IE45170B1 - Urea or thiourea compounds - Google Patents
Urea or thiourea compoundsInfo
- Publication number
- IE45170B1 IE45170B1 IE1503/77A IE150377A IE45170B1 IE 45170 B1 IE45170 B1 IE 45170B1 IE 1503/77 A IE1503/77 A IE 1503/77A IE 150377 A IE150377 A IE 150377A IE 45170 B1 IE45170 B1 IE 45170B1
- Authority
- IE
- Ireland
- Prior art keywords
- compound
- compounds
- diluent
- general formula
- active
- Prior art date
Links
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 title claims abstract description 14
- 150000003585 thioureas Chemical class 0.000 title claims abstract description 8
- 239000004202 carbamide Substances 0.000 title claims abstract description 7
- 230000000855 fungicidal effect Effects 0.000 claims abstract description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 5
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 4
- 239000001301 oxygen Substances 0.000 claims abstract description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims abstract description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 3
- 150000001875 compounds Chemical class 0.000 claims description 70
- 241000233866 Fungi Species 0.000 claims description 27
- 238000000034 method Methods 0.000 claims description 25
- 239000000203 mixture Substances 0.000 claims description 21
- -1 thiocarbamoyl Chemical group 0.000 claims description 19
- 239000003085 diluting agent Substances 0.000 claims description 16
- 238000002360 preparation method Methods 0.000 claims description 12
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 claims description 8
- 238000006243 chemical reaction Methods 0.000 claims description 8
- 239000002904 solvent Substances 0.000 claims description 7
- 239000004480 active ingredient Substances 0.000 claims description 6
- 238000009835 boiling Methods 0.000 claims description 5
- 239000007788 liquid Substances 0.000 claims description 5
- 241000607479 Yersinia pestis Species 0.000 claims description 4
- 239000007787 solid Substances 0.000 claims description 4
- 150000001412 amines Chemical class 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical group 0.000 claims description 3
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical compound O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 claims description 3
- 229910052717 sulfur Chemical group 0.000 claims description 3
- 239000004094 surface-active agent Substances 0.000 claims description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 2
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 2
- 150000002540 isothiocyanates Chemical class 0.000 claims description 2
- 239000011593 sulfur Chemical group 0.000 claims description 2
- IJJWOSAXNHWBPR-HUBLWGQQSA-N 5-[(3as,4s,6ar)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-n-(6-hydrazinyl-6-oxohexyl)pentanamide Chemical compound N1C(=O)N[C@@H]2[C@H](CCCCC(=O)NCCCCCC(=O)NN)SC[C@@H]21 IJJWOSAXNHWBPR-HUBLWGQQSA-N 0.000 claims 1
- 239000000376 reactant Substances 0.000 claims 1
- 125000000753 cycloalkyl group Chemical group 0.000 abstract description 2
- 125000005843 halogen group Chemical group 0.000 abstract 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- 241000196324 Embryophyta Species 0.000 description 12
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 9
- 239000002689 soil Substances 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- 239000000460 chlorine Chemical group 0.000 description 8
- 231100000674 Phytotoxicity Toxicity 0.000 description 7
- 239000008187 granular material Substances 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 240000007594 Oryza sativa Species 0.000 description 6
- 239000004927 clay Substances 0.000 description 5
- 239000003995 emulsifying agent Substances 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 239000000454 talc Substances 0.000 description 5
- 229910052623 talc Inorganic materials 0.000 description 5
- LUBJCRLGQSPQNN-UHFFFAOYSA-N 1-Phenylurea Chemical compound NC(=O)NC1=CC=CC=C1 LUBJCRLGQSPQNN-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 239000000969 carrier Substances 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 201000010099 disease Diseases 0.000 description 4
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 239000000839 emulsion Substances 0.000 description 4
- 208000015181 infectious disease Diseases 0.000 description 4
- 230000003032 phytopathogenic effect Effects 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 239000005909 Kieselgur Substances 0.000 description 3
- 235000011430 Malus pumila Nutrition 0.000 description 3
- 235000015103 Malus silvestris Nutrition 0.000 description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- 235000014443 Pyrus communis Nutrition 0.000 description 3
- 206010039509 Scab Diseases 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 3
- 239000000428 dust Substances 0.000 description 3
- 238000010410 dusting Methods 0.000 description 3
- 150000002170 ethers Chemical class 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 244000053095 fungal pathogen Species 0.000 description 3
- 239000000417 fungicide Substances 0.000 description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 3
- 150000002576 ketones Chemical class 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 238000005507 spraying Methods 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- SYBYTAAJFKOIEJ-UHFFFAOYSA-N 3-Methylbutan-2-one Chemical compound CC(C)C(C)=O SYBYTAAJFKOIEJ-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 241000207199 Citrus Species 0.000 description 2
- 240000008067 Cucumis sativus Species 0.000 description 2
- 235000010799 Cucumis sativus var sativus Nutrition 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- 241000221785 Erysiphales Species 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- 239000004606 Fillers/Extenders Substances 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 206010027146 Melanoderma Diseases 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 235000007164 Oryza sativa Nutrition 0.000 description 2
- 241000918585 Pythium aphanidermatum Species 0.000 description 2
- 241000221662 Sclerotinia Species 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 235000009754 Vitis X bourquina Nutrition 0.000 description 2
- 235000012333 Vitis X labruscana Nutrition 0.000 description 2
- 240000006365 Vitis vinifera Species 0.000 description 2
- 235000014787 Vitis vinifera Nutrition 0.000 description 2
- FRDDEJAABOMVCH-UHFFFAOYSA-N [dimethylcarbamothioylsulfanyl(methyl)arsanyl] n,n-dimethylcarbamodithioate Chemical compound CN(C)C(=S)S[As](C)SC(=S)N(C)C FRDDEJAABOMVCH-UHFFFAOYSA-N 0.000 description 2
- 230000000895 acaricidal effect Effects 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 2
- 235000012211 aluminium silicate Nutrition 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 125000001246 bromo group Chemical group Br* 0.000 description 2
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 2
- NBYQXBYMEUOBON-UHFFFAOYSA-N carbamothioyl chloride Chemical class NC(Cl)=S NBYQXBYMEUOBON-UHFFFAOYSA-N 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 235000020971 citrus fruits Nutrition 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 244000038559 crop plants Species 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 239000012046 mixed solvent Substances 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000006072 paste Substances 0.000 description 2
- 239000000575 pesticide Substances 0.000 description 2
- QKFJKGMPGYROCL-UHFFFAOYSA-N phenyl isothiocyanate Chemical compound S=C=NC1=CC=CC=C1 QKFJKGMPGYROCL-UHFFFAOYSA-N 0.000 description 2
- 230000008635 plant growth Effects 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 235000009566 rice Nutrition 0.000 description 2
- 235000012239 silicon dioxide Nutrition 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 238000010998 test method Methods 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 231100000419 toxicity Toxicity 0.000 description 2
- 230000001988 toxicity Effects 0.000 description 2
- 150000003672 ureas Chemical class 0.000 description 2
- 239000004563 wettable powder Substances 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- HGUFODBRKLSHSI-UHFFFAOYSA-N 2,3,7,8-tetrachloro-dibenzo-p-dioxin Chemical compound O1C2=CC(Cl)=C(Cl)C=C2OC2=C1C=C(Cl)C(Cl)=C2 HGUFODBRKLSHSI-UHFFFAOYSA-N 0.000 description 1
- MCJYFCRORMMYBR-UHFFFAOYSA-N 2-methylbut-1-en-1-one Chemical compound CCC(C)=C=O MCJYFCRORMMYBR-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 102000009027 Albumins Human genes 0.000 description 1
- 108010088751 Albumins Proteins 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 241000235349 Ascomycota Species 0.000 description 1
- 241000556600 Athelia epiphylla Species 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 235000010149 Brassica rapa subsp chinensis Nutrition 0.000 description 1
- 235000000536 Brassica rapa subsp pekinensis Nutrition 0.000 description 1
- 241000499436 Brassica rapa subsp. pekinensis Species 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- CKDWPUIZGOQOOM-UHFFFAOYSA-N Carbamyl chloride Chemical class NC(Cl)=O CKDWPUIZGOQOOM-UHFFFAOYSA-N 0.000 description 1
- 241000688200 Cingulata Species 0.000 description 1
- 241000219112 Cucumis Species 0.000 description 1
- 235000015510 Cucumis melo subsp melo Nutrition 0.000 description 1
- 241000371644 Curvularia ravenelii Species 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- 235000016623 Fragaria vesca Nutrition 0.000 description 1
- 240000009088 Fragaria x ananassa Species 0.000 description 1
- 235000011363 Fragaria x ananassa Nutrition 0.000 description 1
- 240000005979 Hordeum vulgare Species 0.000 description 1
- 235000007340 Hordeum vulgare Nutrition 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 229920001732 Lignosulfonate Polymers 0.000 description 1
- 241001330975 Magnaporthe oryzae Species 0.000 description 1
- 208000003351 Melanosis Diseases 0.000 description 1
- XOBKSJJDNFUZPF-UHFFFAOYSA-N Methoxyethane Chemical compound CCOC XOBKSJJDNFUZPF-UHFFFAOYSA-N 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- 240000008790 Musa x paradisiaca Species 0.000 description 1
- 235000018290 Musa x paradisiaca Nutrition 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 1
- 241000233679 Peronosporaceae Species 0.000 description 1
- 241000219998 Philenoptera violacea Species 0.000 description 1
- 240000007643 Phytolacca americana Species 0.000 description 1
- 241000896242 Podosphaera Species 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- 241000813090 Rhizoctonia solani Species 0.000 description 1
- 241000576755 Sclerotia Species 0.000 description 1
- 244000061458 Solanum melongena Species 0.000 description 1
- 235000002597 Solanum melongena Nutrition 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 235000002595 Solanum tuberosum Nutrition 0.000 description 1
- 241001617088 Thanatephorus sasakii Species 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- 241001074088 Urophycis Species 0.000 description 1
- 241000317942 Venturia <ichneumonid wasp> Species 0.000 description 1
- 241001006642 Venturia pyrina Species 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical class ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- 241000589655 Xanthomonas citri Species 0.000 description 1
- 239000000642 acaricide Substances 0.000 description 1
- 150000008360 acrylonitriles Chemical class 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- MMCPOSDMTGQNKG-UHFFFAOYSA-N anilinium chloride Chemical compound Cl.NC1=CC=CC=C1 MMCPOSDMTGQNKG-UHFFFAOYSA-N 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000003443 antiviral agent Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 229910052785 arsenic Inorganic materials 0.000 description 1
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000008422 chlorobenzenes Chemical class 0.000 description 1
- 239000013065 commercial product Substances 0.000 description 1
- 229940126214 compound 3 Drugs 0.000 description 1
- 239000013068 control sample Substances 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 230000002939 deleterious effect Effects 0.000 description 1
- 125000004119 disulfanediyl group Chemical group *SS* 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- GCFHZZWXZLABBL-UHFFFAOYSA-N ethanol;hexane Chemical compound CCO.CCCCCC GCFHZZWXZLABBL-UHFFFAOYSA-N 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 239000004088 foaming agent Substances 0.000 description 1
- 239000002316 fumigant Substances 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- 230000002363 herbicidal effect Effects 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- BLNWTAHYTCHDJH-UHFFFAOYSA-O hydroxy(oxo)azanium Chemical compound O[NH+]=O BLNWTAHYTCHDJH-UHFFFAOYSA-O 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 238000011081 inoculation Methods 0.000 description 1
- 230000000749 insecticidal effect Effects 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 239000011630 iodine Chemical group 0.000 description 1
- 229910052740 iodine Chemical group 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- QPPQHRDVPBTVEV-UHFFFAOYSA-N isopropyl dihydrogen phosphate Chemical compound CC(C)OP(O)(O)=O QPPQHRDVPBTVEV-UHFFFAOYSA-N 0.000 description 1
- 229910052622 kaolinite Inorganic materials 0.000 description 1
- 239000003350 kerosene Substances 0.000 description 1
- 230000003902 lesion Effects 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 229940043265 methyl isobutyl ketone Drugs 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 239000003607 modifier Substances 0.000 description 1
- PPVZYCGBQWWSKG-UHFFFAOYSA-N n-benzylcyclopentanamine Chemical compound C=1C=CC=CC=1CNC1CCCC1 PPVZYCGBQWWSKG-UHFFFAOYSA-N 0.000 description 1
- ODRSUNBDEPNRJR-UHFFFAOYSA-N n-cyclopentylcarbamoyl chloride Chemical compound ClC(=O)NC1CCCC1 ODRSUNBDEPNRJR-UHFFFAOYSA-N 0.000 description 1
- 230000001069 nematicidal effect Effects 0.000 description 1
- 239000005645 nematicide Substances 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- 230000003071 parasitic effect Effects 0.000 description 1
- 230000001717 pathogenic effect Effects 0.000 description 1
- LKPLKUMXSAEKID-UHFFFAOYSA-N pentachloronitrobenzene Chemical compound [O-][N+](=O)C1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl LKPLKUMXSAEKID-UHFFFAOYSA-N 0.000 description 1
- 239000003090 pesticide formulation Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229940117953 phenylisothiocyanate Drugs 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920000151 polyglycol Polymers 0.000 description 1
- 239000010695 polyglycol Substances 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 238000009958 sewing Methods 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 230000000391 smoking effect Effects 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 150000003573 thiols Chemical class 0.000 description 1
- UBOXGVDOUJQMTN-UHFFFAOYSA-N trichloroethylene Natural products ClCC(Cl)Cl UBOXGVDOUJQMTN-UHFFFAOYSA-N 0.000 description 1
- CYRMSUTZVYGINF-UHFFFAOYSA-N trichlorofluoromethane Chemical compound FC(Cl)(Cl)Cl CYRMSUTZVYGINF-UHFFFAOYSA-N 0.000 description 1
- 229940029284 trichlorofluoromethane Drugs 0.000 description 1
- 229940086542 triethylamine Drugs 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/28—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C335/00—Thioureas, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C335/04—Derivatives of thiourea
- C07C335/16—Derivatives of thiourea having nitrogen atoms of thiourea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/06—Systems containing only non-condensed rings with a five-membered ring
- C07C2601/08—Systems containing only non-condensed rings with a five-membered ring the ring being saturated
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/12—Systems containing only non-condensed rings with a six-membered ring
- C07C2601/14—The ring being saturated
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/18—Systems containing only non-condensed rings with a ring being at least seven-membered
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP8558276A JPS5312844A (en) | 1976-07-20 | 1976-07-20 | Nn44halogenobenzyllnnmethyl*or nonsubstitutedd*cycloalkylln**phenylurea or thiourea compounds* their preparation and fungicides containing the same as active constituents |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE45170L IE45170L (en) | 1978-01-20 |
| IE45170B1 true IE45170B1 (en) | 1982-06-30 |
Family
ID=13862795
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE1503/77A IE45170B1 (en) | 1976-07-20 | 1977-07-19 | Urea or thiourea compounds |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US4127673A (Direct) |
| JP (1) | JPS5312844A (Direct) |
| AU (1) | AU511087B2 (Direct) |
| BE (1) | BE856922A (Direct) |
| BR (1) | BR7704755A (Direct) |
| CH (1) | CH630233A5 (Direct) |
| DE (1) | DE2732257C3 (Direct) |
| DK (1) | DK327077A (Direct) |
| FR (1) | FR2359123A1 (Direct) |
| GB (1) | GB1527858A (Direct) |
| GR (1) | GR73014B (Direct) |
| IE (1) | IE45170B1 (Direct) |
| IL (1) | IL52548A (Direct) |
| IT (1) | IT1083897B (Direct) |
| LU (1) | LU77790A1 (Direct) |
| MY (1) | MY8200071A (Direct) |
| NL (1) | NL174250C (Direct) |
| PH (1) | PH14202A (Direct) |
| TR (1) | TR19192A (Direct) |
| ZA (1) | ZA774330B (Direct) |
Families Citing this family (50)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5822099B2 (ja) * | 1977-06-03 | 1983-05-06 | 日本特殊農薬製造株式会社 | N−ベンジル−シクロアルキルアミン系化合物および該化合物の製造方法 |
| JPS5419943A (en) * | 1977-07-12 | 1979-02-15 | Nippon Tokushu Noyaku Seizo Kk | Urea or thiourea compounds, their preparation, and agricultural and horticultural fungicides comprising them as active constituents |
| US4221816A (en) * | 1979-04-16 | 1980-09-09 | American Cyanamid Company | Method for the control of phytopathogenic fungi using p-(alkoxyalkyl)urea compounds |
| JPS55153760A (en) * | 1979-05-21 | 1980-11-29 | Nippon Tokushu Noyaku Seizo Kk | Urea or thiourea compound, its preparation and antimicrobial containing the same as effective component |
| DE3132690A1 (de) * | 1981-08-19 | 1983-03-17 | Bayer Ag, 5090 Leverkusen | (thio)-harnstoffe, ein verfahren zu ihrer herstellung, ihre verwendung als pflanzenschutzmittel und zwischenprodukte zu ihrer herstellung |
| US4473579A (en) * | 1982-01-26 | 1984-09-25 | American Cyanamid Company | Antiatherosclerotic tetrasubstituted ureas and thioureas |
| US4623662A (en) | 1985-05-23 | 1986-11-18 | American Cyanamid Company | Antiatherosclerotic ureas and thioureas |
| DE3208142A1 (de) * | 1982-03-06 | 1983-09-08 | Bayer Ag, 5090 Leverkusen | Fungizide mittel |
| JPS58222063A (ja) * | 1982-06-17 | 1983-12-23 | Nippon Tokushu Noyaku Seizo Kk | ベンジルウレア誘導体、その製法及び農園芸用殺菌剤 |
| US5237100A (en) * | 1982-12-03 | 1993-08-17 | Nihon Bayer Agrochem K.K. | Substituted benzylcycloalkenylamines and carbamoylhalide intermediates therefor |
| JPS59101443A (ja) * | 1982-12-03 | 1984-06-12 | Nippon Tokushu Noyaku Seizo Kk | 置換ベンジルシクロアルケニルウレア誘導体その製法及び農園芸用殺菌剤 |
| US4731385A (en) * | 1985-10-26 | 1988-03-15 | Nihon Tokushu Noyaku Seizo K.K. | Insecticidal and fungicidal composition for agricultural and horticultural use |
| JPS646203A (en) * | 1986-12-17 | 1989-01-10 | Nihon Tokushu Noyaku Seizo Kk | Agricultural and horticultural insecticidal and germicidal composition |
| US4855478A (en) * | 1987-11-30 | 1989-08-08 | Ici Americas Inc. | N,N'-diaryl-N-alkylureas and method of use |
| CN1021819C (zh) * | 1988-01-20 | 1993-08-18 | 山之内制药株式会社 | 作为药物有用的双脲衍生物的制备方法 |
| US5176779A (en) * | 1988-08-29 | 1993-01-05 | Minnesota Mining And Manufacturing Company | Fan-out padding using a hot melt adhesive |
| JPH05310678A (ja) * | 1990-01-22 | 1993-11-22 | Mitsubishi Kasei Corp | 1−フェニルアルキル−3−フェニル尿素誘導体 |
| DE4304172A1 (de) | 1993-02-12 | 1994-08-25 | Bayer Ag | Fungizide Wirkstoffkombinationen |
| DE19716257A1 (de) | 1997-04-18 | 1998-10-22 | Bayer Ag | Fungizide Wirkstoffkombination |
| DE10333373A1 (de) * | 2003-07-23 | 2005-02-10 | Bayer Ag | Fungizide Wirkstoffkombinationen |
| DE10347090A1 (de) | 2003-10-10 | 2005-05-04 | Bayer Cropscience Ag | Synergistische fungizide Wirkstoffkombinationen |
| DE10349501A1 (de) | 2003-10-23 | 2005-05-25 | Bayer Cropscience Ag | Synergistische fungizide Wirkstoffkombinationen |
| TW200531632A (en) * | 2004-01-15 | 2005-10-01 | Basf Ag | Fungicidal mixtures for controlling harmful fungi |
| DE102005015677A1 (de) * | 2005-04-06 | 2006-10-12 | Bayer Cropscience Ag | Synergistische fungizide Wirkstoffkombinationen |
| MX2007015376A (es) | 2005-06-09 | 2008-02-14 | Bayer Cropscience Ag | Combinaciones de productos activos. |
| DE102005026482A1 (de) | 2005-06-09 | 2006-12-14 | Bayer Cropscience Ag | Wirkstoffkombinationen |
| DE102006023263A1 (de) | 2006-05-18 | 2007-11-22 | Bayer Cropscience Ag | Synergistische Wirkstoffkombinationen |
| EP2489263A3 (en) | 2006-09-18 | 2012-10-24 | Basf Se | Pesticidal mixtures comprising an anthranilamide insecticide and a fungicide |
| WO2008071714A1 (en) | 2006-12-15 | 2008-06-19 | Rohm And Haas Company | Mixtures comprising 1-methylcyclopropene |
| US20100120879A1 (en) | 2007-02-06 | 2010-05-13 | Basf Se | Insecticides as safener for fungicides with phytotoxic action |
| CN101668860B (zh) | 2007-04-23 | 2014-02-12 | 巴斯夫欧洲公司 | 组合化学剂和转基因修饰增强植物生产力 |
| DE102007045920B4 (de) | 2007-09-26 | 2018-07-05 | Bayer Intellectual Property Gmbh | Synergistische Wirkstoffkombinationen |
| US8349877B2 (en) | 2007-09-26 | 2013-01-08 | Basf Se | Ternary fungicidal compositions comprising boscalid and chlorothalonil |
| AU2009342807B2 (en) | 2009-03-25 | 2015-04-02 | Bayer Cropscience Aktiengesellschaft | Synergistic combinations of active ingredients |
| EP2453750A2 (de) | 2009-07-16 | 2012-05-23 | Bayer CropScience AG | Synergistische wirkstoffkombinationen mit phenyltriazolen |
| WO2011026796A1 (en) | 2009-09-01 | 2011-03-10 | Basf Se | Synergistic fungicidal mixtures comprising lactylates and method for combating phytopathogenic fungi |
| MX2013006737A (es) | 2010-12-20 | 2013-07-15 | Basf Se | Mezclas de activos pesticida que comprende compuestos de pirazol. |
| EP2481284A3 (en) | 2011-01-27 | 2012-10-17 | Basf Se | Pesticidal mixtures |
| EP2688405B1 (en) | 2011-03-23 | 2017-11-22 | Basf Se | Compositions containing polymeric, ionic compounds comprising imidazolium groups |
| US20140200136A1 (en) | 2011-09-02 | 2014-07-17 | Basf Se | Agricultural mixtures comprising arylquinazolinone compounds |
| BR122019015104B1 (pt) | 2012-06-20 | 2020-04-07 | Basf Se | mistura pesticida, composição, composição agrícola, métodos para o combate ou controle das pragas de invertebrados, para a proteção dos vegetais em crescimento ou dos materias de propagação vegetal, para a proteção de material de propagação vegetal e uso de uma mistura pesticida |
| US20150257383A1 (en) | 2012-10-12 | 2015-09-17 | Basf Se | Method for combating phytopathogenic harmful microbes on cultivated plants or plant propagation material |
| CN105050406B (zh) | 2012-12-20 | 2017-09-15 | 巴斯夫农业公司 | 包含三唑化合物的组合物 |
| EP2783569A1 (en) | 2013-03-28 | 2014-10-01 | Basf Se | Compositions comprising a triazole compound |
| EP2835052A1 (en) | 2013-08-07 | 2015-02-11 | Basf Se | Fungicidal mixtures comprising pyrimidine fungicides |
| US20160221964A1 (en) | 2013-09-16 | 2016-08-04 | Basf Se | Fungicidal pyrimidine compounds |
| WO2015036059A1 (en) | 2013-09-16 | 2015-03-19 | Basf Se | Fungicidal pyrimidine compounds |
| EP2979549A1 (en) | 2014-07-31 | 2016-02-03 | Basf Se | Method for improving the health of a plant |
| EP3209818B1 (de) | 2014-10-24 | 2019-12-11 | Basf Se | Organische pestizid-teilchen |
| EP2910126A1 (en) | 2015-05-05 | 2015-08-26 | Bayer CropScience AG | Active compound combinations having insecticidal properties |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH429291A (de) * | 1964-12-17 | 1966-10-15 | Ciba Geigy | Verfahren zum Schützen von Textilien gegen Schädlinge |
| GB1143802A (Direct) * | 1965-03-25 | |||
| US3701807A (en) * | 1968-11-12 | 1972-10-31 | Monsanto Co | N-(1-cycloalken-1-yl) ureas and thioureas |
| US3728386A (en) * | 1970-07-27 | 1973-04-17 | Exxon Research Engineering Co | N-cycloalkylalkyl and n-cycloalkyl substituted phenyl ureas and halo acetamides |
| US3761241A (en) * | 1971-01-11 | 1973-09-25 | Monsanto Co | Phytotoxic use of n 1 cycloalken 1 yl ureas and thioureas |
| US4007033A (en) * | 1973-08-17 | 1977-02-08 | Chevron Research Company | Herbicidal substituted-haloethyl urea |
| JPS5224104B2 (Direct) * | 1974-10-07 | 1977-06-29 |
-
1976
- 1976-07-20 JP JP8558276A patent/JPS5312844A/ja active Granted
-
1977
- 1977-07-13 GB GB29444/77A patent/GB1527858A/en not_active Expired
- 1977-07-16 DE DE2732257A patent/DE2732257C3/de not_active Expired
- 1977-07-18 PH PH20006A patent/PH14202A/en unknown
- 1977-07-18 AU AU27084/77A patent/AU511087B2/en not_active Expired
- 1977-07-18 GR GR53985A patent/GR73014B/el unknown
- 1977-07-18 IT IT25825/77A patent/IT1083897B/it active
- 1977-07-18 LU LU77790A patent/LU77790A1/xx unknown
- 1977-07-19 BE BE179444A patent/BE856922A/xx not_active IP Right Cessation
- 1977-07-19 ZA ZA00774330A patent/ZA774330B/xx unknown
- 1977-07-19 FR FR7722073A patent/FR2359123A1/fr active Granted
- 1977-07-19 US US05/816,979 patent/US4127673A/en not_active Expired - Lifetime
- 1977-07-19 BR BR7704755A patent/BR7704755A/pt unknown
- 1977-07-19 IE IE1503/77A patent/IE45170B1/en not_active IP Right Cessation
- 1977-07-19 DK DK327077A patent/DK327077A/da not_active Application Discontinuation
- 1977-07-19 IL IL52548A patent/IL52548A/xx unknown
- 1977-07-19 CH CH895377A patent/CH630233A5/de not_active IP Right Cessation
- 1977-07-20 NL NLAANVRAGE7708088,A patent/NL174250C/xx not_active IP Right Cessation
- 1977-07-20 TR TR19192A patent/TR19192A/xx unknown
-
1982
- 1982-12-30 MY MY71/82A patent/MY8200071A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CH630233A5 (de) | 1982-06-15 |
| GR73014B (Direct) | 1984-01-25 |
| IL52548A0 (en) | 1977-10-31 |
| PH14202A (en) | 1981-03-31 |
| IE45170L (en) | 1978-01-20 |
| NL174250B (nl) | 1983-12-16 |
| AU511087B2 (en) | 1980-07-24 |
| FR2359123B1 (Direct) | 1980-09-19 |
| JPS5312844A (en) | 1978-02-04 |
| MY8200071A (en) | 1982-12-31 |
| BE856922A (fr) | 1978-01-19 |
| ZA774330B (en) | 1978-06-28 |
| DE2732257B2 (de) | 1980-07-03 |
| US4127673A (en) | 1978-11-28 |
| DK327077A (da) | 1978-01-21 |
| TR19192A (tr) | 1978-06-01 |
| IT1083897B (it) | 1985-05-25 |
| NL7708088A (nl) | 1978-01-24 |
| DE2732257A1 (de) | 1978-01-26 |
| AU2708477A (en) | 1979-01-25 |
| NL174250C (nl) | 1984-05-16 |
| GB1527858A (en) | 1978-10-11 |
| LU77790A1 (Direct) | 1978-02-02 |
| IL52548A (en) | 1980-09-16 |
| DE2732257C3 (de) | 1981-04-02 |
| JPS5550014B2 (Direct) | 1980-12-16 |
| FR2359123A1 (fr) | 1978-02-17 |
| BR7704755A (pt) | 1978-04-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IE45170B1 (en) | Urea or thiourea compounds | |
| EP0257888B1 (en) | An iodopropargyl carbamate derivative, a method for its production and fungicidal compositions containing it as an active ingredient | |
| US4010281A (en) | N-(4-halobenzyl)-n-branched alkyl-n'-phenylureas and fungicidal use thereof | |
| US4216228A (en) | Combating fungi with N-benzyl-N-cycloalkyl-ureas | |
| US4036986A (en) | Fungicidal N-(4-halobenzyl)-N-sec. alkyl-N'-phenylthioureas | |
| US3679726A (en) | Substituted benzyl-thiolcarbamic acid esters | |
| US5925674A (en) | Cycloalkylcarboxanilides | |
| CA1180334A (en) | N-sulphenylated biurets, processes for their preparation and their use as fungicides | |
| US3760043A (en) | O-phenyl-s-alkyl-n-alkyl-phosphoroamido-thiolates | |
| EP0018943A1 (de) | 1-Triazolo-N-(phenyl)-azomethin-Derivate, Verfahren zu ihrer Herstellung, diese Verbindungen enthaltende Mittel und ihre Verwendung in der Schädlingsbekämpfung | |
| CA1269111A (en) | Benzoylurea compounds and their production and use | |
| US4044045A (en) | Combating pests with di-(2-thioureido-(N-alkoxycarbonyl)-N-phenylureido)-compounds | |
| GB1574576A (en) | Mono-5-substituted-3-chloro-4h-1,2,6-thiadiazin-4-one antifungal agents | |
| WO1998004525A1 (en) | Fungicidal n-aryl five-membered cyclic imides | |
| KR820000176B1 (ko) | 우레아 유도체의 제조 방법 | |
| EP0258030A2 (en) | A fungicidal composition containing an iodopropargyl carbamate | |
| US4397869A (en) | Combating fungi with N-sulphenylated ureas | |
| US4737522A (en) | N-sulphenylated benzenesulphonic acid amide fungicides | |
| KR820000055B1 (ko) | 우레아 또는 티오우레아 화합물의 제조방법 | |
| EP0194562B1 (en) | Fungicidal composition | |
| US4497807A (en) | Thiadiazinone plant disease control agents | |
| US3917616A (en) | Substituted benzyl-thiolcarbamic acid esters | |
| US4133892A (en) | Combating pests with di-[2-thioureido-(N-alkoxycarbonyl)-N-phenylureido]-compounds | |
| US4514417A (en) | Combating fungi with new N-sulphenylated allophanates | |
| US3978107A (en) | Novel cyclohexyl carbamates and herbicidal and acaricidal compositions |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MK9A | Patent expired |