IE40141B1 - 5(6)-benzene ring substituted benzimidalzone-2-carbamate drivatives having anthelminic activity - Google Patents
5(6)-benzene ring substituted benzimidalzone-2-carbamate drivatives having anthelminic activityInfo
- Publication number
- IE40141B1 IE40141B1 IE2323/73A IE232373A IE40141B1 IE 40141 B1 IE40141 B1 IE 40141B1 IE 2323/73 A IE2323/73 A IE 2323/73A IE 232373 A IE232373 A IE 232373A IE 40141 B1 IE40141 B1 IE 40141B1
- Authority
- IE
- Ireland
- Prior art keywords
- benzene ring
- carbamate
- benzimidalzone
- anthelminic
- drivatives
- Prior art date
Links
- WEYSQARHSRZNTC-UHFFFAOYSA-N 1h-benzimidazol-2-ylcarbamic acid Chemical class C1=CC=C2NC(NC(=O)O)=NC2=C1 WEYSQARHSRZNTC-UHFFFAOYSA-N 0.000 abstract 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D235/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings
- C07D235/02—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings condensed with carbocyclic rings or ring systems
- C07D235/04—Benzimidazoles; Hydrogenated benzimidazoles
- C07D235/24—Benzimidazoles; Hydrogenated benzimidazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
- C07D235/30—Nitrogen atoms not forming part of a nitro radical
- C07D235/32—Benzimidazole-2-carbamic acids, unsubstituted or substituted; Esters thereof; Thio-analogues thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C335/00—Thioureas, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C335/30—Isothioureas
- C07C335/38—Isothioureas containing any of the groups, X being a hetero atom, Y being any atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US31929972A | 1972-12-29 | 1972-12-29 | |
| US05/417,968 US3965113A (en) | 1972-12-29 | 1973-11-21 | 5(6)-Benzene ring substituted benzimidazole-2-carbamate derivatives having anthelmintic activity |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE40141L IE40141L (en) | 1974-06-29 |
| IE40141B1 true IE40141B1 (en) | 1979-03-28 |
Family
ID=26981950
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE2323/73A IE40141B1 (en) | 1972-12-29 | 1973-12-21 | 5(6)-benzene ring substituted benzimidalzone-2-carbamate drivatives having anthelminic activity |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US3965113A (Direct) |
| JP (1) | JPS4994671A (Direct) |
| AR (1) | AR214701A1 (Direct) |
| AT (1) | AT332422B (Direct) |
| BR (1) | BR7310294D0 (Direct) |
| CA (1) | CA1023750A (Direct) |
| DE (1) | DE2363348C3 (Direct) |
| DK (1) | DK151628C (Direct) |
| ES (1) | ES421928A1 (Direct) |
| FR (1) | FR2212149B1 (Direct) |
| GB (1) | GB1434830A (Direct) |
| IE (1) | IE40141B1 (Direct) |
| IL (1) | IL43859A (Direct) |
| IN (1) | IN138645B (Direct) |
| NL (1) | NL7317798A (Direct) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2425704A1 (de) * | 1974-05-28 | 1975-12-18 | Hoechst Ag | Substituierte phenylmercapto-benzimidazole |
| SE443977B (sv) * | 1977-05-10 | 1986-03-17 | Chinoin Gyogyszer Es Vegyeszet | Forfarande for framstellning av 5(6)-tio-bensimidazolderivat |
| US4136174A (en) * | 1978-01-18 | 1979-01-23 | E. R. Squibb & Sons, Inc. | Benzimidazolecarbamates and method |
| US4156006A (en) * | 1978-01-09 | 1979-05-22 | E. R. Squibb & Sons, Inc. | Vinyl sulfide derivatives of benzimidazoles |
| GB1600840A (en) | 1978-05-30 | 1981-10-21 | Wellcome Found | Diphenylether derivatives useful as flukicidal agents |
| EP0028455A1 (en) * | 1979-10-12 | 1981-05-13 | Imperial Chemical Industries Plc | 5-Phenylselenobenzimidazole derivatives, their preparation and anthelmintic or fasciolicidal compositions containing them |
| HU184780B (en) * | 1980-09-17 | 1984-10-29 | Chinoin Gyogyszer Es Vegyeszet | Process for producing thiocyanato-benzimidazoles |
| IL61232A (en) * | 1979-10-19 | 1985-09-29 | Chinoin Gyogyszer Es Vegyeszet | Process for the preparation of 2-amino(or alkoxycarbonylamino)-5(6)-thiocyanato(or thiol)benzimidazole derivatives |
| HU182794B (en) * | 1980-03-19 | 1984-03-28 | Chinoin Gyogyszer Es Vegyeszet | Process for producing 5-bracket-6-bracket closed-thiocyanato-benzimidazolyl-alkyl-carbamates and salts |
| DE3719783A1 (de) * | 1987-06-13 | 1988-12-22 | Hoechst Ag | Verfahren zur herstellung von 5-phenylsulfinyl-1h-2-(methoxycarbonylamino)- benzimidazol |
| GB9900752D0 (en) * | 1999-01-15 | 1999-03-03 | Angiogene Pharm Ltd | Benzimidazole vascular damaging agents |
| US6593466B1 (en) * | 1999-07-07 | 2003-07-15 | Isis Pharmaceuticals, Inc. | Guanidinium functionalized nucleotides and precursors thereof |
| CN112094237B (zh) * | 2020-11-06 | 2023-01-20 | 江苏宝众宝达药业股份有限公司 | 氟苯咪唑的合成方法 |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2933502A (en) * | 1958-02-12 | 1960-04-19 | Du Pont | Benzimidazolone derivatives |
| US2933504A (en) * | 1959-08-10 | 1960-04-19 | Du Pont | Derivatives of polyalkoxycarbonyl imine |
| US3010968A (en) * | 1959-11-25 | 1961-11-28 | Du Pont | Process for manufacture of certain alkyl esters of benzimidazole carbamic acids |
| BE666795A (Direct) * | 1964-08-04 | 1966-01-13 | ||
| US3401171A (en) * | 1966-03-11 | 1968-09-10 | Smithkline Corp | 2-amidobenzimidazoles |
| US3480642A (en) * | 1967-03-22 | 1969-11-25 | Smithkline Corp | Process for producing 2-carbalkoxyaminobenzimidazoles |
| CH490010A (de) * | 1967-10-26 | 1970-05-15 | Ciba Geigy | Schädlingsbekämpfungsmittel |
| US3714180A (en) * | 1970-08-12 | 1973-01-30 | Squibb & Sons Inc | Sulfonyl benzimidazoles |
| US3720686A (en) * | 1971-04-01 | 1973-03-13 | Squibb & Sons Inc | Mercaptobenzimidazole derivatives |
| BE793358A (fr) * | 1971-12-27 | 1973-06-27 | Hoechst Ag | Nouveaux derives de 2-carbalcoxy-amino-benzimidazole presentantune activite anthelmintique et leur procede de preparation |
-
1973
- 1973-11-21 US US05/417,968 patent/US3965113A/en not_active Expired - Lifetime
- 1973-12-10 IN IN2693/CAL/73A patent/IN138645B/en unknown
- 1973-12-12 CA CA187,977A patent/CA1023750A/en not_active Expired
- 1973-12-13 GB GB5792373A patent/GB1434830A/en not_active Expired
- 1973-12-17 DK DK685373A patent/DK151628C/da not_active IP Right Cessation
- 1973-12-19 IL IL43859A patent/IL43859A/en unknown
- 1973-12-20 DE DE2363348A patent/DE2363348C3/de not_active Expired
- 1973-12-21 IE IE2323/73A patent/IE40141B1/xx unknown
- 1973-12-21 AT AT1075073A patent/AT332422B/de not_active IP Right Cessation
- 1973-12-26 JP JP49004828A patent/JPS4994671A/ja active Pending
- 1973-12-28 BR BR10294/73A patent/BR7310294D0/pt unknown
- 1973-12-28 FR FR7346945A patent/FR2212149B1/fr not_active Expired
- 1973-12-28 AR AR251777A patent/AR214701A1/es active
- 1973-12-28 NL NL7317798A patent/NL7317798A/xx not_active Application Discontinuation
- 1973-12-29 ES ES421928A patent/ES421928A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| ATA1075073A (de) | 1976-01-15 |
| ES421928A1 (es) | 1976-10-16 |
| GB1434830A (en) | 1976-05-05 |
| FR2212149B1 (Direct) | 1977-07-01 |
| AT332422B (de) | 1976-09-27 |
| FR2212149A1 (Direct) | 1974-07-26 |
| DE2363348C3 (de) | 1981-04-30 |
| NL7317798A (Direct) | 1974-07-02 |
| IL43859A0 (en) | 1974-03-14 |
| DK151628C (da) | 1988-06-27 |
| DE2363348B2 (de) | 1980-08-28 |
| BR7310294D0 (pt) | 1974-09-24 |
| CA1023750A (en) | 1978-01-03 |
| IL43859A (en) | 1976-12-31 |
| US3965113A (en) | 1976-06-22 |
| JPS4994671A (Direct) | 1974-09-09 |
| DK151628B (da) | 1987-12-21 |
| AR214701A1 (es) | 1979-07-31 |
| AU6367573A (en) | 1975-06-19 |
| IE40141L (en) | 1974-06-29 |
| IN138645B (Direct) | 1976-03-06 |
| DE2363348A1 (de) | 1974-07-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IE40046B1 (en) | 5(6)-benzene ring substituted benzimidazole-2-carbamate derivatives having anthelmintic activity | |
| CA1030547A (en) | Cyclohexane derivatives | |
| IE42109L (en) | Benzimidazole-2-carbamate derivatives. | |
| IE40141B1 (en) | 5(6)-benzene ring substituted benzimidalzone-2-carbamate drivatives having anthelminic activity | |
| CA1030144A (en) | 5(6)-benzene ring substituted benzimidazole-2-carbamate derivatives having anthelmintic activity | |
| CA1026760A (en) | 3,4-dihydro-2h-naphthalin-1-one-5-oxypropyl-piperazine derivatives | |
| ES429871A1 (es) | Procedimiento de preparacion de derivados 1, 3-benzodioxol. | |
| CA1032171A (en) | 5(6)-benzene ring substituted benzimidazole-2-carbamate derivatives having anthelmintic activity | |
| IE38561B1 (en) | 1,4-dithiino 2,3-cpyrrole derivatives | |
| CA1025448A (en) | 1,3-benzodioxole derivatives | |
| CA1020562A (en) | 5(6)-benzene ring substituted benzimidazole-2-carbamate derivatives having anthelmintic activity | |
| CA1029726A (en) | 1,8-naphthyridine-3-carboxamidetetrazolyl derivatives | |
| AU503626B2 (en) | Substituted 1, 5-diphenyl-3-formazancarbonitriles | |
| AU462331B2 (en) | Synthesis of 1, 2-butadiene | |
| IE39813L (en) | 7-H-INDOLIZINO [5,6,7-ij] ISOQUINOLINE DERIVATIVES. | |
| AU491359B2 (en) | Amphetamine derivatives | |
| CA1018178A (en) | Insecticidal substituted alkenes | |
| AU7283374A (en) | Amphetamine derivatives | |
| AU482390B2 (en) | New derivatives of 2,benzamido-5-nitro-thiazoles | |
| AU486509B2 (en) | Novel autoxidative derivatives | |
| AU478207B2 (en) | Difluoromethylene substituted prostaglandin derivatives | |
| AU480736B2 (en) | 1, 2-diphenyl-ethane derivatives | |
| AU487239B2 (en) | 2, 3-methanoprostaglandin derivatives | |
| AU477537B2 (en) | 3, 4-DIHYDRO-2H-NAPHTHALIN-lone-5-OXYPROPYLPIPERAZINE DERIVATIVES | |
| AU480938B2 (en) | 5 (6)-benzene ring substituted benzimida zole-2-carbamate derivatives having anthelmintic activity |