IL35693A - Benzofuran and benzothiophen carboxylic acids,their production and pharmaceutical compositions containing them - Google Patents
Benzofuran and benzothiophen carboxylic acids,their production and pharmaceutical compositions containing themInfo
- Publication number
- IL35693A IL35693A IL35693A IL3569370A IL35693A IL 35693 A IL35693 A IL 35693A IL 35693 A IL35693 A IL 35693A IL 3569370 A IL3569370 A IL 3569370A IL 35693 A IL35693 A IL 35693A
- Authority
- IL
- Israel
- Prior art keywords
- carboxylic acid
- formula
- pharmaceutically acceptable
- heterocyclic carboxylic
- dihydro
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title claims description 10
- 239000008194 pharmaceutical composition Substances 0.000 title claims description 3
- IANQTJSKSUMEQM-UHFFFAOYSA-N 1-benzofuran Chemical compound C1=CC=C2OC=CC2=C1 IANQTJSKSUMEQM-UHFFFAOYSA-N 0.000 title description 4
- DYSJMQABFPKAQM-UHFFFAOYSA-N 1-benzothiophene-2-carboxylic acid Chemical class C1=CC=C2SC(C(=O)O)=CC2=C1 DYSJMQABFPKAQM-UHFFFAOYSA-N 0.000 title 1
- -1 Heterocyclic carboxylic acids Chemical class 0.000 claims description 38
- 150000001875 compounds Chemical class 0.000 claims description 27
- 150000003839 salts Chemical class 0.000 claims description 21
- 238000000034 method Methods 0.000 claims description 18
- 239000002253 acid Substances 0.000 claims description 14
- 150000002148 esters Chemical class 0.000 claims description 10
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 125000005907 alkyl ester group Chemical group 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 230000003301 hydrolyzing effect Effects 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims 1
- 229910052801 chlorine Inorganic materials 0.000 claims 1
- 239000000460 chlorine Substances 0.000 claims 1
- 239000003085 diluting agent Substances 0.000 claims 1
- 229910052731 fluorine Inorganic materials 0.000 claims 1
- 125000001153 fluoro group Chemical group F* 0.000 claims 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 58
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 35
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 33
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 28
- 229960000583 acetic acid Drugs 0.000 description 27
- 239000000243 solution Substances 0.000 description 26
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 24
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 24
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 24
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 23
- 239000012362 glacial acetic acid Substances 0.000 description 23
- 239000000203 mixture Substances 0.000 description 22
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 14
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 12
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 11
- 239000007858 starting material Substances 0.000 description 11
- 239000012043 crude product Substances 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000013543 active substance Substances 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 9
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Substances [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 9
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 8
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 8
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 7
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 7
- 150000007530 organic bases Chemical class 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 6
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 6
- 229910052783 alkali metal Inorganic materials 0.000 description 6
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 6
- 239000002775 capsule Substances 0.000 description 6
- 150000001735 carboxylic acids Chemical class 0.000 description 6
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 6
- 239000008298 dragée Substances 0.000 description 6
- MCSAJNNLRCFZED-UHFFFAOYSA-N nitroethane Chemical compound CC[N+]([O-])=O MCSAJNNLRCFZED-UHFFFAOYSA-N 0.000 description 6
- 235000017557 sodium bicarbonate Nutrition 0.000 description 6
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 6
- 239000003826 tablet Substances 0.000 description 6
- 239000000454 talc Substances 0.000 description 6
- 229910052623 talc Inorganic materials 0.000 description 6
- 235000012222 talc Nutrition 0.000 description 6
- 239000001828 Gelatine Substances 0.000 description 5
- 238000001704 evaporation Methods 0.000 description 5
- 230000008020 evaporation Effects 0.000 description 5
- 229920000159 gelatin Polymers 0.000 description 5
- 235000019322 gelatine Nutrition 0.000 description 5
- 239000012442 inert solvent Substances 0.000 description 5
- 150000007529 inorganic bases Chemical class 0.000 description 5
- 235000019359 magnesium stearate Nutrition 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- 150000003141 primary amines Chemical class 0.000 description 5
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 239000008187 granular material Substances 0.000 description 4
- 229920001592 potato starch Polymers 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 239000001117 sulphuric acid Substances 0.000 description 4
- 235000011149 sulphuric acid Nutrition 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- UHDAGVSUCICGQM-UHFFFAOYSA-N 6,7-dimethyl-5-(2-nitrobut-1-enyl)-2,3-dihydro-1-benzofuran-2-carboxylic acid Chemical compound [N+](=O)([O-])C(=CC=1C(=C(C2=C(CC(O2)C(=O)O)C1)C)C)CC UHDAGVSUCICGQM-UHFFFAOYSA-N 0.000 description 3
- DQVIZIDHNMMJLT-UHFFFAOYSA-N 6-chloro-5-formyl-2,3-dihydro-1-benzothiophene-2-carboxylic acid Chemical compound C(=O)C1=CC2=C(SC(C2)C(=O)O)C=C1Cl DQVIZIDHNMMJLT-UHFFFAOYSA-N 0.000 description 3
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 229940075614 colloidal silicon dioxide Drugs 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 230000005494 condensation Effects 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- GRTGGSXWHGKRSB-UHFFFAOYSA-N dichloromethyl methyl ether Chemical compound COC(Cl)Cl GRTGGSXWHGKRSB-UHFFFAOYSA-N 0.000 description 3
- LQNKRORHZBAFLU-UHFFFAOYSA-N ethyl 5-(butyliminomethyl)-6,7-dimethyl-2,3-dihydro-1-benzofuran-2-carboxylate Chemical compound C(C)OC(=O)C1OC2=C(C1)C=C(C(=C2C)C)C=NCCCC LQNKRORHZBAFLU-UHFFFAOYSA-N 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 239000008101 lactose Substances 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- MJGFBOZCAJSGQW-UHFFFAOYSA-N mercury sodium Chemical compound [Na].[Hg] MJGFBOZCAJSGQW-UHFFFAOYSA-N 0.000 description 3
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 229910001023 sodium amalgam Inorganic materials 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- QWBBPBRQALCEIZ-UHFFFAOYSA-N 2,3-dimethylphenol Chemical compound CC1=CC=CC(O)=C1C QWBBPBRQALCEIZ-UHFFFAOYSA-N 0.000 description 2
- ZUKWIQSZWLJEMT-UHFFFAOYSA-N 3,6-dimethyl-2,3-dihydro-1-benzofuran-2-carboxylic acid Chemical compound CC1=CC=C2C(C)C(C(O)=O)OC2=C1 ZUKWIQSZWLJEMT-UHFFFAOYSA-N 0.000 description 2
- VZTPRAHUNORRBF-UHFFFAOYSA-N 5-formyl-3,6-dimethyl-2,3-dihydro-1-benzofuran-2-carboxylic acid Chemical compound CC1C(OC2=C1C=C(C(=C2)C)C=O)C(=O)O VZTPRAHUNORRBF-UHFFFAOYSA-N 0.000 description 2
- YHGXUBDJYPGDLL-UHFFFAOYSA-N 5-formyl-6,7-dimethyl-2,3-dihydro-1-benzofuran-2-carboxylic acid Chemical compound C(=O)C=1C(=C(C2=C(CC(O2)C(=O)O)C1)C)C YHGXUBDJYPGDLL-UHFFFAOYSA-N 0.000 description 2
- JBGVCHAJHGUTBQ-UHFFFAOYSA-N 5-formyl-6-methoxy-2,3-dihydro-1-benzofuran-2-carboxylic acid Chemical compound C(=O)C=1C(=CC2=C(CC(O2)C(=O)O)C1)OC JBGVCHAJHGUTBQ-UHFFFAOYSA-N 0.000 description 2
- ZYQCKPKFAFHUSJ-UHFFFAOYSA-N 6-methoxy-2,3-dihydro-1-benzofuran-2-carboxylic acid Chemical compound COC1=CC=C2CC(C(O)=O)OC2=C1 ZYQCKPKFAFHUSJ-UHFFFAOYSA-N 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- 229920000084 Gum arabic Polymers 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 239000000205 acacia gum Substances 0.000 description 2
- 235000010489 acacia gum Nutrition 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 125000003710 aryl alkyl group Chemical group 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 235000013681 dietary sucrose Nutrition 0.000 description 2
- AHYJRRZPUZPNRY-UHFFFAOYSA-N ethyl 6,7-dimethyl-5-(2-nitropent-1-enyl)-2,3-dihydro-1-benzofuran-2-carboxylate Chemical compound C(C)OC(=O)C1OC2=C(C1)C=C(C(=C2C)C)C=C(CCC)[N+](=O)[O-] AHYJRRZPUZPNRY-UHFFFAOYSA-N 0.000 description 2
- UNICUCGBMNDIEX-UHFFFAOYSA-N ethyl 6-chloro-5-(2-nitroprop-1-enyl)-2,3-dihydro-1-benzothiophene-2-carboxylate Chemical compound C(C)OC(=O)C1CC2=C(S1)C=C(C(=C2)C=C(C)[N+](=O)[O-])Cl UNICUCGBMNDIEX-UHFFFAOYSA-N 0.000 description 2
- 125000004494 ethyl ester group Chemical group 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000013067 intermediate product Substances 0.000 description 2
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- KIWUVOGUEXMXSV-UHFFFAOYSA-N rhodanine Chemical compound O=C1CSC(=S)N1 KIWUVOGUEXMXSV-UHFFFAOYSA-N 0.000 description 2
- 239000012266 salt solution Substances 0.000 description 2
- 125000003548 sec-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- 229960004793 sucrose Drugs 0.000 description 2
- QERYCTSHXKAMIS-UHFFFAOYSA-N thiophene-2-carboxylic acid Chemical compound OC(=O)C1=CC=CS1 QERYCTSHXKAMIS-UHFFFAOYSA-N 0.000 description 2
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- NALZTFARIYUCBY-UHFFFAOYSA-N 1-nitrobutane Chemical compound CCCC[N+]([O-])=O NALZTFARIYUCBY-UHFFFAOYSA-N 0.000 description 1
- FEYJIFXFOHFGCC-UHFFFAOYSA-N 1-nitrohexane Chemical compound CCCCCC[N+]([O-])=O FEYJIFXFOHFGCC-UHFFFAOYSA-N 0.000 description 1
- JSZOAYXJRCEYSX-UHFFFAOYSA-N 1-nitropropane Chemical compound CCC[N+]([O-])=O JSZOAYXJRCEYSX-UHFFFAOYSA-N 0.000 description 1
- HBEDSQVIWPRPAY-UHFFFAOYSA-N 2,3-dihydrobenzofuran Chemical class C1=CC=C2OCCC2=C1 HBEDSQVIWPRPAY-UHFFFAOYSA-N 0.000 description 1
- 125000005916 2-methylpentyl group Chemical group 0.000 description 1
- 125000003542 3-methylbutan-2-yl group Chemical group [H]C([H])([H])C([H])(*)C([H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- DUTNBAQMMZPIKM-UHFFFAOYSA-N 5-[(2,4-dichlorophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one Chemical compound ClC1=CC(Cl)=CC=C1C=C1C(=O)NC(=S)S1 DUTNBAQMMZPIKM-UHFFFAOYSA-N 0.000 description 1
- ZQWOLTVJEJDOFX-UHFFFAOYSA-N 6,7-dimethyl-1-benzofuran-2-carboxylic acid Chemical compound CC1=CC=C2C=C(C(O)=O)OC2=C1C ZQWOLTVJEJDOFX-UHFFFAOYSA-N 0.000 description 1
- KPGBOYHKDHJWJN-UHFFFAOYSA-N 6,7-dimethyl-5-(2-nitropent-1-enyl)-2,3-dihydro-1-benzofuran-2-carboxylic acid Chemical compound [N+](=O)([O-])C(=CC=1C(=C(C2=C(CC(O2)C(=O)O)C1)C)C)CCC KPGBOYHKDHJWJN-UHFFFAOYSA-N 0.000 description 1
- LMTVAANSGVHGFM-UHFFFAOYSA-N 6,7-dimethyl-5-(2-nitroprop-1-enyl)-2,3-dihydro-1-benzofuran-2-carboxylic acid Chemical compound [N+](=O)([O-])C(=CC=1C(=C(C2=C(CC(O2)C(=O)O)C1)C)C)C LMTVAANSGVHGFM-UHFFFAOYSA-N 0.000 description 1
- AVAGKGZNBMZOLD-UHFFFAOYSA-N 6-chloro-1-benzothiophene-2-carboxylic acid Chemical compound C1=C(Cl)C=C2SC(C(=O)O)=CC2=C1 AVAGKGZNBMZOLD-UHFFFAOYSA-N 0.000 description 1
- CDZHZOSUCIBINM-UHFFFAOYSA-N 6-chloro-2,3-dihydro-1-benzothiophene-2-carboxylic acid Chemical compound C1=C(Cl)C=C2SC(C(=O)O)CC2=C1 CDZHZOSUCIBINM-UHFFFAOYSA-N 0.000 description 1
- QXBQJXVMLMPNHS-UHFFFAOYSA-N 7,8-dimethylchromen-2-one Chemical compound C1=CC(=O)OC2=C(C)C(C)=CC=C21 QXBQJXVMLMPNHS-UHFFFAOYSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 229920000945 Amylopectin Polymers 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- SCSXLFCILINGCA-UHFFFAOYSA-N C(C)OC(=O)C1CC2=C(S1)C=C(C(=C2)C=NCCCC)Cl Chemical compound C(C)OC(=O)C1CC2=C(S1)C=C(C(=C2)C=NCCCC)Cl SCSXLFCILINGCA-UHFFFAOYSA-N 0.000 description 1
- JMAQGUCKSFKSTP-UHFFFAOYSA-N C(C)OC(=O)C1OC2=C(C1)C=C(C(=C2C)C)C=C(CC)[N+](=O)[O-] Chemical compound C(C)OC(=O)C1OC2=C(C1)C=C(C(=C2C)C)C=C(CC)[N+](=O)[O-] JMAQGUCKSFKSTP-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 241000207199 Citrus Species 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- 244000165918 Eucalyptus papuana Species 0.000 description 1
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241001466453 Laminaria Species 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 235000019759 Maize starch Nutrition 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 206010030113 Oedema Diseases 0.000 description 1
- 229920001800 Shellac Polymers 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 239000005864 Sulphur Chemical group 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 102100029469 WD repeat and HMG-box DNA-binding protein 1 Human genes 0.000 description 1
- 101710097421 WD repeat and HMG-box DNA-binding protein 1 Proteins 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 1
- 235000013539 calcium stearate Nutrition 0.000 description 1
- 239000008116 calcium stearate Substances 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- OEYIOHPDSNJKLS-UHFFFAOYSA-N choline Chemical compound C[N+](C)(C)CCO OEYIOHPDSNJKLS-UHFFFAOYSA-N 0.000 description 1
- 229960001231 choline Drugs 0.000 description 1
- 235000020971 citrus fruits Nutrition 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000002950 deficient Effects 0.000 description 1
- MJNJTZVLAVUIDU-UHFFFAOYSA-N dichloromethoxyethane Chemical compound CCOC(Cl)Cl MJNJTZVLAVUIDU-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000002934 diuretic Substances 0.000 description 1
- 230000001882 diuretic effect Effects 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 239000003792 electrolyte Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- GLMDDCOEFPGRFI-UHFFFAOYSA-N ethyl 5-formyl-6,7-dimethyl-2,3-dihydro-1-benzofuran-2-carboxylate Chemical compound C(C)OC(=O)C1OC2=C(C1)C=C(C(=C2C)C)C=O GLMDDCOEFPGRFI-UHFFFAOYSA-N 0.000 description 1
- BGSJEKNSGJCJLT-UHFFFAOYSA-N ethyl 6,7-dimethyl-5-(2-nitroprop-1-enyl)-2,3-dihydro-1-benzofuran-2-carboxylate Chemical compound C(C)OC(=O)C1OC2=C(C1)C=C(C(=C2C)C)C=C(C)[N+](=O)[O-] BGSJEKNSGJCJLT-UHFFFAOYSA-N 0.000 description 1
- XRXCUQXNVFDAOD-UHFFFAOYSA-N ethyl 6-chloro-5-formyl-2,3-dihydro-1-benzothiophene-2-carboxylate Chemical compound C(C)OC(=O)C1CC2=C(S1)C=C(C(=C2)C=O)Cl XRXCUQXNVFDAOD-UHFFFAOYSA-N 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 230000029142 excretion Effects 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 150000002440 hydroxy compounds Chemical class 0.000 description 1
- 239000004922 lacquer Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000000894 saliuretic effect Effects 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical compound CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 description 1
- ZLGIYFNHBLSMPS-ATJNOEHPSA-N shellac Chemical compound OCCCCCC(O)C(O)CCCCCCCC(O)=O.C1C23[C@H](C(O)=O)CCC2[C@](C)(CO)[C@@H]1C(C(O)=O)=C[C@@H]3O ZLGIYFNHBLSMPS-ATJNOEHPSA-N 0.000 description 1
- 239000004208 shellac Substances 0.000 description 1
- 229940113147 shellac Drugs 0.000 description 1
- 235000013874 shellac Nutrition 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- HRZFUMHJMZEROT-UHFFFAOYSA-L sodium disulfite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])(=O)=O HRZFUMHJMZEROT-UHFFFAOYSA-L 0.000 description 1
- 239000004296 sodium metabisulphite Substances 0.000 description 1
- 235000010262 sodium metabisulphite Nutrition 0.000 description 1
- 239000007901 soft capsule Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/50—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D333/52—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes
- C07D333/54—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
- C07D333/56—Radicals substituted by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/82—Benzo [b] furans; Hydrogenated benzo [b] furans with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to carbon atoms of the hetero ring
- C07D307/84—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
- C07D307/85—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/50—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D333/52—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes
- C07D333/62—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to carbon atoms of the hetero ring
- C07D333/68—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
- C07D333/70—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 2
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1727369A CH523236A (de) | 1969-11-20 | 1969-11-20 | Verfahren zur Herstellung von neuen heterocyclischen Carbonsäuren |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL35693A0 IL35693A0 (en) | 1971-01-28 |
| IL35693A true IL35693A (en) | 1973-06-29 |
Family
ID=4424112
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL35693A IL35693A (en) | 1969-11-20 | 1970-11-19 | Benzofuran and benzothiophen carboxylic acids,their production and pharmaceutical compositions containing them |
Country Status (15)
| Country | Link |
|---|---|
| AT (2) | AT299937B (de) |
| BE (1) | BE759138A (de) |
| BG (1) | BG18182A3 (de) |
| CA (1) | CA963016A (de) |
| CH (2) | CH523236A (de) |
| DE (1) | DE2056935A1 (de) |
| DK (1) | DK126038B (de) |
| ES (2) | ES385701A1 (de) |
| FR (1) | FR2073396B1 (de) |
| GB (1) | GB1312470A (de) |
| IL (1) | IL35693A (de) |
| NL (1) | NL7016683A (de) |
| SE (1) | SE375531B (de) |
| SU (1) | SU366609A3 (de) |
| ZA (1) | ZA707819B (de) |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH510007A (de) * | 1968-05-30 | 1971-07-15 | Ciba Geigy Ag | Verfahren zur Herstellung von neuen heterocyclischen Carbonsäuren |
-
0
- BE BE759138D patent/BE759138A/xx unknown
-
1969
- 1969-11-20 CH CH1727369A patent/CH523236A/de not_active IP Right Cessation
- 1969-11-20 CH CH644672A patent/CH523237A/de not_active IP Right Cessation
-
1970
- 1970-11-13 NL NL7016683A patent/NL7016683A/xx unknown
- 1970-11-13 DK DK576570AA patent/DK126038B/da unknown
- 1970-11-13 SE SE7015345A patent/SE375531B/xx unknown
- 1970-11-19 GB GB5494670A patent/GB1312470A/en not_active Expired
- 1970-11-19 BG BG016099A patent/BG18182A3/xx unknown
- 1970-11-19 FR FR707041566A patent/FR2073396B1/fr not_active Expired
- 1970-11-19 ZA ZA707819A patent/ZA707819B/xx unknown
- 1970-11-19 AT AT1042970A patent/AT299937B/de not_active IP Right Cessation
- 1970-11-19 AT AT726471A patent/AT305275B/de not_active IP Right Cessation
- 1970-11-19 IL IL35693A patent/IL35693A/en unknown
- 1970-11-19 DE DE19702056935 patent/DE2056935A1/de active Pending
- 1970-11-19 ES ES385701A patent/ES385701A1/es not_active Expired
- 1970-11-19 SU SU1494507A patent/SU366609A3/ru active
- 1970-11-19 ES ES385702A patent/ES385702A1/es not_active Expired
- 1970-11-19 CA CA098,563A patent/CA963016A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| AT305275B (de) | 1973-02-26 |
| ZA707819B (en) | 1971-08-25 |
| AT299937B (de) | 1972-07-10 |
| DE2056935A1 (de) | 1971-05-27 |
| CH523236A (de) | 1972-05-31 |
| GB1312470A (en) | 1973-04-04 |
| IL35693A0 (en) | 1971-01-28 |
| NL7016683A (de) | 1971-05-24 |
| BG18182A3 (bg) | 1974-09-02 |
| BE759138A (fr) | 1971-05-19 |
| ES385702A1 (es) | 1973-04-01 |
| DK126038B (da) | 1973-06-04 |
| CA963016A (en) | 1975-02-18 |
| ES385701A1 (es) | 1973-10-01 |
| CH523237A (de) | 1972-05-31 |
| SE375531B (de) | 1975-04-21 |
| SU366609A3 (de) | 1973-01-16 |
| FR2073396A1 (de) | 1971-10-01 |
| FR2073396B1 (de) | 1974-02-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HK22484A (en) | Enzyme inhibitory phthalazin-4-ylacetic acid derivatives, pharmaceutical compositions thereof, and process for their manufacture | |
| US3751430A (en) | 5-acyl-2,3-dihydrobenzothiophene-2-carboxylic acids | |
| US3705907A (en) | 4-(2-hydroxy)-3-aminopropoxy)-indole derivatives | |
| PL119501B1 (en) | Process for manufacturing novel,condensed pyrimidine derivatives pirimidina | |
| EP0199393B1 (de) | Inden- und Naphthalinderivate | |
| US4247706A (en) | Dibenzothiepin derivatives and a process for producing the same | |
| US4168380A (en) | 7-Methoxy-5-oxo-5H-thiazolo[2,3-b]quinazoline-2-carboxylic acid | |
| US3580931A (en) | 5-(2-methylenealkanoyl)-benzofuran 7-carboxylic acids | |
| US4282360A (en) | 7-Methylthio or methylsulfinyl-5-oxo-5H-thiazolo[2,3-b]quinazoline-2-carboxylic acid | |
| US3843797A (en) | Saluretic and diuretic compositions and method with 2,3-dihydro-5-(2-nitro-1-alkenylbenzofuran-2-carboxylic acids and pharmaceutically acceptable salts | |
| SE447382B (sv) | 2-bensyliden-bensofuran-3(2h)-on-derivat samt forfarande for deras framstellning | |
| US3674810A (en) | 4-chloro-5-(2-methylene-butyryl)-benzo(6)thiophene-2-carboxylic acids | |
| IL35693A (en) | Benzofuran and benzothiophen carboxylic acids,their production and pharmaceutical compositions containing them | |
| US3873538A (en) | Amino-9,10-dihydro-9,10-dioxo-2-anthroic acids | |
| US3891644A (en) | 10,10-Disubstituted-2,3,4,10-tetrahydro-and 1,2,3,4,10a-hexahydropyrimidol {8 1,2-a{9 indole derivatives | |
| US3523124A (en) | Antidepressant amino-alkyl-substituted phthalanes,compositions and method of treating | |
| US3726904A (en) | 2,3-dihydro-5-(2-nitro-1-alkenyl)-benzofuran-2-carboxylic acid and pharmaceutically acceptable salts | |
| US3929833A (en) | Organic compounds | |
| US3709909A (en) | Derivatives of 2,3-dihydro-benzothiophene and benzofuran-2-carboxylic acids | |
| US3627785A (en) | Benzofuran-2-carboxylic acids | |
| US3682961A (en) | 4-chloro-5-(2-methylene-butryl)-indole carboxylic acid | |
| IL30444A (en) | Aminoacyl-benzofuran carboxylic acids,their preparation and pharmaceutical compositions containing them | |
| US3573290A (en) | Substituted cinnamic acids | |
| US3985731A (en) | 2H-2-benzazepin-1,3-diones | |
| IL32311A (en) | Benzofuran and thianaphthene carboxylic acids,their preparation and pharmaceutical compositions containing them |