IL34980A - Pleuromutilin derivatives and their preparation - Google Patents
Pleuromutilin derivatives and their preparationInfo
- Publication number
- IL34980A IL34980A IL34980A IL3498070A IL34980A IL 34980 A IL34980 A IL 34980A IL 34980 A IL34980 A IL 34980A IL 3498070 A IL3498070 A IL 3498070A IL 34980 A IL34980 A IL 34980A
- Authority
- IL
- Israel
- Prior art keywords
- preparation
- pleuromutilin derivatives
- pleuromutilin
- derivatives
- Prior art date
Links
- ZRZNJUXESFHSIO-VYTKZBNOSA-N pleuromutilin Chemical class C([C@H]([C@]1(C)[C@@H](C[C@@](C)(C=C)[C@@H](O)[C@@H]2C)OC(=O)CO)C)C[C@]32[C@H]1C(=O)CC3 ZRZNJUXESFHSIO-VYTKZBNOSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C247/00—Compounds containing azido groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D229/00—Heterocyclic compounds containing rings of less than five members having two nitrogen atoms as the only ring hetero atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyridine Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| AT722369A AT301753B (de) | 1969-07-25 | 1969-07-25 | Verfahren zur Herstellung neuer Pleuromutilin-Derivate |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL34980A0 IL34980A0 (en) | 1970-09-17 |
| IL34980A true IL34980A (en) | 1974-09-10 |
Family
ID=3593920
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL34980A IL34980A (en) | 1969-07-25 | 1970-07-23 | Pleuromutilin derivatives and their preparation |
Country Status (13)
| Country | Link |
|---|---|
| JP (2) | JPS5010590B1 (index.php) |
| AT (1) | AT301753B (index.php) |
| CA (1) | CA986102A (index.php) |
| CS (1) | CS172913B2 (index.php) |
| DE (2) | DE2066118C3 (index.php) |
| ES (3) | ES382075A1 (index.php) |
| FR (1) | FR2059559B1 (index.php) |
| GB (1) | GB1312148A (index.php) |
| IL (1) | IL34980A (index.php) |
| NL (1) | NL7010444A (index.php) |
| PL (2) | PL79777B1 (index.php) |
| SE (1) | SE369712B (index.php) |
| ZA (1) | ZA705091B (index.php) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4107164A (en) * | 1971-10-05 | 1978-08-15 | Sandoz Ltd. | Certain pleuromulilin ester derivatives |
| US4208326A (en) * | 1971-10-05 | 1980-06-17 | Sandoz Ltd. | Pleuromutilin esters |
| BE789629A (fr) * | 1971-10-05 | 1973-04-03 | Sandoz Sa | Nouveaux derives de la pleuromutiline, leur preparation et leurapplication en therapeutique |
| EP0013768B1 (en) * | 1979-01-12 | 1984-02-01 | Sandoz Ag | New pleuromutilin derivatives, their production and pharmaceutical compositions containing them |
| GB0017031D0 (en) * | 2000-07-11 | 2000-08-30 | Biochemie Gmbh | Antimicrobials |
| GB0308114D0 (en) * | 2003-04-08 | 2003-05-14 | Glaxo Group Ltd | Novel compounds |
| EP2014645A1 (en) * | 2007-07-13 | 2009-01-14 | Nabriva Therapeutics AG | Pleuromutilin derivatives and their use as antimicrobials |
| EP2014640A1 (en) | 2007-07-13 | 2009-01-14 | Nabriva Therapeutics AG | Pleuromutilin derivatives |
| WO2021219399A1 (en) * | 2020-04-28 | 2021-11-04 | Nabriva Therapeutics GmbH | Novel 12-epi-mutilin compounds, process for preparing the same and uses thereof |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AT261804B (de) * | 1964-04-17 | 1968-05-10 | Biochemie Gmbh | Verfahren zur Herstellung von neuen wasserlöslichen, antibiotisch wirksamen Verbindungen |
-
1969
- 1969-07-25 AT AT722369A patent/AT301753B/de not_active IP Right Cessation
-
1970
- 1970-07-10 GB GB3350470A patent/GB1312148A/en not_active Expired
- 1970-07-15 NL NL7010444A patent/NL7010444A/xx not_active Application Discontinuation
- 1970-07-21 DE DE2066118A patent/DE2066118C3/de not_active Expired
- 1970-07-21 DE DE2036027A patent/DE2036027C3/de not_active Expired
- 1970-07-23 JP JP45064009A patent/JPS5010590B1/ja active Pending
- 1970-07-23 PL PL1970142234A patent/PL79777B1/pl unknown
- 1970-07-23 CA CA088,942A patent/CA986102A/en not_active Expired
- 1970-07-23 IL IL34980A patent/IL34980A/xx unknown
- 1970-07-23 FR FR707027253A patent/FR2059559B1/fr not_active Expired
- 1970-07-23 SE SE10173/70A patent/SE369712B/xx unknown
- 1970-07-23 ES ES382075A patent/ES382075A1/es not_active Expired
- 1970-07-23 PL PL1970172425A patent/PL88867B1/pl unknown
- 1970-07-24 ZA ZA705091A patent/ZA705091B/xx unknown
- 1970-07-24 CS CS5251A patent/CS172913B2/cs unknown
-
1971
- 1971-02-25 ES ES388614A patent/ES388614A1/es not_active Expired
- 1971-02-25 ES ES388613A patent/ES388613A1/es not_active Expired
-
1974
- 1974-01-11 JP JP49006084A patent/JPS5010857B1/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| CA986102A (en) | 1976-03-23 |
| SE369712B (index.php) | 1974-09-16 |
| PL88867B1 (index.php) | 1976-10-30 |
| JPS5010590B1 (index.php) | 1975-04-22 |
| ZA705091B (en) | 1972-02-23 |
| FR2059559A1 (index.php) | 1971-06-04 |
| ES382075A1 (es) | 1973-04-01 |
| AT301753B (de) | 1972-09-25 |
| GB1312148A (en) | 1973-04-04 |
| CS172913B2 (index.php) | 1977-01-28 |
| FR2059559B1 (index.php) | 1973-08-10 |
| IL34980A0 (en) | 1970-09-17 |
| ES388614A1 (es) | 1974-02-16 |
| ES388613A1 (es) | 1974-02-16 |
| PL79777B1 (index.php) | 1975-06-30 |
| NL7010444A (index.php) | 1971-01-27 |
| JPS5010857B1 (index.php) | 1975-04-24 |
| DE2066118B1 (de) | 1980-08-28 |
| DE2036027B2 (de) | 1980-10-23 |
| DE2036027A1 (de) | 1971-02-18 |
| DE2036027C3 (de) | 1981-12-17 |
| DE2066118C3 (de) | 1981-07-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL34383A0 (en) | 2-acylimidazoles and their preparation | |
| MY7500161A (en) | Phenoxy-hydroxypropylamines and their preparation | |
| IL35047A0 (en) | New beta-aryl-2-aminoalkoxy-styrenes and their preparation | |
| ZA707150B (en) | Isothioureas and their derivatives | |
| IL34955A0 (en) | Pleuromutilin derivatives and their production | |
| IL34980A0 (en) | Pleuromutilin derivatives and their preparation | |
| IL34453A0 (en) | Benzomorphane derivatives and their manufacture | |
| ZA708410B (en) | New evomonoside derivatives and the preparation thereof | |
| CY731A (en) | Substituted indenylacetic acids and their derivatives | |
| ZA705567B (en) | 7beta-alkyl-19-nortestosterones and derivatives | |
| IL34590A0 (en) | Derivatives of alpha-aminopenicillins and their preparation | |
| ZA708566B (en) | New derivatives of neriifolin and the preparation thereof | |
| IL32080A (en) | Pyrrolylcarbonylnoviosyloxy-coumarin derivatives and their preparation | |
| ZA705448B (en) | Dibenzazepine derivatives and their preparation | |
| IL33812A (en) | 9alpha-fluoro-16-fluoromethylene-prednisolone-21-ester and preparation thereof | |
| IL36085A0 (en) | Benzocycloheptaisoquinoline derivatives and their preparation | |
| IL34084A (en) | N-phosphoryl-,n-phosphonyl-,n-thionophosphoryl-and n-thionophosphonyl-3-methyl-5-hydroxypyrazole derivatives and their preparation | |
| IL34965A0 (en) | 3-amino-4-hydrocarbylthioazetidin-2-one derivatives and their preparation | |
| IL35891A (en) | New thienobenzothiepinopyrrole derivatives and their production | |
| IL37971A (en) | 2-amino-4-thiocyanatobenzothiazoles and their preparation | |
| ZA711467B (en) | Thioxsanthene derivatives and their preparation | |
| IL32329A0 (en) | 6-isocyanatopenicillanic acid derivatives and their preparation | |
| IL33390A0 (en) | P-aminoarylalkanal derivatives and processes for their preparation | |
| IL38281A0 (en) | Substituted butyronitriles and their preparation | |
| IL36728A0 (en) | Substituted pyrrolylmethylamines and their preparation |