IE40992B1 - Nitroimidazolyl-s-triazolo(4,3-b) pyridazines - Google Patents
Nitroimidazolyl-s-triazolo(4,3-b) pyridazinesInfo
- Publication number
- IE40992B1 IE40992B1 IE854/75A IE85475A IE40992B1 IE 40992 B1 IE40992 B1 IE 40992B1 IE 854/75 A IE854/75 A IE 854/75A IE 85475 A IE85475 A IE 85475A IE 40992 B1 IE40992 B1 IE 40992B1
- Authority
- IE
- Ireland
- Prior art keywords
- nitroimidazolyl
- pyridazines
- triazolo
- us3948912a
- formula
- Prior art date
Links
- PXEVBXAZLYCECS-UHFFFAOYSA-N 3-(1H-imidazol-2-yl)-6-nitro-[1,2,4]triazolo[4,3-b]pyridazine Chemical class N12N=C([N+](=O)[O-])C=CC2=NN=C1C1=NC=CN1 PXEVBXAZLYCECS-UHFFFAOYSA-N 0.000 title 1
- GEDGPTYHODZBEP-UHFFFAOYSA-N 6-(1h-imidazol-2-yl)-7-nitro-2h-triazolo[4,5-c]pyridazine Chemical class N1=NC=2N=NNC=2C([N+](=O)[O-])=C1C1=NC=CN1 GEDGPTYHODZBEP-UHFFFAOYSA-N 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2418435A DE2418435A1 (de) | 1974-04-17 | 1974-04-17 | Nitroimidazolyl-triazolo-pyridazine und verfahren zu ihrer herstellung |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE40992L IE40992L (en) | 1975-10-17 |
| IE40992B1 true IE40992B1 (en) | 1979-09-26 |
Family
ID=5913090
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE854/75A IE40992B1 (en) | 1974-04-17 | 1975-04-16 | Nitroimidazolyl-s-triazolo(4,3-b) pyridazines |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US3948912A (,) |
| JP (1) | JPS50140488A (,) |
| AR (1) | AR202974A1 (,) |
| AT (1) | AT341535B (,) |
| BE (1) | BE827939A (,) |
| CA (1) | CA1026339A (,) |
| CH (2) | CH617936A5 (,) |
| DD (1) | DD120652A5 (,) |
| DE (1) | DE2418435A1 (,) |
| DK (1) | DK136822B (,) |
| ES (1) | ES436605A1 (,) |
| FI (1) | FI751093A7 (,) |
| FR (1) | FR2267782B1 (,) |
| GB (1) | GB1458325A (,) |
| HU (1) | HU169492B (,) |
| IE (1) | IE40992B1 (,) |
| IL (1) | IL47082A0 (,) |
| NL (1) | NL7504404A (,) |
| PL (1) | PL95094B1 (,) |
| RO (1) | RO66912A (,) |
| SE (1) | SE7504374L (,) |
| SU (1) | SU532340A3 (,) |
| ZA (1) | ZA752349B (,) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GR70309B (,) * | 1979-10-29 | 1982-09-08 | Dow Chemical Co | |
| WO2004058769A2 (en) * | 2002-12-18 | 2004-07-15 | Vertex Pharmaceuticals Incorporated | Triazolopyridazines as protein kinases inhibitors |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL128809C (,) * | 1966-06-18 |
-
1974
- 1974-04-17 DE DE2418435A patent/DE2418435A1/de not_active Withdrawn
-
1975
- 1975-03-17 US US05/559,285 patent/US3948912A/en not_active Expired - Lifetime
- 1975-04-02 CA CA223,700A patent/CA1026339A/en not_active Expired
- 1975-04-10 AR AR258319A patent/AR202974A1/es active
- 1975-04-11 GB GB1503075A patent/GB1458325A/en not_active Expired
- 1975-04-11 SU SU2121917A patent/SU532340A3/ru active
- 1975-04-11 FI FI751093A patent/FI751093A7/fi not_active Application Discontinuation
- 1975-04-12 RO RO7581975A patent/RO66912A/ro unknown
- 1975-04-14 ZA ZA00752349A patent/ZA752349B/xx unknown
- 1975-04-14 NL NL7504404A patent/NL7504404A/xx not_active Application Discontinuation
- 1975-04-14 CH CH474375A patent/CH617936A5/de not_active IP Right Cessation
- 1975-04-14 IL IL47082A patent/IL47082A0/xx unknown
- 1975-04-15 BE BE155409A patent/BE827939A/xx unknown
- 1975-04-15 DK DK161675AA patent/DK136822B/da not_active IP Right Cessation
- 1975-04-15 JP JP50045737A patent/JPS50140488A/ja active Pending
- 1975-04-15 ES ES436605A patent/ES436605A1/es not_active Expired
- 1975-04-15 DD DD185463A patent/DD120652A5/xx unknown
- 1975-04-16 HU HUBO1550A patent/HU169492B/hu unknown
- 1975-04-16 AT AT289475A patent/AT341535B/de not_active IP Right Cessation
- 1975-04-16 SE SE7504374A patent/SE7504374L/xx unknown
- 1975-04-16 PL PL1975179685A patent/PL95094B1/pl unknown
- 1975-04-16 FR FR7511790A patent/FR2267782B1/fr not_active Expired
- 1975-04-16 IE IE854/75A patent/IE40992B1/xx unknown
-
1979
- 1979-11-12 CH CH1010479A patent/CH619226A5/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| DE2418435A1 (de) | 1975-10-30 |
| GB1458325A (en) | 1976-12-15 |
| CH619226A5 (,) | 1980-09-15 |
| AU8012775A (en) | 1976-10-21 |
| SE7504374L (sv) | 1975-10-20 |
| BE827939A (fr) | 1975-10-15 |
| SU532340A3 (ru) | 1976-10-15 |
| ES436605A1 (es) | 1977-03-01 |
| ZA752349B (en) | 1976-04-28 |
| ATA289475A (de) | 1977-06-15 |
| FI751093A7 (,) | 1975-10-18 |
| DK161675A (da) | 1975-10-18 |
| AR202974A1 (es) | 1975-07-31 |
| JPS50140488A (,) | 1975-11-11 |
| US3948912A (en) | 1976-04-06 |
| DD120652A5 (,) | 1976-06-20 |
| RO66912A (ro) | 1980-12-30 |
| AT341535B (de) | 1978-02-10 |
| FR2267782B1 (,) | 1978-10-06 |
| DK136822B (da) | 1977-11-28 |
| NL7504404A (nl) | 1975-10-21 |
| HU169492B (,) | 1976-12-28 |
| IL47082A0 (en) | 1975-06-25 |
| PL95094B1 (,) | 1977-09-30 |
| IE40992L (en) | 1975-10-17 |
| CH617936A5 (,) | 1980-06-30 |
| CA1026339A (en) | 1978-02-14 |
| FR2267782A1 (,) | 1975-11-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU500196B2 (en) | Pyrido / 2, 1-6 / quinazolinones | |
| AU504595B2 (en) | 4,5-dihydro-2-lower-alkoxycarbonyl-amino-4 phenylimidazoles | |
| AU498333B2 (en) | 7-substituted-benzo-1, 2, 4-triazine-3-ethers | |
| GB1548676A (en) | Preparation of 4,4,6-trimethyl-2-cyclohexenone | |
| AU507882B2 (en) | 1, 4-diphenyl-3-pyrazolin-5-ones | |
| IE43253L (en) | Phosphinic acid halides. | |
| IE40992B1 (en) | Nitroimidazolyl-s-triazolo(4,3-b) pyridazines | |
| AU518594B2 (en) | 15, 15-dihydroxyprostaglandins | |
| IE38561L (en) | 1,4-DITHIINO (2,3-c) PYRROLE DERIVATIVES | |
| IE40634L (en) | Vincamine 2- ketoglutarate | |
| AU497945B2 (en) | Dihydrotetrazolo ( 1,5-a) quinzoline derivatives | |
| AU502268B2 (en) | 2, 1, 3-benzothiadiazine compounds | |
| AU499442B2 (en) | 1, 4 benzodioxanes | |
| AU510764B2 (en) | Preparation of 2, 3-Dichloroanisole | |
| IE39813B1 (en) | 7h-indolizino 5,6,7ij)isoquinoline derivatives | |
| AU500501B2 (en) | 6,11-dihydrodibenzo-thiepin-11-ones | |
| GB1537905A (en) | Processes for the preparation of 3',4'-dideoxykanamycin b | |
| GB1554468A (en) | Manufacture of 2,6,6-trimethyl-cyclohex-2 en-1-one | |
| AU505275B2 (en) | IMIDAZO (1, 2-b) ISOQUINOLINE DERIVATIVES | |
| AU495632B2 (en) | Preparation of 1,1- dihalo-4-methyl-pentadienes | |
| JPS5212195A (en) | Preparation of 1,2,5-thiadiazolo(3,4-e)2, 7,1,3,6,8-dithiatetraza-as-in dacene | |
| AU507058B2 (en) | Preparation of 2-Dialkoxyphinylimino 1, 3-Dithietane | |
| IE40955L (en) | Cyclohexanediol derivatives | |
| AU1311976A (en) | Preparation of 1,1- dihalo-4-methyl-pentadienes | |
| IE43611L (en) | Antihypertonic agent |