IE38558B1 - N-menthyl-o-phenyl-carbamic acid esters process for their production and their use as insecticides - Google Patents
N-menthyl-o-phenyl-carbamic acid esters process for their production and their use as insecticidesInfo
- Publication number
- IE38558B1 IE38558B1 IE217173A IE217173A IE38558B1 IE 38558 B1 IE38558 B1 IE 38558B1 IE 217173 A IE217173 A IE 217173A IE 217173 A IE217173 A IE 217173A IE 38558 B1 IE38558 B1 IE 38558B1
- Authority
- IE
- Ireland
- Prior art keywords
- phenyl
- acid esters
- carbamic acid
- menthyl
- insecticides
- Prior art date
Links
- 239000002917 insecticide Substances 0.000 title 1
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 abstract 4
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 abstract 2
- 150000001875 compounds Chemical class 0.000 abstract 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 abstract 1
- 239000004480 active ingredient Substances 0.000 abstract 1
- -1 chloroformic acid ester Chemical class 0.000 abstract 1
- ROORDVPLFPIABK-UHFFFAOYSA-N diphenyl carbonate Chemical compound C=1C=CC=CC=1OC(=O)OC1=CC=CC=C1 ROORDVPLFPIABK-UHFFFAOYSA-N 0.000 abstract 1
- 230000000749 insecticidal effect Effects 0.000 abstract 1
- UZOXOBUYZGSAIW-UHFFFAOYSA-N methoxy(phenyl)carbamic acid Chemical class CON(C(O)=O)C1=CC=CC=C1 UZOXOBUYZGSAIW-UHFFFAOYSA-N 0.000 abstract 1
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 abstract 1
- 239000000203 mixture Substances 0.000 abstract 1
Landscapes
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19722258805 DE2258805C3 (de) | 1972-12-01 | 1972-12-01 | N-Methyl-O-phenyl-carbaminsäureester, Verfahren zu ihrer Herstellung und ihre Verwendung zur Bekämpfung von Insekten |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE38558L IE38558L (en) | 1974-06-01 |
| IE38558B1 true IE38558B1 (en) | 1978-04-12 |
Family
ID=5863204
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE217173A IE38558B1 (en) | 1972-12-01 | 1973-11-30 | N-menthyl-o-phenyl-carbamic acid esters process for their production and their use as insecticides |
Country Status (25)
| Country | Link |
|---|---|
| JP (2) | JPS5634587B2 (oth) |
| AT (1) | AT328226B (oth) |
| AU (1) | AU473735B2 (oth) |
| BE (1) | BE807917A (oth) |
| BR (1) | BR7309411D0 (oth) |
| CA (1) | CA1012550A (oth) |
| CH (1) | CH585008A5 (oth) |
| CS (1) | CS181734B2 (oth) |
| DD (1) | DD112711A5 (oth) |
| DE (1) | DE2258805C3 (oth) |
| DK (1) | DK134908C (oth) |
| ES (1) | ES421007A1 (oth) |
| FR (1) | FR2208890B1 (oth) |
| GB (1) | GB1433557A (oth) |
| HU (1) | HU167709B (oth) |
| IE (1) | IE38558B1 (oth) |
| IL (1) | IL43712A (oth) |
| IT (1) | IT1048159B (oth) |
| LU (1) | LU68890A1 (oth) |
| NL (1) | NL7316288A (oth) |
| PL (1) | PL87094B1 (oth) |
| RO (1) | RO68555A (oth) |
| SU (1) | SU650477A3 (oth) |
| TR (1) | TR18028A (oth) |
| ZA (1) | ZA739115B (oth) |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL131470C (oth) * | 1959-12-05 |
-
1972
- 1972-12-01 DE DE19722258805 patent/DE2258805C3/de not_active Expired
-
1973
- 1973-11-27 AU AU62933/73A patent/AU473735B2/en not_active Expired
- 1973-11-27 CS CS816773A patent/CS181734B2/cs unknown
- 1973-11-28 RO RO7376808A patent/RO68555A/ro unknown
- 1973-11-28 IL IL43712A patent/IL43712A/en unknown
- 1973-11-28 BE BE138261A patent/BE807917A/xx unknown
- 1973-11-28 NL NL7316288A patent/NL7316288A/xx not_active Application Discontinuation
- 1973-11-29 IT IT3191573A patent/IT1048159B/it active
- 1973-11-29 DD DD17497273A patent/DD112711A5/xx unknown
- 1973-11-29 SU SU731971735A patent/SU650477A3/ru active
- 1973-11-29 CH CH1678773A patent/CH585008A5/xx not_active IP Right Cessation
- 1973-11-29 LU LU68890D patent/LU68890A1/xx unknown
- 1973-11-29 PL PL16693173A patent/PL87094B1/pl unknown
- 1973-11-29 TR TR1802873A patent/TR18028A/xx unknown
- 1973-11-30 DK DK648773A patent/DK134908C/da not_active IP Right Cessation
- 1973-11-30 ZA ZA739115A patent/ZA739115B/xx unknown
- 1973-11-30 CA CA187,069A patent/CA1012550A/en not_active Expired
- 1973-11-30 FR FR7342746A patent/FR2208890B1/fr not_active Expired
- 1973-11-30 ES ES421007A patent/ES421007A1/es not_active Expired
- 1973-11-30 IE IE217173A patent/IE38558B1/xx unknown
- 1973-11-30 BR BR941173A patent/BR7309411D0/pt unknown
- 1973-11-30 HU HUBA003002 patent/HU167709B/hu unknown
- 1973-11-30 GB GB5566973A patent/GB1433557A/en not_active Expired
- 1973-12-01 JP JP13404373A patent/JPS5634587B2/ja not_active Expired
- 1973-12-01 JP JP13404473A patent/JPS5636169B2/ja not_active Expired
- 1973-12-03 AT AT1009673A patent/AT328226B/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| HU167709B (oth) | 1975-12-25 |
| IL43712A (en) | 1977-04-29 |
| FR2208890B1 (oth) | 1977-08-12 |
| IT1048159B (it) | 1980-11-20 |
| ES421007A1 (es) | 1976-04-01 |
| RO68555A (ro) | 1982-02-26 |
| BR7309411D0 (pt) | 1974-08-29 |
| TR18028A (tr) | 1978-08-12 |
| ATA1009673A (de) | 1975-05-15 |
| ZA739115B (en) | 1974-11-27 |
| DK134908C (da) | 1977-06-27 |
| CH585008A5 (oth) | 1977-02-28 |
| CS181734B2 (en) | 1978-03-31 |
| LU68890A1 (oth) | 1974-01-29 |
| IL43712A0 (en) | 1974-03-14 |
| FR2208890A1 (oth) | 1974-06-28 |
| AU6293373A (en) | 1975-05-29 |
| JPS5634587B2 (oth) | 1981-08-11 |
| IE38558L (en) | 1974-06-01 |
| DK134908B (da) | 1977-02-07 |
| GB1433557A (en) | 1976-04-28 |
| PL87094B1 (oth) | 1976-06-30 |
| NL7316288A (oth) | 1974-06-05 |
| JPS4986541A (oth) | 1974-08-19 |
| AT328226B (de) | 1976-03-10 |
| SU650477A3 (ru) | 1979-02-28 |
| DE2258805B2 (de) | 1980-07-03 |
| AU473735B2 (en) | 1976-07-01 |
| JPS5636169B2 (oth) | 1981-08-22 |
| JPS4986342A (oth) | 1974-08-19 |
| DD112711A5 (oth) | 1975-05-05 |
| DE2258805C3 (de) | 1981-06-19 |
| BE807917A (fr) | 1974-05-28 |
| DE2258805A1 (de) | 1974-06-06 |
| CA1012550A (en) | 1977-06-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1394416A (en) | Cyclopropanecarboxylates processes for producing them and compositions containing them | |
| GB1336549A (en) | N-dimethyl-aminomethylidene-thiol-thiono-phosphoric acid ester imides process for their preparation and their use as insecticides or acaricides | |
| IE38373B1 (en) | Novel carbamic acid esters and their use as insecticides and acaricides | |
| GB1517960A (en) | Furanhydroxamic acid derivatives useful as fungicides | |
| GB1390639A (en) | Phenyl-formamidine carboxylic acid esters the preparation thereof and their use as pesticides | |
| IE42957L (en) | Rosamicin (antibiotic 67-694) derivatives. | |
| IE38558B1 (en) | N-menthyl-o-phenyl-carbamic acid esters process for their production and their use as insecticides | |
| GB1298515A (en) | Substituted phenylcarbamic acid ester, process for its preparation, and its use as insecticide | |
| IE43348L (en) | Phenoxybenzyl esters of spirocarboxylic acids, pyrethroids. | |
| GB1457235A (en) | N-dithiophosphoryl-carbamic acid esters and their use as insecticides and acaricides | |
| IE39924B1 (en) | Benzimidazole -1-carboximido acid esters | |
| IE40890L (en) | Pyrimidin (2) yl- thionophosphoric acid esters; insecticides | |
| IE35352L (en) | Phosphoric acid amide esters | |
| IE38127B1 (en) | Haloalkylthionophosphoric acid esters processes for their production and their use as insecticides and nematocides | |
| FI800333A7 (fi) | Laimennettavissa oleva bentsimidatsolikarbamiinihappoalkyyliesteriseos, sen valmistusmenetelmja käyttö biosidina. | |
| IL43804A (en) | A thiolphosphoric acid ester,its preparation and its use in pest control | |
| GB1245735A (en) | O,o-dialkyl-s-(1,2,2-trichloroethyl)-thionothiolphosphoric acid esters and o-alkyl-s-(1,2,2-trichloroethyl)-alkane-thionothiolphosphonic acid esters | |
| IE41017B1 (en) | 0iethyl-0-iso-butyl-0-(2,2-dichlorovinyl)-thionophosphoric acid ester, a process for its preparation and its use as an insecticide | |
| GB1325656A (en) | Phosphorus-containing imino formic acid alkyl esters process for their preparation and their use as insecticides and acaricides | |
| GB1194309A (en) | Methylene-bis-(Phenylsulphide)-4-Arylsulphonic Acid Esters | |
| JPS5461128A (en) | Peptide derivative | |
| GB1278847A (en) | New amidothionophosphoric acid phenyl esters | |
| GB1415543A (en) | O-alkyl-s-carbamoyloxymethyl -thiono-thiolphosphoric-phosphonic acid esters process for thei production and their use as insecticides and acaricides | |
| GB1373160A (en) | Organic phosphorus-containing compounds their preparation and use as pesticides | |
| IE40101B1 (en) | A novel thionothiolphosphoric acid ester and its use as aninsecticide and acaricide |