IE42710B1 - Substituted piperazine derivative,its preparation and compositions containing it - Google Patents
Substituted piperazine derivative,its preparation and compositions containing itInfo
- Publication number
- IE42710B1 IE42710B1 IE464/76A IE46476A IE42710B1 IE 42710 B1 IE42710 B1 IE 42710B1 IE 464/76 A IE464/76 A IE 464/76A IE 46476 A IE46476 A IE 46476A IE 42710 B1 IE42710 B1 IE 42710B1
- Authority
- IE
- Ireland
- Prior art keywords
- trifluoromethylthio
- compound
- nitro
- fluoro
- bromo
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title claims description 16
- 238000002360 preparation method Methods 0.000 title claims description 3
- 150000004885 piperazines Chemical class 0.000 title abstract description 4
- 150000001875 compounds Chemical class 0.000 claims abstract description 29
- 150000003839 salts Chemical class 0.000 claims abstract description 9
- GLUUGHFHXGJENI-UHFFFAOYSA-N diethylenediamine Natural products C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 claims abstract description 6
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 claims abstract description 5
- QTBPZZLJAGVEAM-UHFFFAOYSA-N 4-bromo-3-(trifluoromethylsulfanyl)aniline Chemical compound NC1=CC=C(Br)C(SC(F)(F)F)=C1 QTBPZZLJAGVEAM-UHFFFAOYSA-N 0.000 claims abstract description 4
- OMDVCPVYJUCGHK-UHFFFAOYSA-N 4-fluoro-3-(trifluoromethylsulfanyl)aniline Chemical compound NC1=CC=C(F)C(SC(F)(F)F)=C1 OMDVCPVYJUCGHK-UHFFFAOYSA-N 0.000 claims abstract description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 11
- 238000006243 chemical reaction Methods 0.000 claims description 8
- 239000002253 acid Substances 0.000 claims description 7
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 claims description 6
- 238000000034 method Methods 0.000 claims description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 4
- 229910052794 bromium Inorganic materials 0.000 claims description 4
- 239000003054 catalyst Substances 0.000 claims description 3
- 239000003814 drug Substances 0.000 claims description 2
- 239000003937 drug carrier Substances 0.000 claims description 2
- 229910000042 hydrogen bromide Inorganic materials 0.000 claims description 2
- 150000002828 nitro derivatives Chemical class 0.000 claims description 2
- 239000008194 pharmaceutical composition Substances 0.000 claims description 2
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N N-phenyl amine Natural products NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 claims 1
- 150000001448 anilines Chemical class 0.000 claims 1
- 230000003301 hydrolyzing effect Effects 0.000 claims 1
- 230000001590 oxidative effect Effects 0.000 claims 1
- 208000022531 anorexia Diseases 0.000 abstract description 6
- 206010061428 decreased appetite Diseases 0.000 abstract description 6
- 230000001939 inductive effect Effects 0.000 abstract description 5
- 239000003795 chemical substances by application Substances 0.000 abstract description 3
- 239000000543 intermediate Chemical class 0.000 abstract description 2
- TVJNFBMZRGVEOO-UHFFFAOYSA-N 1-bromo-4-nitro-2-(trifluoromethylsulfanyl)benzene Chemical compound [O-][N+](=O)C1=CC=C(Br)C(SC(F)(F)F)=C1 TVJNFBMZRGVEOO-UHFFFAOYSA-N 0.000 abstract 3
- IWRJVJJQWGZKMT-UHFFFAOYSA-N 1-bromo-2-(trifluoromethylsulfanyl)benzene Chemical compound FC(F)(F)SC1=CC=CC=C1Br IWRJVJJQWGZKMT-UHFFFAOYSA-N 0.000 abstract 1
- CAKWJBKQZUOMMF-UHFFFAOYSA-N 1-fluoro-4-nitro-2-(trifluoromethylsulfanyl)benzene Chemical compound [O-][N+](=O)C1=CC=C(F)C(SC(F)(F)F)=C1 CAKWJBKQZUOMMF-UHFFFAOYSA-N 0.000 abstract 1
- 239000004480 active ingredient Substances 0.000 abstract 1
- 230000031709 bromination Effects 0.000 abstract 1
- 238000005893 bromination reaction Methods 0.000 abstract 1
- 239000000825 pharmaceutical preparation Substances 0.000 abstract 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 16
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 15
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 10
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 5
- 239000000706 filtrate Substances 0.000 description 5
- 229910052938 sodium sulfate Inorganic materials 0.000 description 5
- 235000011152 sodium sulphate Nutrition 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 4
- NROKBHXJSPEDAR-UHFFFAOYSA-M potassium fluoride Chemical compound [F-].[K+] NROKBHXJSPEDAR-UHFFFAOYSA-M 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 231100000111 LD50 Toxicity 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000000155 melt Substances 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- SSOLNOMRVKKSON-UHFFFAOYSA-N proguanil Chemical compound CC(C)\N=C(/N)N=C(N)NC1=CC=C(Cl)C=C1 SSOLNOMRVKKSON-UHFFFAOYSA-N 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- DBGIVFWFUFKIQN-UHFFFAOYSA-N (+-)-Fenfluramine Chemical compound CCNC(C)CC1=CC=CC(C(F)(F)F)=C1 DBGIVFWFUFKIQN-UHFFFAOYSA-N 0.000 description 2
- TXUICONDJPYNPY-UHFFFAOYSA-N (1,10,13-trimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) heptanoate Chemical compound C1CC2CC(=O)C=C(C)C2(C)C2C1C1CCC(OC(=O)CCCCCC)C1(C)CC2 TXUICONDJPYNPY-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 241000699670 Mus sp. Species 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- IJKVHSBPTUYDLN-UHFFFAOYSA-N dihydroxy(oxo)silane Chemical compound O[Si](O)=O IJKVHSBPTUYDLN-UHFFFAOYSA-N 0.000 description 2
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 2
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 2
- 239000012259 ether extract Substances 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 229960001582 fenfluramine Drugs 0.000 description 2
- 235000013305 food Nutrition 0.000 description 2
- 235000012631 food intake Nutrition 0.000 description 2
- 238000001640 fractional crystallisation Methods 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 239000011698 potassium fluoride Substances 0.000 description 2
- 235000003270 potassium fluoride Nutrition 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000001119 stannous chloride Substances 0.000 description 2
- 235000011150 stannous chloride Nutrition 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- GRMGTJHSIVCGEW-UHFFFAOYSA-N 1-[4-fluoro-3-(trifluoromethyl)phenyl]piperazine Chemical compound C1=C(C(F)(F)F)C(F)=CC=C1N1CCNCC1 GRMGTJHSIVCGEW-UHFFFAOYSA-N 0.000 description 1
- WXKUQZCCHVFRGZ-UHFFFAOYSA-N 1-[4-fluoro-3-(trifluoromethylsulfanyl)phenyl]piperazine Chemical compound C1=C(SC(F)(F)F)C(F)=CC=C1N1CCNCC1 WXKUQZCCHVFRGZ-UHFFFAOYSA-N 0.000 description 1
- XFUMHENRNCUHOH-UHFFFAOYSA-N 1-fluoro-4-methylsulfanylbenzene Chemical compound CSC1=CC=C(F)C=C1 XFUMHENRNCUHOH-UHFFFAOYSA-N 0.000 description 1
- DCPLOIFDMMEBQZ-UHFFFAOYSA-N 2-bromo-n-phenylacetamide Chemical compound BrCC(=O)NC1=CC=CC=C1 DCPLOIFDMMEBQZ-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- 102100025027 E3 ubiquitin-protein ligase TRIM69 Human genes 0.000 description 1
- 101000830203 Homo sapiens E3 ubiquitin-protein ligase TRIM69 Proteins 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 208000008589 Obesity Diseases 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- 241000534944 Thia Species 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 230000007059 acute toxicity Effects 0.000 description 1
- 231100000403 acute toxicity Toxicity 0.000 description 1
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 1
- 230000002891 anorexigenic effect Effects 0.000 description 1
- WIRUZQNBHNAMAB-UHFFFAOYSA-N benzene;cyclohexane Chemical compound C1CCCCC1.C1=CC=CC=C1 WIRUZQNBHNAMAB-UHFFFAOYSA-N 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- BLNWTAHYTCHDJH-UHFFFAOYSA-O hydroxy(oxo)azanium Chemical compound O[NH+]=O BLNWTAHYTCHDJH-UHFFFAOYSA-O 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 230000004899 motility Effects 0.000 description 1
- 230000037023 motor activity Effects 0.000 description 1
- MGNPLIACIXIYJE-UHFFFAOYSA-N n-fluoroaniline Chemical compound FNC1=CC=CC=C1 MGNPLIACIXIYJE-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 235000020824 obesity Nutrition 0.000 description 1
- -1 ortho-disubstituted benzene compound Chemical class 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 235000011837 pasties Nutrition 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000004289 sodium hydrogen sulphite Substances 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 230000004936 stimulating effect Effects 0.000 description 1
- 229940066771 systemic antihistamines piperazine derivative Drugs 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 231100001274 therapeutic index Toxicity 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/08—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms
- C07D295/096—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms separated by carbocyclic rings or by carbon chains interrupted by carbocyclic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7507650A FR2303549A1 (fr) | 1975-03-12 | 1975-03-12 | Nouveau derive monosubstitue de piperazine, ses sels, sa preparation et les medicaments qui en renferment |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE42710L IE42710L (en) | 1976-09-12 |
| IE42710B1 true IE42710B1 (en) | 1980-10-08 |
Family
ID=9152445
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE464/76A IE42710B1 (en) | 1975-03-12 | 1976-03-05 | Substituted piperazine derivative,its preparation and compositions containing it |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US4044132A (show.php) |
| JP (1) | JPS51118779A (show.php) |
| AT (1) | AT350575B (show.php) |
| AU (1) | AU497004B2 (show.php) |
| BE (1) | BE839516A (show.php) |
| CA (1) | CA1058180A (show.php) |
| CH (1) | CH608796A5 (show.php) |
| DE (1) | DE2609574C3 (show.php) |
| DK (1) | DK139266B (show.php) |
| ES (1) | ES445969A1 (show.php) |
| FR (1) | FR2303549A1 (show.php) |
| GB (1) | GB1503626A (show.php) |
| GR (1) | GR59892B (show.php) |
| IE (1) | IE42710B1 (show.php) |
| LU (1) | LU74548A1 (show.php) |
| NL (1) | NL7602538A (show.php) |
| NO (1) | NO760837L (show.php) |
| SE (1) | SE7602760L (show.php) |
| ZA (1) | ZA761393B (show.php) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4202898A (en) * | 1978-06-05 | 1980-05-13 | Synthelabo | Method of treating anxiety and depression |
| EP0259265B1 (de) * | 1986-09-03 | 1991-09-11 | Ciba-Geigy Ag | 3-Methylphthalimide |
| EP0259264A1 (de) * | 1986-09-03 | 1988-03-09 | Ciba-Geigy Ag | Neue 4-Methylphthalimide |
| DE3737985A1 (de) * | 1987-11-09 | 1989-05-18 | Bayer Ag | Am aromatischen kern fluor enthaltende fluormethoxy- und fluormethylthio-aminobenzole und deren herstellung |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3637705A (en) * | 1968-10-01 | 1972-01-25 | Abbott Lab | N-3 4-dihalo phenyl piperazines |
| FR2179491B1 (show.php) * | 1972-04-10 | 1975-10-10 | Synthelabo |
-
1975
- 1975-03-12 FR FR7507650A patent/FR2303549A1/fr active Granted
-
1976
- 1976-02-27 SE SE7602760A patent/SE7602760L/xx not_active Application Discontinuation
- 1976-03-05 IE IE464/76A patent/IE42710B1/en unknown
- 1976-03-08 DE DE2609574A patent/DE2609574C3/de not_active Expired
- 1976-03-08 ZA ZA761393A patent/ZA761393B/xx unknown
- 1976-03-09 CA CA247,419A patent/CA1058180A/en not_active Expired
- 1976-03-10 GB GB9617/76A patent/GB1503626A/en not_active Expired
- 1976-03-10 NO NO760837A patent/NO760837L/no unknown
- 1976-03-11 NL NL7602538A patent/NL7602538A/xx not_active Application Discontinuation
- 1976-03-11 US US05/665,884 patent/US4044132A/en not_active Expired - Lifetime
- 1976-03-11 DK DK106076AA patent/DK139266B/da unknown
- 1976-03-11 ES ES445969A patent/ES445969A1/es not_active Expired
- 1976-03-12 AU AU11971/76A patent/AU497004B2/en not_active Expired
- 1976-03-12 LU LU74548A patent/LU74548A1/xx unknown
- 1976-03-12 JP JP51027623A patent/JPS51118779A/ja active Pending
- 1976-03-12 CH CH763135A patent/CH608796A5/xx not_active IP Right Cessation
- 1976-03-12 BE BE165121A patent/BE839516A/xx unknown
- 1976-03-12 GR GR50289A patent/GR59892B/el unknown
- 1976-03-12 AT AT183476A patent/AT350575B/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| US4044132A (en) | 1977-08-23 |
| JPS51118779A (en) | 1976-10-18 |
| NL7602538A (nl) | 1976-09-14 |
| AT350575B (de) | 1979-06-11 |
| CA1058180A (en) | 1979-07-10 |
| DE2609574A1 (de) | 1976-09-23 |
| DK139266B (da) | 1979-01-22 |
| ZA761393B (en) | 1977-02-23 |
| IE42710L (en) | 1976-09-12 |
| ES445969A1 (es) | 1977-05-16 |
| DE2609574B2 (de) | 1977-10-27 |
| LU74548A1 (show.php) | 1976-09-01 |
| DK106076A (show.php) | 1976-09-13 |
| AU497004B2 (en) | 1978-11-16 |
| DE2609574C3 (de) | 1978-06-22 |
| SE7602760L (sv) | 1976-09-13 |
| FR2303549A1 (fr) | 1976-10-08 |
| GR59892B (en) | 1978-03-15 |
| FR2303549B1 (show.php) | 1979-08-10 |
| GB1503626A (en) | 1978-03-15 |
| DK139266C (show.php) | 1979-06-25 |
| AU1197176A (en) | 1977-09-15 |
| NO760837L (show.php) | 1976-09-14 |
| CH608796A5 (show.php) | 1979-01-31 |
| ATA183476A (de) | 1978-11-15 |
| BE839516A (fr) | 1976-09-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CY1201A (en) | Substituted orthoanisamides methods of preparing them compositions containing them and their application as psychotropic agents | |
| EP0005528A2 (en) | Imidazole derivatives, their preparation and pharmaceutical compositions | |
| US3378582A (en) | (alpha-phenoxy)-and (alpha-phenylthio)-omegaphenyl-alkanoic acids | |
| EP0047536B1 (en) | Substituted propylamines | |
| US4064139A (en) | Substituted 9,10-dihydroanthracen-9,10-imines | |
| US4324796A (en) | Substituted oxiranecarboxylic acids, their use and medicaments containing them | |
| EP0098934A1 (en) | 2-Methylseleno-benzamides | |
| US3067101A (en) | Method for controlling hypertension | |
| FR2496102A1 (fr) | Benzopyranes 7-substitues, leur preparation et leur application en tant que medicaments | |
| US4430339A (en) | Substituted oxiranecarboxylic acids, their preparation and their use as medicaments | |
| US3860647A (en) | {60 -Aminomethyl-4-hydroxy-3-sulfamyl-benzyl alcohols and 4-hydroxy-3-sulfamyl phenethylamines | |
| US3652665A (en) | Halo-phenoxy salicylic acids | |
| US3860636A (en) | Substituted indenyl phosphonic acids having anti-inflammatory activity | |
| IE42710B1 (en) | Substituted piperazine derivative,its preparation and compositions containing it | |
| US3773936A (en) | Method of treating inflammation with substituted anilino salicylic acids | |
| US3851063A (en) | Treatment of pain,fever or inflammation | |
| GB2078715A (en) | N-(diethylaminoethyl)-2-alkoxybenzamide derivatives | |
| US4198431A (en) | Alkyl N-(3-trifluoromethylphenyl)-anthranilate | |
| US3917833A (en) | Amino-substituted benzocycloheptenones for inducing sleep | |
| JPS6281365A (ja) | グアニジノエタンチオスルホン酸、その製造法、及びそれを含有するコレステロ−ル低下剤 | |
| SU1547708A3 (ru) | Способ получени третбутил производного эрголина | |
| GB1560239A (en) | Substituted phenylglycolic acid and its pharmacetuically acceptable esters and salts and processes for preparing the same | |
| US3294638A (en) | Method and compositions employing 2-alkyl-3-piperidinopyrazines | |
| US3943254A (en) | Beta-adrenergic antagonists | |
| US3629463A (en) | Pharmaceutical compositions containing n-cyclopropyl-1-amino-1 2 3 4-tetrahydronaphthalenes and use of such n-cyclopropyl compounds as hypotensives |