IE37645B1 - Tricyclic sulphones and pharmaceutical compositions containing them - Google Patents
Tricyclic sulphones and pharmaceutical compositions containing themInfo
- Publication number
- IE37645B1 IE37645B1 IE795/73A IE79573A IE37645B1 IE 37645 B1 IE37645 B1 IE 37645B1 IE 795/73 A IE795/73 A IE 795/73A IE 79573 A IE79573 A IE 79573A IE 37645 B1 IE37645 B1 IE 37645B1
- Authority
- IE
- Ireland
- Prior art keywords
- acid
- tetrazolyl
- formula
- compound
- amide
- Prior art date
Links
- 239000008194 pharmaceutical composition Substances 0.000 title abstract 2
- 125000001174 sulfone group Chemical group 0.000 title abstract 2
- 150000001875 compounds Chemical class 0.000 abstract 11
- 150000001408 amides Chemical class 0.000 abstract 9
- 150000001732 carboxylic acid derivatives Chemical class 0.000 abstract 8
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 abstract 5
- 125000000896 monocarboxylic acid group Chemical group 0.000 abstract 4
- 150000003839 salts Chemical class 0.000 abstract 4
- 125000000217 alkyl group Chemical group 0.000 abstract 3
- 150000002148 esters Chemical class 0.000 abstract 3
- 150000002825 nitriles Chemical class 0.000 abstract 3
- ZKGWIXREXLXNKN-UHFFFAOYSA-N 2-(benzenesulfonyl)-4-(2h-tetrazol-5-yl)benzoic acid Chemical compound OC(=O)C1=CC=C(C=2NN=NN=2)C=C1S(=O)(=O)C1=CC=CC=C1 ZKGWIXREXLXNKN-UHFFFAOYSA-N 0.000 abstract 2
- ZAKUARPHBLJYPD-UHFFFAOYSA-N 2-chloro-6-(2h-tetrazol-5-yl)thioxanthen-9-one Chemical compound C=1C=C2C(=O)C3=CC(Cl)=CC=C3SC2=CC=1C1=NN=NN1 ZAKUARPHBLJYPD-UHFFFAOYSA-N 0.000 abstract 2
- ZPRLMWFVDIKTNI-UHFFFAOYSA-N 2-phenylsulfanylbenzene-1,4-dicarbonitrile Chemical compound N#CC1=CC=C(C#N)C(SC=2C=CC=CC=2)=C1 ZPRLMWFVDIKTNI-UHFFFAOYSA-N 0.000 abstract 2
- -1 5-tetrazolyl Chemical group 0.000 abstract 2
- KFTPXAFBDZWJNK-UHFFFAOYSA-N 9,10,10-trioxothioxanthene-3-carbonitrile Chemical compound N#CC1=CC=C2C(=O)C3=CC=CC=C3S(=O)(=O)C2=C1 KFTPXAFBDZWJNK-UHFFFAOYSA-N 0.000 abstract 2
- 239000002253 acid Substances 0.000 abstract 2
- 239000000543 intermediate Substances 0.000 abstract 2
- 239000002243 precursor Substances 0.000 abstract 2
- 125000003831 tetrazolyl group Chemical group 0.000 abstract 2
- ITTPKTWJMJMKEW-UHFFFAOYSA-N 10,10-dioxothianthrene-2-carboxylic acid Chemical compound C1=CC=C2S(=O)(=O)C3=CC(C(=O)O)=CC=C3SC2=C1 ITTPKTWJMJMKEW-UHFFFAOYSA-N 0.000 abstract 1
- HSYWWJVWXXVKFR-UHFFFAOYSA-N 2-(4-chlorophenyl)sulfanyl-4-(2h-tetrazol-5-yl)benzonitrile Chemical compound C1=CC(Cl)=CC=C1SC1=CC(C=2NN=NN=2)=CC=C1C#N HSYWWJVWXXVKFR-UHFFFAOYSA-N 0.000 abstract 1
- IKCLCGXPQILATA-UHFFFAOYSA-N 2-chlorobenzoic acid Chemical compound OC(=O)C1=CC=CC=C1Cl IKCLCGXPQILATA-UHFFFAOYSA-N 0.000 abstract 1
- MRGCEDWOTHZNFG-UHFFFAOYSA-N 2-ethyl-6-(2h-tetrazol-5-yl)thioxanthen-9-one Chemical compound C=1C=C2C(=O)C3=CC(CC)=CC=C3SC2=CC=1C1=NN=NN1 MRGCEDWOTHZNFG-UHFFFAOYSA-N 0.000 abstract 1
- YJQMXVDKXSQCDI-UHFFFAOYSA-N 2-ethylthioxanthen-9-one Chemical compound C1=CC=C2C(=O)C3=CC(CC)=CC=C3SC2=C1 YJQMXVDKXSQCDI-UHFFFAOYSA-N 0.000 abstract 1
- BPFOGJYEKZTUTE-UHFFFAOYSA-N 2-methoxy-6-(2h-tetrazol-5-yl)thioxanthen-9-one Chemical compound C=1C=C2C(=O)C3=CC(OC)=CC=C3SC2=CC=1C1=NN=NN1 BPFOGJYEKZTUTE-UHFFFAOYSA-N 0.000 abstract 1
- UPLKJVHYACNBJJ-UHFFFAOYSA-N 2-nitrobenzene-1,4-dicarbonitrile Chemical compound [O-][N+](=O)C1=CC(C#N)=CC=C1C#N UPLKJVHYACNBJJ-UHFFFAOYSA-N 0.000 abstract 1
- DMJMATNDGRWKGG-UHFFFAOYSA-N 2-phenylsulfanyl-4-(2h-tetrazol-5-yl)benzonitrile Chemical compound N#CC1=CC=C(C=2NN=NN=2)C=C1SC1=CC=CC=C1 DMJMATNDGRWKGG-UHFFFAOYSA-N 0.000 abstract 1
- RNVMUWIULURZLC-UHFFFAOYSA-N 2-tert-butyl-6-(2h-tetrazol-5-yl)thioxanthen-9-one Chemical compound C=1C=C2C(=O)C3=CC(C(C)(C)C)=CC=C3SC2=CC=1C=1N=NNN=1 RNVMUWIULURZLC-UHFFFAOYSA-N 0.000 abstract 1
- LFCIPFQOPWQEPF-UHFFFAOYSA-N 2-tert-butylthioxanthen-9-one Chemical compound C1=CC=C2C(=O)C3=CC(C(C)(C)C)=CC=C3SC2=C1 LFCIPFQOPWQEPF-UHFFFAOYSA-N 0.000 abstract 1
- YDXSOEVMYAEXDD-UHFFFAOYSA-N 3-(2h-tetrazol-5-yl)thioxanthen-9-one Chemical compound C=1C=C2C(=O)C3=CC=CC=C3SC2=CC=1C1=NN=NN1 YDXSOEVMYAEXDD-UHFFFAOYSA-N 0.000 abstract 1
- DMGFVJVLVZOSOE-UHFFFAOYSA-N 3-amino-4-chlorobenzoic acid Chemical compound NC1=CC(C(O)=O)=CC=C1Cl DMGFVJVLVZOSOE-UHFFFAOYSA-N 0.000 abstract 1
- NQWYLTBMVTXHIF-UHFFFAOYSA-N 3-phenyl-4-sulfanylcarbonylbenzoic acid Chemical compound OC(=O)C1=CC=C(C(O)=S)C(C=2C=CC=CC=2)=C1 NQWYLTBMVTXHIF-UHFFFAOYSA-N 0.000 abstract 1
- ZIYILGYCQDBDIZ-UHFFFAOYSA-N 4-chloro-2-phenylsulfanylcyclohexa-1,5-diene-1,4-dicarbonitrile Chemical compound C1=CC(Cl)(C#N)CC(SC=2C=CC=CC=2)=C1C#N ZIYILGYCQDBDIZ-UHFFFAOYSA-N 0.000 abstract 1
- PXWNKNGVQGVTOX-UHFFFAOYSA-N 4-chloro-3-(2-nitrophenyl)sulfanylbenzoic acid Chemical compound OC(=O)C1=CC=C(Cl)C(SC=2C(=CC=CC=2)[N+]([O-])=O)=C1 PXWNKNGVQGVTOX-UHFFFAOYSA-N 0.000 abstract 1
- HBARLEHZOZVEHS-UHFFFAOYSA-N 4-chloro-3-sulfanylbenzoic acid Chemical compound OC(=O)C1=CC=C(Cl)C(S)=C1 HBARLEHZOZVEHS-UHFFFAOYSA-N 0.000 abstract 1
- IBRSIERVSWSOKL-UHFFFAOYSA-N 5-phenoxathiin-2-yl-2h-tetrazole Chemical compound C=1C=C2OC3=CC=CC=C3SC2=CC=1C1=NN=NN1 IBRSIERVSWSOKL-UHFFFAOYSA-N 0.000 abstract 1
- HFAKFQYMGKNCDH-UHFFFAOYSA-N 7-ethyl-9-oxothioxanthene-3-carbonitrile Chemical compound N#CC1=CC=C2C(=O)C3=CC(CC)=CC=C3SC2=C1 HFAKFQYMGKNCDH-UHFFFAOYSA-N 0.000 abstract 1
- WJGAMAYUMGTDQH-UHFFFAOYSA-N 7-methyl-9,10,10-trioxothioxanthene-3-carbonitrile Chemical compound C1=C(C#N)C=C2S(=O)(=O)C3=CC=C(C)C=C3C(=O)C2=C1 WJGAMAYUMGTDQH-UHFFFAOYSA-N 0.000 abstract 1
- KTMTUGYSHWKLNN-UHFFFAOYSA-N 9,10,10-trioxothioxanthene-3-carboxylic acid Chemical compound C1=CC=C2S(=O)(=O)C3=CC(C(=O)O)=CC=C3C(=O)C2=C1 KTMTUGYSHWKLNN-UHFFFAOYSA-N 0.000 abstract 1
- ZLOILRDPUMCBAR-UHFFFAOYSA-N 9,10,10-trioxothioxanthene-4-carbonitrile Chemical compound C1=CC=C2C(=O)C3=CC=CC=C3S(=O)(=O)C2=C1C#N ZLOILRDPUMCBAR-UHFFFAOYSA-N 0.000 abstract 1
- HWWLQYBCAODZCA-UHFFFAOYSA-N 9,10,10-trioxothioxanthene-4-carboxylic acid Chemical compound O=C1C2=CC=CC=C2S(=O)(=O)C2=C1C=CC=C2C(=O)O HWWLQYBCAODZCA-UHFFFAOYSA-N 0.000 abstract 1
- 208000035285 Allergic Seasonal Rhinitis Diseases 0.000 abstract 1
- 206010010741 Conjunctivitis Diseases 0.000 abstract 1
- 201000004624 Dermatitis Diseases 0.000 abstract 1
- 206010020751 Hypersensitivity Diseases 0.000 abstract 1
- 239000002841 Lewis acid Substances 0.000 abstract 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 abstract 1
- 208000024780 Urticaria Diseases 0.000 abstract 1
- 125000005236 alkanoylamino group Chemical group 0.000 abstract 1
- 125000003545 alkoxy group Chemical group 0.000 abstract 1
- 125000004644 alkyl sulfinyl group Chemical group 0.000 abstract 1
- 125000004414 alkyl thio group Chemical group 0.000 abstract 1
- 208000006673 asthma Diseases 0.000 abstract 1
- 208000010668 atopic eczema Diseases 0.000 abstract 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 abstract 1
- 125000001589 carboacyl group Chemical group 0.000 abstract 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 abstract 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 abstract 1
- 238000006243 chemical reaction Methods 0.000 abstract 1
- 239000003638 chemical reducing agent Substances 0.000 abstract 1
- LTYMSROWYAPPGB-UHFFFAOYSA-N diphenyl sulfide Chemical compound C=1C=CC=CC=1SC1=CC=CC=C1 LTYMSROWYAPPGB-UHFFFAOYSA-N 0.000 abstract 1
- 229910052736 halogen Inorganic materials 0.000 abstract 1
- 150000002367 halogens Chemical class 0.000 abstract 1
- JUINSXZKUKVTMD-UHFFFAOYSA-N hydrogen azide Chemical compound N=[N+]=[N-] JUINSXZKUKVTMD-UHFFFAOYSA-N 0.000 abstract 1
- 230000003301 hydrolyzing effect Effects 0.000 abstract 1
- 239000003112 inhibitor Substances 0.000 abstract 1
- 229910052500 inorganic mineral Inorganic materials 0.000 abstract 1
- 150000007517 lewis acids Chemical class 0.000 abstract 1
- 239000011707 mineral Substances 0.000 abstract 1
- 150000007524 organic acids Chemical class 0.000 abstract 1
- 239000007800 oxidant agent Substances 0.000 abstract 1
- 230000001590 oxidative effect Effects 0.000 abstract 1
- GJSGGHOYGKMUPT-UHFFFAOYSA-N phenoxathiine Chemical compound C1=CC=C2OC3=CC=CC=C3SC2=C1 GJSGGHOYGKMUPT-UHFFFAOYSA-N 0.000 abstract 1
- NRPVHSBFVSBZMI-UHFFFAOYSA-N phenoxathiine-2-carbaldehyde Chemical compound C1=CC=C2SC3=CC(C=O)=CC=C3OC2=C1 NRPVHSBFVSBZMI-UHFFFAOYSA-N 0.000 abstract 1
- SEQQECSHITUZQZ-UHFFFAOYSA-N phenoxathiine-2-carbonitrile Chemical compound C1=CC=C2SC3=CC(C#N)=CC=C3OC2=C1 SEQQECSHITUZQZ-UHFFFAOYSA-N 0.000 abstract 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 abstract 1
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 abstract 1
- NBOMNTLFRHMDEZ-UHFFFAOYSA-N thiosalicylic acid Chemical compound OC(=O)C1=CC=CC=C1S NBOMNTLFRHMDEZ-UHFFFAOYSA-N 0.000 abstract 1
- 229940103494 thiosalicylic acid Drugs 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D257/00—Heterocyclic compounds containing rings having four nitrogen atoms as the only ring hetero atoms
- C07D257/02—Heterocyclic compounds containing rings having four nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D257/04—Five-membered rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
- C07C317/12—Sulfones; Sulfoxides having sulfone or sulfoxide groups bound to carbon atoms of rings other than six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
- C07C317/44—Sulfones; Sulfoxides having sulfone or sulfoxide groups and carboxyl groups bound to the same carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/50—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton
- C07C323/62—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton having the sulfur atom of at least one of the thio groups bound to a carbon atom of a six-membered aromatic ring of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D327/00—Heterocyclic compounds containing rings having oxygen and sulfur atoms as the only ring hetero atoms
- C07D327/02—Heterocyclic compounds containing rings having oxygen and sulfur atoms as the only ring hetero atoms one oxygen atom and one sulfur atom
- C07D327/06—Six-membered rings
- C07D327/08—[b,e]-condensed with two six-membered carbocyclic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/50—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D333/76—Dibenzothiophenes
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D339/00—Heterocyclic compounds containing rings having two sulfur atoms as the only ring hetero atoms
- C07D339/08—Six-membered rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB2380572 | 1972-05-19 | ||
| GB4142972 | 1972-09-06 | ||
| GB2117473*[A GB1447031A (en) | 1972-05-19 | 1973-05-04 | Tricyclic sulphones and pharmaceutical compositions containing them |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE37645L IE37645L (en) | 1973-11-19 |
| IE37645B1 true IE37645B1 (en) | 1977-09-14 |
Family
ID=27257983
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE795/73A IE37645B1 (en) | 1972-05-19 | 1973-05-18 | Tricyclic sulphones and pharmaceutical compositions containing them |
| IE2480/76A IE37646B1 (en) | 1972-05-19 | 1973-05-18 | Tricyclic sulphones and pharmaceutical compositions containing them |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE2480/76A IE37646B1 (en) | 1972-05-19 | 1973-05-18 | Tricyclic sulphones and pharmaceutical compositions containing them |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US3905989A (Direct) |
| JP (1) | JPS4948657A (Direct) |
| AR (4) | AR210237A1 (Direct) |
| AT (1) | AT336011B (Direct) |
| CA (1) | CA1024987A (Direct) |
| CH (1) | CH616423A5 (Direct) |
| DD (1) | DD108539A5 (Direct) |
| DE (1) | DE2325300A1 (Direct) |
| ES (1) | ES414888A1 (Direct) |
| FR (3) | FR2185407B1 (Direct) |
| GB (1) | GB1447031A (Direct) |
| IE (2) | IE37645B1 (Direct) |
| IL (3) | IL42311A (Direct) |
| LU (1) | LU67622A1 (Direct) |
| NL (1) | NL7306958A (Direct) |
| SE (1) | SE7604471L (Direct) |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4012517A (en) * | 1975-01-24 | 1977-03-15 | Burroughs Wellcome Co. | Compositions and treatment |
| BE837876A (fr) * | 1975-01-24 | 1976-07-23 | Compositions pharmaceutiques antiallergiques | |
| CH628343A5 (en) * | 1977-03-24 | 1982-02-26 | Sandoz Ag | Process for preparing thioxanthones |
| US4536507A (en) * | 1977-07-26 | 1985-08-20 | Merck & Co., Inc. | Prostaglandin antagonists |
| US4221800A (en) * | 1977-12-23 | 1980-09-09 | Miles Laboratories, Inc. | Cycloalkenochromone |
| FR2419282A1 (fr) * | 1978-03-09 | 1979-10-05 | Labaz | Nouveau derive de benzonitrile, son procede de preparation et son application |
| US4394515A (en) * | 1978-06-23 | 1983-07-19 | Merck & Co., Inc. | 10,11-Dihydro-11-oxodibenzo[b,f]thiepin compounds |
| CH640849A5 (de) * | 1979-05-18 | 1984-01-31 | Ciba Geigy Ag | Thioxanthoncarbonsaeureester, -thioester und -amide. |
| US4432986A (en) * | 1979-06-18 | 1984-02-21 | Riker Laboratories, Inc. | Tetrazoles bonded to certain polycyclic aromatic systems and anti-allergic use thereof |
| NL8005946A (nl) * | 1979-11-02 | 1981-06-01 | Hoffmann La Roche | Middelen tegen vetzucht en verhoogde vetspiegel. |
| US4237160A (en) * | 1979-11-27 | 1980-12-02 | Merck Sharp & Dohme (I.A.) Corp. | 3-Hydroxymethyldibenzo[b,f]thiepins as prostaglandin antagonists |
| US4731363A (en) * | 1979-12-26 | 1988-03-15 | Hoffmann-La Roche Inc. | Thromboxane synthase inhibitors as insulin lowering agents and antiobesity agents |
| US4500540A (en) * | 1979-12-26 | 1985-02-19 | Hoffmann-La Roche Inc. | Thromboxane synthase inhibitors as insulin lowering agents and antionbesity agents |
| JPS5716821A (en) * | 1980-07-04 | 1982-01-28 | Yoshitomi Pharmaceut Ind Ltd | Remedy for disease due to immunological dysfunction |
| US4377579A (en) * | 1981-12-03 | 1983-03-22 | Minnesota Mining And Manufacturing Company | N-(Tetrazol-5-yl)phenazine-1-carboxamides |
| US4535171A (en) * | 1982-11-18 | 1985-08-13 | Merck Frosst Canada, Inc. | Dibenzo[b,f]thiepin-3-carboxaldehydes as prostaglandin antagonists |
| EP0150891A1 (en) * | 1984-01-05 | 1985-08-07 | The Wellcome Foundation Limited | Tricyclic compounds, processes for their preparation, compositions containing such compounds and their use in medicine |
| GB8400202D0 (en) * | 1984-01-05 | 1984-02-08 | Wellcome Found | Tricyclic compounds |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3096343A (en) * | 1960-07-20 | 1963-07-02 | Du Pont | Method for isolating aromatic carboxylic acids |
| US3597420A (en) * | 1969-02-17 | 1971-08-03 | Sterling Drug Inc | Tertiary-amino-lower-alkoxy-9-benzylidene-xanthenes and thioxanthenes |
| US3642997A (en) * | 1969-06-25 | 1972-02-15 | Merck & Co Inc | Tricyclic carboxylic acids in the treatment of inflammation |
| BE759292A (fr) * | 1969-11-27 | 1971-05-24 | Allen & Hanburys Ltd | Derives de xanthone, leur preparation et leur emploi |
-
1973
- 1973-05-04 GB GB2117473*[A patent/GB1447031A/en not_active Expired
- 1973-05-18 IL IL7342311A patent/IL42311A/xx unknown
- 1973-05-18 AT AT435573A patent/AT336011B/de not_active IP Right Cessation
- 1973-05-18 CH CH713973A patent/CH616423A5/de not_active IP Right Cessation
- 1973-05-18 DE DE2325300A patent/DE2325300A1/de active Pending
- 1973-05-18 AR AR248104A patent/AR210237A1/es active
- 1973-05-18 DD DD170909A patent/DD108539A5/xx unknown
- 1973-05-18 US US361523A patent/US3905989A/en not_active Expired - Lifetime
- 1973-05-18 CA CA171,774A patent/CA1024987A/en not_active Expired
- 1973-05-18 LU LU67622A patent/LU67622A1/xx unknown
- 1973-05-18 IE IE795/73A patent/IE37645B1/xx unknown
- 1973-05-18 JP JP48055454A patent/JPS4948657A/ja active Pending
- 1973-05-18 NL NL7306958A patent/NL7306958A/xx not_active Application Discontinuation
- 1973-05-18 IL IL7350000A patent/IL50000A/xx unknown
- 1973-05-18 ES ES414888A patent/ES414888A1/es not_active Expired
- 1973-05-18 IE IE2480/76A patent/IE37646B1/xx unknown
- 1973-05-21 FR FR7318299A patent/FR2185407B1/fr not_active Expired
-
1974
- 1974-08-10 AR AR255012A patent/AR210245A1/es active
-
1975
- 1975-07-16 AR AR259624A patent/AR209311A1/es active
-
1976
- 1976-02-17 FR FR7604263A patent/FR2300088A1/fr active Granted
- 1976-02-17 FR FR7604262A patent/FR2293198A1/fr active Granted
- 1976-04-15 SE SE7604471A patent/SE7604471L/xx unknown
- 1976-07-08 IL IL7650000A patent/IL50000A0/xx unknown
- 1976-08-06 AR AR259185D patent/AR206633A1/es active
Also Published As
| Publication number | Publication date |
|---|---|
| IE37645L (en) | 1973-11-19 |
| IL50000A0 (en) | 1976-09-30 |
| FR2293198A1 (fr) | 1976-07-02 |
| LU67622A1 (Direct) | 1973-11-23 |
| US3905989A (en) | 1975-09-16 |
| NL7306958A (Direct) | 1973-11-21 |
| FR2185407B1 (Direct) | 1977-08-19 |
| DD108539A5 (Direct) | 1974-09-20 |
| AU5595973A (en) | 1974-11-21 |
| IL42311A0 (en) | 1973-07-30 |
| CH616423A5 (Direct) | 1980-03-31 |
| CA1024987A (en) | 1978-01-24 |
| ATA435573A (de) | 1976-08-15 |
| AT336011B (de) | 1977-04-12 |
| FR2185407A1 (Direct) | 1974-01-04 |
| GB1447031A (en) | 1976-08-25 |
| AR206633A1 (es) | 1976-08-06 |
| DE2325300A1 (de) | 1973-12-20 |
| JPS4948657A (Direct) | 1974-05-11 |
| SE7604471L (sv) | 1976-04-15 |
| ES414888A1 (es) | 1976-06-01 |
| AR209311A1 (es) | 1977-04-15 |
| IL42311A (en) | 1978-03-10 |
| AR210237A1 (es) | 1977-07-15 |
| FR2300088B1 (Direct) | 1980-04-25 |
| FR2300088A1 (fr) | 1976-09-03 |
| AR210245A1 (es) | 1977-07-15 |
| IL50000A (en) | 1978-03-10 |
| FR2293198B1 (Direct) | 1979-06-29 |
| IE37646B1 (en) | 1977-09-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IE37646B1 (en) | Tricyclic sulphones and pharmaceutical compositions containing them | |
| CA1161850A (en) | Amide derivatives | |
| US3657430A (en) | Composition and methods for treating inflammation | |
| GB1291639A (en) | Xanthenyl alkanoic acid derivatives and pharmaceutical compositions containing them | |
| US3682968A (en) | Anti-inflammatory salicylic acid derivatives | |
| IL41220A (en) | Thioxanthone-2-carboxylic acids and derivatives thereof,their preparation and pharmaceutical compositions containing them | |
| GB1447032A (en) | Tricyclic sulphones and pharmaceutical compositions containing them | |
| DE60012587T2 (de) | Friedel-craft verfahren zur herstellung von thioxanthonen | |
| AU620037B2 (en) | Leukotriene antagonists | |
| GB1285398A (en) | Hydroxy-substituted tricyclic carboxylic acids and derivatives and pharmaceutical compositions containing them | |
| US4093802A (en) | Thiocarbamatemethyl-substituted cephalosporin derivatives | |
| IE40649L (en) | Butyramide pharmaceuticals | |
| GB1357929A (en) | 2-phenyl-3-acylbenzothiazolines and their oxides | |
| GB1173312A (en) | Heterocyclic Compounds | |
| US3886162A (en) | Acridone carboxylic acids and derivatives | |
| IE35137B1 (en) | New n-methyl-imidazole derivatives processes for their manufacture and their use as medicines | |
| US3755359A (en) | Anti-inflammatory salicylic acid derivatives | |
| GB1492163A (en) | Triazolobenzocycloalkylthiadiazine derivatives | |
| US3994875A (en) | Antibiotics | |
| GB1494460A (en) | Coumarins containing sulphonylamino groups | |
| GB1512130A (en) | Cephalosporin derivatives | |
| IE33870B1 (en) | Benzobenzofuranooxepine compounds and process for preparing the same | |
| IE38261L (en) | Benzocycloheptathiophene derivatives. | |
| US3962454A (en) | Bis-(1-alkyl-5-nitro-imidazolyl-2-alkyl)-compounds | |
| ES8201999A1 (es) | Un procedimiento para la preparacion del 5-oxido del acido 8-fluordibenzo (b,f) tiepin-3-carboxilico |