IE49234B1 - Novel 3,4-diaza-bicyclo(4.1.0)hept-2-en-5-ones,their preparation and therapeutic agents containing these compounds - Google Patents
Novel 3,4-diaza-bicyclo(4.1.0)hept-2-en-5-ones,their preparation and therapeutic agents containing these compoundsInfo
- Publication number
- IE49234B1 IE49234B1 IE2418/79A IE241879A IE49234B1 IE 49234 B1 IE49234 B1 IE 49234B1 IE 2418/79 A IE2418/79 A IE 2418/79A IE 241879 A IE241879 A IE 241879A IE 49234 B1 IE49234 B1 IE 49234B1
- Authority
- IE
- Ireland
- Prior art keywords
- hept
- bicyclo
- diaza
- compound
- formula
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 title claims abstract description 41
- 238000002360 preparation method Methods 0.000 title claims abstract description 7
- 239000003814 drug Substances 0.000 title abstract description 5
- 229940124597 therapeutic agent Drugs 0.000 title abstract description 4
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims abstract description 6
- 230000009424 thromboembolic effect Effects 0.000 claims abstract description 6
- 206010020772 Hypertension Diseases 0.000 claims abstract description 5
- 238000011282 treatment Methods 0.000 claims abstract description 4
- -1 amino compound Chemical class 0.000 claims description 68
- 239000000203 mixture Substances 0.000 claims description 22
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 claims description 14
- 239000000460 chlorine Substances 0.000 claims description 12
- 238000000034 method Methods 0.000 claims description 11
- 239000003795 chemical substances by application Substances 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 7
- 230000008569 process Effects 0.000 claims description 7
- 125000005843 halogen group Chemical group 0.000 claims description 6
- 238000009472 formulation Methods 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 239000002253 acid Substances 0.000 claims description 4
- 125000003342 alkenyl group Chemical group 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 4
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000004429 atom Chemical group 0.000 claims description 2
- 239000003085 diluting agent Substances 0.000 claims description 2
- 239000003937 drug carrier Substances 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- 230000001225 therapeutic effect Effects 0.000 claims description 2
- 125000002252 acyl group Chemical group 0.000 claims 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 36
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 36
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 26
- 239000013078 crystal Substances 0.000 description 21
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 18
- 238000004458 analytical method Methods 0.000 description 18
- 238000002844 melting Methods 0.000 description 18
- 230000008018 melting Effects 0.000 description 18
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 17
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 16
- 238000004220 aggregation Methods 0.000 description 15
- 230000002776 aggregation Effects 0.000 description 15
- 239000000047 product Substances 0.000 description 14
- 210000001772 blood platelet Anatomy 0.000 description 13
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 10
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 230000005764 inhibitory process Effects 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- 230000003276 anti-hypertensive effect Effects 0.000 description 8
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 8
- YARZVGLNBOLGTP-UHFFFAOYSA-N 2-(4-aminophenyl)-3,4-diazabicyclo[4.1.0]hept-2-en-5-one Chemical compound C1=CC(N)=CC=C1C1=NNC(=O)C2C1C2 YARZVGLNBOLGTP-UHFFFAOYSA-N 0.000 description 7
- 102000008186 Collagen Human genes 0.000 description 7
- 108010035532 Collagen Proteins 0.000 description 7
- 241000700159 Rattus Species 0.000 description 7
- 229920001436 collagen Polymers 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- 239000008298 dragée Substances 0.000 description 6
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 6
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 6
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 6
- 238000001953 recrystallisation Methods 0.000 description 6
- YMGUBTXCNDTFJI-UHFFFAOYSA-N cyclopropanecarboxylic acid Chemical compound OC(=O)C1CC1 YMGUBTXCNDTFJI-UHFFFAOYSA-N 0.000 description 5
- VQKLRVZQQYVIJW-UHFFFAOYSA-N dihydralazine Chemical compound C1=CC=C2C(NN)=NN=C(NN)C2=C1 VQKLRVZQQYVIJW-UHFFFAOYSA-N 0.000 description 5
- 229960002877 dihydralazine Drugs 0.000 description 5
- 235000019359 magnesium stearate Nutrition 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- 239000000454 talc Substances 0.000 description 5
- 229910052623 talc Inorganic materials 0.000 description 5
- 235000012222 talc Nutrition 0.000 description 5
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- FZERHIULMFGESH-UHFFFAOYSA-N N-phenylacetamide Chemical compound CC(=O)NC1=CC=CC=C1 FZERHIULMFGESH-UHFFFAOYSA-N 0.000 description 4
- 229960001138 acetylsalicylic acid Drugs 0.000 description 4
- 235000001014 amino acid Nutrition 0.000 description 4
- 150000001413 amino acids Chemical class 0.000 description 4
- 230000036772 blood pressure Effects 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 208000035475 disorder Diseases 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 238000005303 weighing Methods 0.000 description 4
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 3
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 3
- 229920002472 Starch Polymers 0.000 description 3
- 208000010513 Stupor Diseases 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 150000003931 anilides Chemical class 0.000 description 3
- 210000004369 blood Anatomy 0.000 description 3
- 239000008280 blood Substances 0.000 description 3
- 238000007796 conventional method Methods 0.000 description 3
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 3
- 238000000338 in vitro Methods 0.000 description 3
- 230000002401 inhibitory effect Effects 0.000 description 3
- 239000008101 lactose Substances 0.000 description 3
- 230000000144 pharmacologic effect Effects 0.000 description 3
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 3
- 239000008107 starch Substances 0.000 description 3
- 235000019698 starch Nutrition 0.000 description 3
- 235000000346 sugar Nutrition 0.000 description 3
- ZRMYHUFDVLRYPN-WSOKHJQSSA-N (1s,5r)-3-oxabicyclo[3.1.0]hexane-2,4-dione Chemical compound O=C1OC(=O)[C@@H]2C[C@H]12 ZRMYHUFDVLRYPN-WSOKHJQSSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- BBSJNSSPSCYJLF-UHFFFAOYSA-N 1-chloro-n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]cyclopropane-1-carboxamide Chemical compound C=1C=C(C=2C3CC3C(=O)NN=2)C=CC=1NC(=O)C1(Cl)CC1 BBSJNSSPSCYJLF-UHFFFAOYSA-N 0.000 description 2
- AAILEWXSEQLMNI-UHFFFAOYSA-N 1h-pyridazin-6-one Chemical class OC1=CC=CN=N1 AAILEWXSEQLMNI-UHFFFAOYSA-N 0.000 description 2
- SKWKFLGOWJRSJK-UHFFFAOYSA-N 2,2-dichloro-n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]cyclopropane-1-carboxamide Chemical compound ClC1(Cl)CC1C(=O)NC1=CC=C(C=2C3CC3C(=O)NN=2)C=C1 SKWKFLGOWJRSJK-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- HKOFNJRSMKMTGH-UHFFFAOYSA-N 2-phenyl-3,4-diazabicyclo[4.1.0]hept-2-en-5-one Chemical compound C12CC2C(=O)NN=C1C1=CC=CC=C1 HKOFNJRSMKMTGH-UHFFFAOYSA-N 0.000 description 2
- CXXNLVYHLFPAJW-UHFFFAOYSA-N 3,4-diazabicyclo[4.1.0]hept-2-en-5-one Chemical compound O=C1NN=CC2CC12 CXXNLVYHLFPAJW-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 2
- 238000005863 Friedel-Crafts acylation reaction Methods 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 229960001413 acetanilide Drugs 0.000 description 2
- 229940030600 antihypertensive agent Drugs 0.000 description 2
- 239000002220 antihypertensive agent Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- HXOUKQMDQCSFDW-UHFFFAOYSA-N bicyclo[4.1.0]hept-2-en-5-one Chemical compound O=C1CC=CC2CC12 HXOUKQMDQCSFDW-UHFFFAOYSA-N 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000011737 fluorine Chemical group 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- JHHZQADGLDKIPM-UHFFFAOYSA-N hept-3-en-2-one Chemical compound CCCC=CC(C)=O JHHZQADGLDKIPM-UHFFFAOYSA-N 0.000 description 2
- 230000003301 hydrolyzing effect Effects 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- ULULHWSQTRWPST-UHFFFAOYSA-N n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]acetamide Chemical compound C1=CC(NC(=O)C)=CC=C1C1=NNC(=O)C2C1C2 ULULHWSQTRWPST-UHFFFAOYSA-N 0.000 description 2
- WSGLJMPGEWHZDJ-UHFFFAOYSA-N n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]cyclopropanecarboxamide Chemical compound C=1C=C(C=2C3CC3C(=O)NN=2)C=CC=1NC(=O)C1CC1 WSGLJMPGEWHZDJ-UHFFFAOYSA-N 0.000 description 2
- SIRJAQPRFJSIKX-UHFFFAOYSA-N n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]formamide Chemical compound C1=CC(NC=O)=CC=C1C1=NNC(=O)C2C1C2 SIRJAQPRFJSIKX-UHFFFAOYSA-N 0.000 description 2
- MPKZWJNCWHWBGY-UHFFFAOYSA-N n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]propanamide Chemical compound C1=CC(NC(=O)CC)=CC=C1C1=NNC(=O)C2C1C2 MPKZWJNCWHWBGY-UHFFFAOYSA-N 0.000 description 2
- VIKNJXKGJWUCNN-XGXHKTLJSA-N norethisterone Chemical compound O=C1CC[C@@H]2[C@H]3CC[C@](C)([C@](CC4)(O)C#C)[C@@H]4[C@@H]3CCC2=C1 VIKNJXKGJWUCNN-XGXHKTLJSA-N 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 238000011321 prophylaxis Methods 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 230000001624 sedative effect Effects 0.000 description 2
- 238000013222 sprague-dawley male rat Methods 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 230000035488 systolic blood pressure Effects 0.000 description 2
- 238000002560 therapeutic procedure Methods 0.000 description 2
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 2
- MIOPJNTWMNEORI-GMSGAONNSA-N (S)-camphorsulfonic acid Chemical compound C1C[C@@]2(CS(O)(=O)=O)C(=O)C[C@@H]1C2(C)C MIOPJNTWMNEORI-GMSGAONNSA-N 0.000 description 1
- 125000006083 1-bromoethyl group Chemical group 0.000 description 1
- 125000006426 1-chlorocyclopropyl group Chemical group [H]C1([H])C([H])([H])C1(Cl)* 0.000 description 1
- 125000001478 1-chloroethyl group Chemical group [H]C([H])([H])C([H])(Cl)* 0.000 description 1
- 125000004776 1-fluoroethyl group Chemical group [H]C([H])([H])C([H])(F)* 0.000 description 1
- HNEGJTWNOOWEMH-UHFFFAOYSA-N 1-fluoropropane Chemical group [CH2]CCF HNEGJTWNOOWEMH-UHFFFAOYSA-N 0.000 description 1
- 125000006432 1-methyl cyclopropyl group Chemical group [H]C([H])([H])C1(*)C([H])([H])C1([H])[H] 0.000 description 1
- CLHRGMHHCLQPFW-UHFFFAOYSA-N 1-methyl-n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]cyclopropane-1-carboxamide Chemical compound C=1C=C(C=2C3CC3C(=O)NN=2)C=CC=1NC(=O)C1(C)CC1 CLHRGMHHCLQPFW-UHFFFAOYSA-N 0.000 description 1
- GTDXPJJHRWOFDI-UHFFFAOYSA-N 1-methylcyclopropane-1-carbonyl chloride Chemical compound ClC(=O)C1(C)CC1 GTDXPJJHRWOFDI-UHFFFAOYSA-N 0.000 description 1
- CMFRINHLDIXCJX-UHFFFAOYSA-N 2,2,2-trifluoro-n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]acetamide Chemical compound C1=CC(NC(=O)C(F)(F)F)=CC=C1C1=NNC(=O)C2C1C2 CMFRINHLDIXCJX-UHFFFAOYSA-N 0.000 description 1
- ZANROANQSDERGH-UHFFFAOYSA-N 2,2-difluoro-n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]acetamide Chemical compound C1=CC(NC(=O)C(F)F)=CC=C1C1=NNC(=O)C2C1C2 ZANROANQSDERGH-UHFFFAOYSA-N 0.000 description 1
- KURKJXZWCPWPFX-UHFFFAOYSA-N 2,2-difluoroacetyl chloride Chemical compound FC(F)C(Cl)=O KURKJXZWCPWPFX-UHFFFAOYSA-N 0.000 description 1
- YYEVAXWKLUGSJO-UHFFFAOYSA-N 2,2-dimethyl-n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]cyclopropane-1-carboxamide Chemical compound CC1(C)CC1C(=O)NC1=CC=C(C=2C3CC3C(=O)NN=2)C=C1 YYEVAXWKLUGSJO-UHFFFAOYSA-N 0.000 description 1
- QQNQOWHUBGUGQI-UHFFFAOYSA-N 2,2-dimethylcyclopropane-1-carbonyl chloride Chemical compound CC1(C)CC1C(Cl)=O QQNQOWHUBGUGQI-UHFFFAOYSA-N 0.000 description 1
- SCFHHQYJOLMDKO-UHFFFAOYSA-N 2-(4-aminophenyl)-3,4-diazabicyclo[4.1.0]hept-2-en-5-one;hydrochloride Chemical compound Cl.C1=CC(N)=CC=C1C1=NNC(=O)C2C1C2 SCFHHQYJOLMDKO-UHFFFAOYSA-N 0.000 description 1
- OBTZDIRUQWFRFZ-UHFFFAOYSA-N 2-(5-methylfuran-2-yl)-n-(4-methylphenyl)quinoline-4-carboxamide Chemical compound O1C(C)=CC=C1C1=CC(C(=O)NC=2C=CC(C)=CC=2)=C(C=CC=C2)C2=N1 OBTZDIRUQWFRFZ-UHFFFAOYSA-N 0.000 description 1
- KMGUEILFFWDGFV-UHFFFAOYSA-N 2-benzoyl-2-benzoyloxy-3-hydroxybutanedioic acid Chemical compound C=1C=CC=CC=1C(=O)C(C(C(O)=O)O)(C(O)=O)OC(=O)C1=CC=CC=C1 KMGUEILFFWDGFV-UHFFFAOYSA-N 0.000 description 1
- PHJYDQSVAJZXNQ-UHFFFAOYSA-N 2-bromo-n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]butanamide Chemical compound C1=CC(NC(=O)C(Br)CC)=CC=C1C1=NNC(=O)C2C1C2 PHJYDQSVAJZXNQ-UHFFFAOYSA-N 0.000 description 1
- QAUXKXVYCJUECX-UHFFFAOYSA-N 2-bromo-n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]cyclopropane-1-carboxamide Chemical compound BrC1CC1C(=O)NC1=CC=C(C=2C3CC3C(=O)NN=2)C=C1 QAUXKXVYCJUECX-UHFFFAOYSA-N 0.000 description 1
- 125000005999 2-bromoethyl group Chemical group 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- MQTWDYASJAYKIL-UHFFFAOYSA-N 2-chloro-n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]acetamide Chemical compound C1=CC(NC(=O)CCl)=CC=C1C1=NNC(=O)C2C1C2 MQTWDYASJAYKIL-UHFFFAOYSA-N 0.000 description 1
- UAPLCIWTLBXLSC-UHFFFAOYSA-N 2-chloro-n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]propanamide Chemical compound C1=CC(NC(=O)C(Cl)C)=CC=C1C1=NNC(=O)C2C1C2 UAPLCIWTLBXLSC-UHFFFAOYSA-N 0.000 description 1
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 1
- KKZUMAMOMRDVKA-UHFFFAOYSA-N 2-chloropropane Chemical group [CH2]C(C)Cl KKZUMAMOMRDVKA-UHFFFAOYSA-N 0.000 description 1
- FMLMPJGFFXJPSS-UHFFFAOYSA-N 2-fluoro-n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]acetamide Chemical compound C1=CC(NC(=O)CF)=CC=C1C1=NNC(=O)C2C1C2 FMLMPJGFFXJPSS-UHFFFAOYSA-N 0.000 description 1
- 125000004777 2-fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 description 1
- LGYGLKHYBMRKHY-UHFFFAOYSA-N 2-iodo-n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]acetamide Chemical compound C1=CC(NC(=O)CI)=CC=C1C1=NNC(=O)C2C1C2 LGYGLKHYBMRKHY-UHFFFAOYSA-N 0.000 description 1
- IVVUZGRHJXLSCK-UHFFFAOYSA-N 2-methyl-n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]cyclobutane-1-carboxamide Chemical compound CC1CCC1C(=O)NC1=CC=C(C=2C3CC3C(=O)NN=2)C=C1 IVVUZGRHJXLSCK-UHFFFAOYSA-N 0.000 description 1
- UBQXHZLDCVCUPV-UHFFFAOYSA-N 2-methyl-n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]cyclopropane-1-carboxamide Chemical compound CC1CC1C(=O)NC1=CC=C(C=2C3CC3C(=O)NN=2)C=C1 UBQXHZLDCVCUPV-UHFFFAOYSA-N 0.000 description 1
- VQWMWXOVWJLPQK-UHFFFAOYSA-N 2-methyl-n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]propanamide Chemical compound C1=CC(NC(=O)C(C)C)=CC=C1C1=NNC(=O)C2C1C2 VQWMWXOVWJLPQK-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- XRGMGBLABSDIKU-UHFFFAOYSA-N 3-bromo-n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]propanamide Chemical compound C1=CC(NC(=O)CCBr)=CC=C1C1=NNC(=O)C2C1C2 XRGMGBLABSDIKU-UHFFFAOYSA-N 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- PIZIOUKNRXZMEM-UHFFFAOYSA-N 3-chloro-n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]cyclobutane-1-carboxamide Chemical compound C1C(Cl)CC1C(=O)NC1=CC=C(C=2C3CC3C(=O)NN=2)C=C1 PIZIOUKNRXZMEM-UHFFFAOYSA-N 0.000 description 1
- LFXNZAMYXNCGSE-UHFFFAOYSA-N 3-chloro-n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]propanamide Chemical compound C1=CC(NC(=O)CCCl)=CC=C1C1=NNC(=O)C2C1C2 LFXNZAMYXNCGSE-UHFFFAOYSA-N 0.000 description 1
- MSYYLDTUPRIJSX-UHFFFAOYSA-N 3-methyl-n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]butanamide Chemical compound C1=CC(NC(=O)CC(C)C)=CC=C1C1=NNC(=O)C2C1C2 MSYYLDTUPRIJSX-UHFFFAOYSA-N 0.000 description 1
- ZRMYHUFDVLRYPN-UHFFFAOYSA-N 3-oxabicyclo[3.1.0]hexane-2,4-dione Chemical compound O=C1OC(=O)C2CC12 ZRMYHUFDVLRYPN-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- BSYNRYMUTXBXSQ-FOQJRBATSA-N 59096-14-9 Chemical compound CC(=O)OC1=CC=CC=C1[14C](O)=O BSYNRYMUTXBXSQ-FOQJRBATSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N Acrylic acid Chemical group OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 229920000623 Cellulose acetate phthalate Polymers 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical group FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- UCIWXHGABDMGPN-UHFFFAOYSA-N N12N=CCC(C2C1)=O Chemical compound N12N=CCC(C2C1)=O UCIWXHGABDMGPN-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 229920001800 Shellac Polymers 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 239000000370 acceptor Substances 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- HFBMWMNUJJDEQZ-UHFFFAOYSA-N acryloyl chloride Chemical compound ClC(=O)C=C HFBMWMNUJJDEQZ-UHFFFAOYSA-N 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 230000000202 analgesic effect Effects 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000008033 biological extinction Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000005997 bromomethyl group Chemical group 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 235000010216 calcium carbonate Nutrition 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- QGJOPFRUJISHPQ-NJFSPNSNSA-N carbon disulfide-14c Chemical compound S=[14C]=S QGJOPFRUJISHPQ-NJFSPNSNSA-N 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 229940105329 carboxymethylcellulose Drugs 0.000 description 1
- 229940096529 carboxypolymethylene Drugs 0.000 description 1
- 210000001715 carotid artery Anatomy 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 229940081734 cellulose acetate phthalate Drugs 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 125000004775 chlorodifluoromethyl group Chemical group FC(F)(Cl)* 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 229940125773 compound 10 Drugs 0.000 description 1
- 238000013329 compounding Methods 0.000 description 1
- 239000012059 conventional drug carrier Substances 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- RLWFMZKPPHHHCB-UHFFFAOYSA-N cyclopropane-1,2-dicarboxylate;hydron Chemical compound OC(=O)C1CC1C(O)=O RLWFMZKPPHHHCB-UHFFFAOYSA-N 0.000 description 1
- ZOOSILUVXHVRJE-UHFFFAOYSA-N cyclopropanecarbonyl chloride Chemical compound ClC(=O)C1CC1 ZOOSILUVXHVRJE-UHFFFAOYSA-N 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- 125000004772 dichloromethyl group Chemical group [H]C(Cl)(Cl)* 0.000 description 1
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 1
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 1
- UFVKGYZPFZQRLF-UHFFFAOYSA-N hydroxypropyl methyl cellulose Chemical compound OC1C(O)C(OC)OC(CO)C1OC1C(O)C(O)C(OC2C(C(O)C(OC3C(C(O)C(O)C(CO)O3)O)C(CO)O2)O)C(CO)O1 UFVKGYZPFZQRLF-UHFFFAOYSA-N 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 238000007912 intraperitoneal administration Methods 0.000 description 1
- 239000011630 iodine Chemical group 0.000 description 1
- 229910052740 iodine Chemical group 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000000555 isopropenyl group Chemical group [H]\C([H])=C(\*)C([H])([H])[H] 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- ZLVXBBHTMQJRSX-VMGNSXQWSA-N jdtic Chemical compound C1([C@]2(C)CCN(C[C@@H]2C)C[C@H](C(C)C)NC(=O)[C@@H]2NCC3=CC(O)=CC=C3C2)=CC=CC(O)=C1 ZLVXBBHTMQJRSX-VMGNSXQWSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 125000006203 morpholinoethyl group Chemical group [H]C([H])(*)C([H])([H])N1C([H])([H])C([H])([H])OC([H])([H])C1([H])[H] 0.000 description 1
- VJGVELLBPBTDTK-UHFFFAOYSA-N n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]butanamide Chemical compound C1=CC(NC(=O)CCC)=CC=C1C1=NNC(=O)C2C1C2 VJGVELLBPBTDTK-UHFFFAOYSA-N 0.000 description 1
- DGGVLXMHNRKPLL-UHFFFAOYSA-N n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]cyclobutanecarboxamide Chemical compound C=1C=C(C=2C3CC3C(=O)NN=2)C=CC=1NC(=O)C1CCC1 DGGVLXMHNRKPLL-UHFFFAOYSA-N 0.000 description 1
- VPBMBAOZLXCLQE-UHFFFAOYSA-N n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]pentanamide Chemical compound C1=CC(NC(=O)CCCC)=CC=C1C1=NNC(=O)C2C1C2 VPBMBAOZLXCLQE-UHFFFAOYSA-N 0.000 description 1
- LHDWHHARRUCYOH-UHFFFAOYSA-N n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]prop-2-enamide Chemical compound C1=CC(NC(=O)C=C)=CC=C1C1=NNC(=O)C2C1C2 LHDWHHARRUCYOH-UHFFFAOYSA-N 0.000 description 1
- RJIXIHNBOCJFGR-UHFFFAOYSA-N n-[5-chloro-2-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]-2,2-difluoroacetamide Chemical compound FC(F)C(=O)NC1=CC(Cl)=CC=C1C1=NNC(=O)C2C1C2 RJIXIHNBOCJFGR-UHFFFAOYSA-N 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- 239000008024 pharmaceutical diluent Substances 0.000 description 1
- 230000003285 pharmacodynamic effect Effects 0.000 description 1
- 230000000079 pharmacotherapeutic effect Effects 0.000 description 1
- 238000005375 photometry Methods 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 229940075065 polyvinyl acetate Drugs 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- WYVAMUWZEOHJOQ-UHFFFAOYSA-N propionic anhydride Chemical compound CCC(=O)OC(=O)CC WYVAMUWZEOHJOQ-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 239000013558 reference substance Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000000611 regression analysis Methods 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000004208 shellac Substances 0.000 description 1
- ZLGIYFNHBLSMPS-ATJNOEHPSA-N shellac Chemical compound OCCCCCC(O)C(O)CCCCCCCC(O)=O.C1C23[C@H](C(O)=O)CCC2[C@](C)(CO)[C@@H]1C(C(O)=O)=C[C@@H]3O ZLGIYFNHBLSMPS-ATJNOEHPSA-N 0.000 description 1
- 235000013874 shellac Nutrition 0.000 description 1
- 229940113147 shellac Drugs 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000017550 sodium carbonate Nutrition 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 235000010356 sorbitol Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- 235000010215 titanium dioxide Nutrition 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P7/00—Drugs for disorders of the blood or the extracellular fluid
- A61P7/02—Antithrombotic agents; Anticoagulants; Platelet aggregation inhibitors
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/12—Antihypertensives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/49—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups
- C07C205/56—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups bound to carbon atoms of six-membered aromatic rings and carboxyl groups bound to acyclic carbon atoms of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C62/00—Compounds having carboxyl groups bound to carbon atoms of rings other than six—membered aromatic rings and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C62/30—Unsaturated compounds
- C07C62/38—Unsaturated compounds containing keto groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D237/00—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings
- C07D237/26—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings condensed with carbocyclic rings or ring systems
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Veterinary Medicine (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Engineering & Computer Science (AREA)
- Life Sciences & Earth Sciences (AREA)
- Public Health (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Hematology (AREA)
- Diabetes (AREA)
- Cardiology (AREA)
- Heart & Thoracic Surgery (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782854475 DE2854475A1 (de) | 1978-12-16 | 1978-12-16 | Neue 3,4-diaza-bicyclo eckige klammer auf 4.1.0 eckige klammer zu hepten-(2)- one-(5), verfahren zu ihrer herstellung und diese verbindungen enthaltende therapeutische mittel |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE792418L IE792418L (en) | 1980-06-16 |
| IE49234B1 true IE49234B1 (en) | 1985-09-04 |
Family
ID=6057438
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE2418/79A IE49234B1 (en) | 1978-12-16 | 1979-12-13 | Novel 3,4-diaza-bicyclo(4.1.0)hept-2-en-5-ones,their preparation and therapeutic agents containing these compounds |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4271163A (enExample) |
| EP (1) | EP0012366B1 (enExample) |
| JP (1) | JPS5583758A (enExample) |
| AT (1) | ATE6643T1 (enExample) |
| CA (1) | CA1145749A (enExample) |
| DE (2) | DE2854475A1 (enExample) |
| DK (1) | DK149590C (enExample) |
| HU (1) | HU182454B (enExample) |
| IE (1) | IE49234B1 (enExample) |
| ZA (1) | ZA796789B (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3124699A1 (de) * | 1981-06-24 | 1983-01-13 | Basf Ag, 6700 Ludwigshafen | Neue 2-aryl-3,4-diaza-bicyclo(4.n.0.)alken-(2)-one-(5),verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel |
| DE3209159A1 (de) * | 1982-03-13 | 1983-09-15 | Basf Ag, 6700 Ludwigshafen | Neue 6-aryl-4,5-dihydro-3(2h)-pyridazinone, verfahren zu ihrer herstellung, diese verbindungen enthaltende therapeutische mittel und deren verwendung |
| DE3302021A1 (de) * | 1983-01-22 | 1984-07-26 | Basf Ag, 6700 Ludwigshafen | 6-aryl-4,5-dihydro-3(2h)-pyridazinone, ihre herstellung und verwendung |
| JP3442815B2 (ja) * | 1992-05-13 | 2003-09-02 | 第一製薬株式会社 | ジアザビシクロアルケン誘導体 |
| US5789434A (en) * | 1994-11-15 | 1998-08-04 | Bayer Corporation | Derivatives of substituted 4-biarylbutyric acid as matrix metalloprotease inhibitors |
| HRP950558A2 (en) * | 1994-11-15 | 1997-12-31 | Scott M. Wilhelm | Substituted 4-biarylbutric or biarylpentanoic acids and derivatives as matrix metalloprotease inhibitors |
| US5886022A (en) * | 1995-06-05 | 1999-03-23 | Bayer Corporation | Substituted cycloalkanecarboxylic acid derivatives as matrix metalloprotease inhibitors |
| WO2020157199A1 (en) | 2019-02-01 | 2020-08-06 | Bayer Aktiengesellschaft | Annulated dihydropyridazinone compounds as anti-cancer compounds |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2110329A1 (en) * | 1970-10-09 | 1972-06-02 | American Cyanamid Co | 6-phenyl-pyridazin-3-one derivs - hypotensives |
| US3822260A (en) * | 1970-10-09 | 1974-07-02 | American Cyanamid Co | 6-(cyanophenyl)-4,5-dihydro-3(2h)-pyridazinones |
| US3689652A (en) * | 1970-10-09 | 1972-09-05 | William Vincent Curran | Method of lowering blood pressure in mammals |
| IL37788A0 (en) | 1970-10-09 | 1971-12-29 | American Cyanamid Co | New pyridazinone compounds,their preparation and pharmaceutical compositions containing them |
| US4088762A (en) * | 1971-02-22 | 1978-05-09 | Bdh Pharmaceuticals Limited | 6-(P-PIPERAZINO)-PHENYL-4,5-DIHYDRO-3(2H)pyridazinones |
| GB1383906A (en) | 1971-02-22 | 1974-02-12 | Bdh Pharmaceuticals Ltd | Pyridazinones |
| US3975388A (en) * | 1971-02-22 | 1976-08-17 | Bdh Pharmaceuticals Limited | Pyridazinones |
| US3746712A (en) * | 1971-06-08 | 1973-07-17 | A Ross | 6-(substituted-phenyl)-5-methyl-4,5-dihydro-3(2h)-pyridazinones |
| US3812256A (en) * | 1971-06-08 | 1974-05-21 | American Cyanamid Co | Novel method for lowering blood pressure in mammals |
| JPS5221616B2 (enExample) * | 1974-01-09 | 1977-06-11 | ||
| DE2727481A1 (de) * | 1977-06-18 | 1979-01-11 | Basf Ag | Dihydropyridazone und dihydropyridazone enthaltende therapeutische mittel |
-
1978
- 1978-12-16 DE DE19782854475 patent/DE2854475A1/de not_active Withdrawn
-
1979
- 1979-11-30 US US06/098,854 patent/US4271163A/en not_active Expired - Lifetime
- 1979-12-06 EP EP79104956A patent/EP0012366B1/de not_active Expired
- 1979-12-06 AT AT79104956T patent/ATE6643T1/de not_active IP Right Cessation
- 1979-12-06 DE DE7979104956T patent/DE2966809D1/de not_active Expired
- 1979-12-12 CA CA000341754A patent/CA1145749A/en not_active Expired
- 1979-12-13 IE IE2418/79A patent/IE49234B1/en unknown
- 1979-12-14 HU HU79BA3905A patent/HU182454B/hu unknown
- 1979-12-14 ZA ZA00796789A patent/ZA796789B/xx unknown
- 1979-12-14 DK DK532679A patent/DK149590C/da active
- 1979-12-17 JP JP16290679A patent/JPS5583758A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| EP0012366B1 (de) | 1984-03-14 |
| HU182454B (en) | 1984-01-30 |
| DK149590C (da) | 1987-02-09 |
| JPS5583758A (en) | 1980-06-24 |
| CA1145749A (en) | 1983-05-03 |
| DK532679A (da) | 1980-06-17 |
| DE2966809D1 (en) | 1984-04-19 |
| ZA796789B (en) | 1980-12-31 |
| DK149590B (da) | 1986-08-04 |
| EP0012366A1 (de) | 1980-06-25 |
| JPS6328911B2 (enExample) | 1988-06-10 |
| IE792418L (en) | 1980-06-16 |
| US4271163A (en) | 1981-06-02 |
| DE2854475A1 (de) | 1980-07-03 |
| ATE6643T1 (de) | 1984-03-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4376771A (en) | 6-(p-Acylaminophenyl)-4,5-dihydropyridaz-3-ones and therapeutic agents containing said compounds | |
| RU2114113C1 (ru) | Пиразолопиримидиноны, фармацевтическая композиция и способ ингибирования фосфодиэстеразы циклического гуанозин-3',5'-монофосфата | |
| US4399136A (en) | Pyrazolopyridazine antihypertensives | |
| AU2008281545A1 (en) | Substituted bicyclolactam compounds | |
| FI73425B (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara 2-aryl-3,4-diaza-bicyklo/4.n.0/alken-(2)-on-(5)- derivat. | |
| IE49234B1 (en) | Novel 3,4-diaza-bicyclo(4.1.0)hept-2-en-5-ones,their preparation and therapeutic agents containing these compounds | |
| KR920003559B1 (ko) | 만성 당뇨병의 합병증 치료용 피리도-피리다지논 아세트산 | |
| FR2678618A1 (fr) | Nouveaux derives de triazolo pyrimidine antagonistes des recepteurs a l'angiotensine ii; leurs procedes de preparation, compositions pharmaceutiques les contenant. | |
| HU180159B (en) | Process for producing triazolo-pyridazine derivatives | |
| HU190573B (en) | Process for producing new beta-carboline derivatives and pharmaceutical compositions cintaining them | |
| GB1579499A (en) | 1-(2-acylaminophenyl) imidazoles | |
| GB2267089A (en) | Cycloheptimidazole derivatives | |
| US4937241A (en) | N-substituted N-nitrosoaminoacetonitriles, process for their preparation and their use | |
| US4376121A (en) | Antiallerigically-active imidazothienopyrimidine derivatives | |
| US4410529A (en) | Novel dihydropyridazinones, their preparation and therapeutic agents containing these compounds | |
| CA1149811A (en) | Indole and indoline derivatives | |
| AU598927B2 (en) | Benzenesulfonamide derivatives and a process for the preparation thereof | |
| JPS6322565A (ja) | アルド−スレダクタ−ゼ抑制剤として有用なナフタレニルスルホニルイミダゾリジンジオンおよびそのチオキソ類似体 | |
| US4504669A (en) | 1,2-Benzisoxazoloxyethylamines and intermediates for the preparation thereof | |
| US3761487A (en) | Hydrazines of pyrazolopyridine carboxylic acids and esters | |
| US5003068A (en) | Pyridazinone manufacture | |
| JPS5933261A (ja) | 3a−(置換−フエニル)−3a,4,7,7a−テトラヒドロ−4,7−メタノイソインドリン類およびそれらの製造法 | |
| US3755312A (en) | 6-substituted-1, 2,4-pyrimido{8 4,5-e{9 thiadiazine-1,1-dioxides | |
| HU181114B (en) | Process for producing substituted pyrrolidinyl-benzoic acid derivatives | |
| US4286091A (en) | Synthesis of pyridazinone pharmaceutical intermediates using diketene reactant |