IE45570B1 - Bleaching particles and compositions containing them - Google Patents
Bleaching particles and compositions containing themInfo
- Publication number
- IE45570B1 IE45570B1 IE1781/77A IE178177A IE45570B1 IE 45570 B1 IE45570 B1 IE 45570B1 IE 1781/77 A IE1781/77 A IE 1781/77A IE 178177 A IE178177 A IE 178177A IE 45570 B1 IE45570 B1 IE 45570B1
- Authority
- IE
- Ireland
- Prior art keywords
- peroxyaeid
- bleaching
- compound
- particles
- peroxyacid
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 69
- 239000002245 particle Substances 0.000 title claims abstract description 67
- 238000004061 bleaching Methods 0.000 title claims abstract description 54
- 150000004965 peroxy acids Chemical class 0.000 claims abstract description 47
- -1 peroxyacid compound Chemical class 0.000 claims abstract description 46
- 239000004094 surface-active agent Substances 0.000 claims abstract description 44
- 150000001875 compounds Chemical class 0.000 claims abstract description 28
- 238000000034 method Methods 0.000 claims abstract description 20
- 239000011248 coating agent Substances 0.000 claims abstract description 14
- 238000000576 coating method Methods 0.000 claims abstract description 14
- 239000007787 solid Substances 0.000 claims abstract description 11
- 239000000463 material Substances 0.000 claims description 31
- 150000003839 salts Chemical class 0.000 claims description 23
- 239000003795 chemical substances by application Substances 0.000 claims description 19
- 239000002904 solvent Substances 0.000 claims description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 15
- 125000000129 anionic group Chemical group 0.000 claims description 11
- 239000004744 fabric Substances 0.000 claims description 10
- 125000001931 aliphatic group Chemical group 0.000 claims description 7
- 239000006185 dispersion Substances 0.000 claims description 7
- 239000002888 zwitterionic surfactant Substances 0.000 claims description 6
- 150000004996 alkyl benzenes Chemical group 0.000 claims description 5
- 229940077388 benzenesulfonate Drugs 0.000 claims description 5
- JHUXOSATQXGREM-UHFFFAOYSA-N dodecanediperoxoic acid Chemical compound OOC(=O)CCCCCCCCCCC(=O)OO JHUXOSATQXGREM-UHFFFAOYSA-N 0.000 claims description 5
- 238000001035 drying Methods 0.000 claims description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- 229910001385 heavy metal Inorganic materials 0.000 claims description 3
- SXLLDUPXUVRMEE-UHFFFAOYSA-N nonanediperoxoic acid Chemical compound OOC(=O)CCCCCCCC(=O)OO SXLLDUPXUVRMEE-UHFFFAOYSA-N 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- 150000008052 alkyl sulfonates Chemical class 0.000 claims description 2
- 125000005233 alkylalcohol group Chemical group 0.000 claims description 2
- 239000002738 chelating agent Substances 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 description 23
- 125000004432 carbon atom Chemical group C* 0.000 description 23
- 239000002253 acid Substances 0.000 description 20
- 239000011734 sodium Substances 0.000 description 20
- 229910052708 sodium Inorganic materials 0.000 description 20
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 18
- 239000008187 granular material Substances 0.000 description 15
- 229910052783 alkali metal Inorganic materials 0.000 description 12
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 12
- 239000007844 bleaching agent Substances 0.000 description 11
- 239000000243 solution Substances 0.000 description 10
- 239000003945 anionic surfactant Substances 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- 239000003599 detergent Substances 0.000 description 7
- 238000010979 pH adjustment Methods 0.000 description 7
- 229910052700 potassium Inorganic materials 0.000 description 7
- 239000011591 potassium Substances 0.000 description 7
- 239000003760 tallow Substances 0.000 description 7
- 150000001340 alkali metals Chemical class 0.000 description 6
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 6
- 235000014113 dietary fatty acids Nutrition 0.000 description 6
- 239000000194 fatty acid Substances 0.000 description 6
- 229930195729 fatty acid Natural products 0.000 description 6
- 239000004615 ingredient Substances 0.000 description 6
- 150000004760 silicates Chemical class 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 5
- 150000004665 fatty acids Chemical class 0.000 description 5
- 150000004967 organic peroxy acids Chemical class 0.000 description 5
- 159000000001 potassium salts Chemical class 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical group C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 4
- 229920000388 Polyphosphate Polymers 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 150000008051 alkyl sulfates Chemical class 0.000 description 4
- 125000003118 aryl group Chemical group 0.000 description 4
- 239000007795 chemical reaction product Substances 0.000 description 4
- 235000019864 coconut oil Nutrition 0.000 description 4
- 239000003240 coconut oil Substances 0.000 description 4
- 238000000354 decomposition reaction Methods 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 150000002170 ethers Chemical class 0.000 description 4
- 238000004900 laundering Methods 0.000 description 4
- 239000001205 polyphosphate Substances 0.000 description 4
- 235000011176 polyphosphates Nutrition 0.000 description 4
- 239000000344 soap Substances 0.000 description 4
- 238000003860 storage Methods 0.000 description 4
- 150000003871 sulfonates Chemical class 0.000 description 4
- 239000005725 8-Hydroxyquinoline Substances 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical class C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 3
- 235000013162 Cocos nucifera Nutrition 0.000 description 3
- 244000060011 Cocos nucifera Species 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 229910019142 PO4 Inorganic materials 0.000 description 3
- 239000012190 activator Substances 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 3
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical class O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 3
- 235000011180 diphosphates Nutrition 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 150000002367 halogens Chemical group 0.000 description 3
- 229930195733 hydrocarbon Natural products 0.000 description 3
- 150000002430 hydrocarbons Chemical class 0.000 description 3
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 3
- 239000002736 nonionic surfactant Substances 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 235000019198 oils Nutrition 0.000 description 3
- 229960003540 oxyquinoline Drugs 0.000 description 3
- 235000021317 phosphate Nutrition 0.000 description 3
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 3
- GRLPQNLYRHEGIJ-UHFFFAOYSA-J potassium aluminium sulfate Chemical compound [Al+3].[K+].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O GRLPQNLYRHEGIJ-UHFFFAOYSA-J 0.000 description 3
- MCJGNVYPOGVAJF-UHFFFAOYSA-N quinolin-8-ol Chemical compound C1=CN=C2C(O)=CC=CC2=C1 MCJGNVYPOGVAJF-UHFFFAOYSA-N 0.000 description 3
- FQENQNTWSFEDLI-UHFFFAOYSA-J sodium diphosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])([O-])=O FQENQNTWSFEDLI-UHFFFAOYSA-J 0.000 description 3
- 235000019818 tetrasodium diphosphate Nutrition 0.000 description 3
- 239000010457 zeolite Substances 0.000 description 3
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- RGHNJXZEOKUKBD-SQOUGZDYSA-N D-gluconic acid Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)=O RGHNJXZEOKUKBD-SQOUGZDYSA-N 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 229910021536 Zeolite Inorganic materials 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 239000002671 adjuvant Substances 0.000 description 2
- 230000002411 adverse Effects 0.000 description 2
- 150000001335 aliphatic alkanes Chemical group 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 150000003863 ammonium salts Chemical class 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- RRDBXTBGGXLZHD-UHFFFAOYSA-N benzene-1,4-dicarboperoxoic acid Chemical compound OOC(=O)C1=CC=C(C(=O)OO)C=C1 RRDBXTBGGXLZHD-UHFFFAOYSA-N 0.000 description 2
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 2
- 239000004327 boric acid Substances 0.000 description 2
- 150000001642 boronic acid derivatives Chemical class 0.000 description 2
- 239000006172 buffering agent Substances 0.000 description 2
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- WJJMNDUMQPNECX-UHFFFAOYSA-N dipicolinic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=N1 WJJMNDUMQPNECX-UHFFFAOYSA-N 0.000 description 2
- POULHZVOKOAJMA-UHFFFAOYSA-N dodecanoic acid Chemical compound CCCCCCCCCCCC(O)=O POULHZVOKOAJMA-UHFFFAOYSA-N 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 125000005456 glyceride group Chemical group 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 239000002563 ionic surfactant Substances 0.000 description 2
- YDSWCNNOKPMOTP-UHFFFAOYSA-N mellitic acid Chemical class OC(=O)C1=C(C(O)=O)C(C(O)=O)=C(C(O)=O)C(C(O)=O)=C1C(O)=O YDSWCNNOKPMOTP-UHFFFAOYSA-N 0.000 description 2
- MPQXHAGKBWFSNV-UHFFFAOYSA-N oxidophosphanium Chemical class [PH3]=O MPQXHAGKBWFSNV-UHFFFAOYSA-N 0.000 description 2
- VSXGXPNADZQTGQ-UHFFFAOYSA-N oxirane;phenol Chemical compound C1CO1.OC1=CC=CC=C1 VSXGXPNADZQTGQ-UHFFFAOYSA-N 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- SIOXPEMLGUPBBT-UHFFFAOYSA-N picolinic acid Chemical compound OC(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-N 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- 229940048086 sodium pyrophosphate Drugs 0.000 description 2
- 235000019832 sodium triphosphate Nutrition 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 2
- 239000001577 tetrasodium phosphonato phosphate Substances 0.000 description 2
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- SFRLSTJPMFGBDP-UHFFFAOYSA-N 1,2-diphosphonoethylphosphonic acid Chemical class OP(O)(=O)CC(P(O)(O)=O)P(O)(O)=O SFRLSTJPMFGBDP-UHFFFAOYSA-N 0.000 description 1
- CFPOJWPDQWJEMO-UHFFFAOYSA-N 2-(1,2-dicarboxyethoxy)butanedioic acid Chemical class OC(=O)CC(C(O)=O)OC(C(O)=O)CC(O)=O CFPOJWPDQWJEMO-UHFFFAOYSA-N 0.000 description 1
- GLVYLTSKTCWWJR-UHFFFAOYSA-N 2-carbonoperoxoylbenzoic acid Chemical compound OOC(=O)C1=CC=CC=C1C(O)=O GLVYLTSKTCWWJR-UHFFFAOYSA-N 0.000 description 1
- JTNCEQNHURODLX-UHFFFAOYSA-N 2-phenylethanimidamide Chemical compound NC(=N)CC1=CC=CC=C1 JTNCEQNHURODLX-UHFFFAOYSA-N 0.000 description 1
- XYJLPCAKKYOLGU-UHFFFAOYSA-N 2-phosphonoethylphosphonic acid Chemical class OP(O)(=O)CCP(O)(O)=O XYJLPCAKKYOLGU-UHFFFAOYSA-N 0.000 description 1
- GPPRMDWJKBFBMZ-UHFFFAOYSA-N 4-morpholin-4-ylphenol Chemical compound C1=CC(O)=CC=C1N1CCOCC1 GPPRMDWJKBFBMZ-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- BTBUEUYNUDRHOZ-UHFFFAOYSA-N Borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- RGHNJXZEOKUKBD-UHFFFAOYSA-N D-gluconic acid Natural products OCC(O)C(O)C(O)C(O)C(O)=O RGHNJXZEOKUKBD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical class OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical class CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- 239000005639 Lauric acid Substances 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical class OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical class [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 239000004115 Sodium Silicate Substances 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 238000005054 agglomeration Methods 0.000 description 1
- 230000002776 aggregation Effects 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 150000004645 aluminates Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 229910000323 aluminium silicate Inorganic materials 0.000 description 1
- DIZPMCHEQGEION-UHFFFAOYSA-H aluminium sulfate (anhydrous) Chemical compound [Al+3].[Al+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O DIZPMCHEQGEION-UHFFFAOYSA-H 0.000 description 1
- LCQXXBOSCBRNNT-UHFFFAOYSA-K ammonium aluminium sulfate Chemical compound [NH4+].[Al+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O LCQXXBOSCBRNNT-UHFFFAOYSA-K 0.000 description 1
- BIGPRXCJEDHCLP-UHFFFAOYSA-N ammonium bisulfate Chemical compound [NH4+].OS([O-])(=O)=O BIGPRXCJEDHCLP-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229910021538 borax Inorganic materials 0.000 description 1
- MDAVASCOAJMZHZ-UHFFFAOYSA-L calcium;2-hydroxypropanoate;hydrate Chemical compound O.[Ca+2].CC(O)C([O-])=O.CC(O)C([O-])=O MDAVASCOAJMZHZ-UHFFFAOYSA-L 0.000 description 1
- AZTGOPSQAGBNFT-UHFFFAOYSA-L calcium;sodium;sulfate Chemical compound [Na+].[Ca+2].[O-]S([O-])(=O)=O AZTGOPSQAGBNFT-UHFFFAOYSA-L 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 238000002144 chemical decomposition reaction Methods 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000005056 compaction Methods 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 239000012297 crystallization seed Substances 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- XPPKVPWEQAFLFU-UHFFFAOYSA-J diphosphate(4-) Chemical compound [O-]P([O-])(=O)OP([O-])([O-])=O XPPKVPWEQAFLFU-UHFFFAOYSA-J 0.000 description 1
- LRVLKJSNOLCIQY-UHFFFAOYSA-L disodium;2-(1,2-dicarboxyethoxy)butanedioate Chemical compound [Na+].[Na+].OC(=O)CC(C(O)=O)OC(C([O-])=O)CC([O-])=O LRVLKJSNOLCIQY-UHFFFAOYSA-L 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 229960001484 edetic acid Drugs 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 238000007046 ethoxylation reaction Methods 0.000 description 1
- 239000003925 fat Substances 0.000 description 1
- 235000019197 fats Nutrition 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 235000021588 free fatty acids Nutrition 0.000 description 1
- 229940083124 ganglion-blocking antiadrenergic secondary and tertiary amines Drugs 0.000 description 1
- 239000000174 gluconic acid Substances 0.000 description 1
- 235000012208 gluconic acid Nutrition 0.000 description 1
- 239000004220 glutamic acid Substances 0.000 description 1
- 235000013922 glutamic acid Nutrition 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 230000003179 granulation Effects 0.000 description 1
- 238000005469 granulation Methods 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- XLYOFNOQVPJJNP-ZSJDYOACSA-N heavy water Substances [2H]O[2H] XLYOFNOQVPJJNP-ZSJDYOACSA-N 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- BHEPBYXIRTUNPN-UHFFFAOYSA-N hydridophosphorus(.) (triplet) Chemical compound [PH] BHEPBYXIRTUNPN-UHFFFAOYSA-N 0.000 description 1
- 229910052806 inorganic carbonate Inorganic materials 0.000 description 1
- 229910052816 inorganic phosphate Inorganic materials 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 229910021645 metal ion Inorganic materials 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 1
- BPLYVSYSBPLDOA-GYOJGHLZSA-N n-[(2r,3r)-1,3-dihydroxyoctadecan-2-yl]tetracosanamide Chemical compound CCCCCCCCCCCCCCCCCCCCCCCC(=O)N[C@H](CO)[C@H](O)CCCCCCCCCCCCCCC BPLYVSYSBPLDOA-GYOJGHLZSA-N 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical class C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical class OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 1
- 235000012149 noodles Nutrition 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 150000003891 oxalate salts Chemical class 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 125000000864 peroxy group Chemical group O(O*)* 0.000 description 1
- XCRBXWCUXJNEFX-UHFFFAOYSA-N peroxybenzoic acid Chemical compound OOC(=O)C1=CC=CC=C1 XCRBXWCUXJNEFX-UHFFFAOYSA-N 0.000 description 1
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 1
- XYFCBTPGUUZFHI-UHFFFAOYSA-O phosphonium Chemical compound [PH4+] XYFCBTPGUUZFHI-UHFFFAOYSA-O 0.000 description 1
- 229940081066 picolinic acid Drugs 0.000 description 1
- 229920005646 polycarboxylate Polymers 0.000 description 1
- 229940068917 polyethylene glycols Drugs 0.000 description 1
- 229910000343 potassium bisulfate Inorganic materials 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 229940048084 pyrophosphate Drugs 0.000 description 1
- LOAUVZALPPNFOQ-UHFFFAOYSA-N quinaldic acid Chemical compound C1=CC=CC2=NC(C(=O)O)=CC=C21 LOAUVZALPPNFOQ-UHFFFAOYSA-N 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 239000003352 sequestering agent Substances 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- WBHQBSYUUJJSRZ-UHFFFAOYSA-M sodium bisulfate Chemical compound [Na+].OS([O-])(=O)=O WBHQBSYUUJJSRZ-UHFFFAOYSA-M 0.000 description 1
- 229910000342 sodium bisulfate Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000001509 sodium citrate Substances 0.000 description 1
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 1
- DZCAZXAJPZCSCU-UHFFFAOYSA-K sodium nitrilotriacetate Chemical compound [Na+].[Na+].[Na+].[O-]C(=O)CN(CC([O-])=O)CC([O-])=O DZCAZXAJPZCSCU-UHFFFAOYSA-K 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 1
- 229910052911 sodium silicate Inorganic materials 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000004328 sodium tetraborate Substances 0.000 description 1
- 235000010339 sodium tetraborate Nutrition 0.000 description 1
- 239000002195 soluble material Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 150000003890 succinate salts Chemical class 0.000 description 1
- 230000001180 sulfating effect Effects 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/39—Organic or inorganic per-compounds
- C11D3/3945—Organic per-compounds
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D17/00—Detergent materials or soaps characterised by their shape or physical properties
- C11D17/0039—Coated compositions or coated components in the compositions, (micro)capsules
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Detergent Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/718,283 US4126573A (en) | 1976-08-27 | 1976-08-27 | Peroxyacid bleach compositions having increased solubility |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE45570L IE45570L (en) | 1978-02-27 |
| IE45570B1 true IE45570B1 (en) | 1982-09-22 |
Family
ID=24885522
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE1781/77A IE45570B1 (en) | 1976-08-27 | 1977-08-26 | Bleaching particles and compositions containing them |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4126573A (OSRAM) |
| JP (1) | JPS6031880B2 (OSRAM) |
| AU (1) | AU509805B2 (OSRAM) |
| BE (1) | BE858145A (OSRAM) |
| CA (1) | CA1098261A (OSRAM) |
| DE (1) | DE2737864A1 (OSRAM) |
| ES (1) | ES461900A1 (OSRAM) |
| FR (1) | FR2362922A1 (OSRAM) |
| GB (1) | GB1582299A (OSRAM) |
| GR (1) | GR61640B (OSRAM) |
| IE (1) | IE45570B1 (OSRAM) |
| IT (1) | IT1085023B (OSRAM) |
| NL (1) | NL7709437A (OSRAM) |
| PH (1) | PH17228A (OSRAM) |
Families Citing this family (92)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS54122335A (en) * | 1978-03-16 | 1979-09-21 | Tokuyama Soda Co Ltd | Adhesive composition |
| ZA804929B (en) * | 1979-08-16 | 1982-03-31 | Unilever Ltd | Bleach composition |
| FR2471222A1 (fr) * | 1979-12-12 | 1981-06-19 | Interox | Procede pour la stabilisation de particules contenant des composes peroxygenes et compositions de blanchiment contenant des particules stabilisees selon ce procede |
| US4405482A (en) * | 1980-09-01 | 1983-09-20 | Richardson-Vicks Pty. Limited | Sanitizing formulation |
| GR75893B (OSRAM) * | 1981-03-14 | 1984-08-02 | Sterwin Ag | |
| DE3266352D1 (en) * | 1981-06-22 | 1985-10-24 | Procter & Gamble | Mixed peroxyacid bleaches having improved bleaching power |
| US4391723A (en) * | 1981-07-13 | 1983-07-05 | The Procter & Gamble Company | Controlled release laundry bleach product |
| US4374035A (en) * | 1981-07-13 | 1983-02-15 | The Procter & Gamble Company | Accelerated release laundry bleach product |
| US4391725A (en) * | 1981-10-21 | 1983-07-05 | The Procter & Gamble Company | Controlled release laundry bleach product |
| US4391724A (en) * | 1981-10-21 | 1983-07-05 | The Procter & Gamble Company | Controlled release laundry bleach product |
| US4473507A (en) * | 1981-10-21 | 1984-09-25 | The Procter & Gamble Company | Controlled release laundry bleach product |
| US4489574A (en) | 1981-11-10 | 1984-12-25 | The Procter & Gamble Company | Apparatus for highly efficient laundering of textiles |
| US4482349A (en) * | 1982-01-04 | 1984-11-13 | Monsanto Company | Substituted-butanediperoxoic acids and process for bleaching |
| US4487723A (en) * | 1982-01-04 | 1984-12-11 | Monsanto Company | Substituted-butanediperoxoic acids and process for bleaching |
| US4483781A (en) * | 1983-09-02 | 1984-11-20 | The Procter & Gamble Company | Magnesium salts of peroxycarboxylic acids |
| DE3367934D1 (en) | 1982-09-30 | 1987-01-15 | Procter & Gamble | Bleaching compositions |
| GB8307036D0 (en) * | 1983-03-15 | 1983-04-20 | Interox Chemicals Ltd | Peroxygen compounds |
| GB8307037D0 (en) * | 1983-03-15 | 1983-04-20 | Interox Chemicals Ltd | Peroxygen compounds |
| US4655781A (en) * | 1984-07-02 | 1987-04-07 | The Clorox Company | Stable bleaching compositions |
| US4659519A (en) * | 1984-07-02 | 1987-04-21 | The Clorox Company | Process for synthesizing alkyl monoperoxysuccinic acid bleaching compositions |
| GB8422158D0 (en) * | 1984-09-01 | 1984-10-03 | Procter & Gamble Ltd | Bleach compositions |
| NL8402957A (nl) * | 1984-09-28 | 1986-04-16 | Akzo Nv | Toepassing van peroxycarbonzuur-bevattende suspensies als bleeksamenstelling. |
| NZ214260A (en) * | 1985-04-30 | 1988-06-30 | Ecolab Inc | Encapsulated halogen bleach compositions |
| US5213705A (en) * | 1985-04-30 | 1993-05-25 | Ecolab Inc. | Encapsulated halogen bleaches and methods of preparation and use |
| DE3515712A1 (de) * | 1985-05-02 | 1986-11-06 | Henkel KGaA, 4000 Düsseldorf | Bleichwirkstoff, seine herstellung und seine verwendung |
| DE3681973D1 (de) | 1985-06-14 | 1991-11-21 | Procter & Gamble | Dipercarbonsaeuren und bleichmittel. |
| US5167854A (en) * | 1985-08-21 | 1992-12-01 | The Clorox Company | Encapsulated enzyme in dry bleach composition |
| US4863626A (en) * | 1985-08-21 | 1989-09-05 | The Clorox Company | Encapsulated enzyme in dry bleach composition |
| ES2001074A6 (es) * | 1985-08-21 | 1988-04-16 | Clorox Co | Perfeccionamientos en la fabricacion de productos blanqueantes secos basados en diperacidos. |
| US5093021A (en) * | 1985-08-21 | 1992-03-03 | The Clorox Company | Encapsulated enzyme in dry bleach composition |
| US5211874A (en) * | 1985-08-21 | 1993-05-18 | The Clorox Company | Stable peracid and enzyme bleaching composition |
| US5254287A (en) * | 1985-08-21 | 1993-10-19 | The Clorox Company | Encapsulated enzyme in dry bleach composition |
| GB8607164D0 (en) * | 1986-03-22 | 1986-04-30 | Interox Chemicals Ltd | Surface treatment of peroxyacids |
| US4957647A (en) * | 1986-11-06 | 1990-09-18 | The Clorox Company | Acyloxynitrogen peracid precursors |
| US5087385A (en) * | 1986-11-06 | 1992-02-11 | The Clorox Company | Acyloxynitrogen peracid precursors |
| US4756844A (en) * | 1986-12-29 | 1988-07-12 | The Dow Chemical Company | Controlled-release composition having a membrane comprising submicron particles |
| US4867895A (en) * | 1987-01-13 | 1989-09-19 | The Clorox Company | Timed-release bleach coated with an amine with reduced dye damage |
| US4741858A (en) * | 1987-03-02 | 1988-05-03 | The Clorox Company | Timed-release hypochlorite bleach compositions |
| MA21216A1 (fr) * | 1987-03-17 | 1988-10-01 | Procter & Gamble | Compositions de blanchiment. |
| US4923753A (en) * | 1987-03-26 | 1990-05-08 | The Dow Chemical Company | Controlled-release compositions for acids |
| US4824592A (en) * | 1988-03-25 | 1989-04-25 | Lever Brothers Company | Suspending system for insoluble peroxy acid bleach |
| US4828747A (en) * | 1988-03-25 | 1989-05-09 | Lever Brothers Company | Suspending system for insoluble peroxy acid bleach |
| US5258132A (en) * | 1989-11-15 | 1993-11-02 | Lever Brothers Company, Division Of Conopco, Inc. | Wax-encapsulated particles |
| US5200236A (en) * | 1989-11-15 | 1993-04-06 | Lever Brothers Company, Division Of Conopco, Inc. | Method for wax encapsulating particles |
| US5230822A (en) * | 1989-11-15 | 1993-07-27 | Lever Brothers Company, Division Of Conopco, Inc. | Wax-encapsulated particles |
| US5279757A (en) * | 1990-04-06 | 1994-01-18 | Hoechst Aktiengesellschaft | Stable peroxycarboxylic acid granule comprising an imidoperoxycarboxylic acid or salt thereof |
| US5055218A (en) * | 1990-04-13 | 1991-10-08 | The Procter & Gamble Company | Bleach granules containing an amidoperoxyacid |
| ES2124752T3 (es) * | 1992-05-19 | 1999-02-16 | Clariant Gmbh | Procedimiento para la produccion de granulados bajos en polvo. |
| US5336433A (en) * | 1992-06-08 | 1994-08-09 | Eka Nobel Ab | Bleaching agent |
| DE4227277A1 (de) * | 1992-08-18 | 1994-02-24 | Hoechst Ag | Stabile Granulate für Wasch-, Reinigungs- und Desinfektionsmittel |
| EP0592033A1 (en) * | 1992-10-07 | 1994-04-13 | The Procter & Gamble Company | Process for making peroxyacid containing particles |
| WO1994024260A1 (en) * | 1993-04-19 | 1994-10-27 | Akzo Nobel N.V. | Fluidized bed coated amidoperoxyacid bleach composition |
| US5419847A (en) * | 1993-05-13 | 1995-05-30 | The Procter & Gamble Company | Translucent, isotropic aqueous liquid bleach composition |
| US5534196A (en) * | 1993-12-23 | 1996-07-09 | The Procter & Gamble Co. | Process for making lactam bleach activator containing particles |
| US5534195A (en) * | 1993-12-23 | 1996-07-09 | The Procter & Gamble Co. | Process for making particles comprising lactam bleach activators |
| US5770551A (en) * | 1996-08-19 | 1998-06-23 | Lever Brothers Company, Division Of Conopco, Inc. | Amido- and imido- peroxycarboxylic acid bleach granules |
| US5858945A (en) * | 1996-06-26 | 1999-01-12 | Lever Brothers Company, Division Of Conopco, Inc. | Peracid granules containing citric acid monohydrate for improved dissolution rates |
| US5981463A (en) * | 1998-06-08 | 1999-11-09 | Noramtech Corporation | Anhydrous detergent/bleach composition and method of preparing same |
| WO2000046329A1 (en) | 1999-02-05 | 2000-08-10 | Unilever Plc | Dish washing process and compositions relating thereto |
| GB0004988D0 (en) * | 2000-03-01 | 2000-04-19 | Unilever Plc | Composition and method for bleaching a substrate |
| DE10134364A1 (de) * | 2001-07-14 | 2003-01-23 | Clariant Gmbh | Verfahren zur Herstellung von Bleichaktivator-Granulaten |
| US20040077519A1 (en) * | 2002-06-28 | 2004-04-22 | The Procter & Gamble Co. | Ionic liquid based products and method of using the same |
| DE10361100A1 (de) * | 2003-06-13 | 2005-01-05 | Henkel Kgaa | Lagerstabile Kapseln auf Basis von Peroxycarbonsäuren |
| DE10361170A1 (de) * | 2003-06-13 | 2005-01-05 | Henkel Kgaa | Lagerstabiles Polyelektrolytkapselsystem auf Basis von Peroxycarbonsäuren |
| DE10361084A1 (de) * | 2003-06-13 | 2005-01-05 | Henkel Kgaa | Lagerstabile Bleichmittelzusammensetzungen auf Basis von Peroxycarbonsäuren |
| GB0324245D0 (en) * | 2003-10-16 | 2003-11-19 | Reckitt Benckiser Nv | Coated bleach particle |
| US20060094616A1 (en) * | 2004-11-01 | 2006-05-04 | Hecht Stacie E | Ionic liquids derived from surfactants |
| US7737102B2 (en) * | 2004-11-01 | 2010-06-15 | The Procter & Gamble Company | Ionic liquids derived from functionalized anionic surfactants |
| US20060094621A1 (en) * | 2004-11-01 | 2006-05-04 | Jordan Glenn T Iv | Process for improving processability of a concentrate and compositions made by the same |
| US7776810B2 (en) * | 2004-11-01 | 2010-08-17 | The Procter & Gamble Company | Compositions containing ionic liquid actives |
| US20060090777A1 (en) * | 2004-11-01 | 2006-05-04 | Hecht Stacie E | Multiphase cleaning compositions having ionic liquid phase |
| US7939485B2 (en) * | 2004-11-01 | 2011-05-10 | The Procter & Gamble Company | Benefit agent delivery system comprising ionic liquid |
| US20060090271A1 (en) * | 2004-11-01 | 2006-05-04 | Price Kenneth N | Processes for modifying textiles using ionic liquids |
| US7786065B2 (en) * | 2005-02-18 | 2010-08-31 | The Procter & Gamble Company | Ionic liquids derived from peracid anions |
| US8871807B2 (en) | 2008-03-28 | 2014-10-28 | Ecolab Usa Inc. | Detergents capable of cleaning, bleaching, sanitizing and/or disinfecting textiles including sulfoperoxycarboxylic acids |
| CA2715175C (en) | 2008-03-28 | 2017-11-21 | Ecolab Inc. | Sulfoperoxycarboxylic acids, their preparation and methods of use as bleaching and antimicrobial agents |
| US8809392B2 (en) | 2008-03-28 | 2014-08-19 | Ecolab Usa Inc. | Sulfoperoxycarboxylic acids, their preparation and methods of use as bleaching and antimicrobial agents |
| US12203056B2 (en) | 2008-03-28 | 2025-01-21 | Ecolab Usa Inc. | Sulfoperoxycarboxylic acids, their preparation and methods of use as bleaching and antimicrobial agents |
| WO2012090125A2 (en) | 2010-12-29 | 2012-07-05 | Ecolab Usa Inc. | Sugar ester peracid on-site generator and formulator |
| ES3053941T3 (en) | 2010-12-29 | 2026-01-28 | Ecolab Usa Inc | Generation of peroxycarboxylic acids at alkaline ph, and their use as textile bleaching and antimicrobial agents |
| WO2012090124A2 (en) | 2010-12-29 | 2012-07-05 | Ecolab Usa Inc. | IN SITU GENERATION OF PEROXYCARBOXYLIC ACIDS AT ALKALINE pH, AND METHODS OF USE THEREOF |
| US9321664B2 (en) | 2011-12-20 | 2016-04-26 | Ecolab Usa Inc. | Stable percarboxylic acid compositions and uses thereof |
| CN106396037B (zh) | 2012-03-30 | 2019-10-15 | 艺康美国股份有限公司 | 过乙酸/过氧化氢和过氧化物还原剂用于处理钻井液、压裂液、回流水和排放水的用途 |
| US20140256811A1 (en) | 2013-03-05 | 2014-09-11 | Ecolab Usa Inc. | Efficient stabilizer in controlling self accelerated decomposition temperature of peroxycarboxylic acid compositions with mineral acids |
| US10165774B2 (en) | 2013-03-05 | 2019-01-01 | Ecolab Usa Inc. | Defoamer useful in a peracid composition with anionic surfactants |
| CN117304086A (zh) | 2014-12-18 | 2023-12-29 | 艺康美国股份有限公司 | 通过多元醇甲酸酯生产过氧甲酸 |
| WO2016100700A1 (en) | 2014-12-18 | 2016-06-23 | Ecolab Usa Inc. | Methods for forming peroxyformic acid and uses thereof |
| US11040902B2 (en) | 2014-12-18 | 2021-06-22 | Ecolab Usa Inc. | Use of percarboxylic acids for scale prevention in treatment systems |
| WO2019241635A1 (en) | 2018-06-15 | 2019-12-19 | Ecolab Usa Inc. | On site generated performic acid compositions for teat treatment |
| AU2019325568B2 (en) | 2018-08-22 | 2022-03-10 | Ecolab Usa Inc. | Hydrogen peroxide and peracid stabilization with molecules based on a pyridine carboxylic acid at C-3, -4 or -5 |
| US11185893B2 (en) | 2019-05-31 | 2021-11-30 | Ecolab Usa Inc. | Peracid compositions with conductivity monitoring capability |
| WO2021026410A1 (en) | 2019-08-07 | 2021-02-11 | Ecolab Usa Inc. | Polymeric and solid-supported chelators for stabilization of peracid-containing compositions |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3042621A (en) * | 1957-11-01 | 1962-07-03 | Colgate Palmolive Co | Detergent composition |
| FR1262475A (fr) * | 1960-07-16 | 1961-05-26 | Unilever Nv | Produits de blanchiment |
| FR1330594A (fr) * | 1961-08-07 | 1963-06-21 | United States Borax Chem | Compositions de blanchissage sous forme de pains comprenant un noyau d'un agent de blanchiment solide et sec et un revêtement d'un agent de lavage |
| ZA663919B (OSRAM) * | 1965-07-03 | |||
| US3519570A (en) * | 1966-04-25 | 1970-07-07 | Procter & Gamble | Enzyme - containing detergent compositions and a process for conglutination of enzymes and detergent compositions |
| GB1370626A (en) * | 1971-01-27 | 1974-10-16 | Laporte Industries Ltd | Coated peroxygen compounds |
| GB1398876A (en) * | 1972-07-27 | 1975-06-25 | Interox Chemicals Ltd | Coated peroxygen compounds |
| GB1515674A (en) * | 1972-07-31 | 1978-06-28 | Henkel & Cie Gmbh | Bleaching assistant suitable for use in washing and bleaching agents and a process for its preparation |
| US3773673A (en) * | 1972-11-20 | 1973-11-20 | Procter & Gamble | Bleaching composition |
| CA1001361A (en) * | 1973-05-16 | 1976-12-14 | Ppg Industries, Inc. | Bleaching formulation |
| US3983254A (en) * | 1973-12-07 | 1976-09-28 | Lever Brothers Company | Encapsulation particles |
| JPS5315717B2 (OSRAM) * | 1973-12-20 | 1978-05-26 | ||
| DE2413561A1 (de) * | 1974-03-21 | 1975-10-02 | Henkel & Cie Gmbh | Lagerbestaendiger, leichtloeslicher waschmittelzusatz und verfahren zu dessen herstellung |
-
1976
- 1976-08-27 US US05/718,283 patent/US4126573A/en not_active Expired - Lifetime
-
1977
- 1977-08-23 DE DE19772737864 patent/DE2737864A1/de active Granted
- 1977-08-24 PH PH20161A patent/PH17228A/en unknown
- 1977-08-25 GR GR54230A patent/GR61640B/el unknown
- 1977-08-26 IT IT27013/77A patent/IT1085023B/it active
- 1977-08-26 ES ES461900A patent/ES461900A1/es not_active Expired
- 1977-08-26 BE BE180458A patent/BE858145A/xx not_active IP Right Cessation
- 1977-08-26 FR FR7726136A patent/FR2362922A1/fr active Granted
- 1977-08-26 AU AU28275/77A patent/AU509805B2/en not_active Expired
- 1977-08-26 GB GB35955/77A patent/GB1582299A/en not_active Expired
- 1977-08-26 CA CA285,582A patent/CA1098261A/en not_active Expired
- 1977-08-26 NL NL7709437A patent/NL7709437A/xx not_active Application Discontinuation
- 1977-08-26 IE IE1781/77A patent/IE45570B1/en not_active IP Right Cessation
- 1977-08-27 JP JP52103123A patent/JPS6031880B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE2737864A1 (de) | 1978-03-02 |
| BE858145A (fr) | 1978-02-27 |
| US4126573A (en) | 1978-11-21 |
| AU2827577A (en) | 1979-03-01 |
| AU509805B2 (en) | 1980-05-22 |
| FR2362922A1 (fr) | 1978-03-24 |
| DE2737864C2 (OSRAM) | 1989-03-23 |
| PH17228A (en) | 1984-07-03 |
| CA1098261A (en) | 1981-03-31 |
| NL7709437A (nl) | 1978-03-01 |
| ES461900A1 (es) | 1979-08-16 |
| IT1085023B (it) | 1985-05-28 |
| GB1582299A (en) | 1981-01-07 |
| JPS5329287A (en) | 1978-03-18 |
| JPS6031880B2 (ja) | 1985-07-24 |
| GR61640B (en) | 1978-12-04 |
| FR2362922B1 (OSRAM) | 1982-05-21 |
| IE45570L (en) | 1978-02-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4126573A (en) | Peroxyacid bleach compositions having increased solubility | |
| US4170453A (en) | Peroxyacid bleach composition | |
| US4100095A (en) | Peroxyacid bleach composition having improved exotherm control | |
| US4391723A (en) | Controlled release laundry bleach product | |
| EP0070067B2 (en) | Controlled release laundry bleach product | |
| US4119660A (en) | Method for making diperoxyacids | |
| US4091544A (en) | Drying process | |
| EP0068547B1 (en) | Mixed peroxyacid bleaches having improved bleaching power | |
| EP0079674B1 (en) | Controlled release laundry bleach product | |
| US4233235A (en) | Method for making diperoxyacids | |
| EP0079129B1 (en) | Controlled release laundry bleach product | |
| RU2346888C2 (ru) | Гранулы перкарбоната натрия с покрытием с повышенной устойчивостью при хранении | |
| US4473507A (en) | Controlled release laundry bleach product | |
| CS98991A2 (en) | Amidoperoxy acid containing bleaching granules for washing in hard and soft water | |
| AU643206B2 (en) | Agglomerated peroxyacid bleach granule and process for making same | |
| US4497757A (en) | Energy efficient hydration process | |
| US4314949A (en) | Process for making peroxycarboxylic acids | |
| CA1106396A (en) | Method for making diperoxyacids | |
| JPS59157197A (ja) | 粉末状洗剤布地洗浄用製品の製造方法 | |
| CA1079295A (en) | Method for making diperoxyacids | |
| CA1226503A (en) | Bleaching and laundering composition free of water- soluble silicates |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MK9A | Patent expired |