IL30711A - 2-methyl-3-carbamoyl-quinoxaline-1,4-di-oxides - Google Patents
2-methyl-3-carbamoyl-quinoxaline-1,4-di-oxidesInfo
- Publication number
- IL30711A IL30711A IL30711A IL3071168A IL30711A IL 30711 A IL30711 A IL 30711A IL 30711 A IL30711 A IL 30711A IL 3071168 A IL3071168 A IL 3071168A IL 30711 A IL30711 A IL 30711A
- Authority
- IL
- Israel
- Prior art keywords
- quinoxaline
- carbamoyl
- oxides
- methyl
- Prior art date
Links
- MZXRNZRWWVUJMH-UHFFFAOYSA-N 3-methyl-4-oxido-1-oxoquinoxalin-1-ium-2-carboxamide Chemical class C1=CC=C2N([O-])C(C)=C(C(N)=O)[N+](=O)C2=C1 MZXRNZRWWVUJMH-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D241/00—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings
- C07D241/36—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings condensed with carbocyclic rings or ring systems
- C07D241/50—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings condensed with carbocyclic rings or ring systems with hetero atoms directly attached to ring nitrogen atoms
- C07D241/52—Oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Secondary Cells (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF0053665 | 1967-10-04 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL30711A0 IL30711A0 (en) | 1968-12-26 |
| IL30711A true IL30711A (en) | 1972-05-30 |
Family
ID=7106501
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL30711A IL30711A (en) | 1967-10-04 | 1968-09-16 | 2-methyl-3-carbamoyl-quinoxaline-1,4-di-oxides |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US3660391A (Direct) |
| AT (1) | AT281836B (Direct) |
| BE (1) | BE721724A (Direct) |
| BR (1) | BR6802855D0 (Direct) |
| CA (1) | CA978948A (Direct) |
| CH (1) | CH518953A (Direct) |
| CY (1) | CY763A (Direct) |
| DE (1) | DE1670935C3 (Direct) |
| DK (1) | DK119878B (Direct) |
| ES (1) | ES362861A1 (Direct) |
| FI (1) | FI49720C (Direct) |
| FR (2) | FR1594628A (Direct) |
| GB (1) | GB1235869A (Direct) |
| IL (1) | IL30711A (Direct) |
| MY (1) | MY7400291A (Direct) |
| NL (1) | NL158702B (Direct) |
| NO (1) | NO122017B (Direct) |
| SE (1) | SE364045B (Direct) |
| YU (1) | YU32937B (Direct) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1325581A (en) * | 1969-07-22 | 1973-08-01 | Pfizer | 3-methyl-2-quinoxalinecarboxamide-di-n-oxides |
| GB1330151A (en) * | 1970-03-18 | 1973-09-12 | Pfizer | Substituted quinoxaline-di oxides and process of preparation thereof |
| US3663697A (en) * | 1970-10-07 | 1972-05-16 | Pfizer | 3 - methylquinoxaline - 2 - carboxamide-1,4-dioxides for the control of salmonella choleraesuis infections |
| US4039540A (en) * | 1974-05-07 | 1977-08-02 | Pfizer Inc. | 3-Substituted quinoxaline-2-carboxamide-1,4-dioxides |
| US3948911A (en) * | 1974-11-19 | 1976-04-06 | Pfizer Inc. | Substituted quinoxaline-2-carboxamide 1,4-dioxides |
| SU890961A3 (ru) * | 1976-01-20 | 1981-12-15 | Циба-Гейги Аг (Фирма) | Ростстимулирующее средство дл животных |
| CS195508B1 (en) * | 1977-08-02 | 1980-02-29 | Jaromir Hebky | Cyanacetylhydrazones of 2-formylquinoxalin-1,4-dioxide |
| DE2747700A1 (de) * | 1977-10-25 | 1979-05-03 | Bayer Ag | Verfahren zur herstellung von neuen chinoxalin-di-n-oxiden sowie ihre verwendung als arzneimittel |
| IT7869686A0 (it) * | 1978-11-24 | 1978-11-24 | Loranze Torino A | Procedimento di preparazione di 2metil 3 bidrossietilcarbamollchinossalina i.4 di n ossido puroed altri composti ad esso simili |
| DE3133888A1 (de) * | 1981-08-27 | 1983-03-10 | Bayer Ag | Wirkstoffkombination aus kitasamycin und chinoxalin-di-n-oxiden |
| DE3340931A1 (de) * | 1983-11-11 | 1985-05-23 | Bayer Ag, 5090 Leverkusen | Staubfreie chinoxalin-1,4-di-n-oxide |
| JPS62132870A (ja) * | 1985-12-04 | 1987-06-16 | Chisso Corp | N−(2−ヒドロキシエチル)−2−メチル−3−カルボン酸アミド−キノキサリン−1,4−ジ−n−オキシドの精製法 |
| EP0288628A1 (en) * | 1987-04-30 | 1988-11-02 | Chisso Corporation | Process for producing 2-methyl-3-carbamido-quinoxaline-1, 4-di-n-oxides |
| DE102004035797B9 (de) * | 2004-07-23 | 2006-07-13 | Langenstein & Schemann Gmbh | Verfahren und Vorrichtung zum Überführen eines Werkstücks |
| EP2225175B1 (en) * | 2007-12-13 | 2012-12-12 | Akzo Nobel N.V. | Stabilized hydrogen peroxide solutions |
-
1967
- 1967-10-04 DE DE1670935A patent/DE1670935C3/de not_active Expired
-
1968
- 1968-09-16 CH CH1387368A patent/CH518953A/de not_active IP Right Cessation
- 1968-09-16 IL IL30711A patent/IL30711A/xx unknown
- 1968-09-26 NO NO3806/68A patent/NO122017B/no unknown
- 1968-10-02 US US764611A patent/US3660391A/en not_active Expired - Lifetime
- 1968-10-02 YU YU2296/68A patent/YU32937B/xx unknown
- 1968-10-02 SE SE13325/68A patent/SE364045B/xx unknown
- 1968-10-02 BE BE721724D patent/BE721724A/xx not_active IP Right Cessation
- 1968-10-03 GB GB47013/68A patent/GB1235869A/en not_active Expired
- 1968-10-03 DK DK478168AA patent/DK119878B/da unknown
- 1968-10-03 CA CA031,584A patent/CA978948A/en not_active Expired
- 1968-10-03 AT AT964368A patent/AT281836B/de not_active IP Right Cessation
- 1968-10-04 NL NL6814257.A patent/NL158702B/xx not_active IP Right Cessation
- 1968-10-04 FR FR1594628D patent/FR1594628A/fr not_active Expired
- 1968-10-04 FI FI682815A patent/FI49720C/fi active
- 1968-10-04 BR BR202855/68A patent/BR6802855D0/pt unknown
- 1968-12-30 FR FR181597A patent/FR8123M/fr not_active Expired
-
1969
- 1969-01-24 ES ES362861A patent/ES362861A1/es not_active Expired
-
1974
- 1974-11-07 CY CY76374A patent/CY763A/xx unknown
- 1974-12-30 MY MY291/74A patent/MY7400291A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| BR6802855D0 (pt) | 1973-02-22 |
| ES362861A1 (es) | 1970-11-16 |
| NO122017B (Direct) | 1971-05-10 |
| YU32937B (en) | 1975-12-31 |
| SE364045B (Direct) | 1974-02-11 |
| GB1235869A (en) | 1971-06-16 |
| DE1670935B2 (de) | 1975-04-24 |
| CH518953A (de) | 1972-02-15 |
| FR1594628A (Direct) | 1970-06-08 |
| DE1670935C3 (de) | 1975-12-04 |
| NL6814257A (Direct) | 1969-04-09 |
| AT281836B (de) | 1970-06-10 |
| IL30711A0 (en) | 1968-12-26 |
| MY7400291A (en) | 1974-12-31 |
| CA978948A (en) | 1975-12-02 |
| NL158702B (nl) | 1978-12-15 |
| CY763A (en) | 1974-11-07 |
| FI49720C (fi) | 1975-09-10 |
| US3660391A (en) | 1972-05-02 |
| FR8123M (Direct) | 1970-08-03 |
| FI49720B (Direct) | 1975-06-02 |
| YU229668A (en) | 1975-06-30 |
| BE721724A (Direct) | 1969-04-02 |
| DE1670935A1 (de) | 1971-02-25 |
| DK119878B (da) | 1971-03-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| MY7100160A (en) | 1,2,4- triazine-5-ones | |
| YU31374B (en) | Jednodelni zatvarac od plasticne materije, koje se moze pritegnuti | |
| IL30711A0 (en) | 2-methyl-3-carbamyl-quinoxaline-1,4-di-n-oxides | |
| YU160768A (en) | Pogonski uredaj za motorne, prvenstveno elektro-motorom pokretane busilice-cekicare | |
| GB1165990A (en) | Track-Set | |
| YU31610B (en) | Igracka u vidu pruge, prvenstveno u vidu autoputa | |
| IL29742A (en) | 3-(omega-aminoalkyl)-4-substituted-1,3-benzoxazin-2-ones | |
| YU32517B (en) | Agregat za valjanje celicnih sipki, zica i traka | |
| YU31356B (en) | Uredaj za automatsko, serijsko dokazivanje cvrstih necistoca u ampulnim punjenjima | |
| IL30714A0 (en) | 3-carbamyl-quinocaline-1,4-di-n-oxides | |
| IL29988A0 (en) | Novel 7-trifluoromethoxybenzo-1,4-diazepines | |
| YU228668A (en) | Trodelna veza, posebno prekidne komore sa osnovnom plocom | |
| IE31177L (en) | 6-HALO-9ß, 10Ó-STEROIDS | |
| IE31178L (en) | 9ß, 10Ó-STEROID | |
| IE31369L (en) | 9ß,10Ó-STEROIDS | |
| IE31829L (en) | 1alfa, 2alfa-methylene-6beta,7beta-epoxysteroids | |
| IE31144L (en) | N, n-disubstituted-ethylenediamines | |
| IE31292L (en) | Thioxanthenesulphonamides. | |
| IE31105L (en) | Playball. | |
| IE31171L (en) | Delta 21 - fluoro - 4, 6-pregnadienes | |
| IE31279L (en) | Pryidoindole derivatives. | |
| IE31564L (en) | Benzdiazepine derivatives. | |
| IE31311L (en) | Triazolo-tetrazolo-pyridazine derivatives. | |
| IE31293L (en) | 2-sulphamylthioxanthene-9-one derivatives. | |
| IE31643L (en) | 11, 13ß-DIALKYLSTEROIDS |