IL35623A - 4-butyl-2,6-dinitroaniline derivative and its use as herbicide - Google Patents
4-butyl-2,6-dinitroaniline derivative and its use as herbicideInfo
- Publication number
- IL35623A IL35623A IL35623A IL3562370A IL35623A IL 35623 A IL35623 A IL 35623A IL 35623 A IL35623 A IL 35623A IL 3562370 A IL3562370 A IL 3562370A IL 35623 A IL35623 A IL 35623A
- Authority
- IL
- Israel
- Prior art keywords
- herbicide
- butyl
- dinitroaniline derivative
- dinitroaniline
- derivative
- Prior art date
Links
- XPZLLPFKCUQXFB-UHFFFAOYSA-N 4-butyl-2,6-dinitroaniline Chemical class CCCCC1=CC([N+]([O-])=O)=C(N)C([N+]([O-])=O)=C1 XPZLLPFKCUQXFB-UHFFFAOYSA-N 0.000 title 1
- 230000002363 herbicidal effect Effects 0.000 title 1
- 239000004009 herbicide Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/07—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by halogen atoms
- C07C205/11—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by halogen atoms having nitro groups bound to carbon atoms of six-membered aromatic rings
- C07C205/12—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by halogen atoms having nitro groups bound to carbon atoms of six-membered aromatic rings the six-membered aromatic ring or a condensed ring system containing that ring being substituted by halogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/13—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by hydroxy groups
- C07C205/20—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by hydroxy groups having nitro groups and hydroxy groups bound to carbon atoms of six-membered aromatic rings
- C07C205/21—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by hydroxy groups having nitro groups and hydroxy groups bound to carbon atoms of six-membered aromatic rings having nitro groups and hydroxy groups bound to carbon atoms of the same non-condensed six-membered aromatic ring
- C07C205/23—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by hydroxy groups having nitro groups and hydroxy groups bound to carbon atoms of six-membered aromatic rings having nitro groups and hydroxy groups bound to carbon atoms of the same non-condensed six-membered aromatic ring having two nitro groups bound to the ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US87858369A | 1969-11-20 | 1969-11-20 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL35623A0 IL35623A0 (en) | 1971-01-28 |
| IL35623A true IL35623A (en) | 1973-11-28 |
Family
ID=25372327
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL35623A IL35623A (en) | 1969-11-20 | 1970-11-11 | 4-butyl-2,6-dinitroaniline derivative and its use as herbicide |
Country Status (11)
| Country | Link |
|---|---|
| JP (1) | JPS5114571B1 (de) |
| BR (1) | BR7024045D0 (de) |
| CA (1) | CA976567A (de) |
| CH (1) | CH553538A (de) |
| ES (1) | ES389679A1 (de) |
| FR (1) | FR2069755A5 (de) |
| GB (1) | GB1319306A (de) |
| IL (1) | IL35623A (de) |
| NL (1) | NL152847B (de) |
| SE (1) | SE373360B (de) |
| ZA (1) | ZA707617B (de) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA1336863C (en) * | 1988-05-25 | 1995-09-05 | Gottfried Lichti | Controlled release composition |
| FR2765576B1 (fr) * | 1997-07-02 | 1999-12-31 | Francais Prod Ind Cfpi | Procede de preparation des dinitroanilines 4-substituees |
| FR2761685B1 (fr) * | 1997-04-07 | 1999-06-11 | Francais Prod Ind Cfpi | Procede de preparation des dinitroanilines 4-substituees |
| EP0870755A1 (de) * | 1997-04-07 | 1998-10-14 | Cfpi Agro | Verfahren zur Herstellung von 4-substituierten Nitroanilinen |
-
1970
- 1970-11-10 ZA ZA707617A patent/ZA707617B/xx unknown
- 1970-11-11 IL IL35623A patent/IL35623A/xx unknown
- 1970-11-17 GB GB5465970A patent/GB1319306A/en not_active Expired
- 1970-11-17 CA CA098,356A patent/CA976567A/en not_active Expired
- 1970-11-19 NL NL707016949A patent/NL152847B/xx not_active IP Right Cessation
- 1970-11-20 CH CH1724170A patent/CH553538A/de not_active IP Right Cessation
- 1970-11-20 SE SE7015774A patent/SE373360B/xx unknown
- 1970-11-20 BR BR224045/70A patent/BR7024045D0/pt unknown
- 1970-11-20 JP JP45102625A patent/JPS5114571B1/ja active Pending
- 1970-11-20 FR FR7041719A patent/FR2069755A5/fr not_active Expired
-
1971
- 1971-03-29 ES ES389679A patent/ES389679A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| NL7016949A (de) | 1971-05-24 |
| ES389679A1 (es) | 1974-03-01 |
| SE373360B (sv) | 1975-02-03 |
| CH553538A (de) | 1974-09-13 |
| GB1319306A (en) | 1973-06-06 |
| NL152847B (nl) | 1977-04-15 |
| ZA707617B (en) | 1971-08-25 |
| DE2058201A1 (de) | 1971-05-27 |
| BR7024045D0 (pt) | 1973-06-26 |
| DE2058201B2 (de) | 1976-01-22 |
| CA976567A (en) | 1975-10-21 |
| FR2069755A5 (de) | 1971-09-03 |
| IL35623A0 (en) | 1971-01-28 |
| JPS5114571B1 (de) | 1976-05-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL34616A0 (en) | N-acetonyl-benzamide derivatives,their preparation and use as pesticides | |
| ZA702683B (en) | Substituted anilides,their preparation and use as pesticides | |
| IL35441A0 (en) | Ureidophenylguanidines,their preparation and their use as fungicides | |
| IL35271A0 (en) | 1,1,1-trichloro-ethane derivatives,their preparation and their use as pesticides | |
| IL37193A0 (en) | N,n-dialkylamidoxime derivatives and their use as herbicides | |
| IL32404A0 (en) | N-hydroxy-benzimidazoles,their preparation and use as herbicides | |
| IL36462A (en) | 2-benzothiazolylurea derivatives and their use as herbicides | |
| IL32354A0 (en) | Alkoxycarbonylthioureidobenzenes,their preparation and use as fungicides | |
| IL33730A0 (en) | Substituted anilides,their preparation and use as herbicides | |
| IL35623A0 (en) | Novel 4-butyl-2,6-dinitroaniline derivatives and their use as herbicides | |
| IL34156A0 (en) | Substituted benzamides,their preparation and their use as herbicides | |
| IL31416A0 (en) | 5-imino-2-oxo-imidazolidines,their preparation and use as herbicides | |
| IL32092A0 (en) | Trifluoromethylamilides,their manufacture and use as pesticides | |
| IL37530A0 (en) | New 2-alkylthio-4,6-diamino-s-triazine derivatives,their preparation and their use as herbicides | |
| IL34862A0 (en) | Benzthiadiazole-2,1,3 derivatives,their preparation and their use as fungicides | |
| IL36103A0 (en) | Substituted 6-nitroaniline derivatives,their preparation,and their use as herbicides | |
| IL37121A0 (en) | 1-carbamoyl-n-carbamoyloxy formimidates and their derivatives,their preparation and their use as pesticides | |
| IL32684A0 (en) | New basically substituted 1-cyano-o-carbamoyl-formoximes,their preparation and use as pesticides | |
| IL38159A0 (en) | New aryloxyacetylenes and their use as insecticides and herbicides | |
| MTP624B (en) | Novel substituted acylates and propinates,and their use as pesticides | |
| IL37619A0 (en) | Imidazoisoquinolinediones,their preparation and their use as herbicides | |
| IL32236A0 (en) | 2-phenylimino-pyrrolidines,their preparation and use as pesticides | |
| IL35921A0 (en) | New s-alkyl-n,n-dialkylthiocarbamates and their use as herbicides | |
| IL33830A0 (en) | Benzene derivatives,their production and their use as pesticides | |
| IL34003A0 (en) | 1,3-dithiolanyl-oximidocarbamates,their preparation and use as pesticides |