IL33942A - 1-phenyl-5-amino-1,2,3-triazole-4-carboxylic acid esters,their preparation and pharmaceutical compositions containing them - Google Patents
1-phenyl-5-amino-1,2,3-triazole-4-carboxylic acid esters,their preparation and pharmaceutical compositions containing themInfo
- Publication number
- IL33942A IL33942A IL33942A IL3394270A IL33942A IL 33942 A IL33942 A IL 33942A IL 33942 A IL33942 A IL 33942A IL 3394270 A IL3394270 A IL 3394270A IL 33942 A IL33942 A IL 33942A
- Authority
- IL
- Israel
- Prior art keywords
- acid ethyl
- ethyl ester
- carboxylic acid
- formula
- triazole
- Prior art date
Links
- 239000008194 pharmaceutical composition Substances 0.000 title claims description 9
- 238000002360 preparation method Methods 0.000 title claims description 4
- RXJQVZQJLCDQOH-UHFFFAOYSA-N 5-amino-1-phenyltriazole-4-carboxylic acid Chemical class NC1=C(C(O)=O)N=NN1C1=CC=CC=C1 RXJQVZQJLCDQOH-UHFFFAOYSA-N 0.000 title 1
- 239000002253 acid Substances 0.000 claims description 25
- 150000001875 compounds Chemical class 0.000 claims description 22
- 125000004494 ethyl ester group Chemical group 0.000 claims description 14
- 238000000034 method Methods 0.000 claims description 7
- 239000000203 mixture Substances 0.000 claims description 7
- 239000000460 chlorine Substances 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 4
- 150000001540 azides Chemical class 0.000 claims description 4
- 238000006088 Dimroth rearrangement reaction Methods 0.000 claims description 3
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 3
- 239000004480 active ingredient Substances 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 3
- 239000003937 drug carrier Substances 0.000 claims description 3
- 150000002148 esters Chemical class 0.000 claims description 3
- 229910052731 fluorine Inorganic materials 0.000 claims description 3
- 239000011737 fluorine Substances 0.000 claims description 3
- 239000007788 liquid Substances 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 3
- 239000007787 solid Substances 0.000 claims description 3
- 125000004429 atom Chemical group 0.000 claims description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims 2
- 239000006187 pill Substances 0.000 claims 2
- 125000001424 substituent group Chemical group 0.000 claims 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims 1
- IWYTVJRNVRDBMC-UHFFFAOYSA-N CCOC(C1=NN=NC1(C1=CC(F)=CC=C1)N)=O Chemical compound CCOC(C1=NN=NC1(C1=CC(F)=CC=C1)N)=O IWYTVJRNVRDBMC-UHFFFAOYSA-N 0.000 claims 1
- 230000001476 alcoholic effect Effects 0.000 claims 1
- 238000009835 boiling Methods 0.000 claims 1
- 239000002775 capsule Substances 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 claims 1
- 239000000839 emulsion Substances 0.000 claims 1
- BTHZSTZVTDQFAB-UHFFFAOYSA-N ethyl 5-amino-1-(4-fluorophenyl)triazole-4-carboxylate Chemical compound NC1=C(C(=O)OCC)N=NN1C1=CC=C(F)C=C1 BTHZSTZVTDQFAB-UHFFFAOYSA-N 0.000 claims 1
- 239000000243 solution Substances 0.000 claims 1
- 239000000829 suppository Substances 0.000 claims 1
- 239000000725 suspension Substances 0.000 claims 1
- 238000002844 melting Methods 0.000 description 14
- 230000008018 melting Effects 0.000 description 14
- 239000013078 crystal Substances 0.000 description 10
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 238000001816 cooling Methods 0.000 description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 5
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- 239000001110 calcium chloride Substances 0.000 description 4
- 229910001628 calcium chloride Inorganic materials 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 4
- 230000000507 anthelmentic effect Effects 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- -1 metafluorophenyl azide Chemical class 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 241000222120 Candida <Saccharomycetales> Species 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241000243653 Tubifex Species 0.000 description 1
- FHKPLLOSJHHKNU-INIZCTEOSA-N [(3S)-3-[8-(1-ethyl-5-methylpyrazol-4-yl)-9-methylpurin-6-yl]oxypyrrolidin-1-yl]-(oxan-4-yl)methanone Chemical compound C(C)N1N=CC(=C1C)C=1N(C2=NC=NC(=C2N=1)O[C@@H]1CN(CC1)C(=O)C1CCOCC1)C FHKPLLOSJHHKNU-INIZCTEOSA-N 0.000 description 1
- 230000001754 anti-pyretic effect Effects 0.000 description 1
- 230000003385 bacteriostatic effect Effects 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 229920001281 polyalkylene Polymers 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 229940042055 systemic antimycotics triazole derivative Drugs 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/04—1,2,3-Triazoles; Hydrogenated 1,2,3-triazoles
- C07D249/06—1,2,3-Triazoles; Hydrogenated 1,2,3-triazoles with aryl radicals directly attached to ring atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/04—1,2,3-Triazoles; Hydrogenated 1,2,3-triazoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HUEE001628 | 1969-02-26 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL33942A0 IL33942A0 (en) | 1970-04-20 |
| IL33942A true IL33942A (en) | 1973-07-30 |
Family
ID=10995291
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL33942A IL33942A (en) | 1969-02-26 | 1970-02-23 | 1-phenyl-5-amino-1,2,3-triazole-4-carboxylic acid esters,their preparation and pharmaceutical compositions containing them |
Country Status (9)
| Country | Link |
|---|---|
| AT (1) | AT296295B (de) |
| DE (1) | DE2009134A1 (de) |
| DK (1) | DK128497B (de) |
| FR (1) | FR2034567B1 (de) |
| GB (1) | GB1296911A (de) |
| IL (1) | IL33942A (de) |
| NL (1) | NL143928B (de) |
| SE (1) | SE359547B (de) |
| YU (1) | YU33275B (de) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3134842A1 (de) * | 1981-09-03 | 1983-03-17 | Boehringer Ingelheim KG, 6507 Ingelheim | Neue anilino-1,2,3-triazol-derivate, diese enthaltende arzneimittel sowie verfahren zu deren herstellung und deren verwendung |
| KR20150087400A (ko) | 2012-11-20 | 2015-07-29 | 버텍스 파마슈티칼스 인코포레이티드 | 인돌아민 2,3-디옥시게나제의 억제제로서 유용한 화합물 |
-
1970
- 1970-02-19 GB GB1296911D patent/GB1296911A/en not_active Expired
- 1970-02-20 DK DK86270AA patent/DK128497B/da unknown
- 1970-02-23 IL IL33942A patent/IL33942A/en unknown
- 1970-02-24 NL NL707002572A patent/NL143928B/xx unknown
- 1970-02-24 AT AT170070A patent/AT296295B/de not_active IP Right Cessation
- 1970-02-24 YU YU455/70A patent/YU33275B/xx unknown
- 1970-02-25 SE SE02456/70A patent/SE359547B/xx unknown
- 1970-02-26 DE DE19702009134 patent/DE2009134A1/de active Pending
- 1970-02-26 FR FR7006922A patent/FR2034567B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| YU45570A (en) | 1976-03-31 |
| DK128497B (da) | 1974-05-13 |
| IL33942A0 (en) | 1970-04-20 |
| YU33275B (en) | 1976-08-31 |
| NL7002572A (de) | 1970-08-28 |
| SE359547B (de) | 1973-09-03 |
| NL143928B (nl) | 1974-11-15 |
| GB1296911A (de) | 1972-11-22 |
| FR2034567A1 (de) | 1970-12-11 |
| DE2009134A1 (de) | 1970-09-10 |
| AT296295B (de) | 1972-02-10 |
| FR2034567B1 (de) | 1974-07-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| RU2024521C1 (ru) | Производные дифенилметилимидазола или их фармацевтически приемлемые соли | |
| US4714762A (en) | Antiarteriosclerotic substituted benzimidazol-2-yl-and 3H-imidazo[4,5-b]pyridin-2-yl-phenoxy-alkanoic acids and salts and esters thereof | |
| EP0040401B1 (de) | Triazolochinoxalin-4-one und -4-thione | |
| US4847379A (en) | 3,6-dihydro-1,5(2H)-pyrimidinecarboxylic acid esters | |
| US4225613A (en) | 1H-Pyrrole-1-acetamide compounds and their pharmaceutical compositions | |
| CA2004986A1 (en) | Piperidine derivatives | |
| EP0994863B1 (de) | Kristallmodifikation von 1-(2,6-difluorbenzyl)-1h-1,2,3-triazol-4-carbonsäureamid und seine verwendung als antiepileptikum | |
| US4330550A (en) | Oxoimidazolinealkanoic acids and their salts and esters, their preparation and pharmaceutical compositions containing them | |
| IL33942A (en) | 1-phenyl-5-amino-1,2,3-triazole-4-carboxylic acid esters,their preparation and pharmaceutical compositions containing them | |
| EP0009608B1 (de) | N-Phenyläthylacetamide, Verfahren zu ihrer Herstellung und sie enthaltende therapeutische Zusammensetzungen | |
| US4783473A (en) | Geminally substituted cyclic ether carboxylic acids, derivatives thereof, compositions containing same and method of use | |
| US4053621A (en) | 1-[2-(βNaphthyloxy)ethyl]-3-methylpyrazolone-(5) and antithrombotic and antithrombolytic compositions and methods utilizing them | |
| US4182775A (en) | Benzoic acids and process for their preparation | |
| US3244701A (en) | Butadiene-carboxylic acid piperazides | |
| US3278541A (en) | Di-substituted-n-alkyl piperidines | |
| US4645775A (en) | Positive inotropic 3-nitro-5-substituted ester and thioester-1,4-dihydropyridines | |
| US3971798A (en) | Pyridine derivative, processes of preparation and pharmaceutical compositions | |
| JPH0425953B2 (de) | ||
| US4675329A (en) | Isopropyl 2-(3-trifluoromethylphenoxy)-ethyl 1,4-dihydro-2,6-dimethyl-4-(3-nitrophenyl)-pyridine-3,5-dicarboxylate as vaso-dilators | |
| US2030373A (en) | Derivatives of thiazole and process of preparing the same | |
| US4378369A (en) | Esters of 2,5-anhydro-D-mannitol | |
| JPS6323848A (ja) | Ω−(置換フエニルオキシ)−アルカン酸のアリ−ル−およびアラルキルアミド | |
| EP0329691B1 (de) | Cardiotonische imidazolylphenylpyrrol-2-one | |
| US3635962A (en) | 4 - bis-morpholino- and 2 | |
| EP0045955B1 (de) | Alkyl- und cycloalkylsubstituierte 2-(2-(2-Hydroxy-3-tert.-butylamino-propoxy)-5-acylamino-phenyl)-1,3,4-oxadiazole, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende pharmazeutische Zubereitungen |