IE35599B1 - 2-phenylbenzoxazoles and their production and use - Google Patents
2-phenylbenzoxazoles and their production and useInfo
- Publication number
- IE35599B1 IE35599B1 IE1136/71A IE113671A IE35599B1 IE 35599 B1 IE35599 B1 IE 35599B1 IE 1136/71 A IE1136/71 A IE 1136/71A IE 113671 A IE113671 A IE 113671A IE 35599 B1 IE35599 B1 IE 35599B1
- Authority
- IE
- Ireland
- Prior art keywords
- formula
- compounds
- hydrogen
- prepared
- phenyl
- Prior art date
Links
- FIISKTXZUZBTRC-UHFFFAOYSA-N 2-phenyl-1,3-benzoxazole Chemical class C1=CC=CC=C1C1=NC2=CC=CC=C2O1 FIISKTXZUZBTRC-UHFFFAOYSA-N 0.000 title abstract 3
- 150000001875 compounds Chemical class 0.000 abstract 10
- 229910052739 hydrogen Inorganic materials 0.000 abstract 5
- 239000001257 hydrogen Substances 0.000 abstract 5
- -1 nitro, amino Chemical group 0.000 abstract 4
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical compound NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 abstract 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 abstract 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 abstract 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 abstract 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 abstract 2
- 125000004970 halomethyl group Chemical group 0.000 abstract 2
- 150000002431 hydrogen Chemical class 0.000 abstract 2
- 238000000034 method Methods 0.000 abstract 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 abstract 2
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 abstract 2
- 238000006798 ring closing metathesis reaction Methods 0.000 abstract 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 abstract 2
- 125000004953 trihalomethyl group Chemical group 0.000 abstract 2
- BXKPYGNKDSFBHN-UHFFFAOYSA-N 4-(3-amino-3-oxoprop-1-en-2-yl)benzoyl chloride Chemical compound NC(=O)C(=C)C1=CC=C(C(Cl)=O)C=C1 BXKPYGNKDSFBHN-UHFFFAOYSA-N 0.000 abstract 1
- IYXGSMUGOJNHAZ-UHFFFAOYSA-N Ethyl malonate Chemical compound CCOC(=O)CC(=O)OCC IYXGSMUGOJNHAZ-UHFFFAOYSA-N 0.000 abstract 1
- 238000005727 Friedel-Crafts reaction Methods 0.000 abstract 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract 1
- 206010061218 Inflammation Diseases 0.000 abstract 1
- 238000005903 acid hydrolysis reaction Methods 0.000 abstract 1
- 125000002252 acyl group Chemical group 0.000 abstract 1
- 125000003282 alkyl amino group Chemical group 0.000 abstract 1
- 125000000217 alkyl group Chemical group 0.000 abstract 1
- 125000005037 alkyl phenyl group Chemical group 0.000 abstract 1
- 125000004644 alkyl sulfinyl group Chemical group 0.000 abstract 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 abstract 1
- 125000004414 alkyl thio group Chemical group 0.000 abstract 1
- 125000001118 alkylidene group Chemical group 0.000 abstract 1
- 230000002862 amidating effect Effects 0.000 abstract 1
- 150000001408 amides Chemical class 0.000 abstract 1
- 230000001760 anti-analgesic effect Effects 0.000 abstract 1
- 230000001754 anti-pyretic effect Effects 0.000 abstract 1
- 239000002221 antipyretic Substances 0.000 abstract 1
- 125000004432 carbon atom Chemical group C* 0.000 abstract 1
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 abstract 1
- 125000004663 dialkyl amino group Chemical group 0.000 abstract 1
- 150000002148 esters Chemical class 0.000 abstract 1
- 238000003682 fluorination reaction Methods 0.000 abstract 1
- 125000001153 fluoro group Chemical group F* 0.000 abstract 1
- 125000005843 halogen group Chemical group 0.000 abstract 1
- 238000010438 heat treatment Methods 0.000 abstract 1
- 230000004054 inflammatory process Effects 0.000 abstract 1
- 150000002690 malonic acid derivatives Chemical class 0.000 abstract 1
- 238000002844 melting Methods 0.000 abstract 1
- 230000008018 melting Effects 0.000 abstract 1
- 230000003472 neutralizing effect Effects 0.000 abstract 1
- 230000001590 oxidative effect Effects 0.000 abstract 1
- 150000002923 oximes Chemical class 0.000 abstract 1
- 239000000825 pharmaceutical preparation Substances 0.000 abstract 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract 1
- 230000008707 rearrangement Effects 0.000 abstract 1
- 238000010992 reflux Methods 0.000 abstract 1
- 150000003839 salts Chemical class 0.000 abstract 1
- 239000002904 solvent Substances 0.000 abstract 1
- 125000003396 thiol group Chemical class [H]S* 0.000 abstract 1
- 125000004385 trihaloalkyl group Chemical group 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/52—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings condensed with carbocyclic rings or ring systems
- C07D263/54—Benzoxazoles; Hydrogenated benzoxazoles
- C07D263/56—Benzoxazoles; Hydrogenated benzoxazoles with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached in position 2
- C07D263/57—Aryl or substituted aryl radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/39—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by esterified hydroxy groups
- C07C205/42—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by esterified hydroxy groups having nitro groups or esterified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C205/43—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by esterified hydroxy groups having nitro groups or esterified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton to carbon atoms of the same non-condensed six-membered aromatic ring or to carbon atoms of six-membered aromatic rings being part of the same condensed ring system
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/76—Unsaturated compounds containing keto groups
- C07C59/90—Unsaturated compounds containing keto groups containing singly bound oxygen-containing groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US7122770A | 1970-09-10 | 1970-09-10 | |
| US16538971A | 1971-07-22 | 1971-07-22 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE35599L IE35599L (en) | 1972-03-10 |
| IE35599B1 true IE35599B1 (en) | 1976-03-31 |
Family
ID=26751978
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE1136/71A IE35599B1 (en) | 1970-09-10 | 1971-09-07 | 2-phenylbenzoxazoles and their production and use |
Country Status (23)
| Country | Link |
|---|---|
| JP (2) | JPS544953B1 (index.php) |
| AT (1) | AT311964B (index.php) |
| AU (1) | AU461109B2 (index.php) |
| BE (1) | BE772395A (index.php) |
| CH (1) | CH572916A5 (index.php) |
| DD (1) | DD94814A5 (index.php) |
| DE (1) | DE2145203C2 (index.php) |
| EG (1) | EG10421A (index.php) |
| FI (1) | FI55196C (index.php) |
| FR (1) | FR2106434B1 (index.php) |
| GB (1) | GB1352723A (index.php) |
| IE (1) | IE35599B1 (index.php) |
| IL (1) | IL37633A (index.php) |
| LU (1) | LU63887A1 (index.php) |
| NL (1) | NL174043C (index.php) |
| NO (1) | NO136712C (index.php) |
| OA (1) | OA03911A (index.php) |
| PH (1) | PH11935A (index.php) |
| PL (1) | PL81813B1 (index.php) |
| RO (1) | RO61539A (index.php) |
| SE (1) | SE367203B (index.php) |
| SU (1) | SU455542A3 (index.php) |
| YU (1) | YU34689B (index.php) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3816443A (en) * | 1972-02-17 | 1974-06-11 | Merck & Co Inc | 4-(benzothiazol-2-yl)fluoro phenyl-acetic acids |
| GB1435721A (en) * | 1972-05-18 | 1976-05-12 | Lilly Industries Ltd | Benzoxazole derivatives |
| GB1495488A (en) * | 1976-06-23 | 1977-12-21 | Ippco Int Pharma Patents Co Es | Optically active 2-(2-phenyl-5-benzoxazolyl)propionic acids |
| IT1099589B (it) * | 1978-08-04 | 1985-09-18 | Ravizza Spa | Processo per la preparazione di derivati dell'acido benzoxazolil propionico |
| IT1157295B (it) * | 1982-07-19 | 1987-02-11 | Ravizza Spa | Processo perfezionato per la preparazione di derivati dell'acido benzoxazolil propionico |
| DE19808261A1 (de) * | 1998-02-27 | 1999-10-28 | Bayer Ag | Arylphenylsubstituierte cyclische Ketoenole |
| WO2008035359A2 (en) * | 2006-06-12 | 2008-03-27 | Cadila Healthcare Limited | Oximinophenoxyalkanoic acid and phenylalkanoic acid derivatives |
| JP2008232573A (ja) * | 2007-03-22 | 2008-10-02 | Osaka Gas Co Ltd | 吸収冷凍機 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DD70880A (index.php) * | ||||
| CH483276A (de) * | 1959-09-23 | 1969-12-31 | Ciba Geigy | Verwendung von 2-Phenyl-benzazolen als Schutzmittel vor ultravioletter Strahlung ausserhalb der Textilindustrie |
| US3401120A (en) * | 1965-10-23 | 1968-09-10 | Gaf Corp | Corrosion inhibitors |
| CH514616A (de) * | 1968-10-07 | 1971-10-31 | Ciba Geigy Ag | Verfahren zur Herstellung von Arylenoxazolen |
-
1971
- 1971-09-01 IL IL37633A patent/IL37633A/xx unknown
- 1971-09-02 AU AU33024/71A patent/AU461109B2/en not_active Expired
- 1971-09-02 OA OA54349A patent/OA03911A/xx unknown
- 1971-09-03 CH CH1295571A patent/CH572916A5/xx not_active IP Right Cessation
- 1971-09-06 AT AT773871A patent/AT311964B/de not_active IP Right Cessation
- 1971-09-06 PH PH12818A patent/PH11935A/en unknown
- 1971-09-06 GB GB4149971A patent/GB1352723A/en not_active Expired
- 1971-09-07 IE IE1136/71A patent/IE35599B1/xx unknown
- 1971-09-07 YU YU2279/71A patent/YU34689B/xx unknown
- 1971-09-08 EG EG396/71*UA patent/EG10421A/xx active
- 1971-09-08 PL PL1971150397A patent/PL81813B1/pl unknown
- 1971-09-09 LU LU63887D patent/LU63887A1/xx unknown
- 1971-09-09 SE SE11441/71A patent/SE367203B/xx unknown
- 1971-09-09 SU SU1696052A patent/SU455542A3/ru active
- 1971-09-09 BE BE772395A patent/BE772395A/xx not_active IP Right Cessation
- 1971-09-09 DE DE2145203A patent/DE2145203C2/de not_active Expired
- 1971-09-09 NO NO3355/71A patent/NO136712C/no unknown
- 1971-09-09 DD DD157648A patent/DD94814A5/xx unknown
- 1971-09-09 FI FI2524/71A patent/FI55196C/fi active
- 1971-09-09 NL NLAANVRAGE7112437,A patent/NL174043C/xx not_active IP Right Cessation
- 1971-09-10 JP JP6981371A patent/JPS544953B1/ja active Pending
- 1971-09-10 FR FR7132748A patent/FR2106434B1/fr not_active Expired
- 1971-09-10 RO RO68180A patent/RO61539A/ro unknown
-
1977
- 1977-11-02 JP JP52130931A patent/JPS6044304B2/ja not_active Expired
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1419608A (en) | Aroyl-substituted naphthaleneacetic acids and their derivatives | |
| FR2391210A1 (fr) | Derives d'acides quinoleinecarboxyliques et leur utilisation comme agents antibacteriens | |
| US3755603A (en) | Biphenylyloxyacetic acids in pharmaceutical compositions | |
| US4031243A (en) | 2-(4-Isobutyl phenyl)butyric acid, salts thereof, and pharmaceutical compositions containing the same | |
| GB1481866A (en) | Oxepin derivatives | |
| IE35599B1 (en) | 2-phenylbenzoxazoles and their production and use | |
| KR920018062A (ko) | 글리시레틴산 유도체 | |
| IE781473L (en) | Pyrrolo-pyrrole-1-carboxylic acid derivatives | |
| JPS5686181A (en) | Alkenyllsubstituted thienylalkanecarboxylic acid and its derivative* their manufacture and medicinal composition | |
| GB1497985A (en) | Oxazolo-pyridines their preparation and use and compositions containing them | |
| US3740437A (en) | Naphthyloxyacetic acids and pharmaceutical compositions and methods thereof | |
| GB1355681A (en) | Phenylacetic acid derivatives | |
| US3773936A (en) | Method of treating inflammation with substituted anilino salicylic acids | |
| US3678094A (en) | Substituted anilino carboxylic acids | |
| IE34314B1 (en) | Dibenzodioxocine derivatives | |
| IE38010L (en) | Benzo (b) thiophine compounds | |
| JPS5524116A (en) | Preparation of o-(2, 6-dichloroanilino)-phenylacetic acid | |
| GB1382996A (en) | Substituted biphenyls | |
| GB1382267A (en) | Phenylalkanoic acid derivatives | |
| IE34427B1 (en) | Substituted alkenoic acids and their preparation | |
| GB1242096A (en) | Benzobenzofuranooxepine compounds and process for preparing the same | |
| GB1512537A (en) | 2-(2'-aryl-6'-chromonyl) propionic acids and analgesic and anti-inflammatory derivatives thereof | |
| ZA842423B (en) | Compounds with antiinflammatory activity,process for preparation thereof and pharmaceutical compositions therefrom | |
| GB1394584A (en) | Heterocyclic substituted xanthone carboxylic acid compounds | |
| US3962303A (en) | Novel benzoylphenylacetic acid derivatives |