IL22148A - Benzenesulfonyl ureas - Google Patents
Benzenesulfonyl ureasInfo
- Publication number
- IL22148A IL22148A IL22148A IL2214864A IL22148A IL 22148 A IL22148 A IL 22148A IL 22148 A IL22148 A IL 22148A IL 2214864 A IL2214864 A IL 2214864A IL 22148 A IL22148 A IL 22148A
- Authority
- IL
- Israel
- Prior art keywords
- benzenesulfonyl
- carbon
- alkyl
- ureas
- carbon atoms
- Prior art date
Links
- 235000013877 carbamide Nutrition 0.000 title claims description 34
- -1 Benzenesulfonyl ureas Chemical class 0.000 title claims description 27
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 29
- 239000004202 carbamide Substances 0.000 claims description 15
- 229910052799 carbon Inorganic materials 0.000 claims description 14
- 150000003839 salts Chemical class 0.000 claims description 13
- 150000003672 ureas Chemical class 0.000 claims description 12
- 239000002253 acid Substances 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 10
- 125000004432 carbon atom Chemical group C* 0.000 claims description 10
- 150000001875 compounds Chemical class 0.000 claims description 10
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 9
- 239000008280 blood Substances 0.000 claims description 8
- 210000004369 blood Anatomy 0.000 claims description 8
- 238000000034 method Methods 0.000 claims description 8
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 claims description 7
- 239000000203 mixture Substances 0.000 claims description 6
- 229940100389 Sulfonylurea Drugs 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims description 4
- 239000000126 substance Substances 0.000 claims description 4
- 239000004215 Carbon black (E152) Substances 0.000 claims description 3
- 150000001412 amines Chemical class 0.000 claims description 3
- 206010012601 diabetes mellitus Diseases 0.000 claims description 3
- 125000000623 heterocyclic group Chemical group 0.000 claims description 3
- 229930195733 hydrocarbon Natural products 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- YROXIXLRRCOBKF-UHFFFAOYSA-N sulfonylurea Chemical compound OC(=N)N=S(=O)=O YROXIXLRRCOBKF-UHFFFAOYSA-N 0.000 claims description 3
- 150000007513 acids Chemical class 0.000 claims description 2
- 150000001714 carbamic acid halides Chemical class 0.000 claims description 2
- KXDHJXZQYSOELW-UHFFFAOYSA-N carbonic acid monoamide Natural products NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 claims description 2
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 2
- 239000000825 pharmaceutical preparation Substances 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 125000004434 sulfur atom Chemical group 0.000 claims description 2
- KJAMZCVTJDTESW-UHFFFAOYSA-N tiracizine Chemical compound C1CC2=CC=CC=C2N(C(=O)CN(C)C)C2=CC(NC(=O)OCC)=CC=C21 KJAMZCVTJDTESW-UHFFFAOYSA-N 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims 1
- 150000002430 hydrocarbons Chemical class 0.000 claims 1
- 231100000331 toxic Toxicity 0.000 claims 1
- 230000002588 toxic effect Effects 0.000 claims 1
- 238000002844 melting Methods 0.000 description 32
- 230000008018 melting Effects 0.000 description 32
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 24
- 239000000155 melt Substances 0.000 description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000000706 filtrate Substances 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 4
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 3
- YDPWVAMKZSUTGO-UHFFFAOYSA-N benzenesulfonamide;sodium Chemical compound [Na].NS(=O)(=O)C1=CC=CC=C1 YDPWVAMKZSUTGO-UHFFFAOYSA-N 0.000 description 3
- WUESWDIHTKHGQA-UHFFFAOYSA-N cyclohexylurea Chemical compound NC(=O)NC1CCCCC1 WUESWDIHTKHGQA-UHFFFAOYSA-N 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- JOYRKODLDBILNP-UHFFFAOYSA-N urethane group Chemical group NC(=O)OCC JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 229940112021 centrally acting muscle relaxants carbamic acid ester Drugs 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 230000002218 hypoglycaemic effect Effects 0.000 description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N monobenzene Natural products C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 229940124530 sulfonamide Drugs 0.000 description 2
- 150000003456 sulfonamides Chemical class 0.000 description 2
- BMVXCPBXGZKUPN-UHFFFAOYSA-N 1-hexanamine Chemical compound CCCCCCN BMVXCPBXGZKUPN-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 241000219198 Brassica Species 0.000 description 1
- 235000003351 Brassica cretica Nutrition 0.000 description 1
- 235000003343 Brassica rupestris Nutrition 0.000 description 1
- CKDWPUIZGOQOOM-UHFFFAOYSA-N Carbamyl chloride Chemical compound NC(Cl)=O CKDWPUIZGOQOOM-UHFFFAOYSA-N 0.000 description 1
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- MKYBYDHXWVHEJW-UHFFFAOYSA-N N-[1-oxo-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propan-2-yl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(C(C)NC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 MKYBYDHXWVHEJW-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 230000003178 anti-diabetic effect Effects 0.000 description 1
- 239000003472 antidiabetic agent Substances 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- ALZKZGUTVJXYEF-UHFFFAOYSA-N benzenesulfonylcarbamic acid Chemical compound OC(=O)NS(=O)(=O)C1=CC=CC=C1 ALZKZGUTVJXYEF-UHFFFAOYSA-N 0.000 description 1
- GHDLZGOOOLEJKI-UHFFFAOYSA-N benzenesulfonylurea Chemical compound NC(=O)NS(=O)(=O)C1=CC=CC=C1 GHDLZGOOOLEJKI-UHFFFAOYSA-N 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- RCTYPNKXASFOBE-UHFFFAOYSA-M chloromercury Chemical compound [Hg]Cl RCTYPNKXASFOBE-UHFFFAOYSA-M 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- VXVVUHQULXCUPF-UHFFFAOYSA-N cycloheptanamine Chemical compound NC1CCCCCC1 VXVVUHQULXCUPF-UHFFFAOYSA-N 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 230000005923 long-lasting effect Effects 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910000474 mercury oxide Inorganic materials 0.000 description 1
- UKWHYYKOEPRTIC-UHFFFAOYSA-N mercury(ii) oxide Chemical compound [Hg]=O UKWHYYKOEPRTIC-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 235000010460 mustard Nutrition 0.000 description 1
- UJYAZVSPFMJCLW-UHFFFAOYSA-N n-(oxomethylidene)benzenesulfonamide Chemical class O=C=NS(=O)(=O)C1=CC=CC=C1 UJYAZVSPFMJCLW-UHFFFAOYSA-N 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- GQPLMRYTRLFLPF-UHFFFAOYSA-N nitrous oxide Inorganic materials [O-][N+]#N GQPLMRYTRLFLPF-UHFFFAOYSA-N 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 125000003884 phenylalkyl group Chemical group 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- PFUVRDFDKPNGAV-UHFFFAOYSA-N sodium peroxide Chemical compound [Na+].[Na+].[O-][O-] PFUVRDFDKPNGAV-UHFFFAOYSA-N 0.000 description 1
- QXKXDIKCIPXUPL-UHFFFAOYSA-N sulfanylidenemercury Chemical compound [Hg]=S QXKXDIKCIPXUPL-UHFFFAOYSA-N 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/16—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms
- C07D295/18—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms by radicals derived from carboxylic acids, or sulfur or nitrogen analogues thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Load-Engaging Elements For Cranes (AREA)
- Seats For Vehicles (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF40828A DE1198354B (de) | 1963-09-25 | 1963-09-25 | Verfahren zur Herstellung von Benzol-sulfonylharnstoffen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL22148A true IL22148A (en) | 1968-04-25 |
Family
ID=7098406
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL22148A IL22148A (en) | 1963-09-25 | 1964-09-24 | Benzenesulfonyl ureas |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3336322A (show.php) |
| AT (4) | AT253523B (show.php) |
| BE (2) | BE653586A (show.php) |
| BR (1) | BR6462883D0 (show.php) |
| CH (5) | CH451111A (show.php) |
| DE (1) | DE1198354B (show.php) |
| DK (4) | DK106793C (show.php) |
| FI (1) | FI41023B (show.php) |
| FR (2) | FR1431690A (show.php) |
| GB (1) | GB1054758A (show.php) |
| IL (1) | IL22148A (show.php) |
| NO (4) | NO117362B (show.php) |
| SE (1) | SE310665B (show.php) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL141381B (nl) * | 1963-09-25 | 1974-03-15 | Hoechst Ag | Werkwijze voor het bereiden van geneesmiddelen met bloedsuikerspiegel verlagende werkzaamheid. |
| US3424749A (en) * | 1965-06-23 | 1969-01-28 | Heinz A Pfenninger | Certain n-(benzenesulfonyl) pipecolinic acids and lower alkyl esters thereof |
| DE2951135A1 (de) * | 1979-12-19 | 1981-06-25 | Hoechst Ag, 6230 Frankfurt | Sulfonylharnstoffe, verfahren zu ihrer herstellung, pharmazeutische praeparate auf basis dieser verbindungen und ihre verwendung |
| DE19505397A1 (de) * | 1995-02-17 | 1996-08-22 | Hoechst Ag | Substituierte Benzolsulfonylharnstoffe und -thioharnstoffe, Verfahren zu ihrer Herstellung, ihre Verwendung als Medikament oder Diagnostikum sowie sie enthaltendes Medikament |
| HU226462B1 (en) * | 1995-02-17 | 2008-12-29 | Hoechst Ag | Substituted benzol-sulfonyl-ureas and -thioureas, process for producing them, pharmaceutical compositions containing them, and their use |
| ZA961314B (en) * | 1995-02-21 | 1996-08-27 | Hoechst Ag | Substituted benzenesulfonylureas and -thioreas processes for their preparation their use for the production of pharmaceutical preparations and medicaments containing them |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR919464A (fr) * | 1944-12-28 | 1947-03-10 | Geigy Ag J R | Urées substituées et procédé de préparation de ces produits |
| US2964560A (en) * | 1955-11-28 | 1960-12-13 | Boehringer & Soehne Gmbh | Orally effective compounds for treating diabetes and a process of making same |
| US3198706A (en) * | 1956-07-31 | 1965-08-03 | Hoechst Ag | Methods of reducing blood sugar and compositions therefor |
| GB831044A (en) * | 1959-03-05 | 1960-03-23 | Boehringer & Soehne Gmbh | Benzene sulphonyl ureas |
-
1963
- 1963-09-25 DE DEF40828A patent/DE1198354B/de active Pending
-
1964
- 1964-03-31 GB GB1316564A patent/GB1054758A/en not_active Expired
- 1964-09-21 US US398106A patent/US3336322A/en not_active Expired - Lifetime
- 1964-09-22 NO NO154850A patent/NO117362B/no unknown
- 1964-09-23 CH CH1235464A patent/CH451111A/de unknown
- 1964-09-23 AT AT813164A patent/AT253523B/de active
- 1964-09-23 CH CH1235564A patent/CH448053A/de unknown
- 1964-09-23 AT AT813264A patent/AT252934B/de active
- 1964-09-23 AT AT813064A patent/AT253522B/de active
- 1964-09-23 CH CH1235664A patent/CH444840A/de unknown
- 1964-09-23 CH CH1558367A patent/CH451911A/de unknown
- 1964-09-23 AT AT812964A patent/AT254892B/de active
- 1964-09-23 CH CH1235364A patent/CH448052A/de unknown
- 1964-09-24 DK DK470464AA patent/DK106793C/da active
- 1964-09-24 NO NO154882A patent/NO117851B/no unknown
- 1964-09-24 DK DK470364AA patent/DK105642C/da active
- 1964-09-24 DK DK470264AA patent/DK119104B/da unknown
- 1964-09-24 IL IL22148A patent/IL22148A/en unknown
- 1964-09-24 BR BR162883/64A patent/BR6462883D0/pt unknown
- 1964-09-24 FI FI2028/64A patent/FI41023B/fi active
- 1964-09-24 DK DK470564AA patent/DK109675C/da active
- 1964-09-24 NO NO154884A patent/NO118547B/no unknown
- 1964-09-24 NO NO154883A patent/NO117744B/no unknown
- 1964-09-25 SE SE11511/64A patent/SE310665B/xx unknown
- 1964-09-25 FR FR989291A patent/FR1431690A/fr not_active Expired
- 1964-12-24 FR FR999884A patent/FR3940M/fr not_active Expired
-
1965
- 1965-03-25 BE BE653586A patent/BE653586A/xx unknown
- 1965-11-18 BE BE672496A patent/BE672496R/fr active
Also Published As
| Publication number | Publication date |
|---|---|
| AT253522B (de) | 1967-04-10 |
| AT252934B (de) | 1967-03-10 |
| SE310665B (show.php) | 1969-05-12 |
| NO118547B (show.php) | 1970-01-12 |
| DK106793C (da) | 1967-03-20 |
| NO117851B (show.php) | 1969-10-06 |
| BE653586A (show.php) | 1965-03-25 |
| CH451111A (de) | 1968-05-15 |
| CH444840A (de) | 1967-10-15 |
| CH451911A (de) | 1968-05-15 |
| AT253523B (de) | 1967-04-10 |
| BE672496R (fr) | 1966-03-16 |
| BR6462883D0 (pt) | 1973-08-07 |
| NO117362B (show.php) | 1969-08-04 |
| CH448053A (de) | 1967-12-15 |
| DE1198354B (de) | 1965-08-12 |
| DK109675C (da) | 1968-06-04 |
| AT254892B (de) | 1967-06-12 |
| FR3940M (show.php) | 1966-03-28 |
| NO117744B (show.php) | 1969-09-22 |
| FI41023B (show.php) | 1969-04-30 |
| DK105642C (da) | 1966-10-24 |
| US3336322A (en) | 1967-08-15 |
| CH448052A (de) | 1967-12-15 |
| DK119104B (da) | 1970-11-16 |
| FR1431690A (fr) | 1966-03-18 |
| GB1054758A (show.php) | 1967-01-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO162257B (no) | Fremgangm te for flytendegjoering av naturgass samtur dertil. | |
| US4315940A (en) | Antidiabetic 1-piperidine-sulfonylureas | |
| US3406199A (en) | Benzenesulfonyl ureas and process for their manufacture | |
| DE1518879C3 (de) | Benzolsulfonylharnstoffe, Verfahren zu Ihrer Herstellung und diese enthaltende pharmazeutische Präparate | |
| IL22148A (en) | Benzenesulfonyl ureas | |
| US3102121A (en) | Novel cumaransulfonylureas and 2,3-dihydrothionaphthenesulfonylureas | |
| US3504026A (en) | Benzenesulfonyl-ureas | |
| DE2621958A1 (de) | Benzolsulfonylharnstoffe und verfahren zu ihrer herstellung | |
| US3998968A (en) | Benzenesulfonyl ureas and process for their manufacture | |
| US3435116A (en) | The treatment of diabetes mellitus with benzenesulfonyl ureas | |
| US3454636A (en) | Benzenesulfonyl-ureas and process for their manufacture | |
| US3384757A (en) | Benzene sulfonyl ureas and process for their preparation | |
| DE1568648C3 (de) | Benzolsulfonylharnstoffe, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate | |
| IL42558A (en) | History of N - Transformed - 'N -} 4 -] 2 -) 2 - Aminobenzamido (ethyl [benzene {and N] 2 - Aminobenzamido (India] Sulfonylurea and process for their preparation | |
| PL80492B1 (en) | N - (4-(beta-<2-methoxy-5-chloro-benzamido>-ethyl) - benzenesulfonyl)-n'-cyclopentyl-urea and process for its manufacture[us3754030a] | |
| US3709908A (en) | Benzenesulfonyl ureas having hypoglycemic activity | |
| CH392498A (de) | Verfahren zur Herstellung von neuen Benzolsulfonyl-cyclohexyl-harnstoffen | |
| DE1545810A1 (de) | Verfahren zur Herstellung von Benzolsulfonylsemicarbaziden | |
| IL26927A (en) | Benzenesulfonyl-ureas and process for their manufacture | |
| US3475450A (en) | Arylsulfonylureas and arylsulfonylthioureas | |
| US3202680A (en) | New benzenesulfonyl ureas and process for their manufacture | |
| DE1793111C3 (de) | Acylaminoäthylbenzolsulfonyl-delta hoch 2-cyclohexenyl-harnstoffe, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate | |
| DE1670945C3 (de) | Arylsulfonylharnstoffe, Verfahren zu deren Herstellung und orales Antidiabetikum | |
| KR800000448B1 (ko) | 벤젠설포닐-우레아의 제조방법 | |
| CH504418A (de) | Verfahren zur Herstellung von Benzolsulfonylharnstoffen |