IE41830B1 - Process for preparing phenylglycines - Google Patents
Process for preparing phenylglycinesInfo
- Publication number
- IE41830B1 IE41830B1 IE2501/74A IE250174A IE41830B1 IE 41830 B1 IE41830 B1 IE 41830B1 IE 2501/74 A IE2501/74 A IE 2501/74A IE 250174 A IE250174 A IE 250174A IE 41830 B1 IE41830 B1 IE 41830B1
- Authority
- IE
- Ireland
- Prior art keywords
- glycine
- hydroxy
- hydrogen
- carbon
- formula
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title claims description 4
- 150000005331 phenylglycines Chemical class 0.000 title abstract description 6
- -1 α-phenethyl Chemical group 0.000 claims abstract description 37
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims abstract description 29
- 150000001875 compounds Chemical class 0.000 claims abstract description 27
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims abstract description 14
- HHLFWLYXYJOTON-UHFFFAOYSA-N glyoxylic acid Chemical compound OC(=O)C=O HHLFWLYXYJOTON-UHFFFAOYSA-N 0.000 claims abstract description 14
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 14
- 239000001257 hydrogen Substances 0.000 claims abstract description 14
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 12
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 10
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 10
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 claims abstract description 9
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims abstract description 9
- 239000004202 carbamide Substances 0.000 claims abstract description 8
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical group C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 claims abstract description 8
- 125000006000 trichloroethyl group Chemical group 0.000 claims abstract description 7
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 5
- 150000001408 amides Chemical class 0.000 claims abstract description 5
- CREMABGTGYGIQB-UHFFFAOYSA-N carbon carbon Chemical compound C.C CREMABGTGYGIQB-UHFFFAOYSA-N 0.000 claims abstract description 5
- 239000011203 carbon fibre reinforced carbon Substances 0.000 claims abstract description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 5
- GNVMUORYQLCPJZ-UHFFFAOYSA-M Thiocarbamate Chemical compound NC([S-])=O GNVMUORYQLCPJZ-UHFFFAOYSA-M 0.000 claims abstract description 4
- 150000002148 esters Chemical class 0.000 claims abstract description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 4
- 229910052717 sulfur Inorganic materials 0.000 claims abstract description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims abstract description 4
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 claims abstract 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims abstract 2
- 238000000034 method Methods 0.000 claims description 61
- 229930182555 Penicillin Natural products 0.000 claims description 9
- 238000006243 chemical reaction Methods 0.000 claims description 8
- 239000002253 acid Substances 0.000 claims description 7
- 229930186147 Cephalosporin Natural products 0.000 claims description 6
- 229940124587 cephalosporin Drugs 0.000 claims description 6
- 229940049954 penicillin Drugs 0.000 claims description 6
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 claims description 5
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 229910015900 BF3 Inorganic materials 0.000 claims description 2
- 239000002841 Lewis acid Substances 0.000 claims description 2
- 125000001153 fluoro group Chemical group F* 0.000 claims description 2
- 150000007517 lewis acids Chemical class 0.000 claims description 2
- 239000000376 reactant Substances 0.000 claims 1
- 238000002360 preparation method Methods 0.000 abstract description 3
- 229910052760 oxygen Inorganic materials 0.000 abstract 2
- 125000001475 halogen functional group Chemical group 0.000 abstract 1
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 116
- 239000004471 Glycine Substances 0.000 description 59
- 229960002449 glycine Drugs 0.000 description 59
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 45
- XBXCNNQPRYLIDE-UHFFFAOYSA-N tert-butylcarbamic acid Chemical compound CC(C)(C)NC(O)=O XBXCNNQPRYLIDE-UHFFFAOYSA-N 0.000 description 17
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 15
- 229960003742 phenol Drugs 0.000 description 14
- 239000011541 reaction mixture Substances 0.000 description 14
- 238000006467 substitution reaction Methods 0.000 description 13
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 12
- MOOYVEVEDVVKGD-UHFFFAOYSA-N oxaldehydic acid;hydrate Chemical compound O.OC(=O)C=O MOOYVEVEDVVKGD-UHFFFAOYSA-N 0.000 description 12
- 239000000203 mixture Substances 0.000 description 11
- LUBJCRLGQSPQNN-UHFFFAOYSA-N 1-Phenylurea Chemical compound NC(=O)NC1=CC=CC=C1 LUBJCRLGQSPQNN-UHFFFAOYSA-N 0.000 description 10
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 10
- 239000000047 product Substances 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- LSBDFXRDZJMBSC-UHFFFAOYSA-N 2-phenylacetamide Chemical compound NC(=O)CC1=CC=CC=C1 LSBDFXRDZJMBSC-UHFFFAOYSA-N 0.000 description 8
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 8
- LJCWONGJFPCTTL-UHFFFAOYSA-N 4-hydroxyphenylglycine Chemical class OC(=O)C(N)C1=CC=C(O)C=C1 LJCWONGJFPCTTL-UHFFFAOYSA-N 0.000 description 7
- 239000008346 aqueous phase Substances 0.000 description 7
- NXXYKOUNUYWIHA-UHFFFAOYSA-N 2,6-Dimethylphenol Chemical compound CC1=CC=CC(C)=C1O NXXYKOUNUYWIHA-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- 238000005917 acylation reaction Methods 0.000 description 6
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 125000003277 amino group Chemical group 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 5
- 150000001780 cephalosporins Chemical class 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- XNIHZNNZJHYHLC-UHFFFAOYSA-M 2-oxohexanoate Chemical compound CCCCC(=O)C([O-])=O XNIHZNNZJHYHLC-UHFFFAOYSA-M 0.000 description 4
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 230000010933 acylation Effects 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- RJNJWHFSKNJCTB-UHFFFAOYSA-N benzylurea Chemical compound NC(=O)NCC1=CC=CC=C1 RJNJWHFSKNJCTB-UHFFFAOYSA-N 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- QWVGKYWNOKOFNN-UHFFFAOYSA-N o-cresol Chemical compound CC1=CC=CC=C1O QWVGKYWNOKOFNN-UHFFFAOYSA-N 0.000 description 4
- UADYIAKXZXQESY-UHFFFAOYSA-N o-tert-butyl carbamothioate Chemical compound CC(C)(C)OC(N)=S UADYIAKXZXQESY-UHFFFAOYSA-N 0.000 description 4
- 230000003287 optical effect Effects 0.000 description 4
- 150000002989 phenols Chemical class 0.000 description 4
- 238000000926 separation method Methods 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- NRKYWOKHZRQRJR-UHFFFAOYSA-N 2,2,2-trifluoroacetamide Chemical class NC(=O)C(F)(F)F NRKYWOKHZRQRJR-UHFFFAOYSA-N 0.000 description 3
- CGDQNVNWDDEJPY-UHFFFAOYSA-N 2-(4-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)acetic acid Chemical compound C=1C=C(O)C=CC=1C(C(=O)O)NC(=O)OCC1=CC=CC=C1 CGDQNVNWDDEJPY-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 125000003630 glycyl group Chemical group [H]N([H])C([H])([H])C(*)=O 0.000 description 3
- 150000002431 hydrogen Chemical class 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 150000002596 lactones Chemical class 0.000 description 3
- 150000004702 methyl esters Chemical class 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- JPWQSSQOIDBJBI-UHFFFAOYSA-N o-benzyl carbamothioate Chemical compound NC(=S)OCC1=CC=CC=C1 JPWQSSQOIDBJBI-UHFFFAOYSA-N 0.000 description 3
- 230000020477 pH reduction Effects 0.000 description 3
- 150000002960 penicillins Chemical class 0.000 description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 3
- 125000006239 protecting group Chemical group 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- 238000010561 standard procedure Methods 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- 125000003944 tolyl group Chemical group 0.000 description 3
- KLIDCXVFHGNTTM-UHFFFAOYSA-N 2,6-dimethoxyphenol Chemical compound COC1=CC=CC(OC)=C1O KLIDCXVFHGNTTM-UHFFFAOYSA-N 0.000 description 2
- TYEYBOSBBBHJIV-UHFFFAOYSA-M 2-oxobutanoate Chemical compound CCC(=O)C([O-])=O TYEYBOSBBBHJIV-UHFFFAOYSA-M 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- LJCWONGJFPCTTL-ZETCQYMHSA-N L-4-hydroxyphenylglycine Chemical compound OC(=O)[C@@H](N)C1=CC=C(O)C=C1 LJCWONGJFPCTTL-ZETCQYMHSA-N 0.000 description 2
- LCTONWCANYUPML-UHFFFAOYSA-M Pyruvate Chemical compound CC(=O)C([O-])=O LCTONWCANYUPML-UHFFFAOYSA-M 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 150000001413 amino acids Chemical class 0.000 description 2
- 239000003242 anti bacterial agent Substances 0.000 description 2
- 230000000844 anti-bacterial effect Effects 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- DUXANUSOCMOJSI-UHFFFAOYSA-N benzhydryl carbamate Chemical compound C=1C=CC=CC=1C(OC(=O)N)C1=CC=CC=C1 DUXANUSOCMOJSI-UHFFFAOYSA-N 0.000 description 2
- YCIMNLLNPGFGHC-UHFFFAOYSA-N catechol Chemical compound OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 125000001188 haloalkyl group Chemical group 0.000 description 2
- 125000004464 hydroxyphenyl group Chemical group 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- RLSSMJSEOOYNOY-UHFFFAOYSA-N m-cresol Chemical compound CC1=CC=CC(O)=C1 RLSSMJSEOOYNOY-UHFFFAOYSA-N 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 239000001488 sodium phosphate Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 2
- 229910000406 trisodium phosphate Inorganic materials 0.000 description 2
- 235000019801 trisodium phosphate Nutrition 0.000 description 2
- 238000010792 warming Methods 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- QDAYZTZGLPEDOB-UHFFFAOYSA-N 2-(2-hydroxyanilino)acetic acid Chemical compound OC(=O)CNC1=CC=CC=C1O QDAYZTZGLPEDOB-UHFFFAOYSA-N 0.000 description 1
- VBZRDDRGZQUHLD-UHFFFAOYSA-N 2-(2-hydroxyphenyl)-2-[(2,2,2-trifluoroacetyl)amino]acetic acid Chemical compound FC(C(=O)NC(C(=O)O)C1=C(C=CC=C1)O)(F)F VBZRDDRGZQUHLD-UHFFFAOYSA-N 0.000 description 1
- CBJVTWUVPXQONY-UHFFFAOYSA-N 2-(2-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid Chemical compound CC(C)(C)OC(=O)NC(C(O)=O)C1=CC=CC=C1O CBJVTWUVPXQONY-UHFFFAOYSA-N 0.000 description 1
- WJVLKRKYMKBCDA-UHFFFAOYSA-N 2-(4-hydroxy-3-methylphenyl)-2-(phenylcarbamoylamino)acetic acid Chemical compound C1(=CC=CC=C1)NC(=O)NC(C(=O)O)C1=CC(=C(C=C1)O)C WJVLKRKYMKBCDA-UHFFFAOYSA-N 0.000 description 1
- UYDSXQIHUMUSOQ-UHFFFAOYSA-N 2-(4-hydroxyphenyl)-2-(phenoxycarbonylamino)acetic acid Chemical compound O(C1=CC=CC=C1)C(=O)NC(C(=O)O)C1=CC=C(C=C1)O UYDSXQIHUMUSOQ-UHFFFAOYSA-N 0.000 description 1
- MGSAVTZFSZJUAH-UHFFFAOYSA-N 2-(4-hydroxyphenyl)-2-(phenylcarbamoylamino)acetic acid Chemical compound C=1C=C(O)C=CC=1C(C(=O)O)NC(=O)NC1=CC=CC=C1 MGSAVTZFSZJUAH-UHFFFAOYSA-N 0.000 description 1
- VYRLGZVBBQVMRK-UHFFFAOYSA-N 2-(4-hydroxyphenyl)-2-[(2-phenylacetyl)amino]acetic acid Chemical compound C=1C=C(O)C=CC=1C(C(=O)O)NC(=O)CC1=CC=CC=C1 VYRLGZVBBQVMRK-UHFFFAOYSA-N 0.000 description 1
- UVJQJJCJNQDKIY-UHFFFAOYSA-N 2-acetamido-2-(4-hydroxyphenyl)acetic acid Chemical compound CC(=O)NC(C(O)=O)C1=CC=C(O)C=C1 UVJQJJCJNQDKIY-UHFFFAOYSA-N 0.000 description 1
- ZEUVKCDGZSTJBE-UHFFFAOYSA-N 2-benzamido-2-(2-hydroxyphenyl)acetic acid Chemical compound C(C1=CC=CC=C1)(=O)NC(C(=O)O)C1=C(C=CC=C1)O ZEUVKCDGZSTJBE-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- BUBVLQDEIIUIQG-UHFFFAOYSA-N 3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-one Chemical compound C=1C=CC=CC=1COC1C(OCC=2C=CC=CC=2)C(OCC=2C=CC=CC=2)C(=O)OC1COCC1=CC=CC=C1 BUBVLQDEIIUIQG-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- FOELAGJWTKYUDZ-UHFFFAOYSA-N C(C)(C)(C)C(=S)NC(C(=O)O)C1=C(C=C(C=C1)O)O Chemical compound C(C)(C)(C)C(=S)NC(C(=O)O)C1=C(C=C(C=C1)O)O FOELAGJWTKYUDZ-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- GSHIDXLOTQDUAV-UHFFFAOYSA-N N-Carbamoyl-2-amino-2-(4-hydroxyphenyl)acetic acid Chemical compound NC(=O)NC(C(O)=O)C1=CC=C(O)C=C1 GSHIDXLOTQDUAV-UHFFFAOYSA-N 0.000 description 1
- 230000006181 N-acylation Effects 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- PUJDIJCNWFYVJX-UHFFFAOYSA-N benzyl carbamate Chemical compound NC(=O)OCC1=CC=CC=C1 PUJDIJCNWFYVJX-UHFFFAOYSA-N 0.000 description 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- KBPMSFYZMFMQBP-UHFFFAOYSA-N butyl 2-(2-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)acetate Chemical class C=1C=CC=C(O)C=1C(C(=O)OCCCC)NC(=O)OCC1=CC=CC=C1 KBPMSFYZMFMQBP-UHFFFAOYSA-N 0.000 description 1
- HFDGKLCUGOEPEV-UHFFFAOYSA-N butyl 2-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate Chemical compound CCCCOC(=O)C(NC(=O)OC(C)(C)C)C1=CC=C(O)C=C1 HFDGKLCUGOEPEV-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004744 butyloxycarbonyl group Chemical group 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000006184 cosolvent Substances 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 150000002332 glycine derivatives Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000012456 homogeneous solution Substances 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 150000002440 hydroxy compounds Chemical class 0.000 description 1
- 150000005204 hydroxybenzenes Chemical class 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- BSCCSDNZEIHXOK-UHFFFAOYSA-N phenyl carbamate Chemical compound NC(=O)OC1=CC=CC=C1 BSCCSDNZEIHXOK-UHFFFAOYSA-N 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- 102000004196 processed proteins & peptides Human genes 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- SOEVVANXSDKPIY-UHFFFAOYSA-M sodium glyoxylate Chemical compound [Na+].[O-]C(=O)C=O SOEVVANXSDKPIY-UHFFFAOYSA-M 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000006253 t-butylcarbonyl group Chemical group [H]C([H])([H])C(C(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 125000006007 trichloroethoxy group Chemical group 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C273/00—Preparation of urea or its derivatives, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C273/18—Preparation of urea or its derivatives, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups of substituted ureas
- C07C273/1854—Preparation of urea or its derivatives, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups of substituted ureas by reactions not involving the formation of the N-C(O)-N- moiety
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US422398A US3860631A (en) | 1973-12-06 | 1973-12-06 | Process for the preparation of n-acyl-2- and 4-hydroxyphenylglycines |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE41830L IE41830L (en) | 1975-06-06 |
| IE41830B1 true IE41830B1 (en) | 1980-04-09 |
Family
ID=23674710
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE2501/74A IE41830B1 (en) | 1973-12-06 | 1974-12-04 | Process for preparing phenylglycines |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3860631A (OSRAM) |
| JP (1) | JPS5813538B2 (OSRAM) |
| BE (1) | BE822006A (OSRAM) |
| CA (1) | CA1046522A (OSRAM) |
| CH (1) | CH608231A5 (OSRAM) |
| DE (1) | DE2457617C2 (OSRAM) |
| FR (1) | FR2253738B1 (OSRAM) |
| GB (1) | GB1435268A (OSRAM) |
| IE (1) | IE41830B1 (OSRAM) |
| IL (1) | IL45868A (OSRAM) |
| NL (1) | NL7415930A (OSRAM) |
| ZA (1) | ZA746536B (OSRAM) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| LU66433A1 (OSRAM) * | 1972-11-08 | 1973-02-01 | ||
| CA1066304A (en) * | 1975-09-12 | 1979-11-13 | Yani Christidis | Process for manufacturing n-acyl derivatives of hydroxyarylgycines and novel products resulting therefrom |
| US4111981A (en) * | 1975-12-15 | 1978-09-05 | Smithkline Corporation | Intermediates for preparing substituted phenylglycylcephalosporins |
| CA1108180A (en) * | 1976-07-21 | 1981-09-01 | Hamao Umezawa | Analogs of bestatin |
| JPS53112874A (en) * | 1977-03-11 | 1978-10-02 | Kanegafuchi Chem Ind Co Ltd | Production of 5-(4-hydroxyphenyl)hydantoin |
| IE46672B1 (en) * | 1977-03-18 | 1983-08-24 | Kanegafuchi Chemical Ind | Process for preparing 5-(4-hydroxyphenyl)hydantoin |
| JPS53116373A (en) * | 1977-03-18 | 1978-10-11 | Kanegafuchi Chem Ind Co Ltd | Preparation of 5-(4-hydroxyphenyl)hydantoin |
| GB1576334A (en) * | 1977-05-26 | 1980-10-08 | Ici Ltd | N-alkyl and n,n-dialkyl derivatives thereof process for the manufacture of p-hydroxyphenylglycine and |
| FR2446273A1 (fr) * | 1979-01-11 | 1980-08-08 | Hoechst France | Dl,n-methoxycarbonyl(p-hydroxyphenyl)-2 glycine, son procede de preparation et son application |
| DE3479731D1 (en) * | 1983-07-07 | 1989-10-19 | Beecham Group Plc | Substituted phenylglycine derivatives of beta-lactam antibiotics |
| DE3832740A1 (de) * | 1988-09-27 | 1990-04-05 | Basf Ag | Verfahren zur herstellung von 1-amino-2-chlor-4-hydroxy-anthrachinon |
| EP0432022B1 (fr) * | 1989-12-04 | 1996-10-23 | Rhone-Poulenc Chimie | Milieu réactionnel et solubilisant de peptides et procédé de synthèse de peptides utilisant ce milieu |
| JP5767346B2 (ja) * | 2012-02-15 | 2015-08-19 | ホーナン ニューランド ファーマシューティカル カンパニー リミテッド | 左旋性p−ヒドロキシフェニルグリシン化合物の合成方法 |
-
1973
- 1973-12-06 US US422398A patent/US3860631A/en not_active Expired - Lifetime
-
1974
- 1974-10-09 CA CA211,096A patent/CA1046522A/en not_active Expired
- 1974-10-14 ZA ZA00746536A patent/ZA746536B/xx unknown
- 1974-10-17 IL IL45868A patent/IL45868A/xx unknown
- 1974-11-08 BE BE150343A patent/BE822006A/xx not_active IP Right Cessation
- 1974-11-21 FR FR7438338A patent/FR2253738B1/fr not_active Expired
- 1974-12-02 GB GB5202574A patent/GB1435268A/en not_active Expired
- 1974-12-02 JP JP49140622A patent/JPS5813538B2/ja not_active Expired
- 1974-12-04 IE IE2501/74A patent/IE41830B1/en unknown
- 1974-12-04 CH CH1611674A patent/CH608231A5/xx not_active IP Right Cessation
- 1974-12-05 DE DE2457617A patent/DE2457617C2/de not_active Expired
- 1974-12-06 NL NL7415930A patent/NL7415930A/xx not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| CA1046522A (en) | 1979-01-16 |
| IE41830L (en) | 1975-06-06 |
| FR2253738B1 (OSRAM) | 1976-10-22 |
| JPS5084544A (OSRAM) | 1975-07-08 |
| JPS5813538B2 (ja) | 1983-03-14 |
| ZA746536B (en) | 1975-11-26 |
| AU7507574A (en) | 1976-05-06 |
| NL7415930A (nl) | 1975-06-10 |
| IL45868A (en) | 1978-06-15 |
| IL45868A0 (en) | 1974-12-31 |
| BE822006A (fr) | 1975-05-09 |
| DE2457617C2 (de) | 1985-07-11 |
| US3860631A (en) | 1975-01-14 |
| DE2457617A1 (de) | 1975-06-12 |
| FR2253738A1 (OSRAM) | 1975-07-04 |
| GB1435268A (en) | 1976-05-12 |
| CH608231A5 (OSRAM) | 1978-12-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3860631A (en) | Process for the preparation of n-acyl-2- and 4-hydroxyphenylglycines | |
| EP1149066B1 (en) | Method of preparing alkylated salicylamides | |
| CA1232910A (en) | METHOD OF RESOLVING BICYCLIC IMINO-.alpha.-CARBOXYLIC ACID ESTER RACEMATES | |
| US4480109A (en) | Process for producing threo-3-(3,4-dihydroxyphenyl)serine | |
| US4005088A (en) | Process for the chemical separation of racemic modifications of α-aminocarboxylic acid derivatives, and cinchonidine salt intermediates | |
| US4105690A (en) | Process for manufacturing N-acyl derivatives of hydroxy-arylglycines | |
| US3920730A (en) | Substituted glycines | |
| EP0070114B1 (en) | A process for preparing an optically active p-hydroxyphenyl-glycine or a salt thereof | |
| US4182899A (en) | Optical resolution of amino acids into optical antipodes | |
| US3904606A (en) | Process for preparing optically active 6-(' -amino-acetamido)penicillanic acids and 7-(' -aminoacetamido) cephalosporanic acids | |
| EP0084928B1 (en) | Process for producing threo-3-(3,4-dihydroxyphenyl)serine | |
| EP0172719B1 (en) | Process for the production as asymmetric hydantoins | |
| US3442909A (en) | Alpha-methyl-beta-(3,4-disubstitutedphenyl) propionitriles | |
| US3676482A (en) | Racemization of an alpha-methyl dopa derivative | |
| US3994954A (en) | Process for preparing substituted glycines | |
| US5436256A (en) | Process for the preparation of arylhydantoins | |
| UA44709C2 (uk) | Спосіб oдержання пеніциліну чи цефалоспорину | |
| US4108854A (en) | Process for preparing substituted glycines | |
| US4701527A (en) | Synthesis of salicylamides with improved reaction kinetics and improved effective yields | |
| EP0437566B1 (en) | Phenyl-glycine derivatives | |
| US3997584A (en) | Substituted glycines and intermediates thereof | |
| NL1007126C2 (nl) | Werkwijze voor het bereiden van optisch actief aminozuur of derivaat hiervan met hoge optische zuiverheid. | |
| KATO et al. | Synthesis and aldose reductase inhibitory activity of N-acylthiazolidinecarboxylic acids | |
| US3496172A (en) | Process for the preparation of alpha-lower acylamino - alpha - methyl - beta - (substituted phenyl) propionitriles | |
| FI69628C (fi) | Nytt foerfarande foer framstaellning av apovinkaminsyraestrar |