IE39848B1 - Preparation of a benzamide - Google Patents
Preparation of a benzamideInfo
- Publication number
- IE39848B1 IE39848B1 IE1905/74A IE190574A IE39848B1 IE 39848 B1 IE39848 B1 IE 39848B1 IE 1905/74 A IE1905/74 A IE 1905/74A IE 190574 A IE190574 A IE 190574A IE 39848 B1 IE39848 B1 IE 39848B1
- Authority
- IE
- Ireland
- Prior art keywords
- anisamide
- sept
- chloro
- amino
- quaternary ammonium
- Prior art date
Links
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 title 2
- 239000002253 acid Substances 0.000 abstract 2
- 150000003242 quaternary ammonium salts Chemical class 0.000 abstract 2
- DLYUQMMRRRQYAE-UHFFFAOYSA-N tetraphosphorus decaoxide Chemical compound O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 abstract 2
- RVEATKYEARPWRE-UHFFFAOYSA-N 4-amino-5-chloro-2-methoxybenzoic acid Chemical compound COC1=CC(N)=C(Cl)C=C1C(O)=O RVEATKYEARPWRE-UHFFFAOYSA-N 0.000 abstract 1
- GUCPYIYFQVTFSI-UHFFFAOYSA-N 4-methoxybenzamide Chemical compound COC1=CC=C(C(N)=O)C=C1 GUCPYIYFQVTFSI-UHFFFAOYSA-N 0.000 abstract 1
- 239000012458 free base Substances 0.000 abstract 1
- TTWJBBZEZQICBI-UHFFFAOYSA-N metoclopramide Chemical compound CCN(CC)CCNC(=O)C1=CC(Cl)=C(N)C=C1OC TTWJBBZEZQICBI-UHFFFAOYSA-N 0.000 abstract 1
- UDGSVBYJWHOHNN-UHFFFAOYSA-N n',n'-diethylethane-1,2-diamine Chemical compound CCN(CC)CCN UDGSVBYJWHOHNN-UHFFFAOYSA-N 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/01—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C233/12—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by halogen atoms or by nitro or nitroso groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7333513A FR2243933B1 (enrdf_load_stackoverflow) | 1973-09-17 | 1973-09-17 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE39848L IE39848L (en) | 1975-03-17 |
| IE39848B1 true IE39848B1 (en) | 1979-01-17 |
Family
ID=9125223
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE1905/74A IE39848B1 (en) | 1973-09-17 | 1974-09-13 | Preparation of a benzamide |
Country Status (11)
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4808624A (en) * | 1984-06-28 | 1989-02-28 | Bristol-Myers Company | Pharmacologically active substituted benzamides |
-
1973
- 1973-09-17 FR FR7333513A patent/FR2243933B1/fr not_active Expired
-
1974
- 1974-09-04 CY CY973A patent/CY973A/xx unknown
- 1974-09-05 GB GB3890574A patent/GB1441352A/en not_active Expired
- 1974-09-07 DE DE2442930A patent/DE2442930A1/de not_active Withdrawn
- 1974-09-12 AT AT736274A patent/AT338766B/de not_active IP Right Cessation
- 1974-09-12 JP JP49105905A patent/JPS5053344A/ja active Pending
- 1974-09-12 FI FI2673/74A patent/FI60860C/fi active
- 1974-09-12 CA CA209,119A patent/CA1028719A/en not_active Expired
- 1974-09-13 AR AR255593A patent/AR200468A1/es active
- 1974-09-13 ES ES430021A patent/ES430021A1/es not_active Expired
- 1974-09-13 IE IE1905/74A patent/IE39848B1/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FI60860B (fi) | 1981-12-31 |
| GB1441352A (en) | 1976-06-30 |
| ATA736274A (de) | 1977-01-15 |
| AT338766B (de) | 1977-09-12 |
| CA1028719A (en) | 1978-03-28 |
| JPS5053344A (enrdf_load_stackoverflow) | 1975-05-12 |
| DE2442930A1 (de) | 1975-03-20 |
| IE39848L (en) | 1975-03-17 |
| ES430021A1 (es) | 1976-09-16 |
| FR2243933A1 (enrdf_load_stackoverflow) | 1975-04-11 |
| FI267374A7 (enrdf_load_stackoverflow) | 1975-03-18 |
| CY973A (en) | 1978-12-22 |
| FI60860C (fi) | 1982-04-13 |
| AR200468A1 (es) | 1974-11-08 |
| FR2243933B1 (enrdf_load_stackoverflow) | 1978-06-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2962627D1 (en) | Acid addition salts of 16-beta-monoquaternary ammonium derivatives of 2-beta, 16-beta-bis-piperidino-androstanes and pharmaceutical preparations containing same | |
| IE39848B1 (en) | Preparation of a benzamide | |
| GB1285610A (en) | Quinacridone pigments | |
| IE872239L (en) | Pyridopyrimidinediones and quinazolines | |
| IE37731B1 (en) | 2-methoxy-5-alkylsulphonyl benzamides | |
| IE39259B1 (en) | Benzamide derivative | |
| IE37800L (en) | Benzamide derivatives | |
| IE39837L (en) | Hydroxylamine derivative and its preparation and conversion¹to n- (diethylaminoethyl) -2- methoxy -5-¹methylsulphonylbenzamide | |
| GB1440850A (en) | Vaso-regulator compositions | |
| IE37822L (en) | Benzamide derivatives | |
| IE43003L (en) | Substituted benzamide. | |
| IE38431B1 (en) | Preparation of benzinamides | |
| IE43497L (en) | Preparation of 3-methoxymethylcepalosporins. | |
| GB1451389A (en) | Indolobenzazepines | |
| IE821591L (en) | Stilbene compounds | |
| IE38430B1 (en) | Preparation of benzamides | |
| IE33446L (en) | Isothiocyano-diphenylamines | |
| IE37504L (en) | Substituted benzamides | |
| IE38433L (en) | Preparation of 2-nitro-4-amino-n-phenylaniline | |
| IE38927B1 (en) | Preparation of 2,5-disubstituted benzamide | |
| GB1398373A (en) | Preparation of n-diethylaminoethyl-2-methosy-4-amino-5-chloro benzamide | |
| GB1507180A (en) | Pharmaceutical compositions | |
| AU519340B2 (en) | Preparation of 2,5-diketogluconic acid | |
| GB1357845A (en) | Esters | |
| GB1371684A (en) | Vincamine salt |