IE40897B1 - Cyclic ether antibiotics - Google Patents
Cyclic ether antibioticsInfo
- Publication number
- IE40897B1 IE40897B1 IE719/75A IE71975A IE40897B1 IE 40897 B1 IE40897 B1 IE 40897B1 IE 719/75 A IE719/75 A IE 719/75A IE 71975 A IE71975 A IE 71975A IE 40897 B1 IE40897 B1 IE 40897B1
- Authority
- IE
- Ireland
- Prior art keywords
- cyclic ether
- ether antibiotics
- lasalocid
- isomer
- antibiotics
- Prior art date
Links
- 239000003242 anti bacterial agent Substances 0.000 title abstract 2
- 229940088710 antibiotic agent Drugs 0.000 title 1
- 150000004292 cyclic ethers Chemical class 0.000 title 1
- 230000000844 anti-bacterial effect Effects 0.000 abstract 2
- 241000187747 Streptomyces Species 0.000 abstract 1
- 230000000842 anti-protozoal effect Effects 0.000 abstract 1
- 239000003904 antiprotozoal agent Substances 0.000 abstract 1
- 229910052736 halogen Inorganic materials 0.000 abstract 1
- 150000002367 halogens Chemical class 0.000 abstract 1
- BBMULGJBVDDDNI-OWKLGTHSSA-N lasalocid Chemical compound C([C@@H]1[C@@]2(CC)O[C@@H]([C@H](C2)C)[C@@H](CC)C(=O)[C@@H](C)[C@@H](O)[C@H](C)CCC=2C(=C(O)C(C)=CC=2)C(O)=O)C[C@](O)(CC)[C@H](C)O1 BBMULGJBVDDDNI-OWKLGTHSSA-N 0.000 abstract 1
- 229960000320 lasalocid Drugs 0.000 abstract 1
- BBMULGJBVDDDNI-UHFFFAOYSA-N lasalocid A Natural products C=1C=C(C)C(O)=C(C(O)=O)C=1CCC(C)C(O)C(C)C(=O)C(CC)C(C(C1)C)OC1(CC)C1CCC(O)(CC)C(C)O1 BBMULGJBVDDDNI-UHFFFAOYSA-N 0.000 abstract 1
- 150000003839 salts Chemical class 0.000 abstract 1
- 241000894007 species Species 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/04—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D307/10—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/12—Radicals substituted by oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Preparation Of Compounds By Using Micro-Organisms (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Furan Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/457,298 US3944573A (en) | 1974-04-02 | 1974-04-02 | Iso-lasalocid A |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE40897L IE40897L (en) | 1975-10-02 |
| IE40897B1 true IE40897B1 (en) | 1979-09-12 |
Family
ID=23816183
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE719/75A IE40897B1 (en) | 1974-04-02 | 1975-04-02 | Cyclic ether antibiotics |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US3944573A (en:Method) |
| JP (1) | JPS50140439A (en:Method) |
| AR (1) | AR212801A1 (en:Method) |
| AT (1) | AT345455B (en:Method) |
| BE (1) | BE827416A (en:Method) |
| CA (1) | CA1042907A (en:Method) |
| CH (1) | CH594653A5 (en:Method) |
| DD (1) | DD119228A5 (en:Method) |
| DE (1) | DE2514185A1 (en:Method) |
| DK (1) | DK138321B (en:Method) |
| ES (1) | ES436176A1 (en:Method) |
| FI (1) | FI750967A7 (en:Method) |
| FR (1) | FR2265362B1 (en:Method) |
| GB (1) | GB1501144A (en:Method) |
| IE (1) | IE40897B1 (en:Method) |
| IL (1) | IL46969A (en:Method) |
| LU (1) | LU72177A1 (en:Method) |
| NL (1) | NL7503906A (en:Method) |
| NO (1) | NO143026C (en:Method) |
| PH (1) | PH12450A (en:Method) |
| SE (1) | SE417713B (en:Method) |
| SU (1) | SU648099A3 (en:Method) |
| ZA (1) | ZA751802B (en:Method) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4164586A (en) * | 1974-07-19 | 1979-08-14 | Hoffmann-La Roche Inc. | Therapeutic agent for improving cardiovascular function |
| US4228293A (en) * | 1978-10-11 | 1980-10-14 | Eli Lilly And Company | Iodo-A-23187 derivatives |
| US4227002A (en) * | 1978-10-11 | 1980-10-07 | Eli Lilly And Company | Halo-A-23187 derivatives |
| US4227003A (en) * | 1978-10-11 | 1980-10-07 | Eli Lilly And Company | Bromo-A-23187 derivatives |
| US4302450A (en) * | 1979-01-15 | 1981-11-24 | Hoffmann-La Roche Inc. | Polyether ionophores as antiobesity and hypotriglyceridemic agents |
| US4218443A (en) * | 1979-01-15 | 1980-08-19 | Hoffmann-La Roche Inc. | Polyether ionophores as antiobesity and hypotriglyceridemic agents |
| IE49936B1 (en) * | 1979-07-11 | 1986-01-08 | Int Minerals & Chem Corp | Zinc-containing antibiotic agents |
| US4288629A (en) * | 1980-04-03 | 1981-09-08 | American Cyanamid Company | 1-Hydroxymethyl-11-deoxy-15-hydroxy-prosten-1-ol-derivatives |
| US4410712A (en) * | 1982-03-10 | 1983-10-18 | Hoffmann-La Roche Inc. | Antibiotics X-14873 A, G and H |
| BR9106937A (pt) * | 1990-10-01 | 1993-08-17 | Pfizer | Antibiotico de eteres policiclicos promotor de crescimento e anti-coccidicos |
| CN116836892B (zh) * | 2023-08-30 | 2023-11-14 | 中国热带农业科学院三亚研究院 | 一种同时产生香豆素和水杨酸的5406链霉菌培养方法 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3702333A (en) * | 1967-08-11 | 1972-11-07 | Yoshitomi Pharmaceutical | Cyclopropanecarboxylic acid esters possessing pesticidal properties |
-
1974
- 1974-04-02 US US05/457,298 patent/US3944573A/en not_active Expired - Lifetime
-
1975
- 1975-03-20 CH CH356775A patent/CH594653A5/xx not_active IP Right Cessation
- 1975-03-21 ZA ZA00751802A patent/ZA751802B/xx unknown
- 1975-03-31 IL IL46969A patent/IL46969A/xx unknown
- 1975-03-31 PH PH16996A patent/PH12450A/en unknown
- 1975-04-01 FR FR7510094A patent/FR2265362B1/fr not_active Expired
- 1975-04-01 FI FI750967A patent/FI750967A7/fi not_active Application Discontinuation
- 1975-04-01 DK DK137775AA patent/DK138321B/da not_active IP Right Cessation
- 1975-04-01 SE SE7503717A patent/SE417713B/xx unknown
- 1975-04-01 GB GB13219/75A patent/GB1501144A/en not_active Expired
- 1975-04-01 SU SU752117908A patent/SU648099A3/ru active
- 1975-04-01 AR AR258207A patent/AR212801A1/es active
- 1975-04-01 NO NO751098A patent/NO143026C/no unknown
- 1975-04-01 BE BE154968A patent/BE827416A/xx unknown
- 1975-04-01 LU LU72177A patent/LU72177A1/xx unknown
- 1975-04-01 CA CA223,495A patent/CA1042907A/en not_active Expired
- 1975-04-01 DD DD185151A patent/DD119228A5/xx unknown
- 1975-04-01 ES ES436176A patent/ES436176A1/es not_active Expired
- 1975-04-01 AT AT244775A patent/AT345455B/de not_active IP Right Cessation
- 1975-04-01 DE DE19752514185 patent/DE2514185A1/de not_active Withdrawn
- 1975-04-02 NL NL7503906A patent/NL7503906A/xx not_active Application Discontinuation
- 1975-04-02 JP JP50040214A patent/JPS50140439A/ja active Pending
- 1975-04-02 IE IE719/75A patent/IE40897B1/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| ATA244775A (de) | 1978-01-15 |
| ES436176A1 (es) | 1977-02-01 |
| IE40897L (en) | 1975-10-02 |
| DE2514185A1 (de) | 1975-10-09 |
| FR2265362A1 (en:Method) | 1975-10-24 |
| BE827416A (fr) | 1975-10-01 |
| NL7503906A (nl) | 1975-10-06 |
| CA1042907A (en) | 1978-11-21 |
| FR2265362B1 (en:Method) | 1979-02-23 |
| ZA751802B (en) | 1976-02-25 |
| JPS50140439A (en:Method) | 1975-11-11 |
| DK137775A (en:Method) | 1975-10-03 |
| DD119228A5 (en:Method) | 1976-04-12 |
| IL46969A (en) | 1978-09-29 |
| DK138321C (en:Method) | 1979-01-22 |
| SE417713B (sv) | 1981-04-06 |
| US3944573A (en) | 1976-03-16 |
| SU648099A3 (ru) | 1979-02-15 |
| NO751098L (en:Method) | 1975-10-03 |
| IL46969A0 (en) | 1975-05-22 |
| AU7974175A (en) | 1976-10-07 |
| SE7503717L (en:Method) | 1975-10-03 |
| FI750967A7 (en:Method) | 1975-10-03 |
| GB1501144A (en) | 1978-02-15 |
| AR212801A1 (es) | 1978-10-13 |
| PH12450A (en) | 1979-03-08 |
| NO143026C (no) | 1980-12-03 |
| AT345455B (de) | 1978-09-25 |
| NO143026B (no) | 1980-08-25 |
| DK138321B (da) | 1978-08-14 |
| LU72177A1 (en:Method) | 1977-02-01 |
| CH594653A5 (en:Method) | 1978-01-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NL950016I1 (nl) | Werkwijze ter bereiding van farmaceutische preparaten met antibiotische werkzaamheid, alsmede werkwijze ter bereiding van antibiotische werkzame cefemverbindingen. | |
| IE40897L (en) | Cyclic ether antibiotics | |
| IE43874L (en) | Cephalosporin derivatives. | |
| IE39537B1 (en) | Substituted 16,17,18,19,20-pentanor-prostaglandins | |
| AU497441B2 (en) | Heart active compounds | |
| IE41401L (en) | Cyclic ether antibiotic derivatives. | |
| ES459052A1 (es) | Un procedimiento para la produccion de la mezcla antibioticaa-35512. | |
| IE38221L (en) | Pyrimidinoheterocyclic compounds | |
| IE42372L (en) | Ergoline derivatives. | |
| CA1023263A (en) | Insecticidal and acaricidal composition comprising an interacted compound of o,o-dimethyl-dichlorovinyl phosphate and a cyclodrextrim | |
| AU8681675A (en) | Cyclic phosphamide derivatives | |
| IE38561B1 (en) | 1,4-dithiino 2,3-cpyrrole derivatives | |
| IE42434L (en) | Cephalosporin compounds. | |
| IE38686L (en) | 3-hydrazonomethyl rifamycin | |
| IE37220L (en) | Pyrrolopyridine derivatives | |
| JPS5264494A (en) | Preparation of fr-1923 substance | |
| IE41216L (en) | Antibacterial substance | |
| CA1034579A (en) | 6-fluoro-3,5-dihalo-2-pyridyloxy compounds | |
| NO142789C (no) | Fremgangsmaate for fremstilling av et polypeptidantibiotikum, gardimycin. | |
| IE40172L (en) | Acylamino - phenyl - acetamidine anthelmintics | |
| IE38190B1 (en) | Diaza-oxa-bicyclodecane derivatives | |
| JPS5264491A (en) | Preparation of novel antibiotics sf-1902 | |
| CA1013740A (en) | Preparation of n,n-difluoroamines | |
| JPS5264492A (en) | Preparation of novel antibiotics c18-205 | |
| CA1028351A (en) | PREPARATION OF .alpha.,3-DICHLORO-4-CYCLOHEXYLPHENYL-ACETIC ACID |