IE42287B1 - Process for the preparation of aminophenyl chloroformate hydrochlorides - Google Patents
Process for the preparation of aminophenyl chloroformate hydrochloridesInfo
- Publication number
- IE42287B1 IE42287B1 IE247875A IE247875A IE42287B1 IE 42287 B1 IE42287 B1 IE 42287B1 IE 247875 A IE247875 A IE 247875A IE 247875 A IE247875 A IE 247875A IE 42287 B1 IE42287 B1 IE 42287B1
- Authority
- IE
- Ireland
- Prior art keywords
- chloroformate
- dialkylaminophenyl
- hydrochlorides
- preparation
- hydrochloride
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 28
- 238000002360 preparation method Methods 0.000 title claims abstract description 12
- -1 aminophenyl chloroformate hydrochlorides Chemical class 0.000 title abstract description 12
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical group ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims abstract description 21
- IGWCIHCQFSETGG-UHFFFAOYSA-N carbonochloridic acid;hydron;chloride Chemical class Cl.OC(Cl)=O IGWCIHCQFSETGG-UHFFFAOYSA-N 0.000 claims abstract description 16
- 238000006243 chemical reaction Methods 0.000 claims abstract description 10
- 239000002904 solvent Substances 0.000 claims abstract description 6
- 150000003973 alkyl amines Chemical class 0.000 claims abstract description 4
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims abstract 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 claims description 17
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 239000004215 Carbon black (E152) Substances 0.000 claims 1
- 229930195733 hydrocarbon Natural products 0.000 claims 1
- 150000002430 hydrocarbons Chemical class 0.000 claims 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 abstract description 3
- AHWALFGBDFAJAI-UHFFFAOYSA-N phenyl carbonochloridate Chemical compound ClC(=O)OC1=CC=CC=C1 AHWALFGBDFAJAI-UHFFFAOYSA-N 0.000 abstract 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 22
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical compound NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 229910052757 nitrogen Inorganic materials 0.000 description 8
- 239000000243 solution Substances 0.000 description 7
- 239000000370 acceptor Substances 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 description 4
- 239000002253 acid Substances 0.000 description 3
- 125000003277 amino group Chemical group 0.000 description 3
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 3
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 description 3
- AOGYCOYQMAVAFD-UHFFFAOYSA-N chlorocarbonic acid Chemical class OC(Cl)=O AOGYCOYQMAVAFD-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 238000002329 infrared spectrum Methods 0.000 description 3
- 239000012948 isocyanate Substances 0.000 description 3
- 150000002513 isocyanates Chemical class 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 2
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 2
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 150000003512 tertiary amines Chemical class 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- XAYFOYQUYGHVMH-UHFFFAOYSA-N (2-aminophenyl) carbamate Chemical class NC(=O)OC1=CC=CC=C1N XAYFOYQUYGHVMH-UHFFFAOYSA-N 0.000 description 1
- QUDZAFKCASPJLX-UHFFFAOYSA-N 2-aminophenol;hydron;chloride Chemical compound Cl.NC1=CC=CC=C1O QUDZAFKCASPJLX-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- 101100037762 Caenorhabditis elegans rnh-2 gene Proteins 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- UKLDJPRMSDWDSL-UHFFFAOYSA-L [dibutyl(dodecanoyloxy)stannyl] dodecanoate Chemical compound CCCCCCCCCCCC(=O)O[Sn](CCCC)(CCCC)OC(=O)CCCCCCCCCCC UKLDJPRMSDWDSL-UHFFFAOYSA-L 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 239000002274 desiccant Substances 0.000 description 1
- 239000012975 dibutyltin dilaurate Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- FTHUKEBATJXQFL-UHFFFAOYSA-N formic acid;hydrochloride Chemical compound Cl.OC=O FTHUKEBATJXQFL-UHFFFAOYSA-N 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- NQMRYBIKMRVZLB-UHFFFAOYSA-N methylamine hydrochloride Chemical compound [Cl-].[NH3+]C NQMRYBIKMRVZLB-UHFFFAOYSA-N 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000000361 pesticidal effect Effects 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 239000012264 purified product Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000009738 saturating Methods 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
Landscapes
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7441452A FR2295012A1 (fr) | 1974-12-17 | 1974-12-17 | Chlorhydrates de chloroformiates d'amino phenols |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE42287L IE42287L (en) | 1976-06-17 |
| IE42287B1 true IE42287B1 (en) | 1980-07-16 |
Family
ID=9146241
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE247875A IE42287B1 (en) | 1974-12-17 | 1975-11-14 | Process for the preparation of aminophenyl chloroformate hydrochlorides |
Country Status (9)
| Country | Link |
|---|---|
| BE (1) | BE836741A (enrdf_load_stackoverflow) |
| DE (1) | DE2556039C2 (enrdf_load_stackoverflow) |
| DK (1) | DK142809B (enrdf_load_stackoverflow) |
| FR (1) | FR2295012A1 (enrdf_load_stackoverflow) |
| GB (1) | GB1475259A (enrdf_load_stackoverflow) |
| IE (1) | IE42287B1 (enrdf_load_stackoverflow) |
| IT (1) | IT1051486B (enrdf_load_stackoverflow) |
| LU (1) | LU74014A1 (enrdf_load_stackoverflow) |
| NL (1) | NL7513504A (enrdf_load_stackoverflow) |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE535835C (de) * | 1928-12-04 | 1931-10-27 | Hoffmann La Roche & Co Akt Ges | Verfahren zur Darstellung von mono- und disubstituierten Carbaminsaeureestern |
-
1974
- 1974-12-17 FR FR7441452A patent/FR2295012A1/fr active Granted
-
1975
- 1975-11-14 IE IE247875A patent/IE42287B1/en unknown
- 1975-11-19 NL NL7513504A patent/NL7513504A/xx not_active Application Discontinuation
- 1975-12-02 GB GB4945975A patent/GB1475259A/en not_active Expired
- 1975-12-11 IT IT7005675A patent/IT1051486B/it active
- 1975-12-12 DE DE19752556039 patent/DE2556039C2/de not_active Expired
- 1975-12-15 LU LU74014A patent/LU74014A1/xx unknown
- 1975-12-16 DK DK570375A patent/DK142809B/da not_active IP Right Cessation
- 1975-12-17 BE BE162830A patent/BE836741A/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| LU74014A1 (enrdf_load_stackoverflow) | 1977-07-01 |
| BE836741A (fr) | 1976-06-17 |
| DE2556039C2 (de) | 1985-03-07 |
| IT1051486B (it) | 1981-04-21 |
| GB1475259A (en) | 1977-06-01 |
| IE42287L (en) | 1976-06-17 |
| DK142809C (enrdf_load_stackoverflow) | 1981-08-24 |
| NL7513504A (nl) | 1976-06-21 |
| DK142809B (da) | 1981-02-02 |
| FR2295012A1 (fr) | 1976-07-16 |
| DK570375A (enrdf_load_stackoverflow) | 1976-06-18 |
| FR2295012B1 (enrdf_load_stackoverflow) | 1979-02-23 |
| DE2556039A1 (de) | 1976-06-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU585810A3 (ru) | Способ получени производных имидазола | |
| AU645935B2 (en) | Production of fluoxetine and new intermediates | |
| JPH0115499B2 (enrdf_load_stackoverflow) | ||
| JPH0250106B2 (enrdf_load_stackoverflow) | ||
| US20060058548A1 (en) | Process of preparing O-carbamoyl compounds in the presence of active amine group | |
| NO764110L (enrdf_load_stackoverflow) | ||
| US3076007A (en) | Organic isocyanate preparation | |
| EA003022B1 (ru) | Способ синтеза ингибиторов протеазы вич | |
| IE42287B1 (en) | Process for the preparation of aminophenyl chloroformate hydrochlorides | |
| US4137253A (en) | Preparation of chloroformates having terminal acrylic or methacrylic groups | |
| KR20010005943A (ko) | 0-(3-아미노-2-히드록시-프로필)-히드록심산할라이드의 제조방법 | |
| EP0155862B1 (fr) | Procédé de préparation de dérivés de l'acide carbamique | |
| US5395945A (en) | Synthesis of 3,3-dinitroazetidine | |
| JP2000026473A (ja) | 第四級アルキルアンモニウムテトラフルオロホウ酸塩の製造方法 | |
| US4238404A (en) | Process for the preparation of isocyanate derivatives of aliphatic, cycloaliphatic, and araliphatic compounds | |
| US4122090A (en) | Cyclic esters of 3,4-dihydroxy-thiophene-1,1-dioxide compounds and 3,4-dihydroxy-cyclopentadienone compounds | |
| CA1113111A (en) | Process for the industrial synthesis of vinyl and isopropenyl chloroformate and thiochloroformate | |
| RU2711231C1 (ru) | Способ получения регулятора роста растений N-(изопропоксикарбонил)-О-(4-хлорфенилкарбамоил)этаноламина | |
| US3079302A (en) | O[n-di-(chloroalkyl)carbamoyl] serine | |
| JPH10504827A (ja) | 五置換グアニジンの新規合成方法 | |
| JPH05255229A (ja) | ウレタン及びカーボネートの製造方法 | |
| US3094538A (en) | Carbonatopropyl dicarbamates | |
| US2311046A (en) | Manufacture of aromatic isocyanates | |
| IL28661A (en) | Process for the manufacture of n-carbamoyloxyphenylcarbamates | |
| US3839394A (en) | Process for the preparation of substituted dinitrophenyl chloroformates |