IL32577A - Herbicidal agents containing imidazolidinone derivatives - Google Patents
Herbicidal agents containing imidazolidinone derivativesInfo
- Publication number
- IL32577A IL32577A IL32577A IL3257769A IL32577A IL 32577 A IL32577 A IL 32577A IL 32577 A IL32577 A IL 32577A IL 3257769 A IL3257769 A IL 3257769A IL 32577 A IL32577 A IL 32577A
- Authority
- IL
- Israel
- Prior art keywords
- admixture
- carrier
- compound
- formula
- diluent
- Prior art date
Links
- 239000004009 herbicide Substances 0.000 title claims description 8
- 150000008624 imidazolidinones Chemical class 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims description 52
- 239000003085 diluting agent Substances 0.000 claims description 21
- 241000196324 Embryophyta Species 0.000 claims description 19
- 239000000203 mixture Substances 0.000 claims description 15
- 239000007787 solid Substances 0.000 claims description 13
- 239000007788 liquid Substances 0.000 claims description 12
- 230000002363 herbicidal effect Effects 0.000 claims description 10
- 238000000034 method Methods 0.000 claims description 10
- 235000016068 Berberis vulgaris Nutrition 0.000 claims description 8
- 241000335053 Beta vulgaris Species 0.000 claims description 8
- 239000004480 active ingredient Substances 0.000 claims description 8
- 239000004094 surface-active agent Substances 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 7
- 229920000742 Cotton Polymers 0.000 claims description 6
- DSARFHOMZQKBFZ-UHFFFAOYSA-N 2-oxoimidazolidine-1-carboxamide Chemical compound NC(=O)N1CCNC1=O DSARFHOMZQKBFZ-UHFFFAOYSA-N 0.000 claims description 4
- 235000013339 cereals Nutrition 0.000 claims description 2
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 14
- 238000002360 preparation method Methods 0.000 description 7
- 241000219146 Gossypium Species 0.000 description 6
- -1 N-(3 Chemical class 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 150000001412 amines Chemical class 0.000 description 5
- 239000003995 emulsifying agent Substances 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- KDSNLYIMUZNERS-UHFFFAOYSA-N 2-methylpropanamine Chemical compound CC(C)CN KDSNLYIMUZNERS-UHFFFAOYSA-N 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- VVJKKWFAADXIJK-UHFFFAOYSA-N Allylamine Chemical compound NCC=C VVJKKWFAADXIJK-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 241000209140 Triticum Species 0.000 description 4
- 235000021307 Triticum Nutrition 0.000 description 4
- NXJZQSRAFBHNLI-UHFFFAOYSA-N 2-oxoimidazolidine-1-carbonyl chloride Chemical compound ClC(=O)N1CCNC1=O NXJZQSRAFBHNLI-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 244000075850 Avena orientalis Species 0.000 description 2
- 241000723377 Coffea Species 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- 241000234642 Festuca Species 0.000 description 2
- 239000004606 Fillers/Extenders Substances 0.000 description 2
- 240000005702 Galium aparine Species 0.000 description 2
- 235000014820 Galium aparine Nutrition 0.000 description 2
- 241000209082 Lolium Species 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 241000209094 Oryza Species 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 240000006694 Stellaria media Species 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 125000003342 alkenyl group Chemical group 0.000 description 2
- 125000002877 alkyl aryl group Chemical group 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 2
- 235000013877 carbamide Nutrition 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 239000006072 paste Substances 0.000 description 2
- 229920000151 polyglycol Polymers 0.000 description 2
- 239000010695 polyglycol Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- YBRBMKDOPFTVDT-UHFFFAOYSA-N tert-butylamine Chemical compound CC(C)(C)N YBRBMKDOPFTVDT-UHFFFAOYSA-N 0.000 description 2
- AVWRKZWQTYIKIY-UHFFFAOYSA-N urea-1-carboxylic acid Chemical compound NC(=O)NC(O)=O AVWRKZWQTYIKIY-UHFFFAOYSA-N 0.000 description 2
- 150000003672 ureas Chemical class 0.000 description 2
- OQKFYHCXOJUFET-UHFFFAOYSA-N 2-oxo-n-propan-2-ylimidazolidine-1-carboxamide Chemical compound CC(C)NC(=O)N1CCNC1=O OQKFYHCXOJUFET-UHFFFAOYSA-N 0.000 description 1
- VLJHNNJRRSLTLE-UHFFFAOYSA-N 2-oxoimidazolidine-1-carboxylic acid Chemical compound OC(=O)N1CCNC1=O VLJHNNJRRSLTLE-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- 240000001592 Amaranthus caudatus Species 0.000 description 1
- 235000009328 Amaranthus caudatus Nutrition 0.000 description 1
- 235000007639 Anthemis cotula Nutrition 0.000 description 1
- 235000010960 Atriplex hastata Nutrition 0.000 description 1
- 235000005781 Avena Nutrition 0.000 description 1
- 235000007319 Avena orientalis Nutrition 0.000 description 1
- 244000056139 Brassica cretica Species 0.000 description 1
- 235000003351 Brassica cretica Nutrition 0.000 description 1
- 235000003343 Brassica rupestris Nutrition 0.000 description 1
- 241000209200 Bromus Species 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 241000219312 Chenopodium Species 0.000 description 1
- 240000006122 Chenopodium album Species 0.000 description 1
- 235000009344 Chenopodium album Nutrition 0.000 description 1
- 235000008645 Chenopodium bonus henricus Nutrition 0.000 description 1
- 244000192528 Chrysanthemum parthenium Species 0.000 description 1
- 241000208175 Daucus Species 0.000 description 1
- 244000000626 Daucus carota Species 0.000 description 1
- 235000002767 Daucus carota Nutrition 0.000 description 1
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 1
- 241000192043 Echinochloa Species 0.000 description 1
- 244000058871 Echinochloa crus-galli Species 0.000 description 1
- 235000007351 Eleusine Nutrition 0.000 description 1
- 241000209215 Eleusine Species 0.000 description 1
- 235000014716 Eleusine indica Nutrition 0.000 description 1
- 244000214240 Galinsoga parviflora Species 0.000 description 1
- 235000018914 Galinsoga parviflora Nutrition 0.000 description 1
- 241001101998 Galium Species 0.000 description 1
- 241000237858 Gastropoda Species 0.000 description 1
- 235000009438 Gossypium Nutrition 0.000 description 1
- 241001456088 Hesperocnide Species 0.000 description 1
- 241000209219 Hordeum Species 0.000 description 1
- 240000005979 Hordeum vulgare Species 0.000 description 1
- 235000007340 Hordeum vulgare Nutrition 0.000 description 1
- SBYAVOHNDJTVPA-UHFFFAOYSA-N Isocarbamid Chemical compound CC(C)CNC(=O)N1CCNC1=O SBYAVOHNDJTVPA-UHFFFAOYSA-N 0.000 description 1
- 241000801118 Lepidium Species 0.000 description 1
- 244000211187 Lepidium sativum Species 0.000 description 1
- 235000007849 Lepidium sativum Nutrition 0.000 description 1
- 241000209510 Liliopsida Species 0.000 description 1
- 235000017945 Matricaria Nutrition 0.000 description 1
- 244000042664 Matricaria chamomilla Species 0.000 description 1
- 235000007232 Matricaria chamomilla Nutrition 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- 241000209117 Panicum Species 0.000 description 1
- 235000006443 Panicum miliaceum subsp. miliaceum Nutrition 0.000 description 1
- 235000009037 Panicum miliaceum subsp. ruderale Nutrition 0.000 description 1
- 241000219833 Phaseolus Species 0.000 description 1
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 1
- 244000046052 Phaseolus vulgaris Species 0.000 description 1
- 241000746981 Phleum Species 0.000 description 1
- 241000209048 Poa Species 0.000 description 1
- 241000209051 Saccharum Species 0.000 description 1
- 240000000111 Saccharum officinarum Species 0.000 description 1
- 235000007201 Saccharum officinarum Nutrition 0.000 description 1
- 241000780602 Senecio Species 0.000 description 1
- 240000003705 Senecio vulgaris Species 0.000 description 1
- 235000005775 Setaria Nutrition 0.000 description 1
- 241000232088 Setaria <nematode> Species 0.000 description 1
- 241000220261 Sinapis Species 0.000 description 1
- 235000002634 Solanum Nutrition 0.000 description 1
- 241000207763 Solanum Species 0.000 description 1
- 235000002595 Solanum tuberosum Nutrition 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 244000062793 Sorghum vulgare Species 0.000 description 1
- 244000152045 Themeda triandra Species 0.000 description 1
- 241000219422 Urtica Species 0.000 description 1
- 235000009108 Urtica dioica Nutrition 0.000 description 1
- 241000209149 Zea Species 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- QKSKPIVNLNLAAV-UHFFFAOYSA-N bis(2-chloroethyl) sulfide Chemical compound ClCCSCCCl QKSKPIVNLNLAAV-UHFFFAOYSA-N 0.000 description 1
- ABBZJHFBQXYTLU-UHFFFAOYSA-N but-3-enamide Chemical compound NC(=O)CC=C ABBZJHFBQXYTLU-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 230000002950 deficient Effects 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 241001233957 eudicotyledons Species 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 230000035784 germination Effects 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- YAMHXTCMCPHKLN-UHFFFAOYSA-N imidazolidin-2-one Chemical compound O=C1NCCN1 YAMHXTCMCPHKLN-UHFFFAOYSA-N 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 235000009973 maize Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 235000019713 millet Nutrition 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 235000010460 mustard Nutrition 0.000 description 1
- 230000017066 negative regulation of growth Effects 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 235000012015 potatoes Nutrition 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/04—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D233/28—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/30—Oxygen or sulfur atoms
- C07D233/32—One oxygen atom
- C07D233/38—One oxygen atom with acyl radicals or hetero atoms directly attached to ring nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE1795117A DE1795117C3 (de) | 1968-08-13 | 1968-08-13 | lmidazolidin-2-on-1 -carbonsäureamide, Verfahren zu ihrer Herstellung und ihre Verwendung als Herbizide |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL32577A0 IL32577A0 (en) | 1969-09-25 |
| IL32577A true IL32577A (en) | 1972-01-27 |
Family
ID=5708062
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL32577A IL32577A (en) | 1968-08-13 | 1969-07-08 | Herbicidal agents containing imidazolidinone derivatives |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3933463A (ref) |
| AT (1) | AT293094B (ref) |
| BE (1) | BE737449A (ref) |
| CH (1) | CH509757A (ref) |
| CS (1) | CS153527B2 (ref) |
| DE (1) | DE1795117C3 (ref) |
| DK (2) | DK121010B (ref) |
| ES (1) | ES370448A1 (ref) |
| FR (1) | FR2015604A1 (ref) |
| GB (2) | GB1255752A (ref) |
| IL (1) | IL32577A (ref) |
| NL (1) | NL165038C (ref) |
| PL (2) | PL80291B1 (ref) |
| SE (1) | SE346898B (ref) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2132764A1 (de) * | 1971-07-01 | 1973-01-18 | Bayer Ag | Mittel zur selektiven unkrautbekaempfung in rueben |
| CA1127085A (en) * | 1978-03-06 | 1982-07-06 | Northwestern University | Immunosuppressive 1-(thiocarbamoyl)-2-imidazolidinone |
| JP2641280B2 (ja) * | 1988-12-29 | 1997-08-13 | 日本ペイント株式会社 | 新規な環状ウレア誘導体 |
| JPH02283706A (ja) * | 1988-12-29 | 1990-11-21 | Nippon Paint Co Ltd | 新規な重合性環状ウレア誘導体および環状ウレア基がペンダントした重合体 |
| DE102005041929A1 (de) | 2005-09-03 | 2007-03-08 | Krones Ag | Greifer für Behälter |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE587662A (ref) * | 1959-03-24 |
-
1968
- 1968-08-13 DE DE1795117A patent/DE1795117C3/de not_active Expired
-
1969
- 1969-07-07 CH CH1034369A patent/CH509757A/de not_active IP Right Cessation
- 1969-07-08 IL IL32577A patent/IL32577A/en unknown
- 1969-07-28 US US04/845,540 patent/US3933463A/en not_active Expired - Lifetime
- 1969-07-31 AT AT738469A patent/AT293094B/de not_active IP Right Cessation
- 1969-07-31 GB GB9213/71A patent/GB1255752A/en not_active Expired
- 1969-07-31 GB GB38430/69A patent/GB1255751A/en not_active Expired
- 1969-08-12 DK DK433069AA patent/DK121010B/da not_active IP Right Cessation
- 1969-08-12 PL PL1969135352A patent/PL80291B1/pl unknown
- 1969-08-12 CS CS557269A patent/CS153527B2/cs unknown
- 1969-08-12 ES ES370448A patent/ES370448A1/es not_active Expired
- 1969-08-12 SE SE11208/69A patent/SE346898B/xx unknown
- 1969-08-12 PL PL1969152414A patent/PL77191B1/pl unknown
- 1969-08-13 FR FR6927914A patent/FR2015604A1/fr not_active Withdrawn
- 1969-08-13 BE BE737449D patent/BE737449A/xx unknown
- 1969-08-13 NL NL6912327.A patent/NL165038C/xx not_active IP Right Cessation
-
1970
- 1970-06-30 DK DK339970AA patent/DK122281B/da unknown
Also Published As
| Publication number | Publication date |
|---|---|
| SE346898B (ref) | 1972-07-24 |
| AT293094B (de) | 1971-09-27 |
| BE737449A (ref) | 1970-02-13 |
| PL80291B1 (ref) | 1975-08-30 |
| PL77191B1 (ref) | 1975-04-30 |
| ES370448A1 (es) | 1971-04-16 |
| IL32577A0 (en) | 1969-09-25 |
| US3933463A (en) | 1976-01-20 |
| DE1795117C3 (de) | 1975-11-27 |
| DK122281B (da) | 1972-02-14 |
| DE1795117B2 (de) | 1975-04-10 |
| GB1255751A (en) | 1971-12-01 |
| GB1255752A (en) | 1971-12-01 |
| CS153527B2 (ref) | 1974-02-25 |
| NL165038B (nl) | 1980-10-15 |
| NL6912327A (ref) | 1970-02-17 |
| NL165038C (nl) | 1981-03-16 |
| DE1795117A1 (de) | 1971-12-30 |
| FR2015604A1 (ref) | 1970-04-30 |
| CH509757A (de) | 1971-07-15 |
| DK121010B (da) | 1971-08-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3759939A (en) | Certain 1-(1,3,4-thiadiazol-2-yl)-imidazolidinone-(2) compounds | |
| US3758492A (en) | 1-(1,3,4-thiadiazol-2-yl)-imidazolidinone-(2) compounds | |
| US3849432A (en) | Certain thiadiazolyl-containing-halogen-substituted-imidazolidinones | |
| US3773780A (en) | 1-(1,3,4-thiadiazol-2-yl)-imidazolidinone-(2)compounds | |
| US3845069A (en) | 1-(2-benzothiazolyl)-1-ethyl-3-methyl-urea | |
| US3657264A (en) | Heterocyclically substituted thiadiazoles | |
| US3639668A (en) | N-(2 2 4 4-tetrafluoro-1 3-benzodioxanyl)-ureas | |
| US3686198A (en) | 1,2,4-thiadiazolyl-ureas | |
| IL30586A (en) | N-substituted 5-amino-1,3,4-thiadiazoles | |
| IL32577A (en) | Herbicidal agents containing imidazolidinone derivatives | |
| IL26698A (en) | Amidothionophosphoric acid ester | |
| IL32523A (en) | N-acyl-2-amino-1,3,4-thiazoles,their preparation and their use as herbicides | |
| US3686204A (en) | Cycloaliphatic imidazolidine-2-one-1-carboxylic acid amides | |
| US4128412A (en) | Herbicidal composition and method using N-(2-ethylsulfonyl-1,3,4-thiadiazol-5-yl)-N-methyl-N'-methyl urea | |
| US3981714A (en) | Cyclic N-thiadiazolyl-(2)-carboxylic acid compounds and herbicidal compositions | |
| US3984468A (en) | Herbicidal N-trifluoromethylmercaptophenyl ureas | |
| IL45197A (en) | N-(3-chloro-4-sulphonyloxyphenyl)-n'-alkyl ureas process for their preparation and herbicidal compositions containing them | |
| US4639526A (en) | N-substituted 5-amino-1,3,4-thiadiazoles | |
| US3954785A (en) | Acylated urea compounds and herbicidal compositions | |
| US3763209A (en) | 2,4-dicyano-6-nitro-benzene amines | |
| US3931312A (en) | Novel N(-difluoromethylmercaptophenyl) urea compounds and herbicidal compositions | |
| IL30584A (en) | Herbicidal compositions containing carboxylic acid(1,2,4-thiadiazolyl-5)-amides and new carboxylic acid(1,2,4-thiadiazolyl-5)-amides | |
| US3875180A (en) | Herbicidally active imidazolidin-2-one-1-carboxylic acid isobutyl amide | |
| US3761490A (en) | Cyclopropane-carboxylic acid benzothiazylamides | |
| US4039315A (en) | N-(Difluorochloromethylmercaptophenyl)ureas as herbicides |