IL29115A - Thiamamide azolidines, their preparation and use as herbicides - Google Patents
Thiamamide azolidines, their preparation and use as herbicidesInfo
- Publication number
- IL29115A IL29115A IL6729115A IL2911567A IL29115A IL 29115 A IL29115 A IL 29115A IL 6729115 A IL6729115 A IL 6729115A IL 2911567 A IL2911567 A IL 2911567A IL 29115 A IL29115 A IL 29115A
- Authority
- IL
- Israel
- Prior art keywords
- compound
- formula
- active compound
- active
- composition
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 title description 8
- 239000004009 herbicide Substances 0.000 title description 6
- 150000001875 compounds Chemical class 0.000 claims description 58
- 238000000034 method Methods 0.000 claims description 26
- 241000196324 Embryophyta Species 0.000 claims description 21
- 239000000203 mixture Substances 0.000 claims description 16
- 230000002363 herbicidal effect Effects 0.000 claims description 12
- 239000002904 solvent Substances 0.000 claims description 11
- 239000003085 diluting agent Substances 0.000 claims description 9
- 150000003672 ureas Chemical class 0.000 claims description 8
- 239000007787 solid Substances 0.000 claims description 7
- 239000007788 liquid Substances 0.000 claims description 6
- MNOALXGAYUJNKX-UHFFFAOYSA-N s-chloro chloromethanethioate Chemical compound ClSC(Cl)=O MNOALXGAYUJNKX-UHFFFAOYSA-N 0.000 claims description 6
- 239000004480 active ingredient Substances 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 239000000725 suspension Substances 0.000 claims description 4
- 235000007319 Avena orientalis Nutrition 0.000 claims description 3
- 244000075850 Avena orientalis Species 0.000 claims description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 3
- 241000209140 Triticum Species 0.000 claims description 3
- 235000021307 Triticum Nutrition 0.000 claims description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 claims description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 claims description 3
- 239000004094 surface-active agent Substances 0.000 claims description 3
- 229920000742 Cotton Polymers 0.000 claims description 2
- 244000000626 Daucus carota Species 0.000 claims description 2
- 235000002767 Daucus carota Nutrition 0.000 claims description 2
- 241000219146 Gossypium Species 0.000 claims description 2
- 240000008042 Zea mays Species 0.000 claims description 2
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 claims description 2
- 235000002017 Zea mays subsp mays Nutrition 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 235000009973 maize Nutrition 0.000 claims description 2
- 239000011541 reaction mixture Substances 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- -1 1-(4-trifluoromethyl-phenyl) -3-ethylurea 1-(4-trifluoromethyl-phenyl) -3-isopropylurea 1-( 3-trifluoromethyl-phenyl) -3-methylurea 1-( 3-trifluoromethyl-phenyl) -3-n-propylurea Chemical compound 0.000 description 8
- 230000006378 damage Effects 0.000 description 7
- 239000003995 emulsifying agent Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 238000009472 formulation Methods 0.000 description 4
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 239000004606 Fillers/Extenders Substances 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 241001310793 Podium Species 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 125000002877 alkyl aryl group Chemical group 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- 235000013877 carbamide Nutrition 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 150000002367 halogens Chemical group 0.000 description 2
- 150000002461 imidazolidines Chemical class 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 239000006072 paste Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 1
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 101001015038 Albizia kalkora Kunitz-type trypsin inhibitor alpha chain Proteins 0.000 description 1
- 240000000662 Anethum graveolens Species 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 244000192528 Chrysanthemum parthenium Species 0.000 description 1
- 241000208175 Daucus Species 0.000 description 1
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 1
- 241000748465 Galinsoga Species 0.000 description 1
- WRYCSMQKUKOKBP-UHFFFAOYSA-N Imidazolidine Chemical compound C1CNCN1 WRYCSMQKUKOKBP-UHFFFAOYSA-N 0.000 description 1
- 235000017945 Matricaria Nutrition 0.000 description 1
- 235000007232 Matricaria chamomilla Nutrition 0.000 description 1
- 101000740206 Mus musculus Sal-like protein 1 Proteins 0.000 description 1
- 101100310622 Mus musculus Soga1 gene Proteins 0.000 description 1
- 240000004370 Pastinaca sativa Species 0.000 description 1
- 241000220261 Sinapis Species 0.000 description 1
- 240000006694 Stellaria media Species 0.000 description 1
- 241000219422 Urtica Species 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- HLPKIQYKNZRIJR-UHFFFAOYSA-N chlorosulfonylformyl chloride Chemical compound ClC(=O)S(Cl)(=O)=O HLPKIQYKNZRIJR-UHFFFAOYSA-N 0.000 description 1
- 230000002950 deficient Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 229940117389 dichlorobenzene Drugs 0.000 description 1
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 230000035784 germination Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 230000017066 negative regulation of growth Effects 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- QIIPQYDSKRYMFG-UHFFFAOYSA-N phenyl hydrogen carbonate Chemical class OC(=O)OC1=CC=CC=C1 QIIPQYDSKRYMFG-UHFFFAOYSA-N 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 150000003918 triazines Chemical class 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D285/00—Heterocyclic compounds containing rings having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by groups C07D275/00 - C07D283/00
- C07D285/01—Five-membered rings
- C07D285/02—Thiadiazoles; Hydrogenated thiadiazoles
- C07D285/04—Thiadiazoles; Hydrogenated thiadiazoles not condensed with other rings
- C07D285/08—1,2,4-Thiadiazoles; Hydrogenated 1,2,4-thiadiazoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF0051360 | 1967-01-27 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL29115A true IL29115A (en) | 1971-08-25 |
Family
ID=7104543
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL6729115A IL29115A (en) | 1967-01-27 | 1967-12-12 | Thiamamide azolidines, their preparation and use as herbicides |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3491109A (enExample) |
| BE (1) | BE709916A (enExample) |
| CH (1) | CH492731A (enExample) |
| DE (1) | DE1670792A1 (enExample) |
| ES (1) | ES349831A1 (enExample) |
| FR (1) | FR1554982A (enExample) |
| GB (1) | GB1162472A (enExample) |
| IL (1) | IL29115A (enExample) |
| NL (1) | NL6800946A (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3900485A (en) * | 1967-02-10 | 1975-08-19 | Velsicol Chemical Corp | New substituted 1,2,4-thiadiazolidine-3,5-diones |
| DE2852869A1 (de) * | 1978-12-07 | 1980-06-26 | Bayer Ag | 3,4-dioxo-1,2,5-thiadiazolidin-1-oxide, verfahren zu ihrer herstellung sowie ihre verwendung als fungizide |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3301894A (en) * | 1964-11-16 | 1967-01-31 | Olin Mathieson | S-[nu'-(chlorocarbonyl)-amino] isothiocarbamyl chlorides and their preparation |
-
1967
- 1967-01-27 DE DE19671670792 patent/DE1670792A1/de active Pending
- 1967-12-11 CH CH1739367A patent/CH492731A/de not_active IP Right Cessation
- 1967-12-12 IL IL6729115A patent/IL29115A/en unknown
- 1967-12-22 US US692684A patent/US3491109A/en not_active Expired - Lifetime
-
1968
- 1968-01-09 GB GB0258/68A patent/GB1162472A/en not_active Expired
- 1968-01-22 NL NL6800946A patent/NL6800946A/xx unknown
- 1968-01-26 FR FR1554982D patent/FR1554982A/fr not_active Expired
- 1968-01-26 BE BE709916D patent/BE709916A/xx unknown
- 1968-01-27 ES ES349831A patent/ES349831A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CH492731A (de) | 1970-06-30 |
| GB1162472A (en) | 1969-08-27 |
| ES349831A1 (es) | 1969-04-16 |
| NL6800946A (enExample) | 1968-07-29 |
| US3491109A (en) | 1970-01-20 |
| BE709916A (enExample) | 1968-07-26 |
| FR1554982A (enExample) | 1969-01-24 |
| DE1670792A1 (de) | 1971-03-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS6115877A (ja) | N‐(2‐ニトロフエニル)‐2‐アミノピリミジン誘導体、その製造方法及び該化合物を含有する組成物 | |
| NO167877B (no) | Beslag for vindusrammer eller doerblad | |
| EP0071794A1 (de) | 5-Amino-1-phenyl-pyrazol-4-carbonsäurederivate, Verfahren zu ihrer Herstellung und ihre Verwendung zur Bekämpfung unerwünschten Pflanzenwuchses | |
| US3318680A (en) | Method for the control of weeds | |
| US4146646A (en) | Bis-amide fungicidal compounds | |
| CA1176271A (en) | 2'-phenylhydrazino-2-cyanoacrylic acid esters and herbicides containing these compounds | |
| IL30586A (en) | N-substituted 5-amino-1,3,4-thiadiazoles | |
| IL26698A (en) | Amidothionophosphoric acid ester | |
| IL29115A (en) | Thiamamide azolidines, their preparation and use as herbicides | |
| JP2834247B2 (ja) | 置換スルホニル尿素および該化合物を含有する除草剤 | |
| EP0084673B1 (de) | Aminothiadiazole, Verfahren zu ihrer Herstellung und ihre Verwendung zur Bekämpfung unerwünschten Pflanzenwuchses | |
| EP0062254A1 (de) | Substituierte Acetanilide, Verfahren zu ihrer Herstellung und ihre Verwendung als Herbizide | |
| US4502881A (en) | Weed-killing furazan compounds | |
| EP0192998B1 (de) | Thiazolylamide, Verfahren zu ihrer Herstellung und ihre Verwendung zur Bekämpfung unerwünschten Pflanzenwuchses | |
| USRE29439E (en) | Certain 1,2,4-Oxa- and -thiadiazol-5-ylthioalkanoic acid derivatives | |
| EP0134477A1 (de) | Neue heterocyclisch substituierte Sulfonylharnstoffe | |
| EP0144052A2 (de) | Chinolinoxyphenylharnstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung zur Bekämpfung unerwünschten Pflanzenwuchhses | |
| US4496575A (en) | Fungicidal N-sulphenylated hydantoins | |
| EP0249858B1 (de) | Fluoralkylsubstituierte Chinolinderivate. ihre Herstellung sowie Verwendung zur Bekämpfung unerwünschten Pflanzenwachstums | |
| US4854965A (en) | Herbicidal compositions | |
| KR950013855B1 (ko) | 제초제 활성이 있는 우레아 유도체와 그 제조방법 | |
| IL27724A (en) | Thiaimidazolidines and their preparation | |
| NO772963L (no) | Diuretaner med herbicid virkning. | |
| EP0118982A1 (en) | Organic phosphorous quinoxalinone and their production and use | |
| US3792089A (en) | N-aryl ureas |