IL37431A - Pharmaceutical compositions containing derivatives of thiazolino(3,2-a)pyrimidin-5-one,certain such novel derivatives and their preparation - Google Patents
Pharmaceutical compositions containing derivatives of thiazolino(3,2-a)pyrimidin-5-one,certain such novel derivatives and their preparationInfo
- Publication number
- IL37431A IL37431A IL37431A IL3743171A IL37431A IL 37431 A IL37431 A IL 37431A IL 37431 A IL37431 A IL 37431A IL 3743171 A IL3743171 A IL 3743171A IL 37431 A IL37431 A IL 37431A
- Authority
- IL
- Israel
- Prior art keywords
- compounds
- preparation
- derivatives
- methyl
- thiazolino
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 title claims description 6
- 239000008194 pharmaceutical composition Substances 0.000 title description 2
- BDTRIDKONHOQQN-UHFFFAOYSA-N 4h-pyrimidin-5-one Chemical compound O=C1CN=CN=C1 BDTRIDKONHOQQN-UHFFFAOYSA-N 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 18
- 238000000034 method Methods 0.000 claims description 8
- 239000000203 mixture Substances 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 150000003839 salts Chemical class 0.000 claims description 5
- 238000009833 condensation Methods 0.000 claims description 4
- 230000005494 condensation Effects 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 239000002253 acid Substances 0.000 claims description 2
- 150000002148 esters Chemical class 0.000 claims description 2
- 238000010438 heat treatment Methods 0.000 claims description 2
- 239000003960 organic solvent Substances 0.000 claims description 2
- 239000003153 chemical reaction reagent Substances 0.000 claims 1
- 150000002466 imines Chemical class 0.000 claims 1
- 125000001424 substituent group Chemical group 0.000 claims 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- 230000000202 analgesic effect Effects 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- GKKZMYDNDDMXSE-UHFFFAOYSA-N Ethyl 3-oxo-3-phenylpropanoate Chemical compound CCOC(=O)CC(=O)C1=CC=CC=C1 GKKZMYDNDDMXSE-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000013058 crude material Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000007928 intraperitoneal injection Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000012956 testing procedure Methods 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D513/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00
- C07D513/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00 in which the condensed system contains two hetero rings
- C07D513/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Plural Heterocyclic Compounds (AREA)
- Thiazole And Isothizaole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB3918970 | 1970-08-14 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL37431A0 IL37431A0 (en) | 1971-11-29 |
| IL37431A true IL37431A (en) | 1974-10-22 |
Family
ID=10408188
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL37431A IL37431A (en) | 1970-08-14 | 1971-08-03 | Pharmaceutical compositions containing derivatives of thiazolino(3,2-a)pyrimidin-5-one,certain such novel derivatives and their preparation |
Country Status (21)
| Country | Link |
|---|---|
| JP (1) | JPS5116437B1 (esLanguage) |
| AT (1) | AT305279B (esLanguage) |
| AU (1) | AU3231071A (esLanguage) |
| BE (1) | BE770873A (esLanguage) |
| CA (1) | CA925868A (esLanguage) |
| CH (1) | CH542231A (esLanguage) |
| DE (1) | DE2140601C3 (esLanguage) |
| DK (1) | DK129718B (esLanguage) |
| ES (1) | ES394727A1 (esLanguage) |
| FI (1) | FI52096C (esLanguage) |
| FR (1) | FR2102254B1 (esLanguage) |
| GB (1) | GB1306558A (esLanguage) |
| IE (1) | IE35491B1 (esLanguage) |
| IL (1) | IL37431A (esLanguage) |
| IS (1) | IS918B6 (esLanguage) |
| LU (1) | LU63700A1 (esLanguage) |
| NL (2) | NL149177B (esLanguage) |
| NO (1) | NO132760C (esLanguage) |
| OA (1) | OA03905A (esLanguage) |
| SE (1) | SE380271B (esLanguage) |
| ZA (1) | ZA715194B (esLanguage) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| PL129612B1 (en) * | 1980-07-24 | 1984-05-31 | Rhone Poulenc Ind | Process for preparing novel derivatives of 2,3,6,7-tetrahydrothiazole/3,2-a/pirymidin-5-one |
| US4443451A (en) * | 1981-07-15 | 1984-04-17 | Janssen Pharmaceutica N.V. | Bicyclic pyrimidin-5-one derivatives |
| JPS5980072U (ja) * | 1982-11-19 | 1984-05-30 | 株式会社東洋製作所 | 倉庫の扉開閉装置 |
| JPS6354797U (esLanguage) * | 1986-09-29 | 1988-04-12 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1275804A (en) * | 1969-07-03 | 1972-05-24 | Seperic | Improvements in or relating to new sulphur containing derivatives of pyrimidine, their preparation and their applications |
-
1970
- 1970-08-14 GB GB3918970A patent/GB1306558A/en not_active Expired
-
1971
- 1971-07-08 FR FR7125051A patent/FR2102254B1/fr not_active Expired
- 1971-08-03 BE BE770873A patent/BE770873A/xx unknown
- 1971-08-03 IL IL37431A patent/IL37431A/en unknown
- 1971-08-03 IS IS2024A patent/IS918B6/is unknown
- 1971-08-04 IE IE986/71A patent/IE35491B1/xx unknown
- 1971-08-04 ZA ZA715194A patent/ZA715194B/xx unknown
- 1971-08-05 SE SE7110021A patent/SE380271B/xx unknown
- 1971-08-05 CH CH1155771A patent/CH542231A/fr not_active IP Right Cessation
- 1971-08-09 OA OA54327A patent/OA03905A/xx unknown
- 1971-08-11 LU LU63700D patent/LU63700A1/xx unknown
- 1971-08-11 FI FI712245A patent/FI52096C/fi active
- 1971-08-12 ES ES394727A patent/ES394727A1/es not_active Expired
- 1971-08-12 AU AU32310/71A patent/AU3231071A/en not_active Expired
- 1971-08-13 JP JP46061591A patent/JPS5116437B1/ja active Pending
- 1971-08-13 DE DE2140601A patent/DE2140601C3/de not_active Expired
- 1971-08-13 NL NL717111222A patent/NL149177B/xx not_active IP Right Cessation
- 1971-08-13 NO NO3028/71A patent/NO132760C/no unknown
- 1971-08-13 AT AT711771A patent/AT305279B/de active
- 1971-08-13 DK DK398471AA patent/DK129718B/da unknown
- 1971-08-13 CA CA120534A patent/CA925868A/en not_active Expired
-
1976
- 1976-01-28 NL NL7600885A patent/NL7600885A/xx not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| CH542231A (fr) | 1973-09-30 |
| IS2024A7 (is) | 1972-02-15 |
| NL7111222A (esLanguage) | 1972-02-16 |
| IE35491B1 (en) | 1976-03-03 |
| AU3231071A (en) | 1973-02-15 |
| NO132760C (esLanguage) | 1975-12-29 |
| OA03905A (fr) | 1975-08-14 |
| GB1306558A (en) | 1973-02-14 |
| IL37431A0 (en) | 1971-11-29 |
| CA925868A (en) | 1973-05-08 |
| BE770873A (fr) | 1971-12-16 |
| IE35491L (en) | 1972-02-14 |
| ZA715194B (en) | 1972-04-26 |
| DE2140601B2 (de) | 1974-05-30 |
| LU63700A1 (esLanguage) | 1971-12-17 |
| DK129718C (esLanguage) | 1975-04-28 |
| DE2140601A1 (de) | 1972-02-17 |
| SE380271B (sv) | 1975-11-03 |
| ES394727A1 (es) | 1974-02-16 |
| DK129718B (da) | 1974-11-11 |
| JPS5116437B1 (esLanguage) | 1976-05-24 |
| AT305279B (de) | 1973-02-26 |
| FR2102254A1 (esLanguage) | 1972-04-07 |
| DE2140601C3 (de) | 1975-02-13 |
| NO132760B (esLanguage) | 1975-09-22 |
| FI52096C (fi) | 1977-06-10 |
| FI52096B (esLanguage) | 1977-02-28 |
| NL149177B (nl) | 1976-04-15 |
| IS918B6 (is) | 1975-12-24 |
| NL7600885A (nl) | 1976-04-29 |
| FR2102254B1 (esLanguage) | 1976-04-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS6032620B2 (ja) | 新規なシアン酢酸アニリド誘導体およびその製法 | |
| EP0198456B1 (en) | 1,7-naphthyridine derivatives and medicinal preparations containing same | |
| US4960773A (en) | Xanthine derivatives | |
| US3888983A (en) | Derivatives of thiazolino-pyrimidin-6-ones, in inducing analgesia | |
| US3192253A (en) | N-substituted methoxyphenoxy-ethylamines | |
| IL37431A (en) | Pharmaceutical compositions containing derivatives of thiazolino(3,2-a)pyrimidin-5-one,certain such novel derivatives and their preparation | |
| US3971814A (en) | Benzo(b)thiophene derivatives | |
| US3953461A (en) | Amino derivatives of thiazolo[5,4-b]pyridine-6-carboxylic acids and esters | |
| JPS6024794B2 (ja) | オキサジアゾロピリミジン誘導体 | |
| CS240982B2 (en) | Production method of pyrrolidine derivatives | |
| US4500708A (en) | Benzothiazine derivatives | |
| KR880001298B1 (ko) | 벤조일-페닐-피페리딘 유도체의 제법 | |
| US3029247A (en) | Certain tetrahydro-beta-carbolines | |
| US3523120A (en) | Piperonyl-piperazine compounds | |
| US3824234A (en) | 7,8,9,10-tetrahydro-2-methoxy-7-morpholinomethylcyclohept(b)indol-6(5h)-one | |
| US5098919A (en) | Pyrrolo(2,1-b)thiazole derivatives | |
| US4018793A (en) | Benzo (b) thiophene derivatives | |
| EP0025965A2 (en) | Organogermanium compounds, a method for producing them and pharmaceutical compositions comprising them | |
| US3876639A (en) | Thiazolino-pyrimidin-5-one derivatives, process for their preparation and applications thereof | |
| US2802826A (en) | Octahydro-pyrido [4, 3-d] pyrimidine compounds | |
| KR900000968B1 (ko) | 1,2-디티올-3-티온 유도체, 이의 제조방법 및 조성물 | |
| US3991082A (en) | 4-Substituted-2,3-dihydro-1-benzoxepin-3,5-diones and tautomers | |
| US4056526A (en) | Benzo(b)thiophene derivatives | |
| US3983156A (en) | Substituted ω-nitroacetophenones | |
| US4082770A (en) | Benzo(b)thiophene derivatives |