IL107470A - Pyrrole thiocarboxamide compounds, their use as insecticidal and acaricidal agents and compositions containing them - Google Patents
Pyrrole thiocarboxamide compounds, their use as insecticidal and acaricidal agents and compositions containing themInfo
- Publication number
- IL107470A IL107470A IL107470A IL10747093A IL107470A IL 107470 A IL107470 A IL 107470A IL 107470 A IL107470 A IL 107470A IL 10747093 A IL10747093 A IL 10747093A IL 107470 A IL107470 A IL 107470A
- Authority
- IL
- Israel
- Prior art keywords
- groups
- halogen atoms
- optionally substituted
- alkyl
- phenyl
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 44
- SDRYNUAQSCIOEI-UHFFFAOYSA-N C(=S)N.N1C=CC=C1 Chemical class C(=S)N.N1C=CC=C1 SDRYNUAQSCIOEI-UHFFFAOYSA-N 0.000 title abstract description 19
- 230000000895 acaricidal effect Effects 0.000 title description 13
- 230000000749 insecticidal effect Effects 0.000 title description 9
- 150000001875 compounds Chemical class 0.000 claims abstract description 31
- 241000238876 Acari Species 0.000 claims abstract description 22
- 241000238631 Hexapoda Species 0.000 claims abstract description 20
- 238000000034 method Methods 0.000 claims abstract description 15
- 125000005843 halogen group Chemical group 0.000 claims description 182
- 125000000217 alkyl group Chemical group 0.000 claims description 137
- 125000003545 alkoxy group Chemical group 0.000 claims description 79
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 67
- 229910052739 hydrogen Inorganic materials 0.000 claims description 57
- -1 phenylcarbonyloxy group Chemical group 0.000 claims description 57
- 239000001257 hydrogen Substances 0.000 claims description 54
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 24
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 22
- 229910052794 bromium Inorganic materials 0.000 claims description 17
- CPRRHERYRRXBRZ-SRVKXCTJSA-N methyl n-[(2s)-1-[[(2s)-1-hydroxy-3-[(3s)-2-oxopyrrolidin-3-yl]propan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate Chemical group COC(=O)N[C@@H](CC(C)C)C(=O)N[C@H](CO)C[C@@H]1CCNC1=O CPRRHERYRRXBRZ-SRVKXCTJSA-N 0.000 claims description 15
- 125000004414 alkyl thio group Chemical group 0.000 claims description 13
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 12
- 125000004429 atom Chemical group 0.000 claims description 12
- 229910052799 carbon Inorganic materials 0.000 claims description 12
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 12
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 11
- 125000000168 pyrrolyl group Chemical group 0.000 claims description 10
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 claims description 9
- 125000003808 silyl group Chemical group [H][Si]([H])([H])[*] 0.000 claims description 9
- 125000005196 alkyl carbonyloxy group Chemical group 0.000 claims description 8
- 125000000304 alkynyl group Chemical group 0.000 claims description 8
- 239000002689 soil Substances 0.000 claims description 8
- 125000003342 alkenyl group Chemical group 0.000 claims description 7
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 7
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 7
- 125000004644 alkyl sulfinyl group Chemical group 0.000 claims description 6
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 6
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical group 0.000 claims description 5
- 229910052717 sulfur Inorganic materials 0.000 claims description 5
- HKFMZOYBXJKQLR-UHFFFAOYSA-N 4-cyano-1h-pyrrole-2-carbothioamide Chemical compound NC(=S)C1=CC(C#N)=CN1 HKFMZOYBXJKQLR-UHFFFAOYSA-N 0.000 claims description 4
- 125000005193 alkenylcarbonyloxy group Chemical group 0.000 claims description 4
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 claims description 4
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 3
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 claims description 3
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 claims description 3
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 claims description 3
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 claims description 3
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 claims description 3
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 claims description 3
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 claims description 3
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 claims description 3
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 claims description 3
- 125000002373 5 membered heterocyclic group Chemical group 0.000 claims description 3
- 125000004070 6 membered heterocyclic group Chemical group 0.000 claims description 3
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 3
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 claims description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 3
- 235000013305 food Nutrition 0.000 claims description 3
- JCXJVPUVTGWSNB-UHFFFAOYSA-N nitrogen dioxide Inorganic materials O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 claims description 3
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 3
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 claims description 2
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 claims description 2
- 125000003302 alkenyloxy group Chemical group 0.000 claims description 2
- 238000009395 breeding Methods 0.000 claims description 2
- 230000001488 breeding effect Effects 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims description 2
- 150000002431 hydrogen Chemical group 0.000 claims 18
- BUCKPSKRQTZTSU-UHFFFAOYSA-N 4-(2,3-dichlorophenyl)-1h-pyrrole-3-carbothioamide Chemical compound NC(=S)C1=CNC=C1C1=CC=CC(Cl)=C1Cl BUCKPSKRQTZTSU-UHFFFAOYSA-N 0.000 claims 2
- GZFYGYINBTXKQL-UHFFFAOYSA-N 4-bromo-2-(4-chlorophenyl)-1-(ethoxymethyl)-n-methyl-5-(trifluoromethyl)pyrrole-3-carbothioamide Chemical compound BrC1=C(C(F)(F)F)N(COCC)C(C=2C=CC(Cl)=CC=2)=C1C(=S)NC GZFYGYINBTXKQL-UHFFFAOYSA-N 0.000 claims 2
- CHEUIIGNMUVXAU-UHFFFAOYSA-N 4-bromo-2-(4-chlorophenyl)-1-(ethoxymethyl)-5-(trifluoromethyl)pyrrole-3-carbothioamide Chemical compound BrC1=C(C(F)(F)F)N(COCC)C(C=2C=CC(Cl)=CC=2)=C1C(N)=S CHEUIIGNMUVXAU-UHFFFAOYSA-N 0.000 claims 1
- 125000003320 C2-C6 alkenyloxy group Chemical group 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 27
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 24
- 239000007787 solid Substances 0.000 description 20
- 238000002360 preparation method Methods 0.000 description 17
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 16
- 241000196324 Embryophyta Species 0.000 description 14
- 239000000047 product Substances 0.000 description 14
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 12
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical class CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 12
- 238000012360 testing method Methods 0.000 description 11
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 9
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 8
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 8
- 239000000741 silica gel Substances 0.000 description 7
- 229910002027 silica gel Inorganic materials 0.000 description 7
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 229910052783 alkali metal Inorganic materials 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- 238000004458 analytical method Methods 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- 238000004587 chromatography analysis Methods 0.000 description 5
- 238000011156 evaluation Methods 0.000 description 5
- 238000009472 formulation Methods 0.000 description 5
- 239000002917 insecticide Substances 0.000 description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 230000003595 spectral effect Effects 0.000 description 5
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 4
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 4
- 238000005481 NMR spectroscopy Methods 0.000 description 4
- 239000000642 acaricide Substances 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- 238000010586 diagram Methods 0.000 description 4
- ZMXDDKWLCZADIW-UHFFFAOYSA-N dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 4
- 239000003921 oil Substances 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- 238000011282 treatment Methods 0.000 description 4
- 229940086542 triethylamine Drugs 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- 239000004480 active ingredient Substances 0.000 description 3
- 150000001350 alkyl halides Chemical class 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- FCYRSDMGOLYDHL-UHFFFAOYSA-N chloromethoxyethane Chemical compound CCOCCl FCYRSDMGOLYDHL-UHFFFAOYSA-N 0.000 description 3
- 239000012141 concentrate Substances 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- CFHGBZLNZZVTAY-UHFFFAOYSA-N lawesson's reagent Chemical compound C1=CC(OC)=CC=C1P1(=S)SP(=S)(C=2C=CC(OC)=CC=2)S1 CFHGBZLNZZVTAY-UHFFFAOYSA-N 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 239000012312 sodium hydride Substances 0.000 description 3
- 229910000104 sodium hydride Inorganic materials 0.000 description 3
- 239000000454 talc Substances 0.000 description 3
- 229910052623 talc Inorganic materials 0.000 description 3
- 125000000464 thioxo group Chemical group S=* 0.000 description 3
- RLOQBKJCOAXOLR-UHFFFAOYSA-N 1h-pyrrole-2-carboxamide Chemical compound NC(=O)C1=CC=CN1 RLOQBKJCOAXOLR-UHFFFAOYSA-N 0.000 description 2
- RHSPTIUSWBEMTD-UHFFFAOYSA-N 4-(2,3-dichlorophenyl)-1h-pyrrole-3-carboxylic acid Chemical compound OC(=O)C1=CNC=C1C1=CC=CC(Cl)=C1Cl RHSPTIUSWBEMTD-UHFFFAOYSA-N 0.000 description 2
- AXEVMUOKFNZGFI-UHFFFAOYSA-N 4-bromo-2-(4-chlorophenyl)-1-(ethoxymethyl)-5-(trifluoromethyl)pyrrole-3-carboxylic acid Chemical compound BrC1=C(C(F)(F)F)N(COCC)C(C=2C=CC(Cl)=CC=2)=C1C(O)=O AXEVMUOKFNZGFI-UHFFFAOYSA-N 0.000 description 2
- ULKRPHYHFUBTEZ-UHFFFAOYSA-N 4-cyano-1h-pyrrole-2-carboxamide Chemical compound NC(=O)C1=CC(C#N)=CN1 ULKRPHYHFUBTEZ-UHFFFAOYSA-N 0.000 description 2
- GZOKBSGKQFQHRS-UHFFFAOYSA-N 5-(2,2,2-trichloroacetyl)-1h-pyrrole-3-carbonitrile Chemical compound ClC(Cl)(Cl)C(=O)C1=CC(C#N)=CN1 GZOKBSGKQFQHRS-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical class [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- 244000045232 Canavalia ensiformis Species 0.000 description 2
- 244000166102 Eucalyptus leucoxylon Species 0.000 description 2
- 235000004694 Eucalyptus leucoxylon Nutrition 0.000 description 2
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- 241001521235 Spodoptera eridania Species 0.000 description 2
- 241000607479 Yersinia pestis Species 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 238000013019 agitation Methods 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 239000000428 dust Substances 0.000 description 2
- 239000004495 emulsifiable concentrate Substances 0.000 description 2
- SVYCGHOTVMOUMC-UHFFFAOYSA-N ethyl 3-(2,3-dichlorophenyl)prop-2-enoate Chemical compound CCOC(=O)C=CC1=CC=CC(Cl)=C1Cl SVYCGHOTVMOUMC-UHFFFAOYSA-N 0.000 description 2
- FUKPTHDLKFWUGQ-UHFFFAOYSA-N ethyl 4-(2,3-dichlorophenyl)-1h-pyrrole-3-carboxylate Chemical compound CCOC(=O)C1=CNC=C1C1=CC=CC(Cl)=C1Cl FUKPTHDLKFWUGQ-UHFFFAOYSA-N 0.000 description 2
- HJOVHMDZYOCNQW-UHFFFAOYSA-N isophorone Chemical compound CC1=CC(=O)CC(C)(C)C1 HJOVHMDZYOCNQW-UHFFFAOYSA-N 0.000 description 2
- 239000002736 nonionic surfactant Substances 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- AHWALFGBDFAJAI-UHFFFAOYSA-N phenyl carbonochloridate Chemical class ClC(=O)OC1=CC=CC=C1 AHWALFGBDFAJAI-UHFFFAOYSA-N 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- CFOAUYCPAUGDFF-UHFFFAOYSA-N tosmic Chemical compound CC1=CC=C(S(=O)(=O)C[N+]#[C-])C=C1 CFOAUYCPAUGDFF-UHFFFAOYSA-N 0.000 description 2
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 1
- ARXJGSRGQADJSQ-UHFFFAOYSA-N 1-methoxypropan-2-ol Chemical compound COCC(C)O ARXJGSRGQADJSQ-UHFFFAOYSA-N 0.000 description 1
- 238000001644 13C nuclear magnetic resonance spectroscopy Methods 0.000 description 1
- BQMPGKPTOHKYHS-UHFFFAOYSA-N 1h-pyrrole-2-carbonitrile Chemical compound N#CC1=CC=CN1 BQMPGKPTOHKYHS-UHFFFAOYSA-N 0.000 description 1
- KJEMJZMJDZLKRH-UHFFFAOYSA-N 1h-pyrrole-2-carbothioamide Chemical compound NC(=S)C1=CC=CN1 KJEMJZMJDZLKRH-UHFFFAOYSA-N 0.000 description 1
- UFTWMKYNRHJPES-UHFFFAOYSA-N 1h-pyrrole-3-carbothioamide Chemical compound NC(=S)C=1C=CNC=1 UFTWMKYNRHJPES-UHFFFAOYSA-N 0.000 description 1
- LLMLNAVBOAMOEE-UHFFFAOYSA-N 2,3-dichlorobenzaldehyde Chemical compound ClC1=CC=CC(C=O)=C1Cl LLMLNAVBOAMOEE-UHFFFAOYSA-N 0.000 description 1
- WCJPNRPWRIZFEG-UHFFFAOYSA-N 2,4,5-tribromo-1-methylpyrrole-3-carbonitrile Chemical compound CN1C(Br)=C(Br)C(C#N)=C1Br WCJPNRPWRIZFEG-UHFFFAOYSA-N 0.000 description 1
- POAOYUHQDCAZBD-UHFFFAOYSA-N 2-butoxyethanol Chemical compound CCCCOCCO POAOYUHQDCAZBD-UHFFFAOYSA-N 0.000 description 1
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 1
- SSNSHKKIAFJOTF-UHFFFAOYSA-N 4-(2,3-dichlorophenyl)-1h-pyrrole-3-carboxamide Chemical compound NC(=O)C1=CNC=C1C1=CC=CC(Cl)=C1Cl SSNSHKKIAFJOTF-UHFFFAOYSA-N 0.000 description 1
- AJEIOIYQMBJVDC-UHFFFAOYSA-N 4-bromo-2-(4-chlorophenyl)-1-(ethoxymethyl)-5-(trifluoromethyl)pyrrole-3-carboxamide Chemical compound BrC1=C(C(F)(F)F)N(COCC)C(C=2C=CC(Cl)=CC=2)=C1C(N)=O AJEIOIYQMBJVDC-UHFFFAOYSA-N 0.000 description 1
- VJIVSBNSDXYXPB-UHFFFAOYSA-N 4-bromo-2-(4-chlorophenyl)-1-(ethoxymethyl)-n,n-dimethyl-5-(trifluoromethyl)pyrrole-3-carbothioamide Chemical compound BrC1=C(C(F)(F)F)N(COCC)C(C=2C=CC(Cl)=CC=2)=C1C(=S)N(C)C VJIVSBNSDXYXPB-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 241000239290 Araneae Species 0.000 description 1
- 241000193388 Bacillus thuringiensis Species 0.000 description 1
- OQHIOKDKKJFXHR-UHFFFAOYSA-N C1=CC(OC)=CC=C1P1(=S)SP(=S)S1 Chemical compound C1=CC(OC)=CC=C1P1(=S)SP(=S)S1 OQHIOKDKKJFXHR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- 241000489976 Diabrotica undecimpunctata howardi Species 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- KBEBGUQPQBELIU-CMDGGOBGSA-N Ethyl cinnamate Chemical class CCOC(=O)\C=C\C1=CC=CC=C1 KBEBGUQPQBELIU-CMDGGOBGSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- PNKUSGQVOMIXLU-UHFFFAOYSA-N Formamidine Chemical class NC=N PNKUSGQVOMIXLU-UHFFFAOYSA-N 0.000 description 1
- 241000256257 Heliothis Species 0.000 description 1
- 241000256244 Heliothis virescens Species 0.000 description 1
- LELOWRISYMNNSU-UHFFFAOYSA-N Hydrocyanic acid Natural products N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 235000010617 Phaseolus lunatus Nutrition 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 1
- 244000062793 Sorghum vulgare Species 0.000 description 1
- 241001454293 Tetranychus urticae Species 0.000 description 1
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 1
- 230000009418 agronomic effect Effects 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- 229940097012 bacillus thuringiensis Drugs 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- VEMKTZHHVJILDY-UXHICEINSA-N bioresmethrin Chemical compound CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)OCC1=COC(CC=2C=CC=CC=2)=C1 VEMKTZHHVJILDY-UXHICEINSA-N 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 235000013877 carbamide Nutrition 0.000 description 1
- 150000003857 carboxamides Chemical class 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- CWFOCCVIPCEQCK-UHFFFAOYSA-N chlorfenapyr Chemical compound BrC1=C(C(F)(F)F)N(COCC)C(C=2C=CC(Cl)=CC=2)=C1C#N CWFOCCVIPCEQCK-UHFFFAOYSA-N 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 229940114081 cinnamate Drugs 0.000 description 1
- KBEBGUQPQBELIU-UHFFFAOYSA-N cinnamic acid ethyl ester Natural products CCOC(=O)C=CC1=CC=CC=C1 KBEBGUQPQBELIU-UHFFFAOYSA-N 0.000 description 1
- ATDGTVJJHBUTRL-UHFFFAOYSA-N cyanogen bromide Chemical compound BrC#N ATDGTVJJHBUTRL-UHFFFAOYSA-N 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 235000013601 eggs Nutrition 0.000 description 1
- 239000002158 endotoxin Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 230000009969 flowable effect Effects 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- CYEBJEDOHLIWNP-UHFFFAOYSA-N methanethioamide Chemical compound NC=S CYEBJEDOHLIWNP-UHFFFAOYSA-N 0.000 description 1
- NDMHJEXUTLCTLH-UHFFFAOYSA-N methyl 2-(4-chlorophenyl)-5-(trifluoromethyl)-1h-pyrrole-3-carboxylate Chemical compound C1=C(C(F)(F)F)NC(C=2C=CC(Cl)=CC=2)=C1C(=O)OC NDMHJEXUTLCTLH-UHFFFAOYSA-N 0.000 description 1
- XPYOXNVTRGPIOT-UHFFFAOYSA-N methyl 4-bromo-2-(4-chlorophenyl)-5-(trifluoromethyl)-1h-pyrrole-3-carboxylate Chemical compound BrC1=C(C(F)(F)F)NC(C=2C=CC(Cl)=CC=2)=C1C(=O)OC XPYOXNVTRGPIOT-UHFFFAOYSA-N 0.000 description 1
- 239000004530 micro-emulsion Substances 0.000 description 1
- 235000019713 millet Nutrition 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- UYDLBVPAAFVANX-UHFFFAOYSA-N octylphenoxy polyethoxyethanol Chemical compound CC(C)(C)CC(C)(C)C1=CC=C(OCCOCCOCCOCCO)C=C1 UYDLBVPAAFVANX-UHFFFAOYSA-N 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- 239000000123 paper Substances 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- HXTSPGYEPSIZKP-UHFFFAOYSA-N phenol;tin Chemical class [Sn].OC1=CC=CC=C1 HXTSPGYEPSIZKP-UHFFFAOYSA-N 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- XUYJLQHKOGNDPB-UHFFFAOYSA-N phosphonoacetic acid Chemical compound OC(=O)CP(O)(O)=O XUYJLQHKOGNDPB-UHFFFAOYSA-N 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- ROSDSFDQCJNGOL-UHFFFAOYSA-N protonated dimethyl amine Natural products CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- DOYOPBSXEIZLRE-UHFFFAOYSA-N pyrrole-3-carboxylic acid Chemical compound OC(=O)C=1C=CNC=1 DOYOPBSXEIZLRE-UHFFFAOYSA-N 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 229920005552 sodium lignosulfonate Polymers 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000010183 spectrum analysis Methods 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000004546 suspension concentrate Substances 0.000 description 1
- 239000004557 technical material Substances 0.000 description 1
- FBWNMEQMRUMQSO-UHFFFAOYSA-N tergitol NP-9 Chemical compound CCCCCCCCCC1=CC=C(OCCOCCOCCOCCOCCOCCOCCOCCOCCO)C=C1 FBWNMEQMRUMQSO-UHFFFAOYSA-N 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 239000012085 test solution Substances 0.000 description 1
- WBYWAXJHAXSJNI-VOTSOKGWSA-M trans-cinnamate Chemical compound [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- GGUBFICZYGKNTD-UHFFFAOYSA-N triethyl phosphonoacetate Chemical compound CCOC(=O)CP(=O)(OCC)OCC GGUBFICZYGKNTD-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/34—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom
- A01N43/36—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom five-membered rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/34—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Health & Medical Sciences (AREA)
- Environmental Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Plant Pathology (AREA)
- Pest Control & Pesticides (AREA)
- Agronomy & Crop Science (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pyrrole Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US07/971,025 US5286742A (en) | 1992-11-03 | 1992-11-03 | Pyrrole thiocarboxamide insecticidal and acaricidal agents |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL107470A0 IL107470A0 (en) | 1994-02-27 |
| IL107470A true IL107470A (en) | 1998-02-08 |
Family
ID=25517837
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL107470A IL107470A (en) | 1992-11-03 | 1993-11-02 | Pyrrole thiocarboxamide compounds, their use as insecticidal and acaricidal agents and compositions containing them |
Country Status (21)
| Country | Link |
|---|---|
| US (2) | US5286742A (OSRAM) |
| EP (1) | EP0596204B1 (OSRAM) |
| JP (1) | JP3422828B2 (OSRAM) |
| KR (1) | KR940011445A (OSRAM) |
| CN (1) | CN1041629C (OSRAM) |
| AT (1) | ATE139766T1 (OSRAM) |
| AU (1) | AU673009B2 (OSRAM) |
| BR (1) | BR9304444A (OSRAM) |
| CA (1) | CA2102152A1 (OSRAM) |
| CZ (1) | CZ284786B6 (OSRAM) |
| DE (1) | DE69303346T2 (OSRAM) |
| DK (1) | DK0596204T3 (OSRAM) |
| ES (1) | ES2088614T3 (OSRAM) |
| GR (1) | GR3020384T3 (OSRAM) |
| HU (1) | HU216800B (OSRAM) |
| IL (1) | IL107470A (OSRAM) |
| MX (1) | MX9306603A (OSRAM) |
| SG (1) | SG43139A1 (OSRAM) |
| SK (1) | SK280061B6 (OSRAM) |
| TW (1) | TW268002B (OSRAM) |
| ZA (1) | ZA938178B (OSRAM) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5792778A (en) * | 1995-08-10 | 1998-08-11 | Merck & Co., Inc. | 2-substituted aryl pyrroles, compositions containing such compounds and methods of use |
| US5837719A (en) * | 1995-08-10 | 1998-11-17 | Merck & Co., Inc. | 2,5-substituted aryl pyrroles, compositions containing such compounds and methods of use |
| US5776954A (en) * | 1996-10-30 | 1998-07-07 | Merck & Co., Inc. | Substituted pyridyl pyrroles, compositions containing such compounds and methods of use |
| WO2006036024A1 (ja) * | 2004-09-30 | 2006-04-06 | Takeda Pharmaceutical Company Limited | プロトンポンプ阻害薬 |
| PT2327692E (pt) * | 2005-08-30 | 2012-10-11 | Takeda Pharmaceutical | Derivados de 1h-pirrole substituídos com 1-heterociclilsulfonilo, 2-aminometilo, 5-(hetero)arilo como inibidores da secreção ácida |
| US8933105B2 (en) * | 2007-02-28 | 2015-01-13 | Takeda Pharmaceutical Company Limited | Pyrrole compounds |
| AU2008281772B2 (en) * | 2007-07-31 | 2013-05-30 | Bayer Intellectual Property Gmbh | Fungicidal N-cycloalkyl-benzyl-thiocarboxamides or N-cycloalkyl-benzyl-N' -substituted-amidine derivatives |
| US8969387B2 (en) * | 2008-08-27 | 2015-03-03 | Takeda Pharmaceutical Company Limited | Pyrrole compounds |
| TWI501608B (zh) | 2009-01-23 | 2015-09-21 | Ind Tech Res Inst | 資料收集之方法及其主動裝置與從動裝置 |
| CN105622598B (zh) * | 2016-02-26 | 2017-12-22 | 河南好年景生物发展有限公司 | 用于杀虫的芳基吡咯腈类化合物及制备方法和用途以及农用杀虫剂及防治害虫方法 |
| CN120289436A (zh) * | 2024-01-10 | 2025-07-11 | 青岛清原化合物有限公司 | 吡咯类化合物及其应用 |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR90M (OSRAM) * | 1963-05-21 | 1961-01-09 | ||
| US5187185A (en) * | 1988-12-09 | 1993-02-16 | Rhone-Poulenc Ag Company | Pesticidal 1-arylpyrroles |
| FR2569189B1 (fr) * | 1984-08-14 | 1986-12-19 | Roussel Uclaf | Nouveaux derives du pyrrole, leur procede de preparation et leur application comme pesticides |
| CN1015626B (zh) * | 1985-04-23 | 1992-02-26 | 鲁塞尔-于克拉夫公司 | 制备新的吡咯衍生物的方法 |
| GB8609452D0 (en) * | 1986-04-17 | 1986-05-21 | Ici Plc | Fungicides |
| US5010098A (en) * | 1987-07-29 | 1991-04-23 | American Cyanamid Company | Arylpyrrole insecticidal acaricidal and nematicidal agents and methods for the preparation thereof |
| US5162308A (en) * | 1988-12-05 | 1992-11-10 | American Cyanamid Company | Pyrrole carbonitrile and nitropyrrole insecticidal, acaricidal and molluscicidal agents and methods for the preparation thereof |
| AU641905B2 (en) * | 1988-12-09 | 1993-10-07 | Rhone-Poulenc Agrochimie | 1-substituted-phenyl pyrrole derivatives as insecticides and methods for their production |
| DE9002780U1 (de) * | 1990-03-09 | 1990-05-10 | Claas Ohg, 4834 Harsewinkel | Trommel- und Scheibenhäcksler |
| US5157047A (en) * | 1990-10-18 | 1992-10-20 | American Cyanamid Company | Bis- and tris(trifluoromethyl)arylpyrrole insecticidal and acaricidal agents |
-
1992
- 1992-11-03 US US07/971,025 patent/US5286742A/en not_active Expired - Fee Related
-
1993
- 1993-08-05 DE DE69303346T patent/DE69303346T2/de not_active Expired - Fee Related
- 1993-08-05 EP EP93112562A patent/EP0596204B1/en not_active Expired - Lifetime
- 1993-08-05 AT AT93112562T patent/ATE139766T1/de not_active IP Right Cessation
- 1993-08-05 DK DK93112562.9T patent/DK0596204T3/da active
- 1993-08-05 ES ES93112562T patent/ES2088614T3/es not_active Expired - Lifetime
- 1993-08-05 SG SG1996004231A patent/SG43139A1/en unknown
- 1993-08-16 TW TW082106560A patent/TW268002B/zh active
- 1993-10-14 CZ CZ932171A patent/CZ284786B6/cs not_active IP Right Cessation
- 1993-10-19 SK SK1137-93A patent/SK280061B6/sk unknown
- 1993-10-25 MX MX9306603A patent/MX9306603A/es not_active IP Right Cessation
- 1993-10-28 JP JP29270193A patent/JP3422828B2/ja not_active Expired - Fee Related
- 1993-11-01 BR BR9304444A patent/BR9304444A/pt not_active Application Discontinuation
- 1993-11-01 CA CA002102152A patent/CA2102152A1/en not_active Abandoned
- 1993-11-02 IL IL107470A patent/IL107470A/en not_active IP Right Cessation
- 1993-11-02 CN CN93114132A patent/CN1041629C/zh not_active Expired - Fee Related
- 1993-11-02 ZA ZA938178A patent/ZA938178B/xx unknown
- 1993-11-02 HU HU9303108A patent/HU216800B/hu not_active IP Right Cessation
- 1993-11-02 AU AU50420/93A patent/AU673009B2/en not_active Ceased
- 1993-11-02 KR KR1019930023137A patent/KR940011445A/ko not_active Abandoned
- 1993-11-10 US US08/150,626 patent/US5389669A/en not_active Expired - Fee Related
-
1996
- 1996-06-28 GR GR960400473T patent/GR3020384T3/el unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CN1041629C (zh) | 1999-01-13 |
| EP0596204B1 (en) | 1996-06-26 |
| KR940011445A (ko) | 1994-06-21 |
| ZA938178B (en) | 1994-06-08 |
| CZ217193A3 (en) | 1994-05-18 |
| HU9303108D0 (en) | 1994-01-28 |
| SK280061B6 (sk) | 1999-07-12 |
| ES2088614T3 (es) | 1996-08-16 |
| SK113793A3 (en) | 1994-06-08 |
| JP3422828B2 (ja) | 2003-06-30 |
| DK0596204T3 (da) | 1996-07-29 |
| CN1090574A (zh) | 1994-08-10 |
| EP0596204A1 (en) | 1994-05-11 |
| DE69303346T2 (de) | 1997-01-23 |
| DE69303346D1 (de) | 1996-08-01 |
| CA2102152A1 (en) | 1994-05-04 |
| GR3020384T3 (en) | 1996-09-30 |
| TW268002B (OSRAM) | 1996-01-11 |
| US5286742A (en) | 1994-02-15 |
| MX9306603A (es) | 1994-05-31 |
| SG43139A1 (en) | 1997-10-17 |
| IL107470A0 (en) | 1994-02-27 |
| CZ284786B6 (cs) | 1999-03-17 |
| AU673009B2 (en) | 1996-10-24 |
| HU216800B (hu) | 1999-08-30 |
| US5389669A (en) | 1995-02-14 |
| JPH06220013A (ja) | 1994-08-09 |
| BR9304444A (pt) | 1994-05-10 |
| AU5042093A (en) | 1994-05-19 |
| ATE139766T1 (de) | 1996-07-15 |
| HUT66779A (en) | 1994-12-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US5157047A (en) | Bis- and tris(trifluoromethyl)arylpyrrole insecticidal and acaricidal agents | |
| IE893864L (en) | Pyrrole carbonitrile and nitropyrrole insecticidal,¹acaricidal and molluscicidal agents and methods for the¹preparation thereof | |
| US5162308A (en) | Pyrrole carbonitrile and nitropyrrole insecticidal, acaricidal and molluscicidal agents and methods for the preparation thereof | |
| US5389669A (en) | Pyrrole thiocarboxamide insecticidal and acaricidal agents | |
| EP0549866B1 (en) | Haloalkylthio, -sulfinyl and -sulfonyl arylpyrrole insecticidal, acaricidal and fungicidal agents | |
| US5130328A (en) | N-alkanoylaminomethyl and N-aroylaminomethyl pyrrole insecticidal and acaricidal agents | |
| IE911604A1 (en) | New N-acylated arylpyrroles useful as insecticidal, acaricidal, nematicidal and molluscicidal agents | |
| AU610915B2 (en) | Arylpyrrole insecticidal, acaricidal and nematicidal agents and method for the preparation thereof | |
| US5328928A (en) | N-acylated arylpyrroles useful as insecticidal, agents | |
| US5286743A (en) | N-aminoalkylcarbonyloxyalkylpyrrole insecticidal acaricidal and molluscicidal agents | |
| EP0487870B1 (en) | Insecticidal and acaricidal diarylpyrrolecarbonitrile and diarylnitropyrrole compounds | |
| EP0594940B1 (en) | N-oxy- and thioalkylcarbonyloxyalkypyrrole insecticidal, acaricidal and molluscicidal agents | |
| US5229524A (en) | Bis-and tris (trifluoromethyl) arylpyrrole insecticidal and acaricidal agents | |
| US5233052A (en) | Insecticidal and acaricidal diarylpyrrolecarbonitrile and diarylnitropyrrole compounds |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| FF | Patent granted | ||
| KB | Patent renewed | ||
| KB | Patent renewed | ||
| RH1 | Patent not in force |