IL35590A - Oraidophenyl compounds Theorea, process for their production and use as fungicides - Google Patents
Oraidophenyl compounds Theorea, process for their production and use as fungicidesInfo
- Publication number
- IL35590A IL35590A IL7035590A IL3559070A IL35590A IL 35590 A IL35590 A IL 35590A IL 7035590 A IL7035590 A IL 7035590A IL 3559070 A IL3559070 A IL 3559070A IL 35590 A IL35590 A IL 35590A
- Authority
- IL
- Israel
- Prior art keywords
- formula
- plants
- urea
- parts
- stated
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 13
- 238000002360 preparation method Methods 0.000 title description 4
- 239000000417 fungicide Substances 0.000 title description 3
- -1 Ureidophenyl thioureas Chemical class 0.000 claims description 11
- 239000003085 diluting agent Substances 0.000 claims description 10
- 239000004202 carbamide Substances 0.000 claims description 7
- 238000006243 chemical reaction Methods 0.000 claims description 7
- 150000002540 isothiocyanates Chemical class 0.000 claims description 7
- BTNSLPQCLXHERR-UHFFFAOYSA-N (2-aminophenyl)urea Chemical class NC(=O)NC1=CC=CC=C1N BTNSLPQCLXHERR-UHFFFAOYSA-N 0.000 claims description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 2
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 2
- 125000006232 ethoxy propyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 2
- 239000012442 inert solvent Substances 0.000 claims description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 235000013877 carbamide Nutrition 0.000 claims 8
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims 6
- 150000003672 ureas Chemical class 0.000 claims 2
- 239000000376 reactant Substances 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 description 59
- 241000196324 Embryophyta Species 0.000 description 36
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 27
- 241000233866 Fungi Species 0.000 description 19
- 239000007788 liquid Substances 0.000 description 18
- 239000002904 solvent Substances 0.000 description 18
- 208000015181 infectious disease Diseases 0.000 description 15
- 239000002689 soil Substances 0.000 description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 13
- 241000220225 Malus Species 0.000 description 9
- 239000012141 concentrate Substances 0.000 description 8
- 238000011081 inoculation Methods 0.000 description 8
- 235000015097 nutrients Nutrition 0.000 description 8
- 239000007921 spray Substances 0.000 description 8
- 239000000758 substrate Substances 0.000 description 8
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 7
- 206010061217 Infestation Diseases 0.000 description 6
- 238000007792 addition Methods 0.000 description 6
- 125000002877 alkyl aryl group Chemical group 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- 240000008067 Cucumis sativus Species 0.000 description 5
- 229910052799 carbon Inorganic materials 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- 239000003995 emulsifying agent Substances 0.000 description 5
- 230000012010 growth Effects 0.000 description 5
- 230000009885 systemic effect Effects 0.000 description 5
- 241000221787 Erysiphe Species 0.000 description 4
- 241000489964 Fusicladium Species 0.000 description 4
- DQYBDCGIPTYXML-UHFFFAOYSA-N ethoxyethane;hydrate Chemical compound O.CCOCC DQYBDCGIPTYXML-UHFFFAOYSA-N 0.000 description 4
- 230000000855 fungicidal effect Effects 0.000 description 4
- 229920000151 polyglycol Polymers 0.000 description 4
- 239000010695 polyglycol Substances 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- 229920001817 Agar Polymers 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 240000007594 Oryza sativa Species 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- 241001617088 Thanatephorus sasakii Species 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 235000010419 agar Nutrition 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 201000010099 disease Diseases 0.000 description 3
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 3
- 239000002270 dispersing agent Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 238000011156 evaluation Methods 0.000 description 3
- 230000035784 germination Effects 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 230000017066 negative regulation of growth Effects 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- LUBJCRLGQSPQNN-UHFFFAOYSA-N 1-Phenylurea Chemical compound NC(=O)NC1=CC=CC=C1 LUBJCRLGQSPQNN-UHFFFAOYSA-N 0.000 description 2
- SYBYTAAJFKOIEJ-UHFFFAOYSA-N 3-Methylbutan-2-one Chemical compound CC(C)C(C)=O SYBYTAAJFKOIEJ-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 241000221785 Erysiphales Species 0.000 description 2
- 239000004606 Fillers/Extenders Substances 0.000 description 2
- 241000896246 Golovinomyces cichoracearum Species 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 235000007164 Oryza sativa Nutrition 0.000 description 2
- 241000896242 Podosphaera Species 0.000 description 2
- 241001337928 Podosphaera leucotricha Species 0.000 description 2
- 206010039509 Scab Diseases 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 241000209140 Triticum Species 0.000 description 2
- 235000021307 Triticum Nutrition 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 239000008272 agar Substances 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 230000002464 fungitoxic effect Effects 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 230000001681 protective effect Effects 0.000 description 2
- 235000009566 rice Nutrition 0.000 description 2
- 241000894007 species Species 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000013589 supplement Substances 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- BTABFAODYCXJLG-UHFFFAOYSA-N 1-(2-aminophenyl)-3-(dimethylamino)urea Chemical compound CN(C)NC(=O)NC1=C(N)C=CC=C1 BTABFAODYCXJLG-UHFFFAOYSA-N 0.000 description 1
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 1
- GOJUJUVQIVIZAV-UHFFFAOYSA-N 2-amino-4,6-dichloropyrimidine-5-carbaldehyde Chemical group NC1=NC(Cl)=C(C=O)C(Cl)=N1 GOJUJUVQIVIZAV-UHFFFAOYSA-N 0.000 description 1
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 1
- 241000223600 Alternaria Species 0.000 description 1
- 241000235349 Ascomycota Species 0.000 description 1
- 241000221198 Basidiomycota Species 0.000 description 1
- 241000123650 Botrytis cinerea Species 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 241000228437 Cochliobolus Species 0.000 description 1
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 1
- 241001480059 Erysiphaceae Species 0.000 description 1
- 241000510928 Erysiphe necator Species 0.000 description 1
- PWNAWOCHVWERAR-UHFFFAOYSA-N Flumetralin Chemical compound [O-][N+](=O)C=1C=C(C(F)(F)F)C=C([N+]([O-])=O)C=1N(CC)CC1=C(F)C=CC=C1Cl PWNAWOCHVWERAR-UHFFFAOYSA-N 0.000 description 1
- 206010017533 Fungal infection Diseases 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 241000206672 Gelidium Species 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 208000031888 Mycoses Diseases 0.000 description 1
- GXCLVBGFBYZDAG-UHFFFAOYSA-N N-[2-(1H-indol-3-yl)ethyl]-N-methylprop-2-en-1-amine Chemical compound CN(CCC1=CNC2=C1C=CC=C2)CC=C GXCLVBGFBYZDAG-UHFFFAOYSA-N 0.000 description 1
- 241001329956 Nothopassalora personata Species 0.000 description 1
- 241000896238 Oidium Species 0.000 description 1
- 241000308483 Phialophora cinerescens Species 0.000 description 1
- 241000514450 Podocarpus latifolius Species 0.000 description 1
- 241000184297 Pseudocercospora musae Species 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- 101100388838 Schizosaccharomyces pombe (strain 972 / ATCC 24843) see1 gene Proteins 0.000 description 1
- BCKXLBQYZLBQEK-KVVVOXFISA-M Sodium oleate Chemical compound [Na+].CCCCCCCC\C=C/CCCCCCCC([O-])=O BCKXLBQYZLBQEK-KVVVOXFISA-M 0.000 description 1
- 241000579741 Sphaerotheca <fungi> Species 0.000 description 1
- 241000722093 Tilletia caries Species 0.000 description 1
- 241000031845 Tilletia laevis Species 0.000 description 1
- 241000510929 Uncinula Species 0.000 description 1
- 241000228452 Venturia inaequalis Species 0.000 description 1
- 241000589652 Xanthomonas oryzae Species 0.000 description 1
- 230000000895 acaricidal effect Effects 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 235000021016 apples Nutrition 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- XMQFTWRPUQYINF-UHFFFAOYSA-N bensulfuron-methyl Chemical compound COC(=O)C1=CC=CC=C1CS(=O)(=O)NC(=O)NC1=NC(OC)=CC(OC)=N1 XMQFTWRPUQYINF-UHFFFAOYSA-N 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 150000008422 chlorobenzenes Chemical class 0.000 description 1
- 239000002361 compost Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- 235000021186 dishes Nutrition 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 239000012990 dithiocarbamate Substances 0.000 description 1
- 150000004659 dithiocarbamates Chemical class 0.000 description 1
- 239000004495 emulsifiable concentrate Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- BDTDECDAHYOJRO-UHFFFAOYSA-N ethyl n-(sulfanylidenemethylidene)carbamate Chemical compound CCOC(=O)N=C=S BDTDECDAHYOJRO-UHFFFAOYSA-N 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 208000024386 fungal infectious disease Diseases 0.000 description 1
- 231100000162 fungitoxic Toxicity 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 230000000749 insecticidal effect Effects 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 150000004987 o-phenylenediamines Chemical class 0.000 description 1
- 230000003071 parasitic effect Effects 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 230000001717 pathogenic effect Effects 0.000 description 1
- KRIOVPPHQSLHCZ-UHFFFAOYSA-N phenyl propionaldehyde Natural products CCC(=O)C1=CC=CC=C1 KRIOVPPHQSLHCZ-UHFFFAOYSA-N 0.000 description 1
- 230000008635 plant growth Effects 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- HXDMRUHZGHWXOI-UHFFFAOYSA-N propyl n-(sulfanylidenemethylidene)carbamate Chemical compound CCCOC(=O)N=C=S HXDMRUHZGHWXOI-UHFFFAOYSA-N 0.000 description 1
- 239000011814 protection agent Substances 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 238000009331 sowing Methods 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 238000000967 suction filtration Methods 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C335/00—Thioureas, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C335/04—Derivatives of thiourea
- C07C335/24—Derivatives of thiourea containing any of the groups, X being a hetero atom, Y being any atom
- C07C335/28—Y being a hetero atom, e.g. thiobiuret
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Production Of Liquid Hydrocarbon Mixture For Refining Petroleum (AREA)
- Lubricants (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19691960029 DE1960029A1 (de) | 1969-11-29 | 1969-11-29 | Ureidophenylthioharnstoffe,Verfahren zu ihrer Herstellung und ihre fungizide Verwendung |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL35590A0 IL35590A0 (en) | 1971-01-28 |
| IL35590A true IL35590A (en) | 1973-08-29 |
Family
ID=5752484
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL7035590A IL35590A (en) | 1969-11-29 | 1970-11-04 | Oraidophenyl compounds Theorea, process for their production and use as fungicides |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3780089A (cg-RX-API-DMAC10.html) |
| JP (2) | JPS491529B1 (cg-RX-API-DMAC10.html) |
| BE (1) | BE759474A (cg-RX-API-DMAC10.html) |
| DE (1) | DE1960029A1 (cg-RX-API-DMAC10.html) |
| ES (1) | ES385986A1 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2072578A5 (cg-RX-API-DMAC10.html) |
| GB (1) | GB1312493A (cg-RX-API-DMAC10.html) |
| IL (1) | IL35590A (cg-RX-API-DMAC10.html) |
| NL (1) | NL7017248A (cg-RX-API-DMAC10.html) |
| TR (1) | TR16621A (cg-RX-API-DMAC10.html) |
| ZA (1) | ZA707561B (cg-RX-API-DMAC10.html) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3914284A (en) * | 1969-11-29 | 1975-10-21 | Bayer Ag | Substituted ureidophenyl thioureas |
| US3920831A (en) * | 1969-11-29 | 1975-11-18 | Bayer Ag | Fungicidal substituted ureidophenyl thioureas |
| US4072696A (en) * | 1973-02-12 | 1978-02-07 | Syntex (U.S.A.) Inc. | 5(6)-Benzene ring substituted benzimidazole-2-carbamate derivatives having anthelmintic activity |
| US4259350A (en) * | 1978-03-15 | 1981-03-31 | Sankyo Company Limited | Iodopropargyl derivatives, their use and preparation |
| JPS55122113U (cg-RX-API-DMAC10.html) * | 1979-02-22 | 1980-08-30 | ||
| US4505717A (en) * | 1984-06-25 | 1985-03-19 | Texaco Inc. | Corrosion inhibited motor fuel |
| US4504278A (en) * | 1984-06-27 | 1985-03-12 | Texaco Inc. | Corrosion inhibited motor fuel |
| USRE32786E (en) * | 1984-08-17 | 1988-11-22 | American Cyanamid Company | Neutral hydrocarboxycarbonyl thiourea sulfide collectors |
| US4556482A (en) * | 1984-08-17 | 1985-12-03 | American Cyanamid Company | Process for the flotation of base metal sulfide minerals in acid, neutral or mildly alkaline circuits |
| US4556483A (en) * | 1984-08-17 | 1985-12-03 | American Cyanamid Company | Neutral hydrocarboxycarbonyl thiourea sulfide collectors |
-
0
- BE BE759474D patent/BE759474A/xx unknown
-
1969
- 1969-11-29 DE DE19691960029 patent/DE1960029A1/de active Pending
-
1970
- 1970-11-04 IL IL7035590A patent/IL35590A/en unknown
- 1970-11-09 ZA ZA707561A patent/ZA707561B/xx unknown
- 1970-11-12 TR TR16621A patent/TR16621A/xx unknown
- 1970-11-13 US US00089500A patent/US3780089A/en not_active Expired - Lifetime
- 1970-11-24 GB GB5582970A patent/GB1312493A/en not_active Expired
- 1970-11-25 NL NL7017248A patent/NL7017248A/xx unknown
- 1970-11-27 FR FR7042840A patent/FR2072578A5/fr not_active Expired
- 1970-11-28 JP JP45104712A patent/JPS491529B1/ja active Pending
- 1970-11-28 ES ES385986A patent/ES385986A1/es not_active Expired
- 1970-11-28 JP JP45104711A patent/JPS4946300B1/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| BE759474A (cg-RX-API-DMAC10.html) | 1971-05-26 |
| FR2072578A5 (cg-RX-API-DMAC10.html) | 1971-09-24 |
| DE1960029A1 (de) | 1971-06-03 |
| ES385986A1 (es) | 1974-01-01 |
| ZA707561B (en) | 1971-08-25 |
| TR16621A (tr) | 1973-01-01 |
| IL35590A0 (en) | 1971-01-28 |
| JPS4946300B1 (cg-RX-API-DMAC10.html) | 1974-12-09 |
| JPS491529B1 (cg-RX-API-DMAC10.html) | 1974-01-14 |
| US3780089A (en) | 1973-12-18 |
| GB1312493A (en) | 1973-04-04 |
| NL7017248A (cg-RX-API-DMAC10.html) | 1971-06-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4518600A (en) | Combating fungi with 1-phenoxy-2-pyrimidinyl alkanols | |
| DE2638470A1 (de) | Imidazole und 1,2,4-triazole, verfahren zur herstellung derselben, solche verbindungen enthaltende zusammensetzungen zur bekaempfung von schaedlingen und verfahren zur bekaempfung von schaedlingen | |
| EP0092158A2 (en) | Thiazolidine compound and fungicidal composition containing it | |
| US4239760A (en) | Combating fungi and bacteria with 3-azolyl-benzo-1,2,4-triazines and 1-oxides thereof | |
| US4174398A (en) | Combating fungi with 1-alkyl-1-(1,3,4-thiadiazol-2-yl)-3-phenyl-ureas | |
| IL35590A (en) | Oraidophenyl compounds Theorea, process for their production and use as fungicides | |
| US3828094A (en) | Substituted ureidophenylguanidines | |
| US3856811A (en) | 2-aminobenzimidazole-1-carboxylic acid ketone oxime esters | |
| US4366152A (en) | Combatting fungi with metal salt complexes of 1-phenyl-2-(1,2,4-triazol-1-yl)-ethanes | |
| US3673210A (en) | N-({107 -cyano-alkyl)-carbamyl-benzimidazoles | |
| HU176746B (en) | Fungicide compositions comtaining 1-bracket-2-halogeno-2-phenyl-ethyl-bracket closed-triasole derivatives as active agents and process for producing the active agents | |
| IL35440A (en) | Amidophenylguanidines, their production and use as fungicides | |
| GB2038326A (en) | Acylaniline derivatives | |
| US3832466A (en) | 3-azolylpropyne fungicidal agents | |
| US3843715A (en) | Amidophenylisothioureas | |
| US4134988A (en) | 2-acyloxy-1-phenoxy-1-imidazolyl-(1)-3,3-dimethyl-butanes | |
| US3723628A (en) | (n-trihalomethylthio-n-trifluoromethyl-amino)-benzamides as fungicidal agents | |
| US3711503A (en) | Substituted carbonyl-carbamidyl-benzimidazole-2-yl-carbamic acid esters | |
| JPS599553B2 (ja) | 新規ハロゲントリアゾ−ル誘導体の製法 | |
| US3763219A (en) | 1-(2'-cyclohexylideniminophenyl)-3-alkoxycarbonyl-2-thioureas | |
| CA1046059A (en) | Process for the preparation of 4,5-bis-trifluoro-methylimino derivatives of sulphur-free heterocyclic five-membered rings with two ring hetero atoms | |
| US4073901A (en) | Metal complexes of N-trityl-azoles for combatting fungi | |
| US3864490A (en) | N-{107 -cyano-alkyl)-carbamyl benzimidazoles used as insecticides, acaricides and ovicides | |
| US4237143A (en) | Combating fungi with 2-methylene-3-substituted-4,5-bis-trifluoro-methyl imino-thiazolidines | |
| JPS61271276A (ja) | ジクロロシクロプロピルアルキル−ヒドロキシアルキル−アゾ−ル誘導体 |