IE41835B1 - Prostadienoic acid derivatives - Google Patents
Prostadienoic acid derivativesInfo
- Publication number
- IE41835B1 IE41835B1 IE1383/75A IE138375A IE41835B1 IE 41835 B1 IE41835 B1 IE 41835B1 IE 1383/75 A IE1383/75 A IE 1383/75A IE 138375 A IE138375 A IE 138375A IE 41835 B1 IE41835 B1 IE 41835B1
- Authority
- IE
- Ireland
- Prior art keywords
- formula
- methyl
- hydroxy
- compounds
- compound
- Prior art date
Links
- POKRQUNDSGAZIA-OALUTQOASA-N 7-[(1r,2s)-2-octylcyclopentyl]hepta-2,4-dienoic acid Chemical class CCCCCCCC[C@H]1CCC[C@@H]1CCC=CC=CC(O)=O POKRQUNDSGAZIA-OALUTQOASA-N 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 42
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 28
- 238000000034 method Methods 0.000 claims abstract description 21
- 238000002360 preparation method Methods 0.000 claims abstract description 10
- LERHYEVNRIMGPK-IERKJGKXSA-N 7-[(1R,2R)-2-(3-ethenyl-3-hydroxyoct-1-enyl)-5-oxocyclopentyl]hept-5-enoic acid Chemical compound CCCCCC(O)(C=C)C=C[C@H]1CCC(=O)[C@@H]1CC=CCCCC(O)=O LERHYEVNRIMGPK-IERKJGKXSA-N 0.000 claims abstract description 5
- 239000008194 pharmaceutical composition Substances 0.000 claims abstract description 4
- 239000003937 drug carrier Substances 0.000 claims abstract description 3
- 239000000546 pharmaceutical excipient Substances 0.000 claims abstract description 3
- 239000000203 mixture Substances 0.000 claims description 28
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 20
- 125000004432 carbon atom Chemical group C* 0.000 claims description 11
- 229910052763 palladium Inorganic materials 0.000 claims description 9
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 claims description 6
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 claims description 6
- 239000003054 catalyst Substances 0.000 claims description 6
- 238000009903 catalytic hydrogenation reaction Methods 0.000 claims description 5
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 239000004480 active ingredient Substances 0.000 claims description 2
- 239000000443 aerosol Substances 0.000 claims description 2
- 229910000019 calcium carbonate Inorganic materials 0.000 claims description 2
- 239000002775 capsule Substances 0.000 claims description 2
- 239000000843 powder Substances 0.000 claims description 2
- 239000000829 suppository Substances 0.000 claims description 2
- 239000000725 suspension Substances 0.000 claims description 2
- 239000006188 syrup Substances 0.000 claims description 2
- 235000020357 syrup Nutrition 0.000 claims description 2
- 239000003826 tablet Substances 0.000 claims description 2
- 238000005984 hydrogenation reaction Methods 0.000 claims 2
- 239000006229 carbon black Substances 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- 229910052739 hydrogen Inorganic materials 0.000 abstract description 5
- 230000000694 effects Effects 0.000 abstract description 3
- 208000001953 Hypotension Diseases 0.000 abstract description 2
- 208000021822 hypotensive Diseases 0.000 abstract description 2
- 230000001077 hypotensive effect Effects 0.000 abstract description 2
- 229940094443 oxytocics prostaglandins Drugs 0.000 abstract 2
- 150000003180 prostaglandins Chemical class 0.000 abstract 2
- 125000003342 alkenyl group Chemical group 0.000 abstract 1
- 125000000217 alkyl group Chemical group 0.000 abstract 1
- 125000000304 alkynyl group Chemical group 0.000 abstract 1
- 230000008602 contraction Effects 0.000 abstract 1
- 210000002460 smooth muscle Anatomy 0.000 abstract 1
- 238000011200 topical administration Methods 0.000 abstract 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 30
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 24
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 22
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 18
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 14
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 13
- 239000000243 solution Substances 0.000 description 11
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- 239000000470 constituent Substances 0.000 description 7
- 229920002554 vinyl polymer Polymers 0.000 description 7
- -1 2-btitenyl Chemical group 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 5
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 5
- 235000019341 magnesium sulphate Nutrition 0.000 description 5
- 239000000377 silicon dioxide Substances 0.000 description 5
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 5
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 238000004587 chromatography analysis Methods 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- LROBJRRFCPYLIT-UHFFFAOYSA-M magnesium;ethyne;bromide Chemical compound [Mg+2].[Br-].[C-]#C LROBJRRFCPYLIT-UHFFFAOYSA-M 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- 238000004809 thin layer chromatography Methods 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- LERHYEVNRIMGPK-YMVUGLPASA-N (Z)-7-[(1R,2R)-2-[(E)-3-ethenyl-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid Chemical compound CCCCCC(C=C)(/C=C/[C@@H](CC1)[C@@H](C/C=C\CCCC(O)=O)C1=O)O LERHYEVNRIMGPK-YMVUGLPASA-N 0.000 description 1
- 125000004973 1-butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000006017 1-propenyl group Chemical group 0.000 description 1
- 125000000530 1-propynyl group Chemical group [H]C([H])([H])C#C* 0.000 description 1
- 125000000069 2-butynyl group Chemical group [H]C([H])([H])C#CC([H])([H])* 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- 125000000474 3-butynyl group Chemical group [H]C#CC([H])([H])C([H])([H])* 0.000 description 1
- VPQUYTWCUVLHLA-KRWDZBQOSA-N 7-[(5R)-2-methoxy-5-(3-oxooct-1-enyl)cyclopenten-1-yl]hept-5-enoic acid Chemical compound COC1=C(CC=CCCCC(=O)O)[C@H](CC1)C=CC(CCCCC)=O VPQUYTWCUVLHLA-KRWDZBQOSA-N 0.000 description 1
- OYFGVONASXRUSR-ZENAZSQFSA-N 7-[(5R)-5-(3-hydroxyoct-1-enyl)-2-methoxycyclopenten-1-yl]hept-5-enoic acid Chemical compound OC(C=C[C@H]1CCC(=C1CC=CCCCC(=O)O)OC)CCCCC OYFGVONASXRUSR-ZENAZSQFSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- FDFWUSLHOJFYNR-LJJQOFDWSA-N OC(C=C[C@H]1CC=C([C@@H]1CC=CCCCC(=O)O)OC)CCCCC Chemical compound OC(C=C[C@H]1CC=C([C@@H]1CC=CCCCC(=O)O)OC)CCCCC FDFWUSLHOJFYNR-LJJQOFDWSA-N 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- 241000786363 Rhampholeon spectrum Species 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 208000006673 asthma Diseases 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 208000035475 disorder Diseases 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- DQYBDCGIPTYXML-UHFFFAOYSA-N ethoxyethane;hydrate Chemical compound O.CCOCC DQYBDCGIPTYXML-UHFFFAOYSA-N 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229940046892 lead acetate Drugs 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000013160 medical therapy Methods 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 125000002734 organomagnesium group Chemical group 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 238000000053 physical method Methods 0.000 description 1
- WGJJROVFWIXTPA-OALUTQOASA-N prostanoic acid Chemical class CCCCCCCC[C@H]1CCC[C@@H]1CCCCCCC(O)=O WGJJROVFWIXTPA-OALUTQOASA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 208000023504 respiratory system disease Diseases 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C405/00—Compounds containing a five-membered ring having two side-chains in ortho position to each other, and having oxygen atoms directly attached to the ring in ortho position to one of the side-chains, one side-chain containing, not directly attached to the ring, a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, and the other side-chain having oxygen atoms attached in gamma-position to the ring, e.g. prostaglandins ; Analogues or derivatives thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Cosmetics (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7421602A FR2275443A1 (fr) | 1974-06-21 | 1974-06-21 | Nouveau procede de preparation de derives substitues de l'acide prostanoique |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE41835L IE41835L (en) | 1975-12-21 |
| IE41835B1 true IE41835B1 (en) | 1980-04-09 |
Family
ID=9140359
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE1383/75A IE41835B1 (en) | 1974-06-21 | 1975-06-20 | Prostadienoic acid derivatives |
Country Status (17)
| Country | Link |
|---|---|
| JP (1) | JPS5113751A (OSRAM) |
| BE (1) | BE830475A (OSRAM) |
| CA (1) | CA1061338A (OSRAM) |
| CH (1) | CH596163A5 (OSRAM) |
| DD (1) | DD118412A5 (OSRAM) |
| DE (1) | DE2526355A1 (OSRAM) |
| DK (1) | DK142171B (OSRAM) |
| ES (1) | ES438725A1 (OSRAM) |
| FR (1) | FR2275443A1 (OSRAM) |
| GB (1) | GB1478262A (OSRAM) |
| IE (1) | IE41835B1 (OSRAM) |
| IL (1) | IL47437A (OSRAM) |
| LU (1) | LU72786A1 (OSRAM) |
| NL (1) | NL7507431A (OSRAM) |
| SE (1) | SE7505967L (OSRAM) |
| SU (1) | SU577977A3 (OSRAM) |
| ZA (1) | ZA753959B (OSRAM) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4022912A (en) * | 1976-02-09 | 1977-05-10 | Miles Laboratories, Inc. | Use of 1-decarboxy-1-hydroxymethyl-PGE1 in therapeutic bronchodilation |
| JPH06104644B2 (ja) * | 1986-03-04 | 1994-12-21 | 住友化学工業株式会社 | 光学活性なシクロペンテノン誘導体の製造法 |
-
1974
- 1974-06-21 FR FR7421602A patent/FR2275443A1/fr active Granted
-
1975
- 1975-05-26 SE SE7505967A patent/SE7505967L/ not_active Application Discontinuation
- 1975-06-06 IL IL47437A patent/IL47437A/xx unknown
- 1975-06-12 DE DE19752526355 patent/DE2526355A1/de not_active Withdrawn
- 1975-06-19 DD DD186765A patent/DD118412A5/xx unknown
- 1975-06-20 SU SU7502145918A patent/SU577977A3/ru active
- 1975-06-20 CA CA229,850A patent/CA1061338A/fr not_active Expired
- 1975-06-20 ZA ZA3959A patent/ZA753959B/xx unknown
- 1975-06-20 DK DK279475AA patent/DK142171B/da not_active IP Right Cessation
- 1975-06-20 CH CH808275A patent/CH596163A5/xx not_active IP Right Cessation
- 1975-06-20 NL NL7507431A patent/NL7507431A/xx not_active Application Discontinuation
- 1975-06-20 LU LU72786A patent/LU72786A1/xx unknown
- 1975-06-20 ES ES438725A patent/ES438725A1/es not_active Expired
- 1975-06-20 IE IE1383/75A patent/IE41835B1/en unknown
- 1975-06-20 JP JP50074560A patent/JPS5113751A/ja active Pending
- 1975-06-20 BE BE157537A patent/BE830475A/xx unknown
- 1975-06-23 GB GB2659175A patent/GB1478262A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| IE41835L (en) | 1975-12-21 |
| JPS5113751A (OSRAM) | 1976-02-03 |
| SE7505967L (sv) | 1975-12-22 |
| IL47437A0 (en) | 1975-08-31 |
| NL7507431A (nl) | 1975-12-23 |
| DK279475A (OSRAM) | 1975-12-22 |
| DE2526355A1 (de) | 1976-01-08 |
| ZA753959B (en) | 1977-01-26 |
| CH596163A5 (OSRAM) | 1978-02-28 |
| DK142171B (da) | 1980-09-15 |
| SU577977A3 (ru) | 1977-10-25 |
| DD118412A5 (OSRAM) | 1976-03-05 |
| FR2275443B1 (OSRAM) | 1976-10-22 |
| IL47437A (en) | 1979-10-31 |
| FR2275443A1 (fr) | 1976-01-16 |
| GB1478262A (en) | 1977-06-29 |
| DK142171C (OSRAM) | 1981-02-09 |
| LU72786A1 (OSRAM) | 1976-04-13 |
| AU8211175A (en) | 1976-12-16 |
| ES438725A1 (es) | 1977-03-16 |
| BE830475A (fr) | 1975-12-22 |
| CA1061338A (fr) | 1979-08-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4116988A (en) | 16-Phenoxy prostaglandin E1 analogs | |
| US4029681A (en) | 13,14-Didehydro-PG analogs | |
| SU588916A3 (ru) | Способ получени 2-тетрагидрофурил-6,7-бензоморфанов или их солей | |
| SU873877A3 (ru) | Способ получени оптически акивных или рацемических производных простановых кислот или их солей | |
| FR2466446A1 (fr) | Bicyclo-alcanones, intermediaires de la preparation d'isosteres de type 9-desoxy-9a-methylene de pgi2 | |
| US3933889A (en) | 4,5-Cis-didehydro-PGF1.sub.α analogs | |
| US4026909A (en) | Cis-13-PGF2.sub.α analogs | |
| DE1958600A1 (de) | Neue Isoxazolderivate und deren Herstellung | |
| IE41835B1 (en) | Prostadienoic acid derivatives | |
| CA2012081C (en) | 2,5,6,7-tetranor-4,8-inter-m-phenylene pgi 2 derivatives | |
| CA1159452A (en) | (5e)-9-deoxy-6,9-epoxy-prostaglandin derivatives | |
| EP0050387B1 (en) | Benzo (4,5) pyrano (2,3c) pyrroles, processes for their preparation and pharmaceutical preparations containing same | |
| CA1196632A (en) | 5,6-dihydro-prostacyclin analogs | |
| Yamada et al. | A five-step synthesis of psilocin from indole-3-carbaldehyde | |
| SU602112A3 (ru) | Способ получени аминов, или их солей, рацематов или оптическиактивных антиподов | |
| JPS59141536A (ja) | 新規ビシクロオクタン誘導体 | |
| US3932467A (en) | Process for the production of 2β-formyl 3α-protected hydroxy-5-oxocyclopentane-1α-heptanoic acids and esters corresponding | |
| US4099015A (en) | 2,2-Difluoro-13,14-didehydro-11-deoxy-17-phenyl-18,19,20-trinor-PGE2 compounds | |
| US4551476A (en) | 13,14-Didehydro-prostaglandins and process for their preparation | |
| US4029693A (en) | 2A,2B-Dihomo-11-deoxy-17(substituted phenyl)-18,19,20-trinor-PGE2 compounds and their corresponding esters | |
| US4018803A (en) | 13,14-Didehydro-PG3 compounds | |
| US4197407A (en) | Prostenoic acids and esters | |
| US4130721A (en) | 11-Deoxy PGE2 compounds | |
| US4086258A (en) | 13,14-Didehydro-PGA1 compounds | |
| FR2515642A1 (fr) | Nouvelles (11r)-11-deoxy-11-alkyl-6-oxo-prostaglandines et compositions pharmaceutiques les contenant |