987-11-04 | 1989-05-23 | Gte Laboratories Incorporated | Method for dehydrating hydrogen fluoride |
| GB9305148D0 (en) * | 1993-03-12 | 1993-04-28 | Ici Plc | Hydrogen fluoride recovery process |
| US5800795A (en) * | 1993-03-12 | 1998-09-01 | Imperial Chemical Industries Plc | Hydrogen fluoride recovery process |
| CN1110449C (zh) * | 1995-10-10 | 2003-06-04 | 英尼奥斯费罗控股有限公司 | 分离和回收氟化氢的方法以及制备含氟有机化合物的方法 |
| GB9707176D0 (en) | 1997-04-09 | 1997-05-28 | Ici Plc | Hydrogen fluoride recovery process |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB605472A (en) * | 1945-10-02 | 1948-07-23 | Standard Oil Co | Improvements relating to the recovery of fluorides |
| DE938964C (de) * | 1953-11-08 | 1956-02-09 | Harpener Bergbau Ag | Verfahren zur Rueckgewinnung von Bortrifluorid und wasserfreier Flusssaeure aus waesserigen Loesungen |
-
1972
- 1972-02-16 GB GB626971A patent/GB1332968A/en not_active Expired
- 1972-02-24 AU AU39316/72A patent/AU463078B2/en not_active Expired
- 1972-02-25 IL IL38841A patent/IL38841A/en unknown
- 1972-02-28 ZA ZA721323A patent/ZA721323B/xx unknown
- 1972-03-01 TR TR19068A patent/TR19068A/xx unknown
- 1972-03-01 DE DE19722209841 patent/DE2209841B2/de active Granted
- 1972-03-01 BE BE780060A patent/BE780060A/xx unknown
- 1972-03-01 NL NL727202681A patent/NL151043B/xx unknown
- 1972-03-06 BR BR1280/72*[A patent/BR7201280D0/pt unknown
- 1972-03-07 SU SU1757268A patent/SU459884A3/ru active
- 1972-03-07 DD DD161409A patent/DD94807A5/xx unknown
- 1972-03-07 IT IT21537/72A patent/IT959556B/it active
- 1972-03-07 NO NO724/72A patent/NO133363C/no unknown
- 1972-03-07 SE SE7202891A patent/SE379994B/xx unknown
- 1972-03-07 FR FR7207921A patent/FR2128712B1/fr not_active Expired
- 1972-03-07 ES ES400511A patent/ES400511A1/es not_active Expired
- 1972-03-07 CS CS1507A patent/CS170181B2/cs unknown
- 1972-03-08 AT AT194072A patent/AT325010B/de not_active IP Right Cessation
- 1972-03-08 JP JP47023250A patent/JPS5229276B1/ja active Pending
- 1972-03-08 CA CA136,720A patent/CA957132A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| TR19068A (tr) | 1978-05-01 |
| DD94807A5 (enExample) | 1973-01-05 |
| BE780060A (fr) | 1972-09-01 |
| AT325010B (de) | 1975-09-25 |
| IT959556B (it) | 1973-11-10 |
| FR2128712A1 (enExample) | 1972-10-20 |
| DE2209841A1 (de) | 1972-09-28 |
| NO133363B (enExample) | 1976-01-12 |
| DE2209841B2 (de) | 1976-11-11 |
| NL151043B (nl) | 1976-10-15 |
| NL7202681A (enExample) | 1972-09-12 |
| AU463078B2 (en) | 1975-06-25 |
| AU3931672A (en) | 1973-08-30 |
| BR7201280D0 (pt) | 1973-07-03 |
| CS170181B2 (enExample) | 1976-08-27 |
| SU459884A3 (ru) | 1975-02-05 |
| JPS5229276B1 (enExample) | 1977-08-01 |
| CA957132A (en) | 1974-11-05 |
| GB1332968A (en) | 1973-10-10 |
| NO133363C (enExample) | 1976-04-21 |
| ZA721323B (en) | 1973-10-31 |
| FR2128712B1 (enExample) | 1977-01-14 |
| SE379994B (enExample) | 1975-10-27 |
| IL38841A0 (en) | 1972-04-27 |
| ES400511A1 (es) | 1975-02-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3976447A (en) | Removal of hydrogen fluoride from gaseous mixture by absorption on alkaline earth metal fluoride | |
| US4780112A (en) | Method for the continuous chemical reduction and removal of mineral matter contained in carbon structures | |
| US4236973A (en) | Method of removing contaminants from water | |
| US3721066A (en) | Process for recovery of acid gases | |
| IL45122A (en) | Process for the recovery of cyanuric chloride | |
| US3798875A (en) | Recovery of hydrogen fluoride | |
| US3383173A (en) | Ammonia purification | |
| US5324499A (en) | Fluoride removal from sulphuric acid | |
| IL38841A (en) | Recovery of hydrogen fluoride | |
| US4009214A (en) | Separation of hydrogen fluoride from hydrogen chloride gas | |
| US3140916A (en) | Hydrogen chloride recovery and purification from gases containing hydrogen fluoride | |
| HUT55703A (en) | Process for cleaning and concentrating thin, contaminated hydrochlorid acid | |
| US3044862A (en) | Process for recovering iodine from mixtures of iodine, hydrogen iodide and water | |
| US5449503A (en) | Process for separating arsenic acid from an aqueous mixture comprising sulfuric and arsenic acids | |
| US3258308A (en) | Process for the treatment of waste gases | |
| US2785953A (en) | Process for preparing a dry mixture of ammonium fluosilicate and silica | |
| US3375060A (en) | Method of producing hydrogen fluoride and solubilized beryllium | |
| EP0380014A1 (en) | Method for removing impurities from anhydrous hydrogen chloride | |
| US3568409A (en) | Hydrochloric acid treatment for chlorine | |
| US3995010A (en) | Purification process | |
| CA1242459A (en) | Process for the destruction of by-product tetranitromethane | |
| DE4116925A1 (de) | Verfahren zur aufbereitung von destillationsrueckstaenden der direkten synthese von chlor- und/oder organochlorsilanen | |
| US4169135A (en) | Process for producing vanadium chlorides | |
| JPH0339003B2 (enExample) | ||
| US3218129A (en) | Separation of hydrogen fluoride and silicon tetrafluoride |