IE49773B1 - Tickicidal compositions and processes - Google Patents
Tickicidal compositions and processesInfo
- Publication number
- IE49773B1 IE49773B1 IE872/80A IE87280A IE49773B1 IE 49773 B1 IE49773 B1 IE 49773B1 IE 872/80 A IE872/80 A IE 872/80A IE 87280 A IE87280 A IE 87280A IE 49773 B1 IE49773 B1 IE 49773B1
- Authority
- IE
- Ireland
- Prior art keywords
- composition according
- diethyl
- phosphorothioate
- phosphorodithioate
- component
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 86
- 238000000034 method Methods 0.000 title claims abstract description 22
- 241000238680 Rhipicephalus microplus Species 0.000 claims abstract description 23
- -1 cyclopropanecarboxylic acid ester Chemical class 0.000 claims abstract description 23
- 150000002903 organophosphorus compounds Chemical class 0.000 claims abstract description 16
- 239000004480 active ingredient Substances 0.000 claims description 31
- 239000007787 solid Substances 0.000 claims description 15
- RYYWUUFWQRZTIU-UHFFFAOYSA-K thiophosphate Chemical compound [O-]P([O-])([O-])=S RYYWUUFWQRZTIU-UHFFFAOYSA-K 0.000 claims description 15
- 239000001257 hydrogen Substances 0.000 claims description 11
- 229910052739 hydrogen Inorganic materials 0.000 claims description 11
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 10
- 239000000460 chlorine Substances 0.000 claims description 10
- NAGJZTKCGNOGPW-UHFFFAOYSA-K dioxido-sulfanylidene-sulfido-$l^{5}-phosphane Chemical compound [O-]P([O-])([S-])=S NAGJZTKCGNOGPW-UHFFFAOYSA-K 0.000 claims description 10
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 9
- 229910052801 chlorine Inorganic materials 0.000 claims description 9
- 239000011737 fluorine Substances 0.000 claims description 9
- 229910052731 fluorine Inorganic materials 0.000 claims description 9
- 239000000843 powder Substances 0.000 claims description 8
- 150000002431 hydrogen Chemical class 0.000 claims description 7
- 239000000463 material Substances 0.000 claims description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 7
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 claims description 6
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 claims description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 6
- FSAVDKDHPDSCTO-WQLSENKSSA-N [(z)-2-chloro-1-(2,4-dichlorophenyl)ethenyl] diethyl phosphate Chemical compound CCOP(=O)(OCC)O\C(=C/Cl)C1=CC=C(Cl)C=C1Cl FSAVDKDHPDSCTO-WQLSENKSSA-N 0.000 claims description 6
- 238000009472 formulation Methods 0.000 claims description 6
- 239000007788 liquid Substances 0.000 claims description 6
- 229910019142 PO4 Inorganic materials 0.000 claims description 5
- 239000012141 concentrate Substances 0.000 claims description 5
- 235000021317 phosphate Nutrition 0.000 claims description 5
- QPUYECUOLPXSFR-UHFFFAOYSA-N 1-methylnaphthalene Chemical compound C1=CC=C2C(C)=CC=CC2=C1 QPUYECUOLPXSFR-UHFFFAOYSA-N 0.000 claims description 4
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- CPLXHLVBOLITMK-UHFFFAOYSA-N Magnesium oxide Chemical compound [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 claims description 4
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 4
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 claims description 4
- SWXVUIWOUIDPGS-UHFFFAOYSA-N diacetone alcohol Chemical compound CC(=O)CC(C)(C)O SWXVUIWOUIDPGS-UHFFFAOYSA-N 0.000 claims description 4
- 239000006185 dispersion Substances 0.000 claims description 4
- 238000010410 dusting Methods 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- NAGJZTKCGNOGPW-UHFFFAOYSA-N dithiophosphoric acid Chemical class OP(O)(S)=S NAGJZTKCGNOGPW-UHFFFAOYSA-N 0.000 claims description 3
- 239000000839 emulsion Substances 0.000 claims description 3
- 239000008187 granular material Substances 0.000 claims description 3
- 230000000749 insecticidal effect Effects 0.000 claims description 3
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 claims description 3
- 150000003013 phosphoric acid derivatives Chemical class 0.000 claims description 3
- 229910052717 sulfur Inorganic materials 0.000 claims description 3
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 claims description 2
- 239000005909 Kieselgur Substances 0.000 claims description 2
- RYYWUUFWQRZTIU-UHFFFAOYSA-N Thiophosphoric acid Chemical class OP(O)(S)=O RYYWUUFWQRZTIU-UHFFFAOYSA-N 0.000 claims description 2
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 claims description 2
- 229960000892 attapulgite Drugs 0.000 claims description 2
- 229910000019 calcium carbonate Inorganic materials 0.000 claims description 2
- 239000002775 capsule Substances 0.000 claims description 2
- 239000010440 gypsum Substances 0.000 claims description 2
- 229910052602 gypsum Inorganic materials 0.000 claims description 2
- 229910052622 kaolinite Inorganic materials 0.000 claims description 2
- 239000003350 kerosene Substances 0.000 claims description 2
- 239000000395 magnesium oxide Substances 0.000 claims description 2
- 239000003094 microcapsule Substances 0.000 claims description 2
- 229910052625 palygorskite Inorganic materials 0.000 claims description 2
- 239000010452 phosphate Substances 0.000 claims description 2
- 239000004540 pour-on Substances 0.000 claims description 2
- 239000008262 pumice Substances 0.000 claims description 2
- 239000000377 silicon dioxide Substances 0.000 claims description 2
- 239000000454 talc Substances 0.000 claims description 2
- 229910052623 talc Inorganic materials 0.000 claims description 2
- UBOXGVDOUJQMTN-UHFFFAOYSA-N trichloroethylene Natural products ClCC(Cl)Cl UBOXGVDOUJQMTN-UHFFFAOYSA-N 0.000 claims description 2
- 239000008096 xylene Substances 0.000 claims description 2
- 150000003738 xylenes Chemical class 0.000 claims description 2
- DYLIWHYUXAJDOJ-OWOJBTEDSA-N (e)-4-(6-aminopurin-9-yl)but-2-en-1-ol Chemical compound NC1=NC=NC2=C1N=CN2C\C=C\CO DYLIWHYUXAJDOJ-OWOJBTEDSA-N 0.000 claims 2
- SPVZAYWHHVLPBN-UHFFFAOYSA-N 3-(2-chloro-3,3,3-trifluoroprop-1-en-1-yl)-2,2-dimethylcyclopropanecarboxylic acid Chemical compound CC1(C)C(C=C(Cl)C(F)(F)F)C1C(O)=O SPVZAYWHHVLPBN-UHFFFAOYSA-N 0.000 claims 2
- 150000007942 carboxylates Chemical class 0.000 claims 1
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 claims 1
- IRDLUHRVLVEUHA-UHFFFAOYSA-N diethyl dithiophosphate Chemical compound CCOP(S)(=S)OCC IRDLUHRVLVEUHA-UHFFFAOYSA-N 0.000 claims 1
- 229910052901 montmorillonite Inorganic materials 0.000 claims 1
- 241000238876 Acari Species 0.000 abstract description 16
- 206010061217 Infestation Diseases 0.000 abstract description 7
- 230000008029 eradication Effects 0.000 abstract description 4
- 230000002265 prevention Effects 0.000 abstract description 2
- 230000002195 synergetic effect Effects 0.000 abstract description 2
- 241000283690 Bos taurus Species 0.000 description 14
- 150000001875 compounds Chemical class 0.000 description 13
- RIZMRRKBZQXFOY-UHFFFAOYSA-N ethion Chemical compound CCOP(=S)(OCC)SCSP(=S)(OCC)OCC RIZMRRKBZQXFOY-UHFFFAOYSA-N 0.000 description 12
- KWGUFOITWDSNQY-UHFFFAOYSA-N Bromophos-ethyl Chemical group CCOP(=S)(OCC)OC1=CC(Cl)=C(Br)C=C1Cl KWGUFOITWDSNQY-UHFFFAOYSA-N 0.000 description 10
- 241001465754 Metazoa Species 0.000 description 7
- SBPBAQFWLVIOKP-UHFFFAOYSA-N chlorpyrifos Chemical compound CCOP(=S)(OCC)OC1=NC(Cl)=C(Cl)C=C1Cl SBPBAQFWLVIOKP-UHFFFAOYSA-N 0.000 description 7
- YMGUBTXCNDTFJI-UHFFFAOYSA-M cyclopropanecarboxylate Chemical compound [O-]C(=O)C1CC1 YMGUBTXCNDTFJI-UHFFFAOYSA-M 0.000 description 5
- YMGUBTXCNDTFJI-UHFFFAOYSA-N cyclopropanecarboxylic acid Chemical class OC(=O)C1CC1 YMGUBTXCNDTFJI-UHFFFAOYSA-N 0.000 description 5
- FHIVAFMUCKRCQO-UHFFFAOYSA-N diazinon Chemical compound CCOP(=S)(OCC)OC1=CC(C)=NC(C(C)C)=N1 FHIVAFMUCKRCQO-UHFFFAOYSA-N 0.000 description 5
- 241001481703 Rhipicephalus <genus> Species 0.000 description 4
- BXNANOICGRISHX-UHFFFAOYSA-N coumaphos Chemical compound CC1=C(Cl)C(=O)OC2=CC(OP(=S)(OCC)OCC)=CC=C21 BXNANOICGRISHX-UHFFFAOYSA-N 0.000 description 4
- 239000012669 liquid formulation Substances 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 238000003860 storage Methods 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- VEDTXTNSFWUXGQ-UHFFFAOYSA-N Carbophenothion Chemical compound CCOP(=S)(OCC)SCSC1=CC=C(Cl)C=C1 VEDTXTNSFWUXGQ-UHFFFAOYSA-N 0.000 description 3
- VBKKVDGJXVOLNE-UHFFFAOYSA-N Dioxation Chemical compound CCOP(=S)(OCC)SC1OCCOC1SP(=S)(OCC)OCC VBKKVDGJXVOLNE-UHFFFAOYSA-N 0.000 description 3
- PNVJTZOFSHSLTO-UHFFFAOYSA-N Fenthion Chemical compound COP(=S)(OC)OC1=CC=C(SC)C(C)=C1 PNVJTZOFSHSLTO-UHFFFAOYSA-N 0.000 description 3
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical group [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 3
- TZBPRYIIJAJUOY-UHFFFAOYSA-N Pirimiphos-ethyl Chemical group CCOP(=S)(OCC)OC1=CC(C)=NC(N(CC)CC)=N1 TZBPRYIIJAJUOY-UHFFFAOYSA-N 0.000 description 3
- 241000607479 Yersinia pestis Species 0.000 description 3
- 150000001409 amidines Chemical class 0.000 description 3
- 230000000052 comparative effect Effects 0.000 description 3
- 230000001419 dependent effect Effects 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 125000000623 heterocyclic group Chemical group 0.000 description 3
- 229910052698 phosphorus Inorganic materials 0.000 description 3
- 239000011574 phosphorus Substances 0.000 description 3
- 239000008247 solid mixture Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 239000007921 spray Substances 0.000 description 3
- 239000000080 wetting agent Substances 0.000 description 3
- SPVZAYWHHVLPBN-INEUFUBQSA-N (1s,3s)-3-(2-chloro-3,3,3-trifluoroprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylic acid Chemical compound CC1(C)[C@H](C=C(Cl)C(F)(F)F)[C@@H]1C(O)=O SPVZAYWHHVLPBN-INEUFUBQSA-N 0.000 description 2
- 241000238889 Ixodidae Species 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 229910052785 arsenic Inorganic materials 0.000 description 2
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 230000003631 expected effect Effects 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- JISACBWYRJHSMG-UHFFFAOYSA-N famphur Chemical compound COP(=S)(OC)OC1=CC=C(S(=O)(=O)N(C)C)C=C1 JISACBWYRJHSMG-UHFFFAOYSA-N 0.000 description 2
- 125000001153 fluoro group Chemical group F* 0.000 description 2
- 230000007774 longterm Effects 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000002736 nonionic surfactant Substances 0.000 description 2
- 230000000361 pesticidal effect Effects 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 239000002728 pyrethroid Substances 0.000 description 2
- 239000000375 suspending agent Substances 0.000 description 2
- 208000031295 Animal disease Diseases 0.000 description 1
- NYQDCVLCJXRDSK-UHFFFAOYSA-N Bromofos Chemical compound COP(=S)(OC)OC1=CC(Cl)=C(Br)C=C1Cl NYQDCVLCJXRDSK-UHFFFAOYSA-N 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- 241001480824 Dermacentor Species 0.000 description 1
- CZGGKXNYNPJFAX-UHFFFAOYSA-N Dimethyldithiophosphate Chemical compound COP(S)(=S)OC CZGGKXNYNPJFAX-UHFFFAOYSA-N 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- 241000283086 Equidae Species 0.000 description 1
- 241000238631 Hexapoda Species 0.000 description 1
- 101001054645 Homo sapiens Integrator complex subunit 13 Proteins 0.000 description 1
- 241001480803 Hyalomma Species 0.000 description 1
- 102100027019 Integrator complex subunit 13 Human genes 0.000 description 1
- 241000238681 Ixodes Species 0.000 description 1
- ONIBWKKTOPOVIA-BYPYZUCNSA-N L-Proline Chemical compound OC(=O)[C@@H]1CCCN1 ONIBWKKTOPOVIA-BYPYZUCNSA-N 0.000 description 1
- 241001494479 Pecora Species 0.000 description 1
- 239000005921 Phosmet Substances 0.000 description 1
- 208000005374 Poisoning Diseases 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 229920001328 Polyvinylidene chloride Polymers 0.000 description 1
- 239000011149 active material Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 150000007824 aliphatic compounds Chemical class 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000003945 anionic surfactant Substances 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- CVXBEEMKQHEXEN-UHFFFAOYSA-N carbaryl Chemical compound C1=CC=C2C(OC(=O)NC)=CC=CC2=C1 CVXBEEMKQHEXEN-UHFFFAOYSA-N 0.000 description 1
- 229960005286 carbaryl Drugs 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- FSAVDKDHPDSCTO-UHFFFAOYSA-N chlorfenvinfos Chemical compound CCOP(=O)(OCC)OC(=CCl)C1=CC=C(Cl)C=C1Cl FSAVDKDHPDSCTO-UHFFFAOYSA-N 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 230000002079 cooperative effect Effects 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 125000004188 dichlorophenyl group Chemical group 0.000 description 1
- WGWJBWHBOKETRC-UHFFFAOYSA-N diethoxy-(3-methyl-4-methylsulfanylphenoxy)-sulfanylidene-$l^{5}-phosphane Chemical group CCOP(=S)(OCC)OC1=CC=C(SC)C(C)=C1 WGWJBWHBOKETRC-UHFFFAOYSA-N 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 238000007598 dipping method Methods 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 235000013601 eggs Nutrition 0.000 description 1
- 238000005538 encapsulation Methods 0.000 description 1
- 239000003344 environmental pollutant Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 229920006242 ethylene acrylic acid copolymer Polymers 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 210000003608 fece Anatomy 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- GIUYCYHIANZCFB-FJFJXFQQSA-N fludarabine phosphate Chemical compound C1=NC=2C(N)=NC(F)=NC=2N1[C@@H]1O[C@H](COP(O)(O)=O)[C@@H](O)[C@@H]1O GIUYCYHIANZCFB-FJFJXFQQSA-N 0.000 description 1
- 125000001475 halogen functional group Chemical group 0.000 description 1
- 231100001261 hazardous Toxicity 0.000 description 1
- 230000004886 head movement Effects 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 229920000554 ionomer Polymers 0.000 description 1
- 238000009533 lab test Methods 0.000 description 1
- 230000001418 larval effect Effects 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- LMNZTLDVJIUSHT-UHFFFAOYSA-N phosmet Chemical compound C1=CC=C2C(=O)N(CSP(=S)(OC)OC)C(=O)C2=C1 LMNZTLDVJIUSHT-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 150000003018 phosphorus compounds Chemical class 0.000 description 1
- 125000005544 phthalimido group Chemical group 0.000 description 1
- 231100000719 pollutant Toxicity 0.000 description 1
- 229920002480 polybenzimidazole Polymers 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920000139 polyethylene terephthalate Polymers 0.000 description 1
- 239000005020 polyethylene terephthalate Substances 0.000 description 1
- 229920000098 polyolefin Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 229920002620 polyvinyl fluoride Polymers 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000004627 regenerated cellulose Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 230000004083 survival effect Effects 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N53/00—Biocides, pest repellants or attractants, or plant growth regulators containing cyclopropane carboxylic acids or derivatives thereof
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Agronomy & Crop Science (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| AUPD876779 | 1979-05-11 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE800872L IE800872L (en) | 1980-11-11 |
| IE49773B1 true IE49773B1 (en) | 1985-12-11 |
Family
ID=3768106
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE872/80A IE49773B1 (en) | 1979-05-11 | 1980-04-29 | Tickicidal compositions and processes |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4362722A (enExample) |
| JP (1) | JPS565406A (enExample) |
| AU (1) | AU531541B2 (enExample) |
| BE (1) | BE883227A (enExample) |
| DE (1) | DE3017638A1 (enExample) |
| FR (1) | FR2455857A1 (enExample) |
| GB (1) | GB2052259B (enExample) |
| IE (1) | IE49773B1 (enExample) |
| NZ (1) | NZ193543A (enExample) |
| ZA (1) | ZA802597B (enExample) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4357348A (en) * | 1978-12-08 | 1982-11-02 | Sumitomo Chemical Company, Limited | Insecticidal and/or acaricidal composition exhibiting low toxicity to mammals and fish |
| JPS5838436U (ja) * | 1981-09-07 | 1983-03-12 | 三菱レイヨン株式会社 | 耐候性改良塩化ビニル樹脂複合シ−ト |
| US4589006A (en) * | 1982-08-23 | 1986-05-13 | The United States Of America As Represented By The United States Department Of Energy | Germanium detector passivated with hydrogenated amorphous germanium |
| US5104659A (en) * | 1984-05-31 | 1992-04-14 | American Cyanamid Company | Compositions, devices and method for controlling insects |
| US4695564A (en) * | 1985-03-08 | 1987-09-22 | American Cyanamid Company | Insecticidal compositions comprising a synergistic mixture of terbufos or phorate and a pyrethroid |
| AP143A (en) * | 1989-03-13 | 1991-09-27 | Scient Chemicals Proprietory Ltd | Pesticidal Fomulation |
| RU2087477C1 (ru) * | 1995-06-30 | 1997-08-20 | Институт элементоорганических соединений РАН | 0,0-диалкил-s-[(n-алкокси(арокси)карбонил-n-алкоксикарбонилалкил)аминометил]ди(моно)тиофосфаты, проявляющие синергистическое действие к периметру в отношении комнатных мух и синатропных тараканов |
| ES2123428B1 (es) * | 1996-09-02 | 1999-09-16 | Agrides S A | Nuevo producto insecticida y procedimiento para su preparacion. |
| DK1372396T3 (da) * | 2001-03-21 | 2009-03-02 | Merial Ltd | Pesticidpræparat |
| AU2012201147C1 (en) * | 2001-07-25 | 2015-02-26 | Syngenta Limited | Insecticidal mixture containing gamma-cyhalothrin |
| GB0118137D0 (en) * | 2001-07-25 | 2001-09-19 | Syngenta Ltd | Insecticidal mixture |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS515450B1 (enExample) * | 1971-06-29 | 1976-02-20 | ||
| JPS5077540A (enExample) * | 1973-11-20 | 1975-06-24 | ||
| IL48428A0 (en) * | 1974-11-15 | 1976-03-31 | Fmc Corp | Synergistic insecticidal compositions containing a cyclopropane carboxylate and a phosphonate |
| CY1259A (en) * | 1976-12-24 | 1984-11-23 | Wellcome Found | Synergistic parasiticidal compositions |
| US4183948A (en) * | 1977-01-24 | 1980-01-15 | Imperial Chemical Industries Limited | Halogenated esters |
| GB1595081A (en) * | 1977-02-08 | 1981-08-05 | Shell Int Research | Pesticidal composition |
-
1979
- 1979-05-11 AU AU57855/80A patent/AU531541B2/en not_active Expired
-
1980
- 1980-04-28 NZ NZ193543A patent/NZ193543A/xx unknown
- 1980-04-29 IE IE872/80A patent/IE49773B1/en not_active IP Right Cessation
- 1980-04-30 ZA ZA00802597A patent/ZA802597B/xx unknown
- 1980-05-07 GB GB8015113A patent/GB2052259B/en not_active Expired
- 1980-05-08 DE DE19803017638 patent/DE3017638A1/de active Granted
- 1980-05-09 BE BE0/200560A patent/BE883227A/fr not_active IP Right Cessation
- 1980-05-09 FR FR8010463A patent/FR2455857A1/fr active Granted
- 1980-05-12 US US06/148,586 patent/US4362722A/en not_active Expired - Lifetime
- 1980-05-12 JP JP6182680A patent/JPS565406A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| AU531541B2 (en) | 1983-08-25 |
| AU5785580A (en) | 1980-11-13 |
| DE3017638A1 (de) | 1980-11-20 |
| FR2455857A1 (fr) | 1980-12-05 |
| BE883227A (fr) | 1980-11-10 |
| DE3017638C2 (enExample) | 1990-05-17 |
| US4362722A (en) | 1982-12-07 |
| FR2455857B1 (enExample) | 1984-04-27 |
| JPS565406A (en) | 1981-01-20 |
| NZ193543A (en) | 1982-11-23 |
| IE800872L (en) | 1980-11-11 |
| ZA802597B (en) | 1981-04-29 |
| GB2052259B (en) | 1983-03-02 |
| JPH0222041B2 (enExample) | 1990-05-17 |
| GB2052259A (en) | 1981-01-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4780459A (en) | Synergistic compositions | |
| EP0005826B1 (en) | Synergistic pyrethroid formulations and their preparation | |
| US4362722A (en) | Synergistic tickicidal compositions containing organophosphorus compounds and cyclopropane carboxylates | |
| GB1592691A (en) | Stabilised tickicidal compositions | |
| US4479968A (en) | Control of ectoparasitic infestations of pigs | |
| SK278527B6 (en) | Multicomponent pesticidal agent | |
| HU200697B (en) | Process for producing compositions against ectoparasites, not having skin irratating effect on body-surface of animals, as well as pesticides | |
| US4897386A (en) | Synergistic compositions | |
| JPH0524121B2 (enExample) | ||
| EP1372396B1 (en) | Perticidal composition | |
| US4144331A (en) | Synergistic chlorfenvinphos and pyrethroid pesticidal composition | |
| GB1583847A (en) | Pesticidal compositions | |
| CA1142851A (en) | Synergistic tickicidal compositions | |
| IE46539B1 (en) | Pest control | |
| EP0053100B1 (de) | Schädlingsbekämpfungsmittel | |
| GB1581277A (en) | Pesticidal compositions | |
| GB1602971A (en) | Synergistic pesticidal compositions | |
| US4554270A (en) | Pesticidal composition containing a synergistic combination of 3-hydroxymethylacrylic acid methyl ester dimethylthionophosphate and cypermethrin | |
| US5096895A (en) | Novel synergistic compositions | |
| US4720508A (en) | Halogenated saturated hydrocarbons and saturated hydrocarbon in combination as acaricidal compounds | |
| GB1574636A (en) | Pesticidal compositions | |
| US4132785A (en) | Isopropyl parathion as an insecticide for treating soil | |
| DD202380A5 (de) | Schaedlingsbekaempfungsmittel | |
| GB2079604A (en) | Pesticidal composition | |
| GB1592229A (en) | Pesticidal formulations |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MK9A | Patent expired |